CA1103275A - Process for controlling the catalytic cooligomerisation of 1,3-dienes with schiff's bases - Google Patents
Process for controlling the catalytic cooligomerisation of 1,3-dienes with schiff's basesInfo
- Publication number
- CA1103275A CA1103275A CA284,931A CA284931A CA1103275A CA 1103275 A CA1103275 A CA 1103275A CA 284931 A CA284931 A CA 284931A CA 1103275 A CA1103275 A CA 1103275A
- Authority
- CA
- Canada
- Prior art keywords
- propylamine
- phosphane
- alkyl
- weakly
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 20
- 230000003197 catalytic effect Effects 0.000 title abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- 150000001412 amines Chemical class 0.000 claims abstract description 9
- 239000001257 hydrogen Substances 0.000 claims abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims abstract description 6
- LLVWLCAZSOLOTF-UHFFFAOYSA-N 1-methyl-4-[1,4,4-tris(4-methylphenyl)buta-1,3-dienyl]benzene Chemical compound C1=CC(C)=CC=C1C(C=1C=CC(C)=CC=1)=CC=C(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 LLVWLCAZSOLOTF-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims description 20
- -1 H-acid compound Chemical class 0.000 claims description 19
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 18
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 229910000064 phosphane Inorganic materials 0.000 claims description 6
- 229910052759 nickel Inorganic materials 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 claims description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- 239000005922 Phosphane Substances 0.000 claims description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 3
- 235000011054 acetic acid Nutrition 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- XRIVNKJCNCNGFU-UHFFFAOYSA-N phenyl(propan-2-yl)phosphane Chemical compound CC(C)PC1=CC=CC=C1 XRIVNKJCNCNGFU-UHFFFAOYSA-N 0.000 claims description 3
- 150000003335 secondary amines Chemical class 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000001361 adipic acid Substances 0.000 claims description 2
- 235000011037 adipic acid Nutrition 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 2
- WDIIYWASEVHBBT-UHFFFAOYSA-N di(propan-2-yl)phosphane Chemical compound CC(C)PC(C)C WDIIYWASEVHBBT-UHFFFAOYSA-N 0.000 claims description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 claims description 2
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 claims description 2
- RPGWZZNNEUHDAQ-UHFFFAOYSA-N phenylphosphine Chemical compound PC1=CC=CC=C1 RPGWZZNNEUHDAQ-UHFFFAOYSA-N 0.000 claims description 2
- 235000019260 propionic acid Nutrition 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 2
- 239000002262 Schiff base Substances 0.000 claims 1
- 150000004753 Schiff bases Chemical class 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 150000005215 alkyl ethers Chemical group 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- ZBCKWHYWPLHBOK-UHFFFAOYSA-N cyclohexylphosphane Chemical compound PC1CCCCC1 ZBCKWHYWPLHBOK-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 150000005840 aryl radicals Chemical class 0.000 abstract description 3
- 125000000524 functional group Chemical group 0.000 abstract description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 76
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 54
- 238000006243 chemical reaction Methods 0.000 description 37
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 34
- 241000155250 Iole Species 0.000 description 28
- DFROALYLRQTARX-UHFFFAOYSA-N 1-phenyl-n-propylmethanimine Chemical compound CCCN=CC1=CC=CC=C1 DFROALYLRQTARX-UHFFFAOYSA-N 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 16
- JRTIUDXYIUKIIE-UHFFFAOYSA-N cycloocta-1,5-diene;nickel Chemical compound [Ni].C1CC=CCCC=C1.C1CC=CCCC=C1 JRTIUDXYIUKIIE-UHFFFAOYSA-N 0.000 description 15
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 238000001228 spectrum Methods 0.000 description 7
- 238000002329 infrared spectrum Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- IADUISXJUXDNFB-UHFFFAOYSA-N n-butyl-1-phenylmethanimine Chemical compound CCCCN=CC1=CC=CC=C1 IADUISXJUXDNFB-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 5
- 239000004912 1,5-cyclooctadiene Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- OFNOEPCYYDGJFC-UHFFFAOYSA-N 1-phenyl-n-propylnona-3,6,8-trien-1-amine Chemical compound C=CC=CCC=CCC(NCCC)C1=CC=CC=C1 OFNOEPCYYDGJFC-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- LYSGIJUGUGJIPS-ONEGZZNKSA-N cucurbic acid Chemical compound CC\C=C\CC1C(O)CCC1CC(O)=O LYSGIJUGUGJIPS-ONEGZZNKSA-N 0.000 description 3
- 150000001993 dienes Chemical class 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- PDWIZOPOIRSYIG-UHFFFAOYSA-N n-propylbutan-1-imine Chemical compound CCCC=NCCC PDWIZOPOIRSYIG-UHFFFAOYSA-N 0.000 description 3
- SIJQHZADOOBQMG-UHFFFAOYSA-N n-propylcyclohexanimine Chemical compound CCCN=C1CCCCC1 SIJQHZADOOBQMG-UHFFFAOYSA-N 0.000 description 3
- 150000003002 phosphanes Chemical class 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 2
- GVDZNWFGNHAZCX-UHFFFAOYSA-N 1-phenyl-n-propan-2-ylmethanimine Chemical compound CC(C)N=CC1=CC=CC=C1 GVDZNWFGNHAZCX-UHFFFAOYSA-N 0.000 description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- VKVYGFACNCQJGG-UHFFFAOYSA-N 9-phenyldodeca-2,6,9-trien-1-amine Chemical compound NCC=CCCC=CCC(=CCC)C1=CC=CC=C1 VKVYGFACNCQJGG-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 150000005671 trienes Chemical class 0.000 description 2
- JRTIUDXYIUKIIE-KZUMESAESA-N (1z,5z)-cycloocta-1,5-diene;nickel Chemical compound [Ni].C\1C\C=C/CC\C=C/1.C\1C\C=C/CC\C=C/1 JRTIUDXYIUKIIE-KZUMESAESA-N 0.000 description 1
- NDRUXLROLQGDNL-VOTSOKGWSA-N (3e)-5-methylhepta-1,3,6-triene Chemical compound C=CC(C)\C=C\C=C NDRUXLROLQGDNL-VOTSOKGWSA-N 0.000 description 1
- CLNYHERYALISIR-FNORWQNLSA-N (3e)-nona-1,3-diene Chemical compound CCCCC\C=C\C=C CLNYHERYALISIR-FNORWQNLSA-N 0.000 description 1
- PKHBEGZTQNOZLP-YDFGWWAZSA-N (3e,6e)-octa-1,3,6-triene Chemical compound C\C=C\C\C=C\C=C PKHBEGZTQNOZLP-YDFGWWAZSA-N 0.000 description 1
- IGYDQECKHCJCRP-SOFGYWHQSA-N (6e)-nona-1,6-diene Chemical compound CC\C=C\CCCC=C IGYDQECKHCJCRP-SOFGYWHQSA-N 0.000 description 1
- VYXHVRARDIDEHS-UHFFFAOYSA-N 1,5-cyclooctadiene Chemical compound C1CC=CCCC=C1 VYXHVRARDIDEHS-UHFFFAOYSA-N 0.000 description 1
- VSHOSNZTEKIDCG-UHFFFAOYSA-N 1-octa-2,5,7-trienyl-n-propylcyclohexan-1-amine Chemical compound C=CC=CCC=CCC1(NCCC)CCCCC1 VSHOSNZTEKIDCG-UHFFFAOYSA-N 0.000 description 1
- BBDKZWKEPDTENS-UHFFFAOYSA-N 4-Vinylcyclohexene Chemical compound C=CC1CCC=CC1 BBDKZWKEPDTENS-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical class OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- XECJFFQPLRTMNU-UHFFFAOYSA-N 9-phenyldodeca-1,6,9-trien-1-amine Chemical compound NC=CCCCC=CCC(=CCC)C1=CC=CC=C1 XECJFFQPLRTMNU-UHFFFAOYSA-N 0.000 description 1
- DQQIIGBVJURKJN-UHFFFAOYSA-N 9-phenylnona-1,6-dien-1-amine Chemical compound NC=CCCCC=CCCC1=CC=CC=C1 DQQIIGBVJURKJN-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- 101100188556 Arabidopsis thaliana OCT7 gene Proteins 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 101000654316 Centruroides limpidus Beta-toxin Cll2 Proteins 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 241001163743 Perlodes Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 238000001237 Raman spectrum Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- PHTAQVMXYWFMHF-QVPNGJTFSA-N alpha-L-Fucp-(1->2)-beta-D-Galp-(1->4)-beta-D-GlcpNAc Chemical compound O[C@H]1[C@H](O)[C@H](O)[C@H](C)O[C@H]1O[C@H]1[C@H](O[C@@H]2[C@H](O[C@@H](O)[C@H](NC(C)=O)[C@H]2O)CO)O[C@H](CO)[C@H](O)[C@@H]1O PHTAQVMXYWFMHF-QVPNGJTFSA-N 0.000 description 1
- 229910000091 aluminium hydride Inorganic materials 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 101150084411 crn1 gene Proteins 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- ZOLLIQAKMYWTBR-RYMQXAEESA-N cyclododecatriene Chemical group C/1C\C=C\CC\C=C/CC\C=C\1 ZOLLIQAKMYWTBR-RYMQXAEESA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 230000000249 desinfective effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- STSXGCQYQZEDJS-UHFFFAOYSA-N n-(2,2-dimethylpropyl)-1-phenylmethanimine Chemical compound CC(C)(C)CN=CC1=CC=CC=C1 STSXGCQYQZEDJS-UHFFFAOYSA-N 0.000 description 1
- YVRZTGFPEFORDX-UHFFFAOYSA-N n-(9-phenylnona-1,6-dienyl)propan-1-imine Chemical compound CCC=NC=CCCCC=CCCC1=CC=CC=C1 YVRZTGFPEFORDX-UHFFFAOYSA-N 0.000 description 1
- IXEGSTUUYSHYCN-UHFFFAOYSA-N n-(benzylideneamino)-n-methylmethanamine Chemical compound CN(C)N=CC1=CC=CC=C1 IXEGSTUUYSHYCN-UHFFFAOYSA-N 0.000 description 1
- QKSQEJXIILKPDX-UHFFFAOYSA-N n-cyclohexyl-1-phenylmethanimine Chemical compound C1CCCCC1N=CC1=CC=CC=C1 QKSQEJXIILKPDX-UHFFFAOYSA-N 0.000 description 1
- UCJOAMOXKLJGST-UHFFFAOYSA-N n-propan-2-ylpropan-2-imine Chemical compound CC(C)N=C(C)C UCJOAMOXKLJGST-UHFFFAOYSA-N 0.000 description 1
- VBECEHWBGZQBPC-UHFFFAOYSA-N n-propyldodeca-6,9,11-trien-4-amine Chemical compound CCCNC(CCC)CC=CCC=CC=C VBECEHWBGZQBPC-UHFFFAOYSA-N 0.000 description 1
- XAYLQOQHXQQQDK-UHFFFAOYSA-N n-propylnonan-5-imine Chemical compound CCCCC(CCCC)=NCCC XAYLQOQHXQQQDK-UHFFFAOYSA-N 0.000 description 1
- VLCDNHYJKMXHFI-UHFFFAOYSA-N nickel triphenylphosphane Chemical compound [Ni].[Ni].C1(=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1(=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1(=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1(=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 VLCDNHYJKMXHFI-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/40—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton with quaternised nitrogen atoms bound to carbon atoms of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymerisation Methods In General (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP2638430.5 | 1976-08-26 | ||
| DE2638430A DE2638430C3 (de) | 1976-08-26 | 1976-08-26 | Verfahren zur Herstellung von octatrienylierten Aminen bzw. von octadienylierten Schiffschen Basen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1103275A true CA1103275A (en) | 1981-06-16 |
Family
ID=5986424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA284,931A Expired CA1103275A (en) | 1976-08-26 | 1977-08-17 | Process for controlling the catalytic cooligomerisation of 1,3-dienes with schiff's bases |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4163024A (enExample) |
| JP (1) | JPS5340704A (enExample) |
| BE (1) | BE858030A (enExample) |
| CA (1) | CA1103275A (enExample) |
| CH (1) | CH636841A5 (enExample) |
| DE (1) | DE2638430C3 (enExample) |
| DK (1) | DK380677A (enExample) |
| FR (1) | FR2362821A1 (enExample) |
| GB (1) | GB1588529A (enExample) |
| IE (1) | IE45867B1 (enExample) |
| IT (1) | IT1114647B (enExample) |
| LU (1) | LU78017A1 (enExample) |
| NL (1) | NL7708371A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR101735687B1 (ko) * | 2015-09-23 | 2017-05-15 | 롯데케미칼 주식회사 | 올레핀 올리고머화용 촉매계 및 이를 이용한 올레핀 올리고머화 방법 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE881511C (de) | 1950-09-12 | 1953-06-29 | Ici Ltd | Verfahren zur Herstellung von Cycloolefinen mit mindestens 8 Kohlenstoffatomen im Ring |
| US2686209A (en) * | 1951-11-19 | 1954-08-10 | Ici Ltd | Production of cyclo-olefinic compounds |
| NL259358A (enExample) | 1959-12-22 | |||
| NL266664A (enExample) | 1960-07-07 | 1900-01-01 | ||
| NL269458A (enExample) | 1960-09-21 | 1900-01-01 | ||
| NL282845A (enExample) | 1962-06-09 | |||
| DE1493221A1 (de) | 1965-09-29 | 1969-05-14 | Studiengesellschaft Kohle Mbh | Substituierte 8-,10- und 12-Ringe und Verfahren zu ihrer Herstellung durch katalytische Co-Oligomerisation von ungesaettigten Verbindungen |
| GB1483857A (en) * | 1974-02-22 | 1977-08-24 | Ciba Geigy Ag | Nonylamines and their use as disinfectants |
-
1976
- 1976-08-26 DE DE2638430A patent/DE2638430C3/de not_active Expired
-
1977
- 1977-07-12 CH CH862977A patent/CH636841A5/de not_active IP Right Cessation
- 1977-07-28 NL NL7708371A patent/NL7708371A/xx not_active Application Discontinuation
- 1977-08-01 US US05/820,962 patent/US4163024A/en not_active Expired - Lifetime
- 1977-08-17 CA CA284,931A patent/CA1103275A/en not_active Expired
- 1977-08-22 GB GB35114/77A patent/GB1588529A/en not_active Expired
- 1977-08-23 BE BE180367A patent/BE858030A/xx not_active IP Right Cessation
- 1977-08-23 FR FR7725732A patent/FR2362821A1/fr active Granted
- 1977-08-24 LU LU78017A patent/LU78017A1/xx unknown
- 1977-08-24 IE IE1766/77A patent/IE45867B1/en unknown
- 1977-08-25 JP JP10216277A patent/JPS5340704A/ja active Granted
- 1977-08-26 IT IT26998/77A patent/IT1114647B/it active
- 1977-08-26 DK DK380677A patent/DK380677A/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE45867B1 (en) | 1982-12-15 |
| DK380677A (da) | 1978-02-27 |
| GB1588529A (en) | 1981-04-23 |
| IT1114647B (it) | 1986-01-27 |
| DE2638430B2 (de) | 1980-09-11 |
| BE858030A (fr) | 1977-12-16 |
| FR2362821A1 (fr) | 1978-03-24 |
| DE2638430A1 (de) | 1978-03-02 |
| LU78017A1 (enExample) | 1978-01-11 |
| DE2638430C3 (de) | 1981-04-23 |
| JPS6137259B2 (enExample) | 1986-08-22 |
| US4163024A (en) | 1979-07-31 |
| IE45867L (en) | 1978-02-26 |
| CH636841A5 (de) | 1983-06-30 |
| NL7708371A (nl) | 1978-02-28 |
| FR2362821B1 (enExample) | 1983-11-10 |
| JPS5340704A (en) | 1978-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Sodeoka et al. | New functions of (arene) tricarbonylchromium (0) complexes as hydrogenation catalysts: stereospecific semihydrogenation of alkynes and highly chemoselective hydrogenation of. alpha.,. beta.-unsaturated carbonyl compounds | |
| Cristau et al. | Synthesis of vinyl selenides or sulfides and ketene selenoacetals or thioacetals by nickel (II) vinylation of sodium benzeneselenolate or benzenethiolate | |
| Garcıa-Delgado et al. | Enantioselective addition of dimethylzinc to aldehydes: assessment of optimal N, N-substitution for 2-dialkylamino-1, 1, 2-triphenylethanol ligands | |
| Gold | Photolysis of. alpha.-N-alkylamidoacetophenones, a direct route to 3-azetidinols | |
| US3489786A (en) | Hydrogenation process | |
| US11453645B2 (en) | Process for producing substituted amino alcohols | |
| Pickard et al. | Ketimines. I. Alkyl-Aryl Type1 | |
| CA1103275A (en) | Process for controlling the catalytic cooligomerisation of 1,3-dienes with schiff's bases | |
| US2608583A (en) | Method for stereo-chemical equilibration of secondary carbinamines | |
| EP4294783B1 (en) | Hydrogenation of dienals or dienones with rhodium complexes under carbon monoxide free atmosphere | |
| Medjahdi et al. | Enantioselective synthesis of cis-and trans-2-methyl-6-nonylpiperidines: Alkaloids solenopsin and isosolenopsin | |
| RU1838317C (ru) | Способ получени силанового соединени | |
| De Kimpe et al. | Synthesis of secondary allylic amines | |
| GB1474316A (en) | O-aminoalkyl oximes | |
| US3794692A (en) | Process for the production of squalene-type-hydrocarbons | |
| US2421937A (en) | Production of imines | |
| HU225613B1 (en) | Method for producing optically active chrysantaemic acid | |
| Soderquist et al. | Trans alkenes and vinylsilanes from trans-α-stannyl epoxides | |
| LV12955B (en) | Method for the preparation of (e)-n-(6,6-dimethyl-2-hepten-4-ynyl)-n-methyl-1-naphthalenemethanamine (terbinafine) | |
| Hennion et al. | Sterically Crowded Amines. IV. Secondary and Tertiary Bispropargylic Amines and Their Hydrogenation Products1 | |
| US3271438A (en) | Production of polycyclic compounds | |
| Carroll et al. | Organic sulfur compounds. I. Synthesis of sec-Mercaptoalkylamine Hydrochlorides1a, b | |
| US3432498A (en) | Isomerization of acetylenic compounds to conjugated diolefins | |
| Hasek et al. | Ketenes. IX. Reactions of Ketenes with Various Substituted Enamines1 | |
| US4213901A (en) | 1-Aza-1,5,9-cyclododecatrienes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |