CA1099848A - Process for preparing high molecular weight polyether resins from bisphenols and epoxy resins - Google Patents
Process for preparing high molecular weight polyether resins from bisphenols and epoxy resinsInfo
- Publication number
- CA1099848A CA1099848A CA308,160A CA308160A CA1099848A CA 1099848 A CA1099848 A CA 1099848A CA 308160 A CA308160 A CA 308160A CA 1099848 A CA1099848 A CA 1099848A
- Authority
- CA
- Canada
- Prior art keywords
- bisphenol
- phenolic hydroxyl
- molecular weight
- reaction
- resins
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930185605 Bisphenol Natural products 0.000 title claims abstract description 17
- 239000003822 epoxy resin Substances 0.000 title claims abstract description 12
- 229920000647 polyepoxide Polymers 0.000 title claims abstract description 12
- 229920005989 resin Polymers 0.000 title claims abstract description 8
- 239000011347 resin Substances 0.000 title claims abstract description 8
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 4
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 title description 6
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 title description 4
- 239000004721 Polyphenylene oxide Substances 0.000 title description 2
- 229920000570 polyether Polymers 0.000 title description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims abstract description 29
- 238000000034 method Methods 0.000 claims abstract description 13
- 239000003054 catalyst Substances 0.000 claims abstract description 12
- 239000002904 solvent Substances 0.000 claims abstract description 11
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 claims abstract description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 238000000576 coating method Methods 0.000 abstract 1
- 230000000052 comparative effect Effects 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000002118 epoxides Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- XJPISZINQYKKLE-UHFFFAOYSA-L ethyl(triphenyl)phosphanium;diacetate Chemical compound CC([O-])=O.CC([O-])=O.C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1.C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 XJPISZINQYKKLE-UHFFFAOYSA-L 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Substances OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- -1 for example Chemical class 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- OZXIZRZFGJZWBF-UHFFFAOYSA-N 1,3,5-trimethyl-2-(2,4,6-trimethylphenoxy)benzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=C(C)C=C(C)C=C1C OZXIZRZFGJZWBF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- SRWLXBHGOYPTCM-UHFFFAOYSA-M acetic acid;ethyl(triphenyl)phosphanium;acetate Chemical compound CC(O)=O.CC([O-])=O.C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 SRWLXBHGOYPTCM-UHFFFAOYSA-M 0.000 description 1
- BZPUUPVCWNNZKW-UHFFFAOYSA-M acetic acid;tetrabutylphosphanium;acetate Chemical compound CC(O)=O.CC([O-])=O.CCCC[P+](CCCC)(CCCC)CCCC BZPUUPVCWNNZKW-UHFFFAOYSA-M 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- NJXBVBPTDHBAID-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 NJXBVBPTDHBAID-UHFFFAOYSA-M 0.000 description 1
- SLAFUPJSGFVWPP-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 SLAFUPJSGFVWPP-UHFFFAOYSA-M 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- SHOJXDKTYKFBRD-UHFFFAOYSA-N mesityl oxide Natural products CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- TWWBIMNLBUYJKB-UHFFFAOYSA-N phosphanyl acetate Chemical compound CC(=O)OP TWWBIMNLBUYJKB-UHFFFAOYSA-N 0.000 description 1
- 238000003918 potentiometric titration Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- BJQWBACJIAKDTJ-UHFFFAOYSA-N tetrabutylphosphanium Chemical compound CCCC[P+](CCCC)(CCCC)CCCC BJQWBACJIAKDTJ-UHFFFAOYSA-N 0.000 description 1
- CCIYPTIBRAUPLQ-UHFFFAOYSA-M tetrabutylphosphanium;iodide Chemical compound [I-].CCCC[P+](CCCC)(CCCC)CCCC CCIYPTIBRAUPLQ-UHFFFAOYSA-M 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/68—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used
- C08G59/688—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used containing phosphorus
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/62—Alcohols or phenols
- C08G59/621—Phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
- Polyethers (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/819,321 US4104257A (en) | 1977-07-27 | 1977-07-27 | Process for preparing high molecular weight polyether resins from bisphenols and epoxy resins |
| US819,321 | 1992-01-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1099848A true CA1099848A (en) | 1981-04-21 |
Family
ID=25227820
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA308,160A Expired CA1099848A (en) | 1977-07-27 | 1978-07-26 | Process for preparing high molecular weight polyether resins from bisphenols and epoxy resins |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4104257A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0000578B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5452200A (cg-RX-API-DMAC7.html) |
| AU (1) | AU527804B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR7804816A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1099848A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2862163D1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES472118A1 (cg-RX-API-DMAC7.html) |
| IT (1) | IT1105923B (cg-RX-API-DMAC7.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5624976A (en) * | 1994-03-25 | 1997-04-29 | Dentsply Gmbh | Dental filling composition and method |
| US5876210A (en) | 1994-04-22 | 1999-03-02 | Dentsply G.M.B.H. | Dental polymer product |
| US5998499A (en) | 1994-03-25 | 1999-12-07 | Dentsply G.M.B.H. | Liquid crystalline (meth)acrylate compounds, composition and method |
| US6353061B1 (en) | 1993-05-26 | 2002-03-05 | Dentsply Gmbh | α, ω-methacrylate terminated macromonomer compounds |
| US6369164B1 (en) | 1993-05-26 | 2002-04-09 | Dentsply G.M.B.H. | Polymerizable compounds and compositions |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1147741A (en) * | 1979-05-23 | 1983-06-07 | George A. Doorakian | Phosphonium phenoxide catalysts for promoting reaction of epoxides with phenols and/or carboxylic acids |
| IL65726A (en) * | 1982-05-10 | 1985-08-30 | Makhteshim Chem Works Ltd | Method for preparing flame retardant thermoplastic nylon resin compositions and the compositions obtained |
| US4438254A (en) * | 1983-02-28 | 1984-03-20 | The Dow Chemical Company | Process for producing epoxy resins |
| US4647648A (en) * | 1985-08-26 | 1987-03-03 | The Dow Chemical Company | Polyhydroxyethers from hydroxybiphenyls |
| US4756954A (en) * | 1986-01-22 | 1988-07-12 | The Dow Chemical Company | Epoxy resin laminating varnish and laminates prepared therefrom |
| US4727119A (en) * | 1986-09-15 | 1988-02-23 | The Dow Chemical Company | Halogenated epoxy resins |
| US4895755A (en) * | 1986-09-15 | 1990-01-23 | The Dow Chemical Company | Halogenated advanced epoxy resins |
| JP2742582B2 (ja) * | 1988-01-18 | 1998-04-22 | 阪本薬品工業株式会社 | 高分子量型難燃剤の製造方法 |
| JPH06153363A (ja) * | 1992-10-28 | 1994-05-31 | Nippon Densetsu Kogyo Kk | 昇降式コンセント |
| JPH06153364A (ja) * | 1992-10-28 | 1994-05-31 | Nippon Densetsu Kogyo Kk | 自動昇降式コンセント |
| JP3657720B2 (ja) * | 1996-12-11 | 2005-06-08 | ジャパンエポキシレジン株式会社 | 高分子エポキシ樹脂の製造方法 |
| US10458037B2 (en) * | 2015-10-27 | 2019-10-29 | Georgia Tech Research Corporation | Systems and methods for producing anti-wetting structures on metallic surfaces |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3277048A (en) * | 1961-01-16 | 1966-10-04 | Dow Chemical Co | Thermoplastic fire-retardant, highpolymer, epoxide resin composition |
| US3306872A (en) * | 1961-10-16 | 1967-02-28 | Shell Oil Co | Method for producing a polyether resin |
| FR1407306A (fr) * | 1963-07-17 | 1965-07-30 | Union Carbide Corp | Polyhydroxyéthers thermoplastiques halogénés à poids moléculaire élevé |
| US3379684A (en) * | 1964-04-29 | 1968-04-23 | Wiesner Ivo | Method of preparing high-molecular polyhydroxyethers |
| US3336257A (en) * | 1965-06-29 | 1967-08-15 | Celanese Coatings Co | High molecular weight thermoplastic resin from the polymerization of diphenols and diepoxides |
| US3477990A (en) * | 1967-12-07 | 1969-11-11 | Shell Oil Co | Process for reacting a phenol with an epoxy compound and resulting products |
| US3637590A (en) * | 1970-03-31 | 1972-01-25 | Russel L Maycock | Thermoplastic polyether resins of bisphenols |
| CA977896A (en) * | 1972-03-13 | 1975-11-11 | Patrick H. Martin | Process for coating substrates with high molecular weight epoxy resins |
| JPS5157745A (ja) * | 1974-11-18 | 1976-05-20 | Hitachi Chemical Co Ltd | Nannenseijushisoseibutsu |
| JPS5165200A (ja) * | 1974-12-04 | 1976-06-05 | Asahi Denka Kogyo Kk | Kobunshiryohorieeteruehokisaidono seizoho |
-
1977
- 1977-07-27 US US05/819,321 patent/US4104257A/en not_active Expired - Lifetime
-
1978
- 1978-07-25 EP EP78100495A patent/EP0000578B1/en not_active Expired
- 1978-07-25 DE DE7878100495T patent/DE2862163D1/de not_active Expired
- 1978-07-25 IT IT50456/78A patent/IT1105923B/it active
- 1978-07-25 AU AU38318/78A patent/AU527804B2/en not_active Expired
- 1978-07-26 CA CA308,160A patent/CA1099848A/en not_active Expired
- 1978-07-26 BR BR7804816A patent/BR7804816A/pt unknown
- 1978-07-27 ES ES472118A patent/ES472118A1/es not_active Expired
- 1978-07-27 JP JP9205978A patent/JPS5452200A/ja active Granted
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6339114B1 (en) | 1993-05-26 | 2002-01-15 | Dentsply Detrey Gmbh | Liquid crystalline (meth)acrylate compounds, composition and method |
| US6353061B1 (en) | 1993-05-26 | 2002-03-05 | Dentsply Gmbh | α, ω-methacrylate terminated macromonomer compounds |
| US6369164B1 (en) | 1993-05-26 | 2002-04-09 | Dentsply G.M.B.H. | Polymerizable compounds and compositions |
| US5624976A (en) * | 1994-03-25 | 1997-04-29 | Dentsply Gmbh | Dental filling composition and method |
| US5998499A (en) | 1994-03-25 | 1999-12-07 | Dentsply G.M.B.H. | Liquid crystalline (meth)acrylate compounds, composition and method |
| US5876210A (en) | 1994-04-22 | 1999-03-02 | Dentsply G.M.B.H. | Dental polymer product |
Also Published As
| Publication number | Publication date |
|---|---|
| US4104257A (en) | 1978-08-01 |
| ES472118A1 (es) | 1979-03-16 |
| EP0000578B1 (en) | 1983-01-26 |
| IT1105923B (it) | 1985-11-11 |
| JPS6142725B2 (cg-RX-API-DMAC7.html) | 1986-09-24 |
| DE2862163D1 (en) | 1983-03-03 |
| EP0000578A1 (en) | 1979-02-07 |
| BR7804816A (pt) | 1979-04-10 |
| AU3831878A (en) | 1980-01-31 |
| JPS5452200A (en) | 1979-04-24 |
| IT7850456A0 (it) | 1978-07-25 |
| AU527804B2 (en) | 1983-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1099848A (en) | Process for preparing high molecular weight polyether resins from bisphenols and epoxy resins | |
| EP1244644B1 (en) | Process for the elimination of materials containing hydrolyzable halides and other high molecular weight materials from epihalohydrin derived epoxy resins | |
| JPS62175477A (ja) | 2−オキソ−1、3−ジオキソランの製法 | |
| WO1982004257A1 (en) | Stable precatalyzed epoxy resin compositions | |
| JPS63221121A (ja) | エポキシ樹脂 | |
| EP0121260A2 (en) | A process for preparing epoxy resins from aliphatic hydroxyl-containing compounds | |
| NZ205522A (en) | Process for preparing glycidyl derivatives of compounds having at least one aromatic amine or hydroxy group | |
| EP0095609B1 (en) | Epoxy resins and process for preparing the same | |
| US4582892A (en) | Process for the preparation of epoxy resins | |
| US4358577A (en) | Method for preparing high molecular weight epoxy resins containing hydrolyzed epoxy groups | |
| EP0273520B1 (en) | A composition comprising a polyepoxide and a epoxy advancement catalyst, and a process for preparing advanced epoxy resins | |
| US4558116A (en) | Process for preparing relatively high molecular weight epoxy resins | |
| US4313886A (en) | Process for preparing liquid epoxy resins | |
| US4340713A (en) | Method for preparing high molecular weight epoxy resins containing hydrolyzed epoxy groups | |
| AU592153B2 (en) | Method for preparing advanced epoxy or phenoxy resins with low aliphatic halide content | |
| US4273921A (en) | Water-soluble epoxy resins and process for their preparation | |
| JPS60130580A (ja) | 新規グリシジル化合物及びその製造方法 | |
| GB1454345A (en) | Process for the manufacture of polyethers containing ionic bonds | |
| EP0610987B1 (en) | Process for the preparation of alpha-glycol-containing glycidyl ether resins | |
| EP0060904B1 (en) | A process for making vicinal epoxides and alkyl halides or alkylene dihalides from carbonate esters | |
| AU618146B2 (en) | Process for the manufacture of polyglycidylethers | |
| US4250100A (en) | Water-soluble epoxy resins and process for their preparation | |
| US4110354A (en) | Water-soluble epoxy resins and process for their preparation | |
| EP0065564B1 (en) | Method for preparing high molecular weight epoxy resins containing hydrolyzed glycidyl groups | |
| US4713404A (en) | Paint formulation comprising a thermally stable capped thermoplastic phenolic resin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |