CA1110758A - Brightness control circuit employing a closed control loop - Google Patents
Brightness control circuit employing a closed control loopInfo
- Publication number
- CA1110758A CA1110758A CA302,551A CA302551A CA1110758A CA 1110758 A CA1110758 A CA 1110758A CA 302551 A CA302551 A CA 302551A CA 1110758 A CA1110758 A CA 1110758A
- Authority
- CA
- Canada
- Prior art keywords
- blanking
- signal
- image
- intervals
- level
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008054 signal transmission Effects 0.000 claims description 19
- 230000004044 response Effects 0.000 claims description 11
- 238000005070 sampling Methods 0.000 claims description 10
- 230000005540 biological transmission Effects 0.000 claims description 4
- 230000008878 coupling Effects 0.000 claims 7
- 238000010168 coupling process Methods 0.000 claims 7
- 238000005859 coupling reaction Methods 0.000 claims 7
- 238000001914 filtration Methods 0.000 claims 7
- 230000001747 exhibiting effect Effects 0.000 claims 1
- 230000000737 periodic effect Effects 0.000 abstract description 3
- 239000011159 matrix material Substances 0.000 description 17
- 239000003990 capacitor Substances 0.000 description 8
- 239000002131 composite material Substances 0.000 description 5
- 230000007423 decrease Effects 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000010586 diagram Methods 0.000 description 3
- 238000013459 approach Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- QHGVXILFMXYDRS-UHFFFAOYSA-N pyraclofos Chemical compound C1=C(OP(=O)(OCC)SCCC)C=NN1C1=CC=C(Cl)C=C1 QHGVXILFMXYDRS-UHFFFAOYSA-N 0.000 description 2
- 235000003197 Byrsonima crassifolia Nutrition 0.000 description 1
- 240000001546 Byrsonima crassifolia Species 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 230000009699 differential effect Effects 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/44—Receiver circuitry for the reception of television signals according to analogue transmission standards
- H04N5/57—Control of contrast or brightness
- H04N5/59—Control of contrast or brightness in dependence upon beam current of cathode ray tube
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Processing Of Color Television Signals (AREA)
- Television Receiver Circuits (AREA)
- Picture Signal Circuits (AREA)
- Color Television Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US794,128 | 1977-05-05 | ||
| US05/794,128 US4197557A (en) | 1977-05-05 | 1977-05-05 | Brightness control circuit employing a closed control loop |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1110758A true CA1110758A (en) | 1981-10-13 |
Family
ID=25161796
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA302,551A Expired CA1110758A (en) | 1977-05-05 | 1978-05-03 | Brightness control circuit employing a closed control loop |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4197557A (enExample) |
| JP (1) | JPS53138225A (enExample) |
| AT (1) | AT382992B (enExample) |
| AU (1) | AU520236B2 (enExample) |
| BE (1) | BE866754A (enExample) |
| CA (1) | CA1110758A (enExample) |
| DK (1) | DK147250C (enExample) |
| ES (1) | ES469495A1 (enExample) |
| FI (1) | FI65880C (enExample) |
| FR (1) | FR2390064B1 (enExample) |
| GB (1) | GB1601304A (enExample) |
| HK (1) | HK24487A (enExample) |
| IT (1) | IT1096078B (enExample) |
| MX (1) | MX144734A (enExample) |
| NL (1) | NL188829C (enExample) |
| PL (1) | PL117772B1 (enExample) |
| SE (1) | SE443272B (enExample) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2960094D1 (en) * | 1978-03-16 | 1981-03-19 | Videocolor Sa | Apparatus for generating the cut-off voltage of a cathode-ray-tube and colour television receiver embodying such an apparatus |
| US4253121A (en) * | 1978-10-12 | 1981-02-24 | Rca Corporation | Plural sequential operating mode automatic kinescope beam current limiter |
| US4253110A (en) * | 1979-12-14 | 1981-02-24 | Rca Corporation | Automatic kinescope beam current limiter with sequential control modes |
| US4203131A (en) * | 1979-01-31 | 1980-05-13 | Rca Corporation | Predictable automatic brightness control circuit in a video signal image reproducing system |
| US4204221A (en) * | 1979-01-31 | 1980-05-20 | Rca Corporation | Predictably biased kinescope driver arrangement in a video signal processing system |
| US4209808A (en) * | 1979-03-26 | 1980-06-24 | Rca Corporation | Stabilized automatic brightness control network in a video signal processing system including an automatic kinescope beam current limiter |
| US4291336A (en) * | 1980-01-18 | 1981-09-22 | Rca Corporation | Composite keying signal generator for a television receiver |
| US4295161A (en) * | 1980-04-21 | 1981-10-13 | Rca Corporation | Keyed noise filter in a television receiver |
| US4295163A (en) * | 1980-07-02 | 1981-10-13 | Rca Corporation | Keying signal generator responsive to plural input signals |
| US4319277A (en) * | 1980-07-02 | 1982-03-09 | Rca Corporation | Institutional audio-visual system including a plural operating mode television receiver |
| US4354202A (en) * | 1980-11-26 | 1982-10-12 | Rca Corporation | Television receiver on-screen alphanumeric display |
| US4337478A (en) * | 1980-11-26 | 1982-06-29 | Rca Corporation | Composite timing signal generator with predictable output level |
| US4370674A (en) * | 1981-03-03 | 1983-01-25 | Zenith Radio Corporation | Stabilization network for a cathode ray tube |
| US4376288A (en) * | 1981-08-27 | 1983-03-08 | Rca Corporation | Signal gain control with DC compensation |
| US4404593A (en) * | 1981-08-27 | 1983-09-13 | Rca Corporation | Brightness control circuit |
| US4371896A (en) * | 1981-08-27 | 1983-02-01 | Rca Corporation | Stabilized video signal control loop |
| US4410907A (en) * | 1981-11-16 | 1983-10-18 | Rca Corporation | Burst gate keying and back porch clamp pulse generator |
| US4412244A (en) * | 1981-11-20 | 1983-10-25 | Rca Corporation | Switching circuit for television receiver on-screen display |
| US4474623A (en) * | 1982-04-26 | 1984-10-02 | Raytheon Company | Method of passivating a semiconductor body |
| US4484229A (en) * | 1982-10-29 | 1984-11-20 | Rca Corporation | Automatic kinescope bias control system with selectively disabled signal processor |
| US4516152A (en) * | 1983-05-23 | 1985-05-07 | Rca Corporation | Video signal processor with automatic kinescope white balance and beam current limiter control systems |
| GB2148636A (en) * | 1983-09-15 | 1985-05-30 | Sinclair Res Ltd | Improvements in or relating to television receivers |
| US4679087A (en) * | 1984-03-12 | 1987-07-07 | Loge/Dunn Instruments, Inc. | Method and apparatus for photographing video images of either polarity without CRT brightness or contrast readjustment |
| US4642690A (en) * | 1984-08-27 | 1987-02-10 | Rca Corporation | Digital video signal processor with analog level control |
| JPS61140279A (ja) * | 1984-12-12 | 1986-06-27 | Toshiba Corp | 映像信号処理回路 |
| GB8611235D0 (en) * | 1986-05-08 | 1986-06-18 | Rca Corp | Brightness tracking circuit |
| US4962417A (en) * | 1988-05-12 | 1990-10-09 | Rca Licensing Corporation | Chroma overload detector using a differential amplifier |
| US4945414A (en) * | 1988-05-12 | 1990-07-31 | Rca Licensing Corporation | Compensator for temperature-induced black level drift for use in a television receiver |
| JPH0288408U (enExample) * | 1988-12-23 | 1990-07-12 | ||
| KR930009100B1 (ko) * | 1991-01-17 | 1993-09-22 | 삼성전자 주식회사 | 광대역 음극선관 구동회로 |
| GB9109613D0 (en) * | 1991-05-03 | 1991-06-26 | Thomson Consumer Electronics | A television system having an ultrablack video signal blanking level for an on-screen character display |
| JPH0594146A (ja) * | 1991-10-02 | 1993-04-16 | Mitsubishi Electric Corp | 輝度制御回路 |
| US5390020A (en) * | 1992-09-14 | 1995-02-14 | Eastman Kodak Company | Video amplifier stabilization for CRT printing |
| JP3557675B2 (ja) * | 1994-12-16 | 2004-08-25 | 富士ゼロックス株式会社 | 画像読取装置 |
| US5841488A (en) | 1995-12-28 | 1998-11-24 | Thomson Consumer Electronics, Inc. | Multiple video input clamping arrangement |
| CN102916698A (zh) * | 2011-08-05 | 2013-02-06 | 奇景光电股份有限公司 | 箝位电路以及共模电压产生电路 |
| CN103475801A (zh) * | 2012-06-06 | 2013-12-25 | 比亚迪股份有限公司 | 一种信号箝位装置 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL206643A (enExample) * | 1955-04-29 | |||
| US2965705A (en) * | 1957-08-21 | 1960-12-20 | Rca Corp | Kinescope background control system |
| GB1027249A (en) * | 1963-10-08 | 1966-04-27 | Thorn Electronics Ltd | Improvements in voltage clamps |
| US3543169A (en) * | 1967-10-30 | 1970-11-24 | Bell Telephone Labor Inc | High speed clamping apparatus employing feedback from sample and hold circuit |
| US3651248A (en) * | 1969-01-11 | 1972-03-21 | Fernseh Gmbh | Black level clamping by color signal difference gated to storage during beam blocking |
| US3588341A (en) * | 1969-04-01 | 1971-06-28 | Motorola Inc | Automatic brightness control circuit for establishing the black level of signals in a television reciver |
| US3921205A (en) * | 1971-08-31 | 1975-11-18 | Matsushita Electric Industrial Co Ltd | D.c. controlled chroma circuit |
| US3885093A (en) * | 1972-04-03 | 1975-05-20 | Ampex | Fast acting direct current clamping circuit |
| JPS5754983B2 (enExample) * | 1974-04-19 | 1982-11-20 | ||
| JPS5111297U (enExample) * | 1974-07-12 | 1976-01-27 | ||
| GB1517041A (en) * | 1975-08-27 | 1978-07-05 | Rca Corp | Amplifier suitable for use as a colour kinescope driver |
| US3959811A (en) * | 1975-05-23 | 1976-05-25 | Rca Corporation | Set-up arrangement for a color television receiver |
| US4044375A (en) * | 1976-08-19 | 1977-08-23 | Rca Corporation | Brightness control apparatus |
| US4059838A (en) * | 1976-09-24 | 1977-11-22 | General Electric Company | Chroma-preference control for VIR automatic operation |
| US4122492A (en) * | 1977-01-28 | 1978-10-24 | Ampex Corporation | DC restoration utilizing the color burst signal |
| US4110787A (en) * | 1977-07-28 | 1978-08-29 | Rca Corporation | Combined blanking level and kinescope bias clamp for a television signal processing system |
-
1977
- 1977-05-05 US US05/794,128 patent/US4197557A/en not_active Expired - Lifetime
-
1978
- 1978-04-28 AU AU35549/78A patent/AU520236B2/en not_active Expired
- 1978-04-28 SE SE7804892A patent/SE443272B/sv not_active IP Right Cessation
- 1978-04-28 FI FI781331A patent/FI65880C/fi not_active IP Right Cessation
- 1978-05-02 GB GB17211/78A patent/GB1601304A/en not_active Expired
- 1978-05-03 FR FR7813185A patent/FR2390064B1/fr not_active Expired
- 1978-05-03 CA CA302,551A patent/CA1110758A/en not_active Expired
- 1978-05-03 DK DK194478A patent/DK147250C/da not_active IP Right Cessation
- 1978-05-03 NL NLAANVRAGE7804804,A patent/NL188829C/xx not_active IP Right Cessation
- 1978-05-04 IT IT23029/78A patent/IT1096078B/it active
- 1978-05-04 MX MX173344A patent/MX144734A/es unknown
- 1978-05-04 JP JP5365178A patent/JPS53138225A/ja active Granted
- 1978-05-05 AT AT0328378A patent/AT382992B/de not_active IP Right Cessation
- 1978-05-05 PL PL1978206618A patent/PL117772B1/pl unknown
- 1978-05-05 ES ES469495A patent/ES469495A1/es not_active Expired
- 1978-05-05 BE BE187438A patent/BE866754A/xx not_active IP Right Cessation
-
1987
- 1987-03-19 HK HK244/87A patent/HK24487A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK194478A (da) | 1978-11-06 |
| NL188829B (nl) | 1992-05-06 |
| SE443272B (sv) | 1986-02-17 |
| DK147250B (da) | 1984-05-21 |
| HK24487A (en) | 1987-03-27 |
| FI781331A7 (fi) | 1978-11-06 |
| FR2390064B1 (enExample) | 1985-03-01 |
| GB1601304A (en) | 1981-10-28 |
| MX144734A (es) | 1981-11-18 |
| IT7823029A0 (it) | 1978-05-04 |
| PL206618A1 (pl) | 1979-03-26 |
| AU3554978A (en) | 1979-11-01 |
| SE7804892L (sv) | 1978-11-06 |
| JPS53138225A (en) | 1978-12-02 |
| US4197557A (en) | 1980-04-08 |
| DK147250C (da) | 1984-11-12 |
| FR2390064A1 (enExample) | 1978-12-01 |
| ATA328378A (de) | 1986-09-15 |
| NL7804804A (nl) | 1978-11-07 |
| AU520236B2 (en) | 1982-01-21 |
| IT1096078B (it) | 1985-08-17 |
| FI65880C (fi) | 1984-07-10 |
| BE866754A (fr) | 1978-09-01 |
| PL117772B1 (en) | 1981-08-31 |
| FI65880B (fi) | 1984-03-30 |
| ES469495A1 (es) | 1979-03-16 |
| NL188829C (nl) | 1992-10-01 |
| AT382992B (de) | 1987-05-11 |
| JPS6247034B2 (enExample) | 1987-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1110758A (en) | Brightness control circuit employing a closed control loop | |
| US4143398A (en) | Automatic brightness control circuit employing a closed control loop stabilized against disruption by large amplitude video signals | |
| US4516152A (en) | Video signal processor with automatic kinescope white balance and beam current limiter control systems | |
| US4599642A (en) | Video signal processor with bias error compensation | |
| GB1586092A (en) | Brightness control apparatus | |
| US4209808A (en) | Stabilized automatic brightness control network in a video signal processing system including an automatic kinescope beam current limiter | |
| US4203131A (en) | Predictable automatic brightness control circuit in a video signal image reproducing system | |
| US4135200A (en) | Brightness control circuit with predictable brightness control range | |
| US4067048A (en) | Automatic beam current limiter | |
| US4121252A (en) | Automatic brightness limiter circuit | |
| US4554578A (en) | Error compensated control system in a video signal processor | |
| FI76465C (fi) | Signalbehandlingsanordning. | |
| FI73559C (fi) | Avbrottskompenserad automatisk straolstroembegraensare foer ett bildroer. | |
| US4204221A (en) | Predictably biased kinescope driver arrangement in a video signal processing system | |
| US4489344A (en) | Signal processing unit | |
| US5410222A (en) | Sample pulse generator for automatic kinescope bias system | |
| US4484226A (en) | Automatic kinescope bias control system compensated for kinescope electron gun conduction dissimilarities | |
| CA1127290A (en) | Gated automatic beam current limiter in a video signal processing system | |
| US4183047A (en) | Chroma level stabilizer | |
| EP0641122B1 (en) | Automatic kinescope bias apparatus with hot start flash prevention | |
| CA1219352A (en) | Dc stabilization system | |
| GB2035019A (en) | Kinescope beam current limiter | |
| CA1219353A (en) | Video signal processor with bias error compensation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |