CA1147531A - Process for producing hydrogen peroxide - Google Patents
Process for producing hydrogen peroxideInfo
- Publication number
- CA1147531A CA1147531A CA000386015A CA386015A CA1147531A CA 1147531 A CA1147531 A CA 1147531A CA 000386015 A CA000386015 A CA 000386015A CA 386015 A CA386015 A CA 386015A CA 1147531 A CA1147531 A CA 1147531A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- hydrogen peroxide
- palladium
- aqueous liquid
- acidic aqueous
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims abstract description 147
- 238000000034 method Methods 0.000 title claims abstract description 19
- 230000008569 process Effects 0.000 title claims abstract description 19
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims abstract description 122
- 239000003054 catalyst Substances 0.000 claims abstract description 85
- 239000007788 liquid Substances 0.000 claims abstract description 29
- 239000001257 hydrogen Substances 0.000 claims abstract description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 22
- 230000002378 acidificating effect Effects 0.000 claims abstract description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 21
- 239000001301 oxygen Substances 0.000 claims abstract description 21
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 18
- 150000002940 palladium Chemical class 0.000 claims abstract description 9
- 238000000354 decomposition reaction Methods 0.000 claims abstract description 5
- 230000006872 improvement Effects 0.000 claims abstract description 4
- 238000005063 solubilization Methods 0.000 claims abstract description 4
- 230000007928 solubilization Effects 0.000 claims abstract description 4
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims abstract description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 46
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 43
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 40
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 235000011167 hydrochloric acid Nutrition 0.000 claims description 19
- 229960000443 hydrochloric acid Drugs 0.000 claims description 19
- 239000007789 gas Substances 0.000 claims description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 239000003456 ion exchange resin Substances 0.000 claims description 4
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 150000001299 aldehydes Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 238000002474 experimental method Methods 0.000 description 14
- 239000002904 solvent Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000000243 solution Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- 150000001451 organic peroxides Chemical class 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 230000003247 decreasing effect Effects 0.000 description 6
- 239000012263 liquid product Substances 0.000 description 6
- 150000002978 peroxides Chemical class 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 230000035508 accumulation Effects 0.000 description 4
- 238000009825 accumulation Methods 0.000 description 4
- 235000011180 diphosphates Nutrition 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000013022 venting Methods 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 238000001479 atomic absorption spectroscopy Methods 0.000 description 3
- 238000010923 batch production Methods 0.000 description 3
- 239000006229 carbon black Substances 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 230000009849 deactivation Effects 0.000 description 3
- 239000008240 homogeneous mixture Substances 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910021120 PdC12 Inorganic materials 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 230000002045 lasting effect Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011949 solid catalyst Substances 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- CHRJZRDFSQHIFI-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;styrene Chemical compound C=CC1=CC=CC=C1.C=CC1=CC=CC=C1C=C CHRJZRDFSQHIFI-UHFFFAOYSA-N 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000006066 glass batch Substances 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 150000002941 palladium compounds Chemical class 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- -1 polytetra-fluoroethylene Polymers 0.000 description 1
- 229940058401 polytetrafluoroethylene Drugs 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- ABKQFSYGIHQQLS-UHFFFAOYSA-J sodium tetrachloropalladate Chemical compound [Na+].[Na+].Cl[Pd+2](Cl)(Cl)Cl ABKQFSYGIHQQLS-UHFFFAOYSA-J 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/029—Preparation from hydrogen and oxygen
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/584—Recycling of catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US195,828 | 1980-10-10 | ||
| US06/195,828 US4336238A (en) | 1980-10-10 | 1980-10-10 | Process for producing hydrogen peroxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1147531A true CA1147531A (en) | 1983-06-07 |
Family
ID=22722988
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000386015A Expired CA1147531A (en) | 1980-10-10 | 1981-09-16 | Process for producing hydrogen peroxide |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4336238A (enExample) |
| EP (1) | EP0049809B1 (enExample) |
| JP (1) | JPS5792505A (enExample) |
| CA (1) | CA1147531A (enExample) |
| DE (1) | DE3167966D1 (enExample) |
| MX (1) | MX151770A (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4389390A (en) * | 1980-10-10 | 1983-06-21 | Air Products And Chemicals, Inc. | Process for producing hydrogen peroxide |
| US4462978A (en) * | 1982-12-10 | 1984-07-31 | The Halcon Sd Group, Inc. | Preparation of hydrogen peroxide |
| DE3462598D1 (en) * | 1983-06-22 | 1987-04-16 | Du Pont | Catalytic process for making h2o2 from hydrogen and oxygen |
| US4681751A (en) * | 1983-06-22 | 1987-07-21 | E. I. Du Pont De Nemours And Company | Catalytic process for making H2 O2 from hydrogen and oxygen |
| US4772458A (en) * | 1986-11-19 | 1988-09-20 | E. I. Du Pont De Nemours And Company | Catalytic process for making hydrogen peroxide from hydrogen and oxygen employing a bromide promoter |
| US4889705A (en) * | 1988-05-13 | 1989-12-26 | E. I. Du Pont De Nemours And Company | Hydrogen peroxide method using optimized H+ and BR- concentrations |
| CA1317740C (en) * | 1988-10-24 | 1993-05-18 | Karl T. Chuang | Production of hydrogen peroxide |
| JP3060499B2 (ja) * | 1989-09-01 | 2000-07-10 | 三菱瓦斯化学株式会社 | 過酸化水素の製造方法 |
| US5120524A (en) * | 1991-07-18 | 1992-06-09 | Kerr-Mcgee Corporation | Co-production of hydrogen peroxide and a useful ester |
| US5169618A (en) * | 1992-01-13 | 1992-12-08 | Kerr-Mcgee Corporation | Process for producing hydrogen peroxide |
| US5879365A (en) * | 1995-04-04 | 1999-03-09 | United States Surgical Corporation | Surgical cutting apparatus |
| DE19642770A1 (de) | 1996-10-16 | 1998-04-23 | Basf Ag | Verfahren zur Herstellung von Wasserstoffperoxid |
| DE19857137A1 (de) | 1998-12-11 | 2000-06-15 | Bayer Ag | Integriertes Verfahren zur Herstellung von Epoxiden aus Olefinen |
| ITMI20011016A1 (it) * | 2001-05-17 | 2002-11-17 | Enichem Spa | Sintesi diretta di acqua ossigenata in un nuovo sitema solvente multicomponente |
| ITMI20011688A1 (it) * | 2001-08-02 | 2003-02-02 | Enichem Spa | Catalizzatore e suo impiego nella sintesi di acqua ossigenata |
| DE10153546A1 (de) * | 2001-10-30 | 2003-05-22 | Degussa | Direktsynthese von Wasserstoffperoxid und deren Integration in Oxidationsprozesse |
| CA2422025A1 (en) | 2002-03-12 | 2003-09-12 | Bombardier Inc. | Helmet with breathing mask air passages |
| US7147833B2 (en) | 2002-03-25 | 2006-12-12 | Huckins Harold A | Method for producing hydrogen peroxide from hydrogen and oxygen |
| DE10240129B4 (de) * | 2002-08-30 | 2004-11-11 | Basf Ag | Integriertes Verfahren zur Synthese von Propylenoxid |
| US7067103B2 (en) | 2003-03-28 | 2006-06-27 | Headwaters Nanokinetix, Inc. | Direct hydrogen peroxide production using staged hydrogen addition |
| US7011807B2 (en) | 2003-07-14 | 2006-03-14 | Headwaters Nanokinetix, Inc. | Supported catalysts having a controlled coordination structure and methods for preparing such catalysts |
| US7045479B2 (en) * | 2003-07-14 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Intermediate precursor compositions used to make supported catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7144565B2 (en) * | 2003-07-29 | 2006-12-05 | Headwaters Nanokinetix, Inc. | Process for direct catalytic hydrogen peroxide production |
| ITMI20032552A1 (it) * | 2003-12-22 | 2005-06-23 | Polimeri Europa Spa | Procedimento per la rimozione di acido solforico presente in soluzioni essenzialmente alcoliche di h202 proveniente da sintesi diretta |
| ITMI20032553A1 (it) * | 2003-12-22 | 2005-06-23 | Polimeri Europa Spa | Procedimento per la rimozione degli acidi inorganici e delle impurezze metalliche presenti in soluzioni essenzialmente alcoliche di h202 proveniente da sintesi iretta |
| US7045481B1 (en) | 2005-04-12 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Nanocatalyst anchored onto acid functionalized solid support and methods of making and using same |
| US7396795B2 (en) * | 2005-08-31 | 2008-07-08 | Headwaters Technology Innovation, Llc | Low temperature preparation of supported nanoparticle catalysts having increased dispersion |
| US7892299B2 (en) * | 2005-09-15 | 2011-02-22 | Headwaters Technology Innovation, Llc | Methods of manufacturing fuel cell electrodes incorporating highly dispersed nanoparticle catalysts |
| US7887771B2 (en) * | 2005-10-06 | 2011-02-15 | Headwaters Technology Innovation, Llc | Carbon nanorings manufactured from templating nanoparticles |
| US7718155B2 (en) * | 2005-10-06 | 2010-05-18 | Headwaters Technology Innovation, Llc | Carbon nanostructures manufactured from catalytic templating nanoparticles |
| US8133637B2 (en) * | 2005-10-06 | 2012-03-13 | Headwaters Technology Innovation, Llc | Fuel cells and fuel cell catalysts incorporating a nanoring support |
| US7935276B2 (en) * | 2006-02-09 | 2011-05-03 | Headwaters Technology Innovation Llc | Polymeric materials incorporating carbon nanostructures |
| US7718710B2 (en) * | 2006-03-17 | 2010-05-18 | Headwaters Technology Innovation, Llc | Stable concentrated metal colloids and methods of making same |
| US7632774B2 (en) * | 2006-03-30 | 2009-12-15 | Headwaters Technology Innovation, Llc | Method for manufacturing supported nanocatalysts having an acid-functionalized support |
| US7563742B2 (en) | 2006-09-22 | 2009-07-21 | Headwaters Technology Innovation, Llc | Supported nickel catalysts having high nickel loading and high metal dispersion and methods of making same |
| US7718156B2 (en) * | 2006-12-20 | 2010-05-18 | Headwaters Technology Innovation, Llc | Method for manufacturing carbon nanostructures having minimal surface functional groups |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1108752A (en) * | 1913-06-16 | 1914-08-25 | Henkel & Cie Gmbh | Manufacture of hydrogen peroxid. |
| NL294400A (enExample) * | 1962-06-21 | |||
| US3336112A (en) * | 1963-07-23 | 1967-08-15 | Ici Ltd | Catalytic production of hydrogen peroxide from its elements |
| US4007256A (en) * | 1975-04-11 | 1977-02-08 | Shell Oil Company | Catalytic production of hydrogen peroxide from its elements |
| JPS5271000A (en) * | 1975-12-10 | 1977-06-13 | Tokuyama Soda Co Ltd | Production of hydrogen peroxide |
| JPS5518646A (en) * | 1978-07-26 | 1980-02-08 | Matsushita Electric Ind Co Ltd | Photo coupler |
-
1980
- 1980-10-10 US US06/195,828 patent/US4336238A/en not_active Expired - Lifetime
-
1981
- 1981-09-16 CA CA000386015A patent/CA1147531A/en not_active Expired
- 1981-09-29 DE DE8181107741T patent/DE3167966D1/de not_active Expired
- 1981-09-29 EP EP81107741A patent/EP0049809B1/en not_active Expired
- 1981-10-06 MX MX189521A patent/MX151770A/es unknown
- 1981-10-09 JP JP56160396A patent/JPS5792505A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3167966D1 (en) | 1985-02-07 |
| US4336238A (en) | 1982-06-22 |
| MX151770A (es) | 1985-03-07 |
| EP0049809B1 (en) | 1984-12-27 |
| JPS6257565B2 (enExample) | 1987-12-01 |
| JPS5792505A (en) | 1982-06-09 |
| EP0049809A1 (en) | 1982-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1147531A (en) | Process for producing hydrogen peroxide | |
| CA2419814C (en) | Process for the production of hydrogen peroxide | |
| EP1160195B1 (en) | Process for the continuous production of hydrogen peroxide in organic solvents, using a hydrogen concentration smaller than 4,5%Vol. and an oxigen concentration smaller than 21,5%Vol. | |
| US4336239A (en) | Synthesis of hydrogen peroxide | |
| US6630118B2 (en) | Process for the direct synthesis of hydrogen peroxide | |
| CA1306237C (en) | Process for regenerating a carbonylation catalyst solution to remove corrosion metals | |
| CA1147530A (en) | Synthesis of hydrogen peroxide | |
| US4279883A (en) | Process for producing hydrogen peroxide | |
| RU2156656C2 (ru) | Способ повышения производительности карбонилирующего катализаторного раствора путем удаления металлов коррозии | |
| US3970713A (en) | Process for the production of allyl alcohol | |
| US20030232004A1 (en) | Supported noble metal, phase-controlled catalyst and methods for making and using the catalyst | |
| US4389390A (en) | Process for producing hydrogen peroxide | |
| JP2002532483A (ja) | オレフィンからのエポキシドの連続的製造法 | |
| KR100589886B1 (ko) | 비닐아세테이트의 제조 방법 | |
| CA1072579A (en) | Process for producing pure racemic acid and meso-tartaric acid | |
| US5239119A (en) | Catalytic synthesis of azines from H2 O2 /NH3 /carbonyl compounds | |
| US4110372A (en) | Process for the purification of carboxylic acids | |
| JP3035641B2 (ja) | メタノールのカルボニル化による酢酸の製造方法 | |
| US3140312A (en) | Percarboxylic acid production employing a pretreated, dehydrated acid cation exchange resin | |
| JPH0354656B2 (enExample) | ||
| CA1058634A (en) | Process for producing pure racemic acid and mesotartaric acid | |
| JP3213392B2 (ja) | 酢酸の製造法 | |
| JPH0449250A (ja) | 反応抽出法 | |
| JP2962454B2 (ja) | 炭酸ジメチルの連続製造法 | |
| JPH0940609A (ja) | ギ酸メチルの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 20000607 |