CA1158812A - Releasable locking device - Google Patents
Releasable locking deviceInfo
- Publication number
- CA1158812A CA1158812A CA000396197A CA396197A CA1158812A CA 1158812 A CA1158812 A CA 1158812A CA 000396197 A CA000396197 A CA 000396197A CA 396197 A CA396197 A CA 396197A CA 1158812 A CA1158812 A CA 1158812A
- Authority
- CA
- Canada
- Prior art keywords
- section
- mode
- operative
- operative mode
- inoperative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000033001 locomotion Effects 0.000 claims abstract description 12
- 230000000717 retained effect Effects 0.000 claims description 2
- 230000003001 depressive effect Effects 0.000 claims 1
- 230000006378 damage Effects 0.000 description 4
- 238000010276 construction Methods 0.000 description 3
- 230000000881 depressing effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- JCYWCSGERIELPG-UHFFFAOYSA-N imes Chemical class CC1=CC(C)=CC(C)=C1N1C=CN(C=2C(=CC(C)=CC=2C)C)[C]1 JCYWCSGERIELPG-UHFFFAOYSA-N 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 230000007257 malfunction Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65G—TRANSPORT OR STORAGE DEVICES, e.g. CONVEYORS FOR LOADING OR TIPPING, SHOP CONVEYOR SYSTEMS OR PNEUMATIC TUBE CONVEYORS
- B65G69/00—Auxiliary measures taken, or devices used, in connection with loading or unloading
- B65G69/003—Restraining movement of a vehicle at a loading station using means not being part of the vehicle
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Lock And Its Accessories (AREA)
- Loading Or Unloading Of Vehicles (AREA)
- Auxiliary Methods And Devices For Loading And Unloading (AREA)
- Vehicle Step Arrangements And Article Storage (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US260,340 | 1981-05-04 | ||
| US06/260,340 US4373847A (en) | 1981-05-04 | 1981-05-04 | Releasable locking device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1158812A true CA1158812A (en) | 1983-12-20 |
Family
ID=22988771
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000396197A Expired CA1158812A (en) | 1981-05-04 | 1982-02-12 | Releasable locking device |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4373847A (OSRAM) |
| EP (1) | EP0064327B1 (OSRAM) |
| JP (1) | JPS57186561A (OSRAM) |
| AU (1) | AU555814B2 (OSRAM) |
| CA (1) | CA1158812A (OSRAM) |
| DE (1) | DE3264847D1 (OSRAM) |
| MX (1) | MX155849A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4630989A (en) * | 1985-09-30 | 1986-12-23 | Blue Giant Equipment Of Canada Ltd. | Truck restraint system |
| US7056077B2 (en) | 2002-01-31 | 2006-06-06 | Pentalift Equipment Corporation | Truck restraint |
Families Citing this family (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4443150A (en) * | 1981-11-13 | 1984-04-17 | Rite-Hite Corporation | Releasable locking device |
| US4488325A (en) * | 1982-04-12 | 1984-12-18 | Kelley Company Inc. | Truck locking device |
| US4555211A (en) * | 1982-06-11 | 1985-11-26 | Metz Donald L | Truck locking device |
| USRE33154E (en) * | 1983-08-24 | 1990-01-30 | Abon Corporation | Vehicle restraint |
| US4605353A (en) * | 1983-08-24 | 1986-08-12 | Rite-Hite Corporation | Vehicle restraint |
| EP0139038B1 (en) * | 1983-10-22 | 1988-04-27 | Abon Corporation | Releasable locking device |
| JPS60122636A (ja) * | 1983-11-07 | 1985-07-01 | ライト‐ハイト・コーポレイシヨン | 解放自在のロツク装置 |
| US4692755A (en) * | 1985-02-22 | 1987-09-08 | Rite-Hite Corporation | Loading dock signal and control system |
| US4634334A (en) * | 1985-07-19 | 1987-01-06 | Rite-Hite Corporation | Vehicle restraint |
| US4674941A (en) * | 1985-11-20 | 1987-06-23 | Kelley Company Inc. | Vehicle restraint using a parallelogram linkage |
| US4784567A (en) * | 1985-11-20 | 1988-11-15 | Kelley Company Inc. | Vehicle restraint utilizing a fluid cylinder |
| US4728242A (en) * | 1986-04-14 | 1988-03-01 | Kelley Company Inc. | Vehicle restraint having downwardly facing hook |
| US4767254A (en) * | 1986-04-21 | 1988-08-30 | Kelley Company Inc. | Vehicle restraint having an upwardly biased restraining member |
| US4695216A (en) * | 1986-05-14 | 1987-09-22 | Kelley Company, Inc. | Vehicle restraint |
| US4861217A (en) * | 1987-02-17 | 1989-08-29 | Kelley Company, Inc. | Vehicle restraint using both linear and pivotal movement |
| US4744121A (en) * | 1987-02-20 | 1988-05-17 | Rite-Hite Corporation | Loading dock and hydraulic system therefor |
| US4865508A (en) * | 1987-05-21 | 1989-09-12 | Kelley Company Inc. | Vehicle restraint |
| US4830563A (en) * | 1987-06-09 | 1989-05-16 | Vestil Manufacturing Company | Multi-condition responsive vehicle restraining apparatus |
| US4815918A (en) * | 1987-08-21 | 1989-03-28 | Kelley Company, Inc. | Vehicle restraint having a snubbing restraining member |
| US4938648A (en) * | 1988-08-31 | 1990-07-03 | General Motors Corporation | Shipping dock hook |
| US4887954A (en) * | 1989-03-09 | 1989-12-19 | Air-Lec Industries, Inc. | Vehicle restraint |
| US4938647A (en) * | 1989-09-21 | 1990-07-03 | Kelley Company Inc. | Truck actuated vehicle restraint having a pivotable slide |
| US4973213A (en) * | 1989-09-21 | 1990-11-27 | Kelley Company Inc. | Truck actuated vehicle restraint having a pivotable inclined surface |
| US5259718A (en) * | 1990-01-18 | 1993-11-09 | The Serco Corporation | Vehicle restraint |
| US5120181A (en) * | 1990-01-18 | 1992-06-09 | The Serco Corporation | Vehicle restraint |
| US5203663A (en) * | 1991-05-23 | 1993-04-20 | Dock Leveler Manufacturing, Inc. | Vehicle restraining mechanism |
| WO1993003989A1 (en) * | 1991-08-13 | 1993-03-04 | Rite-Hite Corporation | A releasable locking device |
| US5375965C1 (en) * | 1993-01-25 | 2001-09-11 | Rite Hite Holding Corp | Vehicle restraining device |
| US5348437A (en) * | 1993-05-17 | 1994-09-20 | Overhead Door Corporation | Vehicle restraining apparatus |
| US5388947A (en) * | 1993-07-06 | 1995-02-14 | Ancel, Deceased; John F. | Manually controlled vehicle restraint apparatus with a counterbalance |
| US5452489A (en) * | 1993-09-21 | 1995-09-26 | Systems, Inc. | Dock leveler with automatic end barrier |
| US5457838A (en) * | 1993-09-21 | 1995-10-17 | Systems, Inc. | Extendible dock leveler |
| CA2138890C (en) * | 1993-12-23 | 2005-12-06 | Rite-Hite Holding Corporation | Vehicle restraint |
| DK0749397T3 (da) * | 1994-03-07 | 2000-09-18 | Rite Hite Holding Corp | Køretøjsaktiveret hjulblokeringssystem |
| DE69510359T2 (de) * | 1994-10-21 | 1999-12-30 | Rite-Hite Holding Corp., Milwaukee | Radaktivierte fahrzeugrückhaltevorrichtung |
| US5762459A (en) * | 1994-10-21 | 1998-06-09 | Rite-Hite Corporation | Wheel-activated vehicle restraint system |
| US5709518A (en) | 1995-11-27 | 1998-01-20 | United Dominion Industries | Automatic wheel chock system |
| US5683219A (en) * | 1996-06-07 | 1997-11-04 | Pioneer Manufacturing, Inc. | Mechanical truck restraint |
| US6010297A (en) * | 1996-09-03 | 2000-01-04 | Rite-Hite Holding Corporation | Vehicle restraint and improvements |
| US5836603A (en) * | 1997-04-03 | 1998-11-17 | Logan; Jeff | Shock absorbing trailer hitch |
| US5882167A (en) * | 1997-04-23 | 1999-03-16 | Rite-Hite Holding Corporation | Locking mechanism for a vehicle restraint |
| US5911555A (en) * | 1998-05-12 | 1999-06-15 | Foster; Raymond Keith | Vehicle/dock loading/unloading conveyor system |
| US6065923A (en) * | 1998-05-12 | 2000-05-23 | Foster; Raymond Keith | Vehicle/dock alignment system |
| US6116839A (en) * | 1998-05-27 | 2000-09-12 | Rite-Hite Holding Corporation | Slope extension for vehicle restraints |
| US6106212A (en) | 1998-10-26 | 2000-08-22 | Rite-Hite Holding Corporation | Power-up vehicle restraint |
| US6318947B1 (en) | 1999-01-22 | 2001-11-20 | Rite-Hite Holding Corporation | Pulling-style restraint for a parked swap body |
| CA2343608A1 (en) * | 2000-04-10 | 2001-10-10 | Randy A. Massey | Vertically adjustable trailer hitch |
| US6746037B1 (en) | 2000-12-20 | 2004-06-08 | Craig A. Kaplenski | Trailer hitch with multi-directional dampening system and spherical rod-end assembly |
| US6773221B2 (en) | 2001-07-05 | 2004-08-10 | Rite-Hite Holding Corporation | Positive locking mechanism for a wheel-activated vehicle restraint |
| DE10304978A1 (de) * | 2003-02-07 | 2004-08-19 | Deere & Company, Moline | Anhängevorrichtung für ein landwirtschaftliches oder industrielles Arbeitsfahrzeug |
| US6769710B1 (en) * | 2003-06-16 | 2004-08-03 | The United States Of America As Represented By The Secretary Of The Army | Lunette hitch apparatus |
| US7841823B2 (en) * | 2003-12-22 | 2010-11-30 | Rite-Hite Holding Corporation | Brace system and method for a vehicle at a loading dock |
| US20050196255A1 (en) * | 2003-12-22 | 2005-09-08 | Matt Sveum | Yieldable brace for a vehicle at a loading dock |
| US8657551B2 (en) * | 2003-12-22 | 2014-02-25 | Rite-Hite Holding Corporation | Yieldable brace for a vehicle at a loading dock |
| US20060045678A1 (en) * | 2004-08-11 | 2006-03-02 | Jonathan Andersen | Hydraulic vehicle restraint providing horizontal and vertical spring float with a mechanical hard travel limit |
| US7552937B1 (en) | 2006-06-16 | 2009-06-30 | Shelton Taylor | Shock-absorbing adapter for connecting fifth wheel or gooseneck trailer to towing vehicle |
| US8307956B2 (en) * | 2007-07-25 | 2012-11-13 | Rite-Hite Holding Corporation | Wheel chock system |
| US8006811B2 (en) | 2007-09-07 | 2011-08-30 | Rite-Hite Holding Corporation | Loading dock wheel restraint comprising a flexible elongate member |
| US7753394B2 (en) * | 2007-09-14 | 2010-07-13 | Michael Monostori | Quick change vehicle trailer hitch adapter |
| US7810831B2 (en) * | 2007-10-25 | 2010-10-12 | Jeff Wilkens | Vehicle hitch with multi-directional damping |
| US8464846B2 (en) * | 2008-03-04 | 2013-06-18 | Rite-Hite Holding Corporation | Restraining arms for wheel chocks |
| US7914042B2 (en) * | 2008-05-13 | 2011-03-29 | Rite-Hite Holding Corporation | Support frame vehicle restraints |
| ES2362600B1 (es) * | 2009-12-22 | 2012-03-07 | Amiserru, S.L. | Muelle de carga. |
| US8286757B2 (en) | 2010-07-09 | 2012-10-16 | Rite-Hite Holding Corporation | Wheel chock system |
| US8783706B2 (en) | 2011-02-21 | 2014-07-22 | Cequent Performance Products, Inc. | Gooseneck coupler with slideable locking members and clinch |
| US9150367B2 (en) | 2011-07-13 | 2015-10-06 | Rite-Hite Holding Corporation | Vehicle restraints with stop mechanisms |
| USD686953S1 (en) | 2012-02-21 | 2013-07-30 | Cequent Performance Products, Inc. | Gooseneck coupler head |
| US9227799B2 (en) | 2012-08-30 | 2016-01-05 | Rite-Hite Holding Corporation | Vehicle restraints with anti-rotation features |
| US9174811B2 (en) | 2012-09-05 | 2015-11-03 | Rite-Hite Holding Corporation | Vehicle restraints with rotating and translating barriers |
| US9586771B2 (en) | 2014-01-29 | 2017-03-07 | Rite-Hite Holding Corporation | Vehicle restraints with underside catches |
| US9272854B2 (en) | 2014-02-06 | 2016-03-01 | Rite-Hite Holding Corporation | Vehicle restraints with activated catches |
| WO2025223945A1 (en) | 2024-04-26 | 2025-10-30 | Assa Abloy Entrance Systems Ab | Vehicle restraint with enhanced sliding surface |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US868719A (en) * | 1906-09-26 | 1907-10-22 | Thomas J Stephens | Wagon-brake. |
| US1271676A (en) * | 1918-05-25 | 1918-07-09 | Elmer L Denman | Locking device. |
| US1883493A (en) * | 1929-08-03 | 1932-10-18 | Albert W Berg | Transferring and transporting apparatus |
| US2064615A (en) * | 1930-09-26 | 1936-12-15 | Athey Truss Wheel Co | Draft appliance |
| US2050518A (en) * | 1935-05-06 | 1936-08-11 | Baumgardner Versal Forrest | Hitch means |
| US2649217A (en) * | 1949-11-15 | 1953-08-18 | Jones & Laughlin Steel Corp | Loading apparatus |
| US2945396A (en) * | 1955-12-05 | 1960-07-19 | Charles M O Boyle | Slack adjuster for the foundation brakes of railway freight cars |
| US3400525A (en) * | 1965-08-03 | 1968-09-10 | Sperry Rand Corp | Forage harvester |
| US3368229A (en) * | 1966-01-13 | 1968-02-13 | Kelley Co Inc | Adjustable mechanical dockboard with improved safety legs |
| US3400949A (en) * | 1966-07-19 | 1968-09-10 | Ray E. Kendall | Trailer hitch with vertically adjustable ball |
| US3646627A (en) * | 1970-06-01 | 1972-03-07 | Kelley Co Inc | Holddown mechanism for the ramp of a dockboard |
| US3708183A (en) * | 1970-12-11 | 1973-01-02 | David Dale Lloyd | Trailer hitch |
| US3699601A (en) * | 1971-02-10 | 1972-10-24 | Loomis Machine Co | Dockboard assembly |
| US3692330A (en) * | 1971-06-11 | 1972-09-19 | Ray E Kendall | Vertically adjustable two bar assembly |
| CH563933A5 (OSRAM) * | 1974-03-15 | 1975-07-15 | Weelpal Ag | |
| US3865406A (en) * | 1974-05-31 | 1975-02-11 | Truck Specialist Inc | Quick change hitch for trailer or mobile homes |
| US3922006A (en) * | 1974-10-15 | 1975-11-25 | Alfred Richard Borges | Selectable and height adjustable hitch |
| US4002353A (en) * | 1975-08-27 | 1977-01-11 | The United States Of America As Represented By The Secretary Of The Navy | Towing vehicle having a cart-hitching mechanism |
| US4137587A (en) * | 1975-10-17 | 1979-02-06 | Rosengren Knut T L | Dockboard apparatus |
| US4076273A (en) * | 1976-09-07 | 1978-02-28 | Ernest Campion | Trailer hitch |
| US4127856A (en) * | 1977-04-11 | 1978-11-28 | Bickel Gary G | Vehicle-dock latching apparatus |
| GB1602278A (en) * | 1977-08-31 | 1981-11-11 | Metal Box Co Ltd | Loading and unloading of vehicles |
| US4148498A (en) * | 1977-10-17 | 1979-04-10 | Taylor Jr Thomas A | Trailer hitch |
| US4208161A (en) * | 1978-05-30 | 1980-06-17 | Rite-Hite Corporation | Device for releasably securing a vehicle to an adjacent support |
| JPS54159832A (en) * | 1978-06-07 | 1979-12-18 | Fujitsu Ltd | Adder and subtractor for numbers different in data length |
| US4267748A (en) * | 1978-10-02 | 1981-05-19 | Rite Hite Corporation | Releasable lock mechanism |
| US4282621A (en) * | 1978-12-11 | 1981-08-11 | Rite-Hite Corporation | Releasable locking device |
| US4264259A (en) * | 1979-09-06 | 1981-04-28 | Rite-Hite Corporation | Releasable locking device |
-
1981
- 1981-05-04 US US06/260,340 patent/US4373847A/en not_active Expired - Lifetime
-
1982
- 1982-02-12 CA CA000396197A patent/CA1158812A/en not_active Expired
- 1982-03-02 AU AU81004/82A patent/AU555814B2/en not_active Ceased
- 1982-03-19 DE DE8282301431T patent/DE3264847D1/de not_active Expired
- 1982-03-19 EP EP82301431A patent/EP0064327B1/en not_active Expired
- 1982-04-27 JP JP57069719A patent/JPS57186561A/ja active Granted
- 1982-04-27 MX MX192443A patent/MX155849A/es unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4630989A (en) * | 1985-09-30 | 1986-12-23 | Blue Giant Equipment Of Canada Ltd. | Truck restraint system |
| US7056077B2 (en) | 2002-01-31 | 2006-06-06 | Pentalift Equipment Corporation | Truck restraint |
Also Published As
| Publication number | Publication date |
|---|---|
| US4373847A (en) | 1983-02-15 |
| JPH027853B2 (OSRAM) | 1990-02-21 |
| AU8100482A (en) | 1982-11-11 |
| EP0064327A1 (en) | 1982-11-10 |
| DE3264847D1 (en) | 1985-08-29 |
| MX155849A (es) | 1988-05-11 |
| JPS57186561A (en) | 1982-11-17 |
| AU555814B2 (en) | 1986-10-09 |
| EP0064327B1 (en) | 1985-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1158812A (en) | Releasable locking device | |
| US4443150A (en) | Releasable locking device | |
| US4695216A (en) | Vehicle restraint | |
| US4472099A (en) | Releasable locking device | |
| CA2131193C (en) | Wheel chocking system for arresting road vehicles during transportation | |
| US4605353A (en) | Vehicle restraint | |
| US5440772A (en) | Vehicle-activated safety leg control system for a dock leveler assembly | |
| US6773221B2 (en) | Positive locking mechanism for a wheel-activated vehicle restraint | |
| US4767254A (en) | Vehicle restraint having an upwardly biased restraining member | |
| US5475888A (en) | Lip lifting mechanism for a dock leveler | |
| US4865507A (en) | Dock leveler assembly and latch mechanism therefor | |
| US4531248A (en) | Dockboard assembly | |
| US4619008A (en) | Dockboard construction | |
| CA2133504A1 (en) | Edge-of-dock leveler | |
| US6487741B2 (en) | Multi-position releasable lip latch for a dock leveler | |
| EP2144786B1 (en) | Tensioning device | |
| US7216392B2 (en) | Support leg system and method for supporting a dock leveler | |
| US20080173852A1 (en) | Hydraulic Jack with locking mechanism | |
| US5683219A (en) | Mechanical truck restraint | |
| US6769149B2 (en) | Multi-position releasable lip latch for a dock leveler | |
| US5447361A (en) | Portable dumping insert for a pickup truck | |
| US5416941A (en) | Dockboard having an improved return-to-dock-level mechanism | |
| US2210585A (en) | Creeper | |
| CA1086582A (en) | Truck mounted cattle control box | |
| CA2797541A1 (en) | Lift gate assembly with pedal opener |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |