CA1136650A - Aldehyde-ethers - Google Patents
Aldehyde-ethersInfo
- Publication number
- CA1136650A CA1136650A CA000349512A CA349512A CA1136650A CA 1136650 A CA1136650 A CA 1136650A CA 000349512 A CA000349512 A CA 000349512A CA 349512 A CA349512 A CA 349512A CA 1136650 A CA1136650 A CA 1136650A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl radical
- rhodium
- represent
- hydrogen atom
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 claims abstract description 36
- 229910052703 rhodium Inorganic materials 0.000 claims abstract description 31
- 239000010948 rhodium Substances 0.000 claims abstract description 31
- 238000007037 hydroformylation reaction Methods 0.000 claims abstract description 29
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 26
- -1 Aldehyde ethers Chemical class 0.000 claims abstract description 20
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 16
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- ZJVRXWVVJPAKGP-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxy]butanal Chemical compound CC(C)(C)OCCCC=O ZJVRXWVVJPAKGP-UHFFFAOYSA-N 0.000 claims abstract description 5
- LJQSELUIZOLLPW-UHFFFAOYSA-N 2-methyl-3-[(2-methylpropan-2-yl)oxy]propanal Chemical compound O=CC(C)COC(C)(C)C LJQSELUIZOLLPW-UHFFFAOYSA-N 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000003446 ligand Substances 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 24
- 239000000126 substance Substances 0.000 abstract description 5
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 abstract description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 abstract description 4
- 229930188620 butyrolactone Natural products 0.000 abstract description 2
- 239000000543 intermediate Substances 0.000 abstract description 2
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 23
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- 239000012429 reaction media Substances 0.000 description 9
- FHVRTMVXBVDWCK-UHFFFAOYSA-N 2-methyl-2-prop-2-enoxypropane Chemical compound CC(C)(C)OCC=C FHVRTMVXBVDWCK-UHFFFAOYSA-N 0.000 description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 8
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 8
- 150000001336 alkenes Chemical group 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 7
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical compound CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 6
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 6
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- WGLLSSPDPJPLOR-UHFFFAOYSA-N 2,3-dimethylbut-2-ene Chemical compound CC(C)=C(C)C WGLLSSPDPJPLOR-UHFFFAOYSA-N 0.000 description 4
- XWDYFVMBWGGLNR-UHFFFAOYSA-N 2-methyl-2-prop-2-enoxybutane Chemical compound CCC(C)(C)OCC=C XWDYFVMBWGGLNR-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000000746 allylic group Chemical group 0.000 description 4
- 238000006266 etherification reaction Methods 0.000 description 4
- 125000001145 hydrido group Chemical group *[H] 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- MHNNAWXXUZQSNM-UHFFFAOYSA-N 2-methylbut-1-ene Chemical compound CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012018 catalyst precursor Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- BADXJIPKFRBFOT-UHFFFAOYSA-N dimedone Chemical class CC1(C)CC(=O)CC(=O)C1 BADXJIPKFRBFOT-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- JFZUABNDWZQLIJ-UHFFFAOYSA-N methyl 2-[(2-chloroacetyl)amino]benzoate Chemical compound COC(=O)C1=CC=CC=C1NC(=O)CCl JFZUABNDWZQLIJ-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- BEQGRRJLJLVQAQ-GQCTYLIASA-N (e)-3-methylpent-2-ene Chemical compound CC\C(C)=C\C BEQGRRJLJLVQAQ-GQCTYLIASA-N 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- IBTLFDCPAJLATQ-UHFFFAOYSA-N 1-prop-2-enoxybutane Chemical compound CCCCOCC=C IBTLFDCPAJLATQ-UHFFFAOYSA-N 0.000 description 1
- DVQWBWJZXBYZLA-UHFFFAOYSA-N 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane Chemical compound CC(C)C(C)(C)OC(C)(C)C(C)C DVQWBWJZXBYZLA-UHFFFAOYSA-N 0.000 description 1
- IYIOJBQQTQVIQU-UHFFFAOYSA-N 2-methyl-3-(1-methylcyclohexyl)oxypropanal Chemical compound O=CC(C)COC1(C)CCCCC1 IYIOJBQQTQVIQU-UHFFFAOYSA-N 0.000 description 1
- LCPGLALOFYXRHQ-UHFFFAOYSA-N 3-ethyl-3-(3-ethylhexan-3-yloxy)hexane Chemical compound CCCC(CC)(CC)OC(CC)(CC)CCC LCPGLALOFYXRHQ-UHFFFAOYSA-N 0.000 description 1
- KXEAZJHCOWBLLF-UHFFFAOYSA-N 3-methyl-3-(3-methylpentan-3-yloxy)pentane Chemical compound CCC(C)(CC)OC(C)(CC)CC KXEAZJHCOWBLLF-UHFFFAOYSA-N 0.000 description 1
- RYKZRKKEYSRDNF-UHFFFAOYSA-N 3-methylidenepentane Chemical compound CCC(=C)CC RYKZRKKEYSRDNF-UHFFFAOYSA-N 0.000 description 1
- FRPPXCPEDMQPAB-UHFFFAOYSA-N 4-(1-methylcyclohexyl)oxybutanal Chemical compound O=CCCCOC1(C)CCCCC1 FRPPXCPEDMQPAB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 102000018361 Contactin Human genes 0.000 description 1
- 108060003955 Contactin Proteins 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910019603 Rh2O3 Inorganic materials 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 206010042618 Surgical procedure repeated Diseases 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- GPMUMMNTAZMBEC-UHFFFAOYSA-N bis(oxomethylidene)rhodium Chemical compound [Rh].[O+]#[C-].[O+]#[C-] GPMUMMNTAZMBEC-UHFFFAOYSA-N 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- LVGLLYVYRZMJIN-UHFFFAOYSA-N carbon monoxide;rhodium Chemical compound [Rh].[Rh].[Rh].[Rh].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] LVGLLYVYRZMJIN-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 238000011027 product recovery Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 150000003283 rhodium Chemical class 0.000 description 1
- FQSDTIQFGVAWNS-UHFFFAOYSA-N rhodium;(triphenyl-$l^{5}-phosphanylidene)methanone Chemical compound [Rh].C=1C=CC=CC=1P(C=1C=CC=CC=1)(=C=O)C1=CC=CC=C1 FQSDTIQFGVAWNS-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
- C07C47/198—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/15—Unsaturated ethers containing only non-aromatic carbon-to-carbon double bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/18—Ethers having an ether-oxygen atom bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C43/188—Unsaturated ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7912849 | 1979-04-11 | ||
| GB7912849 | 1979-04-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1136650A true CA1136650A (en) | 1982-11-30 |
Family
ID=10504514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000349512A Expired CA1136650A (en) | 1979-04-11 | 1980-04-10 | Aldehyde-ethers |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US4383125A (esLanguage) |
| EP (1) | EP0018161B1 (esLanguage) |
| JP (1) | JPS55141427A (esLanguage) |
| KR (1) | KR840000276B1 (esLanguage) |
| AR (1) | AR225920A1 (esLanguage) |
| AT (1) | ATE3537T1 (esLanguage) |
| AU (1) | AU536556B2 (esLanguage) |
| BR (1) | BR8002277A (esLanguage) |
| CA (1) | CA1136650A (esLanguage) |
| DE (1) | DE3063424D1 (esLanguage) |
| ES (1) | ES8101531A1 (esLanguage) |
| IN (1) | IN153492B (esLanguage) |
| MX (1) | MX151832A (esLanguage) |
| PL (1) | PL223392A1 (esLanguage) |
| ZA (1) | ZA802151B (esLanguage) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4510080A (en) * | 1982-04-06 | 1985-04-09 | International Flavors & Fragrances Inc. | Organoleptic uses of hydrocarbyloxy alkanals |
| DE3361212D1 (en) * | 1982-06-11 | 1985-12-19 | Davy Mckee London | Hydroformylation process |
| US4599468A (en) * | 1983-09-19 | 1986-07-08 | International Flavors & Fragrances Inc. | Ether carboxaldehydes |
| US4533756A (en) * | 1983-11-07 | 1985-08-06 | Texaco Inc. | Process for synthesis of acrylic acid precursors via hydroformylation of vinyl ether |
| DE3403427A1 (de) * | 1984-02-01 | 1985-08-01 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von 1,4-butandial |
| JPH0723876Y2 (ja) * | 1986-08-01 | 1995-05-31 | オムロン株式会社 | 動作表示灯付電気機器 |
| US4891447A (en) * | 1988-12-16 | 1990-01-02 | Basf K&F Corporation | Sandalwood odorants |
| SG49213A1 (en) † | 1993-05-06 | 1998-05-18 | Dsm Nv | Process for the preparation of a linear aldehyde organic |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2170854A (en) * | 1936-02-24 | 1939-08-29 | Carbide & Carbon Chem Corp | Methoxy acetaldehyde and process of making alkoxy acetaldehydes |
| US2555950A (en) * | 1949-06-23 | 1951-06-05 | Du Pont | Preparation of 2-methoxy-1-alkanols and 2-methoxy-1-alkanals |
| DE891690C (de) * | 1950-05-22 | 1953-10-01 | Distillers Co Yeast Ltd | Verfahren zur Herstellung von ª‰-Alkoxyaldehyden |
| US3239570A (en) * | 1960-07-22 | 1966-03-08 | Shell Oil Co | Hydroformylation of olefins |
| US3676500A (en) * | 1967-01-26 | 1972-07-11 | Du Pont | Tertiary aldehyde compounds |
| US3527809A (en) * | 1967-08-03 | 1970-09-08 | Union Carbide Corp | Hydroformylation process |
| US3518310A (en) * | 1968-02-09 | 1970-06-30 | Shell Oil Co | Preparation of beta-hydroxypropionaldehyde and beta-alkoxypropionaldehydes |
| GB1298331A (en) * | 1968-08-02 | 1972-11-29 | Johnson Matthey Co Ltd | Improved hydroformylation process |
| CA918673A (en) * | 1969-12-22 | 1973-01-09 | L. Pruett Roy | Hydroformylation process |
| US3917661A (en) * | 1970-01-07 | 1975-11-04 | Union Carbide Corp | Hydroformylation of unsaturated organic compounds |
| US3764712A (en) * | 1970-11-24 | 1973-10-09 | Fritzsche Dodge & Olcott Inc | Compositions containing hexoxyacetaldehydes and their derivatives |
| CA1022934A (en) * | 1972-11-29 | 1977-12-20 | Donald E. Morris | Hydroformylation process |
| US4064145A (en) * | 1975-10-20 | 1977-12-20 | Celanese Corporation | Production of tetrahydrofuran |
| US4029710A (en) * | 1976-03-31 | 1977-06-14 | Chevron Research Company | 4-Alkoxy-N-butyraldehyde preparation |
| JPS54119407A (en) * | 1978-03-09 | 1979-09-17 | Agency Of Ind Science & Technol | Preparation of aldehydes |
| EP0018162A1 (en) * | 1979-04-11 | 1980-10-29 | DAVY McKEE (LONDON) LIMITED | Production of butyrolactone |
-
1980
- 1980-04-09 EP EP80301129A patent/EP0018161B1/en not_active Expired
- 1980-04-09 DE DE8080301129T patent/DE3063424D1/de not_active Expired
- 1980-04-09 AT AT80301129T patent/ATE3537T1/de not_active IP Right Cessation
- 1980-04-10 CA CA000349512A patent/CA1136650A/en not_active Expired
- 1980-04-10 ZA ZA00802151A patent/ZA802151B/xx unknown
- 1980-04-10 AU AU57347/80A patent/AU536556B2/en not_active Ceased
- 1980-04-10 IN IN414/CAL/80A patent/IN153492B/en unknown
- 1980-04-10 KR KR1019800001483A patent/KR840000276B1/ko not_active Expired
- 1980-04-11 US US06/139,591 patent/US4383125A/en not_active Expired - Lifetime
- 1980-04-11 PL PL22339280A patent/PL223392A1/xx unknown
- 1980-04-11 ES ES490987A patent/ES8101531A1/es not_active Expired
- 1980-04-11 BR BR8002277A patent/BR8002277A/pt unknown
- 1980-04-11 MX MX181939A patent/MX151832A/es unknown
- 1980-04-11 JP JP4855180A patent/JPS55141427A/ja active Granted
- 1980-04-11 AR AR280659A patent/AR225920A1/es active
-
1982
- 1982-04-07 US US06/366,166 patent/US4414420A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES490987A0 (es) | 1980-12-16 |
| ATE3537T1 (de) | 1983-06-15 |
| KR840000276B1 (ko) | 1984-03-13 |
| US4383125A (en) | 1983-05-10 |
| AR225920A1 (es) | 1982-05-14 |
| KR830002664A (ko) | 1983-05-30 |
| PL223392A1 (esLanguage) | 1981-01-30 |
| JPS55141427A (en) | 1980-11-05 |
| AU536556B2 (en) | 1984-05-10 |
| BR8002277A (pt) | 1980-12-02 |
| JPS6332773B2 (esLanguage) | 1988-07-01 |
| ES8101531A1 (es) | 1980-12-16 |
| MX151832A (es) | 1985-04-01 |
| DE3063424D1 (en) | 1983-07-07 |
| EP0018161A1 (en) | 1980-10-29 |
| US4414420A (en) | 1983-11-08 |
| ZA802151B (en) | 1981-05-27 |
| AU5734780A (en) | 1980-10-16 |
| IN153492B (esLanguage) | 1984-07-21 |
| EP0018161B1 (en) | 1983-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4742178A (en) | Low pressure hydroformylation of dienes | |
| PL111026B1 (en) | Continuous process for aldehydes manufacture | |
| CA1136650A (en) | Aldehyde-ethers | |
| EP0022162A1 (en) | Process for producing disubstituted 4-hydroxycyclopentenones; monosubstituted cyclopentendiones and 4-hydroxycyclopentenones | |
| US5053562A (en) | Process for making 1,3-diols from epoxides | |
| US4275243A (en) | Process for producing hydroxybutyraldehyde | |
| CA1146573A (en) | Production of butyrolactone | |
| Durden et al. | The Boron Trifluoride Catalyzed Reaction of Acetophenone with Acetic Anhydride | |
| Mann et al. | Cycloaddition reactions of polysubstituted furans with oxyallyl carbocations | |
| US4153795A (en) | Cobalt pyridyl catalysts for hydroformylation | |
| Friedrich et al. | Synthesis and reactions of 2, 3-diphenyl-2, 5-dihydro-2-furanol | |
| US4435585A (en) | Process for the preparation of dihydrocinnamaldehyde derivatives | |
| CA1134392A (en) | Production of butane-1,4-diol | |
| US3953518A (en) | Process for preparing γ, δ-unsaturated carbonyl compounds | |
| US4287127A (en) | Production of tetrahydrofuran | |
| US4615838A (en) | Unsaturated compounds and their preparation | |
| US3576011A (en) | Tetrahydropyran production | |
| US2682562A (en) | Reduction of aromatic carbinols | |
| US3017437A (en) | Production of glycol monoethers | |
| Hudson et al. | The reaction of aldehydes with 4-methyl-4-penten-2-ol and α-terpineol | |
| JPH03261776A (ja) | ジヒドロフラン系化合物の製造方法 | |
| Robinson | Anomalous low solvolytic reactivity of 2, 2-dichlorocyclopropylcarbinyl chlorides | |
| US3137731A (en) | Process for preparing substituted cyclopentenones | |
| US3546277A (en) | Method of preparing 1,1-dialkoxy-4,4-diacyloxybutanes | |
| McAndrew et al. | Synthesis of dihydrotagetone (2, 6-dimethyloct-7-en-4-one) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |