CA1151796A - Heat-curable polyepoxide resin compositions - Google Patents
Heat-curable polyepoxide resin compositionsInfo
- Publication number
- CA1151796A CA1151796A CA000373640A CA373640A CA1151796A CA 1151796 A CA1151796 A CA 1151796A CA 000373640 A CA000373640 A CA 000373640A CA 373640 A CA373640 A CA 373640A CA 1151796 A CA1151796 A CA 1151796A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- weight
- parts
- heat
- anhydride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000647 polyepoxide Polymers 0.000 title claims abstract description 44
- 239000011342 resin composition Substances 0.000 title abstract description 3
- 239000000203 mixture Substances 0.000 claims abstract description 64
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims abstract description 48
- 239000003822 epoxy resin Substances 0.000 claims abstract description 28
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- 239000004593 Epoxy Substances 0.000 claims abstract description 9
- 150000008065 acid anhydrides Chemical class 0.000 claims abstract description 5
- 150000008064 anhydrides Chemical class 0.000 claims description 17
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- -1 quaternary ammonium halide Chemical class 0.000 claims description 14
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 229920000570 polyether Polymers 0.000 claims description 8
- 150000002118 epoxides Chemical class 0.000 claims description 7
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical group OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 claims description 5
- 150000004010 onium ions Chemical class 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- DMWVYCCGCQPJEA-UHFFFAOYSA-N 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane Chemical group CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C DMWVYCCGCQPJEA-UHFFFAOYSA-N 0.000 claims description 2
- 125000003700 epoxy group Chemical group 0.000 claims description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 2
- 150000001451 organic peroxides Chemical group 0.000 claims description 2
- 230000000704 physical effect Effects 0.000 abstract description 8
- 230000001747 exhibiting effect Effects 0.000 abstract description 3
- 239000011953 free-radical catalyst Substances 0.000 abstract description 2
- 239000003999 initiator Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 150000002978 peroxides Chemical class 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000000306 component Substances 0.000 description 6
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 6
- 238000000465 moulding Methods 0.000 description 5
- 238000005266 casting Methods 0.000 description 4
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- SLAFUPJSGFVWPP-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 SLAFUPJSGFVWPP-UHFFFAOYSA-M 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- AOIIZSJDYSLFOI-UHFFFAOYSA-L benzyl(trimethyl)azanium;sulfate Chemical compound [O-]S([O-])(=O)=O.C[N+](C)(C)CC1=CC=CC=C1.C[N+](C)(C)CC1=CC=CC=C1 AOIIZSJDYSLFOI-UHFFFAOYSA-L 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000002500 ions Chemical group 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000005609 naphthenate group Chemical group 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XEHIUIKCHPMWMC-UHFFFAOYSA-N 1-butyl-2-propan-2-ylbenzene;hydrogen peroxide Chemical group OO.CCCCC1=CC=CC=C1C(C)C XEHIUIKCHPMWMC-UHFFFAOYSA-N 0.000 description 1
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 1
- YWBMNCRJFZGXJY-UHFFFAOYSA-N 1-hydroperoxy-1,2,3,4-tetrahydronaphthalene Chemical compound C1=CC=C2C(OO)CCCC2=C1 YWBMNCRJFZGXJY-UHFFFAOYSA-N 0.000 description 1
- JPSKCQCQZUGWNM-UHFFFAOYSA-N 2,7-Oxepanedione Chemical class O=C1CCCCC(=O)O1 JPSKCQCQZUGWNM-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- OALMZWNBNXQUAL-UHFFFAOYSA-N 2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanamide Chemical compound NC(=O)C(C)(C)N=NC(C)(C)C(N)=O OALMZWNBNXQUAL-UHFFFAOYSA-N 0.000 description 1
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- VQVIHDPBMFABCQ-UHFFFAOYSA-N 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC(C(C=2C=C3C(=O)OC(=O)C3=CC=2)=O)=C1 VQVIHDPBMFABCQ-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000003677 Sheet moulding compound Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 1
- PDAVOLCVHOKLEO-UHFFFAOYSA-N acetyl benzenecarboperoxoate Chemical compound CC(=O)OOC(=O)C1=CC=CC=C1 PDAVOLCVHOKLEO-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- YSFLDEUTGUMWOT-UHFFFAOYSA-N benzhydrylsulfanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C([SH2+])C1=CC=CC=C1 YSFLDEUTGUMWOT-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- ZSAWQMSQHFHNIZ-UHFFFAOYSA-N benzyl(trimethyl)azanium;nitrate Chemical compound [O-][N+]([O-])=O.C[N+](C)(C)CC1=CC=CC=C1 ZSAWQMSQHFHNIZ-UHFFFAOYSA-N 0.000 description 1
- ZKERZZMUXBDEOG-UHFFFAOYSA-N butyl ethaneperoxoate Chemical group CCCCOOC(C)=O ZKERZZMUXBDEOG-UHFFFAOYSA-N 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- OECMNLAWCROQEE-UHFFFAOYSA-N cyclohexylbenzene;hydrogen peroxide Chemical compound OO.C1CCCCC1C1=CC=CC=C1 OECMNLAWCROQEE-UHFFFAOYSA-N 0.000 description 1
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 1
- QTMKZSUMBOOMSD-UHFFFAOYSA-N dibutyl(diethyl)phosphanium;nitrate Chemical compound [O-][N+]([O-])=O.CCCC[P+](CC)(CC)CCCC QTMKZSUMBOOMSD-UHFFFAOYSA-N 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ITQRVMZJBMZUBB-UHFFFAOYSA-M dimethyl(diphenyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 ITQRVMZJBMZUBB-UHFFFAOYSA-M 0.000 description 1
- DKVMUELSPBXFCZ-UHFFFAOYSA-N dimethyl(diphenyl)azanium;nitrate Chemical compound [O-][N+]([O-])=O.C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 DKVMUELSPBXFCZ-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 238000009730 filament winding Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- QZLKVQRFTHKQKP-UHFFFAOYSA-N hexadecanoic acid;tin Chemical compound [Sn].CCCCCCCCCCCCCCCC(O)=O QZLKVQRFTHKQKP-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940031993 lithium benzoate Drugs 0.000 description 1
- GSZRRTSGQIIDKS-UHFFFAOYSA-M lithium;7,7-dimethyloctanoate Chemical compound [Li+].CC(C)(C)CCCCCC([O-])=O GSZRRTSGQIIDKS-UHFFFAOYSA-M 0.000 description 1
- LDJNSLOKTFFLSL-UHFFFAOYSA-M lithium;benzoate Chemical compound [Li+].[O-]C(=O)C1=CC=CC=C1 LDJNSLOKTFFLSL-UHFFFAOYSA-M 0.000 description 1
- BTAUEIDLAAYHSL-UHFFFAOYSA-M lithium;octanoate Chemical compound [Li+].CCCCCCCC([O-])=O BTAUEIDLAAYHSL-UHFFFAOYSA-M 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- ZQMHJBXHRFJKOT-UHFFFAOYSA-N methyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoate Chemical compound COC(=O)C(C)(C)N=NC(C)(C)C(=O)OC ZQMHJBXHRFJKOT-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VYKXQOYUCMREIS-UHFFFAOYSA-N methylhexahydrophthalic anhydride Chemical compound C1CCCC2C(=O)OC(=O)C21C VYKXQOYUCMREIS-UHFFFAOYSA-N 0.000 description 1
- RWLWLWHZYXSCFS-UHFFFAOYSA-N methylperoxycyclohexane Chemical compound COOC1CCCCC1 RWLWLWHZYXSCFS-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- CYCFYXLDTSNTGP-UHFFFAOYSA-L octadecanoate;tin(2+) Chemical compound [Sn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CYCFYXLDTSNTGP-UHFFFAOYSA-L 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical class O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical group CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000006158 tetracarboxylic acid group Chemical group 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- YVQKKCAGAKEMKO-UHFFFAOYSA-M tricyclohexylsulfanium;bromide Chemical compound [Br-].C1CCCCC1[S+](C1CCCCC1)C1CCCCC1 YVQKKCAGAKEMKO-UHFFFAOYSA-M 0.000 description 1
- NRZWQKGABZFFKE-UHFFFAOYSA-N trimethylsulfonium Chemical compound C[S+](C)C NRZWQKGABZFFKE-UHFFFAOYSA-N 0.000 description 1
- IZYFBZDLXRHRLF-UHFFFAOYSA-N tritylphosphane;hydroiodide Chemical compound [I-].C=1C=CC=CC=1C(C=1C=CC=CC=1)([PH3+])C1=CC=CC=C1 IZYFBZDLXRHRLF-UHFFFAOYSA-N 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/42—Polycarboxylic acids; Anhydrides, halides or low molecular weight esters thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F283/00—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G
- C08F283/10—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G on to polymers containing more than one epoxy radical per molecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/68—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/140,026 US4284753A (en) | 1980-04-14 | 1980-04-14 | Heat curable polyepoxide-unsaturated aromatic monomer resin compositions |
| US140,026 | 1980-04-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1151796A true CA1151796A (en) | 1983-08-09 |
Family
ID=22489389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000373640A Expired CA1151796A (en) | 1980-04-14 | 1981-03-23 | Heat-curable polyepoxide resin compositions |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4284753A (OSRAM) |
| JP (1) | JPS56159215A (OSRAM) |
| CA (1) | CA1151796A (OSRAM) |
| DE (1) | DE3114677A1 (OSRAM) |
| ES (1) | ES8207457A1 (OSRAM) |
| FR (1) | FR2480293A1 (OSRAM) |
| GB (1) | GB2073755B (OSRAM) |
| IT (1) | IT1137536B (OSRAM) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4321305A (en) * | 1980-10-02 | 1982-03-23 | Ppg Industries, Inc. | Beta-diketone-epoxy resin reaction products useful for providing corrosion resistance |
| US4321304A (en) * | 1980-10-02 | 1982-03-23 | Ppg Industries, Inc. | Beta-diketone-epoxy resin reaction products blended with monomeric or polymeric phosphonium salts useful for providing corrosion resistance |
| US4387216A (en) * | 1981-05-06 | 1983-06-07 | Ciba-Geigy Corporation | Heat-polymerizable compositions comprising epoxide resins, aromatic sulfoxonium salts, and organic oxidants |
| US4379908A (en) * | 1982-03-05 | 1983-04-12 | Shell Oil Company | Rapid curing epoxy-unsaturated monomer compositions |
| CA1200349A (en) * | 1981-12-14 | 1986-02-04 | Thomas F. Brownscombe | Curable epoxy compositions, their preparation and formed articles therefrom |
| CA1205250A (en) * | 1981-12-14 | 1986-05-27 | Harold E. De La Mare | Heat-curable epoxy compositions and their use in preparing formed articles |
| US4532299A (en) * | 1982-01-12 | 1985-07-30 | Ameron, Inc. | Flexibilized chemically resistant epoxy resin |
| JPS58164617A (ja) * | 1982-03-25 | 1983-09-29 | Toray Ind Inc | プラスチツクレンズ用樹脂 |
| DE3362757D1 (en) * | 1982-06-14 | 1986-05-07 | Shell Int Research | Heat-curable epoxy compositions and their use in preparing formed articles |
| US4503200A (en) * | 1982-07-19 | 1985-03-05 | Shell Oil Company | Heat curable polyepoxide resin blends |
| US4490511A (en) * | 1984-02-28 | 1984-12-25 | Shell Oil Company | Process for preparation of low-dusting epoxy curing agents based on trimellitic anhydride |
| US4579931A (en) * | 1985-01-28 | 1986-04-01 | Shell Oil Company | Heat-curable composition |
| US4544732A (en) * | 1984-12-24 | 1985-10-01 | Shell Oil Company | Heat-curable composition |
| US4581436A (en) * | 1984-12-24 | 1986-04-08 | Shell Oil Company | Heat-curable composition |
| DE3583027D1 (de) * | 1984-12-24 | 1991-07-04 | Shell Int Research | Waermehaertbare epoxydzusammensetzung. |
| US4554341A (en) * | 1985-02-27 | 1985-11-19 | Shell Oil Company | Fire retardant, fast reacting epoxy resin |
| US4659425A (en) * | 1986-02-03 | 1987-04-21 | Ibm Corporation | Continuous process for the manufacture of printed circuit boards |
| US4962179A (en) * | 1989-08-31 | 1990-10-09 | Shell Oil Company | Epoxidized fatty acid ester compositions |
| US5057554A (en) * | 1989-11-01 | 1991-10-15 | General Motors Corporation | Additives for enhanced dielectric curing |
| US5106924A (en) * | 1990-02-05 | 1992-04-21 | Westinghouse Electric Corp. | Maleic anhydride-epoxy resin prepolymer, (vinyl or isopropenyl)phenyl glycidyl ether and anhydride |
| US5169910A (en) * | 1990-08-08 | 1992-12-08 | Shell Oil Company | Epoxy resin composition |
| US5358977A (en) * | 1990-10-23 | 1994-10-25 | Daubert Coated Products, Inc. | Stabilized paper substrate for release liners using aromatic and aliphatic primers, and novel primer coat |
| US5252631A (en) * | 1991-08-12 | 1993-10-12 | General Motors Corporation | Method for enhanced dielectric curing |
| JP5248623B2 (ja) * | 2007-11-20 | 2013-07-31 | ヘンケル・アクチェンゲゼルシャフト・ウント・コムパニー・コマンディットゲゼルシャフト・アウフ・アクチェン | 低い硬化温度を有するレドックス誘導カチオン重合性組成物 |
| JP5817237B2 (ja) * | 2010-07-29 | 2015-11-18 | Jsr株式会社 | 感放射線性樹脂組成物、硬化膜、カラーフィルタ、硬化膜の形成方法及びカラーフィルタの形成方法 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE515178A (OSRAM) * | 1951-10-31 | |||
| NL173809B (nl) * | 1951-11-17 | Rca Corp | Beeldopneeminrichting met kleurcodeerstrookfilterstelsel. | |
| GB772694A (en) * | 1954-03-31 | 1957-04-17 | Bataafsche Petroleum | Process for preparing reaction products of glycidyl ethers |
| US2939859A (en) * | 1954-03-31 | 1960-06-07 | Shell Oil Co | Process for preparing resinified product from polyepoxy polyether and aromatic-substituted-alkene-1 and composition for production of said product |
| CH336597A (de) * | 1954-07-14 | 1959-02-28 | Basf Ag | Zu Kunststoffen härtbare Mischung |
| US3099638A (en) * | 1959-12-28 | 1963-07-30 | Westinghouse Electric Corp | Resinous glycidyl polyether compositions |
| GB1006848A (en) * | 1962-04-26 | 1965-10-06 | Westinghouse Electric Corp | Modified epoxy resin |
| US3419348A (en) * | 1963-04-22 | 1968-12-31 | Atomic Energy Authority Uk | Separation of metals |
| US3336241A (en) * | 1963-11-12 | 1967-08-15 | Shell Oil Co | Process for preparing epoxy compounds and resulting products |
| US3356624A (en) * | 1964-12-28 | 1967-12-05 | Shell Oil Co | Epoxy resin based traffic paint compositions |
| US3446762A (en) * | 1965-09-24 | 1969-05-27 | Shell Oil Co | Epoxy resin traffic paint compositions |
| US3547885A (en) * | 1968-03-08 | 1970-12-15 | Sun Oil Co | Process for curing polyepoxides with anhydrides and phosphonium halide catalysts therefor |
| US3574157A (en) * | 1969-02-03 | 1971-04-06 | Fred Markus | Coating composition of epoxy resins,polyester resins,and vinyl monomers |
| US3634542A (en) * | 1969-08-04 | 1972-01-11 | Shell Oil Co | Unsaturated polyesters esterified with polycarboxylic acid anhydride and containing polyepoxide |
| US3637618A (en) * | 1970-03-11 | 1972-01-25 | Shell Oil Co | Unsaturated polyesters from epoxides and ethylenically unsaturated monocarboxylic acid mixed with solid epoxide resin |
| BE790021A (fr) * | 1971-10-14 | 1973-04-12 | Westinghouse Electric Corp | Ameliorations dans des compositions de resines ou y relatives |
| US4026862A (en) * | 1974-02-11 | 1977-05-31 | Westinghouse Electric Corporation | Carboxylic acid storage stabilizers for latent catalyst cured epoxy resins |
| US4017453A (en) * | 1974-08-29 | 1977-04-12 | Gulf Oil Corporation | Homogeneous polyepoxide-polyanhydride compositions |
| DE2446697B2 (de) * | 1974-09-30 | 1978-07-20 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Vernetzbare Epoxidharzgießmassen |
| US4013987A (en) * | 1975-08-22 | 1977-03-22 | Westinghouse Electric Corporation | Mica tape binder |
-
1980
- 1980-04-14 US US06/140,026 patent/US4284753A/en not_active Expired - Lifetime
-
1981
- 1981-03-23 CA CA000373640A patent/CA1151796A/en not_active Expired
- 1981-04-10 DE DE19813114677 patent/DE3114677A1/de active Granted
- 1981-04-10 FR FR8107229A patent/FR2480293A1/fr active Granted
- 1981-04-10 JP JP5307781A patent/JPS56159215A/ja active Granted
- 1981-04-10 GB GB8111421A patent/GB2073755B/en not_active Expired
- 1981-04-10 IT IT21071/81A patent/IT1137536B/it active
- 1981-04-10 ES ES501246A patent/ES8207457A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT8121071A0 (it) | 1981-04-10 |
| JPS56159215A (en) | 1981-12-08 |
| DE3114677A1 (de) | 1982-01-14 |
| GB2073755B (en) | 1983-12-07 |
| US4284753A (en) | 1981-08-18 |
| ES501246A0 (es) | 1982-09-16 |
| ES8207457A1 (es) | 1982-09-16 |
| JPH0122848B2 (OSRAM) | 1989-04-28 |
| GB2073755A (en) | 1981-10-21 |
| FR2480293A1 (fr) | 1981-10-16 |
| IT1137536B (it) | 1986-09-10 |
| DE3114677C2 (OSRAM) | 1993-09-23 |
| FR2480293B1 (OSRAM) | 1984-11-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1151796A (en) | Heat-curable polyepoxide resin compositions | |
| US3408422A (en) | Stabilization of unsaturated polyesters and resulting products | |
| US4268656A (en) | Co-curing agents for epoxy resins | |
| US3634542A (en) | Unsaturated polyesters esterified with polycarboxylic acid anhydride and containing polyepoxide | |
| US3432478A (en) | Polyhydroxy-containing unsaturated polyesters and their preparation | |
| US3564074A (en) | Thermosetting vinyl resins reacted with dicarboxylic acid anhydrides | |
| US2843560A (en) | Cured silicon-containing products prepared from polyepoxides | |
| US4524181A (en) | Curable epoxy compositions and cured resins obtained therefrom | |
| US3420914A (en) | Unsaturated polyester compositions and their preparation | |
| US3773856A (en) | Process for the preparation of unsaturated epoxy ester compositions | |
| US4503200A (en) | Heat curable polyepoxide resin blends | |
| JP3277256B2 (ja) | エポキシド付加物の製造方法 | |
| US3845016A (en) | Thermoset molding powders employing glycidyl methacrylate-functional polymers and polymeric polyanhydride crosslinking agents and moldings thereof | |
| US3676397A (en) | Oxazolidinone-containing epoxy resins and process for their preparation | |
| US3845010A (en) | Thermoset molding powders employing glycidyl methacrylate functional polymer and dibasic acid crosslinking agent and moldings thereof | |
| US3736289A (en) | Stabilization of unsaturated polyesters and resulting products | |
| US4554341A (en) | Fire retardant, fast reacting epoxy resin | |
| US3247288A (en) | Carboxy copolymers prepared in 1, 2-epoxy compounds | |
| US2985616A (en) | Curable epoxy compositions and resins made therefrom | |
| US4167539A (en) | Styrene-grafted polyanhydride copolymer | |
| CA1085545A (en) | Pre-accelerated resin composition | |
| US4316002A (en) | Molding compositions comprised of polyimide/N-vinylpyrrolidone prepolymer and epoxy resin | |
| EP0096906B1 (en) | Heat-curable epoxy compositions and their use in preparing formed articles | |
| US4683281A (en) | Organophosphite accelerators for epoxide curing | |
| US4891403A (en) | Curable thermosetting epoxy-polyester resin composition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |