CA1148568A - Process for the manufacture of 1,2-dichloroethane - Google Patents
Process for the manufacture of 1,2-dichloroethaneInfo
- Publication number
- CA1148568A CA1148568A CA000353088A CA353088A CA1148568A CA 1148568 A CA1148568 A CA 1148568A CA 000353088 A CA000353088 A CA 000353088A CA 353088 A CA353088 A CA 353088A CA 1148568 A CA1148568 A CA 1148568A
- Authority
- CA
- Canada
- Prior art keywords
- reaction
- reaction space
- moles
- chlorine
- ethylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 60
- 230000008569 process Effects 0.000 title claims abstract description 52
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 title claims abstract description 39
- 238000004519 manufacturing process Methods 0.000 title abstract description 11
- 238000006243 chemical reaction Methods 0.000 claims abstract description 180
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims abstract description 60
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims abstract description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 59
- 239000003054 catalyst Substances 0.000 claims abstract description 44
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 43
- 239000005977 Ethylene Substances 0.000 claims abstract description 43
- 239000000460 chlorine Substances 0.000 claims abstract description 37
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 37
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 30
- 239000001301 oxygen Substances 0.000 claims abstract description 30
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 30
- 239000011261 inert gas Substances 0.000 claims abstract description 26
- 239000002245 particle Substances 0.000 claims abstract description 22
- 238000005660 chlorination reaction Methods 0.000 claims abstract description 18
- 238000001816 cooling Methods 0.000 claims abstract description 14
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract 12
- 239000007789 gas Substances 0.000 claims description 108
- 239000000203 mixture Substances 0.000 claims description 18
- 239000007795 chemical reaction product Substances 0.000 claims description 10
- 239000007788 liquid Substances 0.000 claims description 7
- 150000001879 copper Chemical class 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 5
- 239000011949 solid catalyst Substances 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 4
- 238000004821 distillation Methods 0.000 claims description 3
- 239000012320 chlorinating reagent Substances 0.000 claims description 2
- 150000002505 iron Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- 238000004458 analytical method Methods 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- 239000011521 glass Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000005336 cracking Methods 0.000 description 8
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 238000004817 gas chromatography Methods 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 238000007259 addition reaction Methods 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 229910052742 iron Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 238000007664 blowing Methods 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000004227 thermal cracking Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- SURLGNKAQXKNSP-DBLYXWCISA-N chlorin Chemical compound C\1=C/2\N/C(=C\C3=N/C(=C\C=4NC(/C=C\5/C=CC/1=N/5)=CC=4)/C=C3)/CC\2 SURLGNKAQXKNSP-DBLYXWCISA-N 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 238000004939 coking Methods 0.000 description 2
- 239000000110 cooling liquid Substances 0.000 description 2
- 238000011549 displacement method Methods 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- UIQWBVPFHHQZHH-UHFFFAOYSA-N OOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOO UIQWBVPFHHQZHH-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910052769 Ytterbium Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000009102 absorption Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910001617 alkaline earth metal chloride Inorganic materials 0.000 description 1
- 230000001174 ascending effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000007033 dehydrochlorination reaction Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000003670 easy-to-clean Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- LMAZKPOSWVOFGY-FBAUPLQOSA-N orine Natural products CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C)[C@H]4C[C@@H](OC(=O)C=Cc5ccccc5)[C@]6(C)[C@@](O)(CC[C@]6(O)[C@]4(O)CC=C3C2)[C@H](C)OC(=O)C=Cc7ccccc7)O[C@H](C)[C@H]1O LMAZKPOSWVOFGY-FBAUPLQOSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- -1 platinum metals Chemical class 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000005029 sieve analysis Methods 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- NAWDYIZEMPQZHO-UHFFFAOYSA-N ytterbium Chemical compound [Yb] NAWDYIZEMPQZHO-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/15—Preparation of halogenated hydrocarbons by replacement by halogens with oxygen as auxiliary reagent, e.g. oxychlorination
- C07C17/152—Preparation of halogenated hydrocarbons by replacement by halogens with oxygen as auxiliary reagent, e.g. oxychlorination of hydrocarbons
- C07C17/156—Preparation of halogenated hydrocarbons by replacement by halogens with oxygen as auxiliary reagent, e.g. oxychlorination of hydrocarbons of unsaturated hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792922375 DE2922375A1 (de) | 1979-06-01 | 1979-06-01 | Verfahren zur herstellung von 1,2-dichlorethan |
| DEP2922375.4 | 1979-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1148568A true CA1148568A (en) | 1983-06-21 |
Family
ID=6072273
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000353088A Expired CA1148568A (en) | 1979-06-01 | 1980-05-30 | Process for the manufacture of 1,2-dichloroethane |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4788358A (oth) |
| EP (1) | EP0019863B1 (oth) |
| JP (1) | JPS55164634A (oth) |
| AR (1) | AR230980A1 (oth) |
| BR (1) | BR8003412A (oth) |
| CA (1) | CA1148568A (oth) |
| CS (1) | CS221912B2 (oth) |
| DD (1) | DD151155A5 (oth) |
| DE (2) | DE2922375A1 (oth) |
| ES (1) | ES8100792A1 (oth) |
| HU (1) | HU186295B (oth) |
| MX (1) | MX153700A (oth) |
| NO (1) | NO151857C (oth) |
| SU (1) | SU1147247A3 (oth) |
| YU (1) | YU143380A (oth) |
| ZA (1) | ZA803244B (oth) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3044854A1 (de) * | 1980-11-28 | 1982-07-01 | Hoechst Ag, 6000 Frankfurt | "verfahren zur herstellung von 1,2-dichlorethan" |
| DE3106983A1 (de) * | 1981-02-25 | 1982-09-09 | Hoechst Ag, 6000 Frankfurt | "verfahren zur herstellung von 1,2-dichlorethan" |
| FR2641779B1 (fr) * | 1988-12-26 | 1991-04-19 | Atochem | Procede et catalyseur d'oxychloration, leur application a la production du 1-2 dichloroethane |
| US5202511A (en) * | 1989-08-16 | 1993-04-13 | The Dow Chemical Company | Catalyst diluent for oxychlorination process |
| DE69601540T2 (de) * | 1995-06-07 | 1999-10-07 | The Dow Chemical Co., Midland | Verfahren zur oxychlorierung |
| TWI341218B (en) * | 2005-11-14 | 2011-05-01 | Oxy Vinyls Lp | Catalyst compositions and process for oxychlorination |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1402337A (en) * | 1919-05-07 | 1922-01-03 | Us Ind Alcohol Co | Production of halogenated hydrocarbons |
| US2716140A (en) * | 1948-01-15 | 1955-08-23 | Purdue Research Foundation | Fluorine activated chlorination |
| DE1229999B (de) * | 1964-01-31 | 1966-12-08 | Huels Chemische Werke Ag | Verfahren zur Herstellung von 1, 2-Dichloraethan |
| US3488398A (en) * | 1964-04-23 | 1970-01-06 | Goodrich Co B F | Method of preparing 1,2-dichloroethane |
| FR1483132A (fr) * | 1965-07-07 | 1967-06-02 | Pittsburgh Plate Glass Co | Procédé d'oxychloration d'hydrocarbures aliphatiques |
| US3481995A (en) * | 1966-03-24 | 1969-12-02 | Monsanto Co | Ethylene dihalide process |
| US3992463A (en) * | 1967-05-19 | 1976-11-16 | Produits Chimiques Pechiney-Saint Gobain | Oxychlorination of ethylene with a fixed bed catalyst |
| US3642921A (en) * | 1967-05-29 | 1972-02-15 | Ethyl Corp | Manufacture of 1 2-dichloroethane |
| US3679373A (en) * | 1968-12-16 | 1972-07-25 | Ppg Industries Inc | Reactor for use with fluidized beds |
| US3892816A (en) * | 1972-12-19 | 1975-07-01 | Shell Oil Co | Process for oxychlorination of ethylene |
| US4206180A (en) * | 1975-07-14 | 1980-06-03 | Stauffer Chemical Company | Oxychlorination of ethylene |
| JPS5257105A (en) * | 1975-11-04 | 1977-05-11 | Kanegafuchi Chem Ind Co Ltd | Gas phase chlorination process for ethylene |
| DE2733502C3 (de) * | 1977-07-25 | 1980-09-25 | Wacker-Chemie Gmbh, 8000 Muenchen | Verfahren zur Herstellung von 1,2-Dichloräthan aus Äthylen enthaltenden Restgasen, die aus einer Oxychlorierung stammen |
| DE2949530A1 (de) * | 1979-12-08 | 1981-06-11 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von 1,2-dichlorethan |
-
1979
- 1979-06-01 DE DE19792922375 patent/DE2922375A1/de not_active Withdrawn
-
1980
- 1980-05-22 DE DE8080102856T patent/DE3060546D1/de not_active Expired
- 1980-05-22 EP EP80102856A patent/EP0019863B1/de not_active Expired
- 1980-05-26 ES ES491856A patent/ES8100792A1/es not_active Expired
- 1980-05-28 YU YU01433/80A patent/YU143380A/xx unknown
- 1980-05-29 MX MX182549A patent/MX153700A/es unknown
- 1980-05-30 NO NO801613A patent/NO151857C/no unknown
- 1980-05-30 CA CA000353088A patent/CA1148568A/en not_active Expired
- 1980-05-30 DD DD80221478A patent/DD151155A5/de not_active IP Right Cessation
- 1980-05-30 CS CS803827A patent/CS221912B2/cs unknown
- 1980-05-30 ZA ZA00803244A patent/ZA803244B/xx unknown
- 1980-05-30 HU HU801361A patent/HU186295B/hu not_active IP Right Cessation
- 1980-05-30 SU SU802928849A patent/SU1147247A3/ru active
- 1980-05-30 AR AR281259A patent/AR230980A1/es active
- 1980-05-30 BR BR8003412A patent/BR8003412A/pt not_active IP Right Cessation
- 1980-05-31 JP JP7218480A patent/JPS55164634A/ja active Granted
-
1985
- 1985-08-05 US US06/762,767 patent/US4788358A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ZA803244B (en) | 1981-06-24 |
| HU186295B (en) | 1985-07-29 |
| YU143380A (en) | 1982-10-31 |
| SU1147247A3 (ru) | 1985-03-23 |
| NO151857B (no) | 1985-03-11 |
| AR230980A1 (es) | 1984-08-31 |
| ES491856A0 (es) | 1980-12-16 |
| US4788358A (en) | 1988-11-29 |
| EP0019863B1 (de) | 1982-06-16 |
| JPH021813B2 (oth) | 1990-01-12 |
| EP0019863A1 (de) | 1980-12-10 |
| NO151857C (no) | 1985-06-19 |
| DD151155A5 (de) | 1981-10-08 |
| CS221912B2 (en) | 1983-04-29 |
| DE3060546D1 (en) | 1982-08-05 |
| NO801613L (no) | 1980-12-02 |
| JPS55164634A (en) | 1980-12-22 |
| BR8003412A (pt) | 1980-12-30 |
| ES8100792A1 (es) | 1980-12-16 |
| DE2922375A1 (de) | 1980-12-11 |
| MX153700A (es) | 1986-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4774070A (en) | Production process of chlorine | |
| CA2708643C (en) | Methods of making chlorinated hydrocarbons | |
| CA1299203C (en) | Process for producing ethylene dichloride | |
| US2005710A (en) | Preparation of fluorine compounds | |
| WO2008000705A1 (en) | Process for the manufacture of 1,2-dichloroethane | |
| US4230668A (en) | Process and apparatus for producing halogenated unsaturated hydrocarbons | |
| CA1148568A (en) | Process for the manufacture of 1,2-dichloroethane | |
| US2498546A (en) | Manufacture of halogenated hydrocarbons | |
| US5097081A (en) | Hydrodechlorination of higher chloromethanes | |
| CA1207802A (en) | Process for the manufacture of 1,2-dichloroethane | |
| US4528174A (en) | Method for preparing hydrogen chloride for the ethyleneoxichlorination process | |
| US3378597A (en) | Method of recovering high purity ethylene dichloride from ethylene dichloride gas stream | |
| US4329527A (en) | Process for the manufacture of 1,2-dichloroethane | |
| JPS62221639A (ja) | 1,2−ジクロルエタンの製造法 | |
| EP0501501B1 (en) | Method for the preparation of methyl chloride from carbon tetrachloride and methyl alcohol | |
| CA2019913A1 (en) | Production of vinylidene fluoride from 1,1-difluoroethane | |
| NO154547B (no) | Fremgangsmaate til fremstilling av 1,2-dikloretan. | |
| US3059035A (en) | Continuous process for producing methyl chloroform | |
| US3557229A (en) | Oxychlorination of ethane to vinyl chloride | |
| IE920329A1 (en) | Process for the synthesis of 1,2-dichloroethane by oxychlorination of ethylene by means of carbon tetrachloride | |
| US5600042A (en) | Process for the production of vinyl chloride | |
| EP0003436B1 (en) | Improved process for producing vanadium chlorides | |
| US2621153A (en) | Preparation of trichloroethane | |
| RU2072976C1 (ru) | Способ получения винилхлорида | |
| US3935288A (en) | Production of olefinic halides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |