CA1151796A - Heat-curable polyepoxide resin compositions - Google Patents
Heat-curable polyepoxide resin compositionsInfo
- Publication number
- CA1151796A CA1151796A CA000373640A CA373640A CA1151796A CA 1151796 A CA1151796 A CA 1151796A CA 000373640 A CA000373640 A CA 000373640A CA 373640 A CA373640 A CA 373640A CA 1151796 A CA1151796 A CA 1151796A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- weight
- parts
- heat
- anhydride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000647 polyepoxide Polymers 0.000 title claims abstract description 44
- 239000011342 resin composition Substances 0.000 title abstract description 3
- 239000000203 mixture Substances 0.000 claims abstract description 64
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims abstract description 48
- 239000003822 epoxy resin Substances 0.000 claims abstract description 28
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- 239000004593 Epoxy Substances 0.000 claims abstract description 9
- 150000008065 acid anhydrides Chemical class 0.000 claims abstract description 5
- 150000008064 anhydrides Chemical class 0.000 claims description 17
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- -1 quaternary ammonium halide Chemical class 0.000 claims description 14
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 229920000570 polyether Polymers 0.000 claims description 8
- 150000002118 epoxides Chemical class 0.000 claims description 7
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical group OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 claims description 5
- 150000004010 onium ions Chemical class 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- DMWVYCCGCQPJEA-UHFFFAOYSA-N 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane Chemical group CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C DMWVYCCGCQPJEA-UHFFFAOYSA-N 0.000 claims description 2
- 125000003700 epoxy group Chemical group 0.000 claims description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 2
- 150000001451 organic peroxides Chemical group 0.000 claims description 2
- 230000000704 physical effect Effects 0.000 abstract description 8
- 230000001747 exhibiting effect Effects 0.000 abstract description 3
- 239000011953 free-radical catalyst Substances 0.000 abstract description 2
- 239000003999 initiator Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 150000002978 peroxides Chemical class 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000000306 component Substances 0.000 description 6
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 6
- 238000000465 moulding Methods 0.000 description 5
- 238000005266 casting Methods 0.000 description 4
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- SLAFUPJSGFVWPP-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 SLAFUPJSGFVWPP-UHFFFAOYSA-M 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- AOIIZSJDYSLFOI-UHFFFAOYSA-L benzyl(trimethyl)azanium;sulfate Chemical compound [O-]S([O-])(=O)=O.C[N+](C)(C)CC1=CC=CC=C1.C[N+](C)(C)CC1=CC=CC=C1 AOIIZSJDYSLFOI-UHFFFAOYSA-L 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000002500 ions Chemical group 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000005609 naphthenate group Chemical group 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XEHIUIKCHPMWMC-UHFFFAOYSA-N 1-butyl-2-propan-2-ylbenzene;hydrogen peroxide Chemical group OO.CCCCC1=CC=CC=C1C(C)C XEHIUIKCHPMWMC-UHFFFAOYSA-N 0.000 description 1
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 1
- YWBMNCRJFZGXJY-UHFFFAOYSA-N 1-hydroperoxy-1,2,3,4-tetrahydronaphthalene Chemical compound C1=CC=C2C(OO)CCCC2=C1 YWBMNCRJFZGXJY-UHFFFAOYSA-N 0.000 description 1
- JPSKCQCQZUGWNM-UHFFFAOYSA-N 2,7-Oxepanedione Chemical class O=C1CCCCC(=O)O1 JPSKCQCQZUGWNM-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- OALMZWNBNXQUAL-UHFFFAOYSA-N 2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanamide Chemical compound NC(=O)C(C)(C)N=NC(C)(C)C(N)=O OALMZWNBNXQUAL-UHFFFAOYSA-N 0.000 description 1
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- VQVIHDPBMFABCQ-UHFFFAOYSA-N 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC(C(C=2C=C3C(=O)OC(=O)C3=CC=2)=O)=C1 VQVIHDPBMFABCQ-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000003677 Sheet moulding compound Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 1
- PDAVOLCVHOKLEO-UHFFFAOYSA-N acetyl benzenecarboperoxoate Chemical compound CC(=O)OOC(=O)C1=CC=CC=C1 PDAVOLCVHOKLEO-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- YSFLDEUTGUMWOT-UHFFFAOYSA-N benzhydrylsulfanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C([SH2+])C1=CC=CC=C1 YSFLDEUTGUMWOT-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- ZSAWQMSQHFHNIZ-UHFFFAOYSA-N benzyl(trimethyl)azanium;nitrate Chemical compound [O-][N+]([O-])=O.C[N+](C)(C)CC1=CC=CC=C1 ZSAWQMSQHFHNIZ-UHFFFAOYSA-N 0.000 description 1
- ZKERZZMUXBDEOG-UHFFFAOYSA-N butyl ethaneperoxoate Chemical group CCCCOOC(C)=O ZKERZZMUXBDEOG-UHFFFAOYSA-N 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- OECMNLAWCROQEE-UHFFFAOYSA-N cyclohexylbenzene;hydrogen peroxide Chemical compound OO.C1CCCCC1C1=CC=CC=C1 OECMNLAWCROQEE-UHFFFAOYSA-N 0.000 description 1
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 1
- QTMKZSUMBOOMSD-UHFFFAOYSA-N dibutyl(diethyl)phosphanium;nitrate Chemical compound [O-][N+]([O-])=O.CCCC[P+](CC)(CC)CCCC QTMKZSUMBOOMSD-UHFFFAOYSA-N 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ITQRVMZJBMZUBB-UHFFFAOYSA-M dimethyl(diphenyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 ITQRVMZJBMZUBB-UHFFFAOYSA-M 0.000 description 1
- DKVMUELSPBXFCZ-UHFFFAOYSA-N dimethyl(diphenyl)azanium;nitrate Chemical compound [O-][N+]([O-])=O.C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 DKVMUELSPBXFCZ-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 238000009730 filament winding Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- QZLKVQRFTHKQKP-UHFFFAOYSA-N hexadecanoic acid;tin Chemical compound [Sn].CCCCCCCCCCCCCCCC(O)=O QZLKVQRFTHKQKP-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940031993 lithium benzoate Drugs 0.000 description 1
- GSZRRTSGQIIDKS-UHFFFAOYSA-M lithium;7,7-dimethyloctanoate Chemical compound [Li+].CC(C)(C)CCCCCC([O-])=O GSZRRTSGQIIDKS-UHFFFAOYSA-M 0.000 description 1
- LDJNSLOKTFFLSL-UHFFFAOYSA-M lithium;benzoate Chemical compound [Li+].[O-]C(=O)C1=CC=CC=C1 LDJNSLOKTFFLSL-UHFFFAOYSA-M 0.000 description 1
- BTAUEIDLAAYHSL-UHFFFAOYSA-M lithium;octanoate Chemical compound [Li+].CCCCCCCC([O-])=O BTAUEIDLAAYHSL-UHFFFAOYSA-M 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- ZQMHJBXHRFJKOT-UHFFFAOYSA-N methyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoate Chemical compound COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC ZQMHJBXHRFJKOT-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VYKXQOYUCMREIS-UHFFFAOYSA-N methylhexahydrophthalic anhydride Chemical compound C1CCCC2C(=O)OC(=O)C21C VYKXQOYUCMREIS-UHFFFAOYSA-N 0.000 description 1
- RWLWLWHZYXSCFS-UHFFFAOYSA-N methylperoxycyclohexane Chemical compound COOC1CCCCC1 RWLWLWHZYXSCFS-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- CYCFYXLDTSNTGP-UHFFFAOYSA-L octadecanoate;tin(2+) Chemical compound [Sn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CYCFYXLDTSNTGP-UHFFFAOYSA-L 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical class O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical group CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000006158 tetracarboxylic acid group Chemical group 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- YVQKKCAGAKEMKO-UHFFFAOYSA-M tricyclohexylsulfanium;bromide Chemical compound [Br-].C1CCCCC1[S+](C1CCCCC1)C1CCCCC1 YVQKKCAGAKEMKO-UHFFFAOYSA-M 0.000 description 1
- NRZWQKGABZFFKE-UHFFFAOYSA-N trimethylsulfonium Chemical compound C[S+](C)C NRZWQKGABZFFKE-UHFFFAOYSA-N 0.000 description 1
- IZYFBZDLXRHRLF-UHFFFAOYSA-N tritylphosphane;hydroiodide Chemical compound [I-].C=1C=CC=CC=1C(C=1C=CC=CC=1)([PH3+])C1=CC=CC=C1 IZYFBZDLXRHRLF-UHFFFAOYSA-N 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/42—Polycarboxylic acids; Anhydrides, halides or low molecular weight esters thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F283/00—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G
- C08F283/10—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G on to polymers containing more than one epoxy radical per molecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/68—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/140,026 US4284753A (en) | 1980-04-14 | 1980-04-14 | Heat curable polyepoxide-unsaturated aromatic monomer resin compositions |
| US140,026 | 1980-04-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1151796A true CA1151796A (en) | 1983-08-09 |
Family
ID=22489389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000373640A Expired CA1151796A (en) | 1980-04-14 | 1981-03-23 | Heat-curable polyepoxide resin compositions |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4284753A (enExample) |
| JP (1) | JPS56159215A (enExample) |
| CA (1) | CA1151796A (enExample) |
| DE (1) | DE3114677A1 (enExample) |
| ES (1) | ES8207457A1 (enExample) |
| FR (1) | FR2480293A1 (enExample) |
| GB (1) | GB2073755B (enExample) |
| IT (1) | IT1137536B (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4321305A (en) * | 1980-10-02 | 1982-03-23 | Ppg Industries, Inc. | Beta-diketone-epoxy resin reaction products useful for providing corrosion resistance |
| US4321304A (en) * | 1980-10-02 | 1982-03-23 | Ppg Industries, Inc. | Beta-diketone-epoxy resin reaction products blended with monomeric or polymeric phosphonium salts useful for providing corrosion resistance |
| US4387216A (en) * | 1981-05-06 | 1983-06-07 | Ciba-Geigy Corporation | Heat-polymerizable compositions comprising epoxide resins, aromatic sulfoxonium salts, and organic oxidants |
| CA1205250A (en) * | 1981-12-14 | 1986-05-27 | Harold E. De La Mare | Heat-curable epoxy compositions and their use in preparing formed articles |
| US4379908A (en) * | 1982-03-05 | 1983-04-12 | Shell Oil Company | Rapid curing epoxy-unsaturated monomer compositions |
| CA1200349A (en) * | 1981-12-14 | 1986-02-04 | Thomas F. Brownscombe | Curable epoxy compositions, their preparation and formed articles therefrom |
| US4532299A (en) * | 1982-01-12 | 1985-07-30 | Ameron, Inc. | Flexibilized chemically resistant epoxy resin |
| JPS58164617A (ja) * | 1982-03-25 | 1983-09-29 | Toray Ind Inc | プラスチツクレンズ用樹脂 |
| DE3362757D1 (en) * | 1982-06-14 | 1986-05-07 | Shell Int Research | Heat-curable epoxy compositions and their use in preparing formed articles |
| US4503200A (en) * | 1982-07-19 | 1985-03-05 | Shell Oil Company | Heat curable polyepoxide resin blends |
| US4490511A (en) * | 1984-02-28 | 1984-12-25 | Shell Oil Company | Process for preparation of low-dusting epoxy curing agents based on trimellitic anhydride |
| US4581436A (en) * | 1984-12-24 | 1986-04-08 | Shell Oil Company | Heat-curable composition |
| DE3583027D1 (de) * | 1984-12-24 | 1991-07-04 | Shell Int Research | Waermehaertbare epoxydzusammensetzung. |
| US4544732A (en) * | 1984-12-24 | 1985-10-01 | Shell Oil Company | Heat-curable composition |
| US4579931A (en) * | 1985-01-28 | 1986-04-01 | Shell Oil Company | Heat-curable composition |
| US4554341A (en) * | 1985-02-27 | 1985-11-19 | Shell Oil Company | Fire retardant, fast reacting epoxy resin |
| US4659425A (en) * | 1986-02-03 | 1987-04-21 | Ibm Corporation | Continuous process for the manufacture of printed circuit boards |
| US4962179A (en) * | 1989-08-31 | 1990-10-09 | Shell Oil Company | Epoxidized fatty acid ester compositions |
| US5057554A (en) * | 1989-11-01 | 1991-10-15 | General Motors Corporation | Additives for enhanced dielectric curing |
| US5106924A (en) * | 1990-02-05 | 1992-04-21 | Westinghouse Electric Corp. | Maleic anhydride-epoxy resin prepolymer, (vinyl or isopropenyl)phenyl glycidyl ether and anhydride |
| US5169910A (en) * | 1990-08-08 | 1992-12-08 | Shell Oil Company | Epoxy resin composition |
| US5358977A (en) * | 1990-10-23 | 1994-10-25 | Daubert Coated Products, Inc. | Stabilized paper substrate for release liners using aromatic and aliphatic primers, and novel primer coat |
| US5252631A (en) * | 1991-08-12 | 1993-10-12 | General Motors Corporation | Method for enhanced dielectric curing |
| WO2009067112A1 (en) * | 2007-11-20 | 2009-05-28 | Henkel Ag & Co. Kgaa | Redox-induced cationically polymerizable compositions with low cure temperature |
| JP5817237B2 (ja) * | 2010-07-29 | 2015-11-18 | Jsr株式会社 | 感放射線性樹脂組成物、硬化膜、カラーフィルタ、硬化膜の形成方法及びカラーフィルタの形成方法 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE515178A (enExample) * | 1951-10-31 | |||
| NL173809B (nl) * | 1951-11-17 | Rca Corp | Beeldopneeminrichting met kleurcodeerstrookfilterstelsel. | |
| US2939859A (en) * | 1954-03-31 | 1960-06-07 | Shell Oil Co | Process for preparing resinified product from polyepoxy polyether and aromatic-substituted-alkene-1 and composition for production of said product |
| GB772694A (en) * | 1954-03-31 | 1957-04-17 | Bataafsche Petroleum | Process for preparing reaction products of glycidyl ethers |
| CH336597A (de) * | 1954-07-14 | 1959-02-28 | Basf Ag | Zu Kunststoffen härtbare Mischung |
| US3099638A (en) * | 1959-12-28 | 1963-07-30 | Westinghouse Electric Corp | Resinous glycidyl polyether compositions |
| GB1006848A (en) * | 1962-04-26 | 1965-10-06 | Westinghouse Electric Corp | Modified epoxy resin |
| US3419348A (en) * | 1963-04-22 | 1968-12-31 | Atomic Energy Authority Uk | Separation of metals |
| US3336241A (en) * | 1963-11-12 | 1967-08-15 | Shell Oil Co | Process for preparing epoxy compounds and resulting products |
| US3356624A (en) * | 1964-12-28 | 1967-12-05 | Shell Oil Co | Epoxy resin based traffic paint compositions |
| US3446762A (en) * | 1965-09-24 | 1969-05-27 | Shell Oil Co | Epoxy resin traffic paint compositions |
| US3547885A (en) * | 1968-03-08 | 1970-12-15 | Sun Oil Co | Process for curing polyepoxides with anhydrides and phosphonium halide catalysts therefor |
| US3574157A (en) * | 1969-02-03 | 1971-04-06 | Fred Markus | Coating composition of epoxy resins,polyester resins,and vinyl monomers |
| US3634542A (en) * | 1969-08-04 | 1972-01-11 | Shell Oil Co | Unsaturated polyesters esterified with polycarboxylic acid anhydride and containing polyepoxide |
| US3637618A (en) * | 1970-03-11 | 1972-01-25 | Shell Oil Co | Unsaturated polyesters from epoxides and ethylenically unsaturated monocarboxylic acid mixed with solid epoxide resin |
| BE790021A (fr) * | 1971-10-14 | 1973-04-12 | Westinghouse Electric Corp | Ameliorations dans des compositions de resines ou y relatives |
| US4026862A (en) * | 1974-02-11 | 1977-05-31 | Westinghouse Electric Corporation | Carboxylic acid storage stabilizers for latent catalyst cured epoxy resins |
| US4017453A (en) * | 1974-08-29 | 1977-04-12 | Gulf Oil Corporation | Homogeneous polyepoxide-polyanhydride compositions |
| DE2446697B2 (de) * | 1974-09-30 | 1978-07-20 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Vernetzbare Epoxidharzgießmassen |
| US4013987A (en) * | 1975-08-22 | 1977-03-22 | Westinghouse Electric Corporation | Mica tape binder |
-
1980
- 1980-04-14 US US06/140,026 patent/US4284753A/en not_active Expired - Lifetime
-
1981
- 1981-03-23 CA CA000373640A patent/CA1151796A/en not_active Expired
- 1981-04-10 GB GB8111421A patent/GB2073755B/en not_active Expired
- 1981-04-10 ES ES501246A patent/ES8207457A1/es not_active Expired
- 1981-04-10 DE DE19813114677 patent/DE3114677A1/de active Granted
- 1981-04-10 FR FR8107229A patent/FR2480293A1/fr active Granted
- 1981-04-10 IT IT21071/81A patent/IT1137536B/it active
- 1981-04-10 JP JP5307781A patent/JPS56159215A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS56159215A (en) | 1981-12-08 |
| US4284753A (en) | 1981-08-18 |
| ES501246A0 (es) | 1982-09-16 |
| FR2480293A1 (fr) | 1981-10-16 |
| IT1137536B (it) | 1986-09-10 |
| DE3114677C2 (enExample) | 1993-09-23 |
| IT8121071A0 (it) | 1981-04-10 |
| ES8207457A1 (es) | 1982-09-16 |
| GB2073755B (en) | 1983-12-07 |
| JPH0122848B2 (enExample) | 1989-04-28 |
| DE3114677A1 (de) | 1982-01-14 |
| FR2480293B1 (enExample) | 1984-11-23 |
| GB2073755A (en) | 1981-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1151796A (en) | Heat-curable polyepoxide resin compositions | |
| US3408422A (en) | Stabilization of unsaturated polyesters and resulting products | |
| US4268656A (en) | Co-curing agents for epoxy resins | |
| US3634542A (en) | Unsaturated polyesters esterified with polycarboxylic acid anhydride and containing polyepoxide | |
| US3432478A (en) | Polyhydroxy-containing unsaturated polyesters and their preparation | |
| US3564074A (en) | Thermosetting vinyl resins reacted with dicarboxylic acid anhydrides | |
| US4524181A (en) | Curable epoxy compositions and cured resins obtained therefrom | |
| US3420914A (en) | Unsaturated polyester compositions and their preparation | |
| US3773856A (en) | Process for the preparation of unsaturated epoxy ester compositions | |
| US4503200A (en) | Heat curable polyepoxide resin blends | |
| JP3277256B2 (ja) | エポキシド付加物の製造方法 | |
| US3845016A (en) | Thermoset molding powders employing glycidyl methacrylate-functional polymers and polymeric polyanhydride crosslinking agents and moldings thereof | |
| US3676397A (en) | Oxazolidinone-containing epoxy resins and process for their preparation | |
| US3845010A (en) | Thermoset molding powders employing glycidyl methacrylate functional polymer and dibasic acid crosslinking agent and moldings thereof | |
| US3736289A (en) | Stabilization of unsaturated polyesters and resulting products | |
| US4554341A (en) | Fire retardant, fast reacting epoxy resin | |
| US3247288A (en) | Carboxy copolymers prepared in 1, 2-epoxy compounds | |
| US2985616A (en) | Curable epoxy compositions and resins made therefrom | |
| US4167539A (en) | Styrene-grafted polyanhydride copolymer | |
| CA1085545A (en) | Pre-accelerated resin composition | |
| US4316002A (en) | Molding compositions comprised of polyimide/N-vinylpyrrolidone prepolymer and epoxy resin | |
| EP0096906B1 (en) | Heat-curable epoxy compositions and their use in preparing formed articles | |
| US4683281A (en) | Organophosphite accelerators for epoxide curing | |
| US4891403A (en) | Curable thermosetting epoxy-polyester resin composition | |
| JPS5930818A (ja) | 熱硬化性エポキシ組成物および成形品を製造するに際してのそれの使用 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |