CA1095802A - Cleansing composition - Google Patents
Cleansing compositionInfo
- Publication number
- CA1095802A CA1095802A CA293,410A CA293410A CA1095802A CA 1095802 A CA1095802 A CA 1095802A CA 293410 A CA293410 A CA 293410A CA 1095802 A CA1095802 A CA 1095802A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- fluoride
- clay
- hypochlorite
- present
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 126
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims abstract description 95
- 239000004927 clay Substances 0.000 claims abstract description 37
- 238000005341 cation exchange Methods 0.000 claims abstract description 12
- 150000004673 fluoride salts Chemical class 0.000 claims abstract description 8
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 26
- -1 hypochlorite ions Chemical class 0.000 claims description 21
- 239000004094 surface-active agent Substances 0.000 claims description 19
- 239000007844 bleaching agent Substances 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims description 11
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 159000000011 group IA salts Chemical class 0.000 claims description 9
- 229910021647 smectite Inorganic materials 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- 150000001768 cations Chemical class 0.000 claims description 8
- 239000002245 particle Substances 0.000 claims description 8
- 239000010451 perlite Substances 0.000 claims description 8
- 235000019362 perlite Nutrition 0.000 claims description 8
- 239000003082 abrasive agent Substances 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 230000005484 gravity Effects 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical class ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 239000011707 mineral Substances 0.000 claims description 5
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- 229910001515 alkali metal fluoride Inorganic materials 0.000 claims description 4
- 235000011180 diphosphates Nutrition 0.000 claims description 4
- 229910017053 inorganic salt Inorganic materials 0.000 claims description 4
- 239000012188 paraffin wax Substances 0.000 claims description 4
- 235000021317 phosphate Nutrition 0.000 claims description 4
- 150000003871 sulfonates Chemical class 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical class ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 claims description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 150000004760 silicates Chemical class 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims 1
- 239000011833 salt mixture Substances 0.000 claims 1
- JNLSTWIBJFIVHZ-UHFFFAOYSA-K trifluoroindigane Chemical class F[In](F)F JNLSTWIBJFIVHZ-UHFFFAOYSA-K 0.000 claims 1
- 229910052725 zinc Inorganic materials 0.000 claims 1
- 239000011701 zinc Substances 0.000 claims 1
- 238000002845 discoloration Methods 0.000 abstract description 5
- 239000000037 vitreous enamel Substances 0.000 abstract description 4
- 210000003298 dental enamel Anatomy 0.000 description 14
- 229940091249 fluoride supplement Drugs 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Inorganic materials [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 11
- 238000010186 staining Methods 0.000 description 11
- 239000007788 liquid Substances 0.000 description 8
- 238000004061 bleaching Methods 0.000 description 7
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Inorganic materials [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- 239000012530 fluid Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 6
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 230000009471 action Effects 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011775 sodium fluoride Substances 0.000 description 5
- 229960000414 sodium fluoride Drugs 0.000 description 5
- 235000013024 sodium fluoride Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 235000013162 Cocos nucifera Nutrition 0.000 description 4
- 244000060011 Cocos nucifera Species 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000005708 Sodium hypochlorite Substances 0.000 description 4
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000011698 potassium fluoride Substances 0.000 description 3
- 235000003270 potassium fluoride Nutrition 0.000 description 3
- ONQDVAFWWYYXHM-UHFFFAOYSA-M potassium lauryl sulfate Chemical compound [K+].CCCCCCCCCCCCOS([O-])(=O)=O ONQDVAFWWYYXHM-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000004576 sand Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- 230000008719 thickening Effects 0.000 description 3
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 3
- 235000019798 tripotassium phosphate Nutrition 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- HPTYUNKZVDYXLP-UHFFFAOYSA-N aluminum;trihydroxy(trihydroxysilyloxy)silane;hydrate Chemical compound O.[Al].[Al].O[Si](O)(O)O[Si](O)(O)O HPTYUNKZVDYXLP-UHFFFAOYSA-N 0.000 description 2
- 239000010839 body fluid Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 229910052621 halloysite Inorganic materials 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229940116985 potassium lauryl sulfate Drugs 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000008262 pumice Substances 0.000 description 2
- 229940048084 pyrophosphate Drugs 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000008234 soft water Substances 0.000 description 2
- 230000009974 thixotropic effect Effects 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 2
- 235000019801 trisodium phosphate Nutrition 0.000 description 2
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- RMSOEGBYNWXXBG-UHFFFAOYSA-N 1-chloronaphthalen-2-ol Chemical compound C1=CC=CC2=C(Cl)C(O)=CC=C21 RMSOEGBYNWXXBG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 241000276489 Merlangius merlangus Species 0.000 description 1
- FUVGZDDOHNQZEO-UHFFFAOYSA-N NS(=O)(=O)NCl Chemical compound NS(=O)(=O)NCl FUVGZDDOHNQZEO-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- VDQQXEISLMTGAB-UHFFFAOYSA-N chloramine T Chemical compound [Na+].CC1=CC=C(S(=O)(=O)[N-]Cl)C=C1 VDQQXEISLMTGAB-UHFFFAOYSA-N 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- CRPOUZQWHJYTMS-UHFFFAOYSA-N dialuminum;magnesium;disilicate Chemical compound [Mg+2].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] CRPOUZQWHJYTMS-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- CDMADVZSLOHIFP-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane;decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 CDMADVZSLOHIFP-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- STNGULMWFPMOCE-UHFFFAOYSA-N ethyl 4-butyl-3,5-dimethyl-1h-pyrrole-2-carboxylate Chemical compound CCCCC1=C(C)NC(C(=O)OCC)=C1C STNGULMWFPMOCE-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- LPTIRUACFKQDHZ-UHFFFAOYSA-N hexadecyl sulfate;hydron Chemical compound CCCCCCCCCCCCCCCCOS(O)(=O)=O LPTIRUACFKQDHZ-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical group ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 229910052900 illite Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 150000002611 lead compounds Chemical class 0.000 description 1
- RVPVRDXYQKGNMQ-UHFFFAOYSA-N lead(2+) Chemical compound [Pb+2] RVPVRDXYQKGNMQ-UHFFFAOYSA-N 0.000 description 1
- YZQBYALVHAANGI-UHFFFAOYSA-N magnesium;dihypochlorite Chemical compound [Mg+2].Cl[O-].Cl[O-] YZQBYALVHAANGI-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ARGDYOIRHYLIMT-UHFFFAOYSA-N n,n-dichloro-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N(Cl)Cl)C=C1 ARGDYOIRHYLIMT-UHFFFAOYSA-N 0.000 description 1
- PJBJJXCZRAHMCK-UHFFFAOYSA-N n,n-dichlorobenzenesulfonamide Chemical compound ClN(Cl)S(=O)(=O)C1=CC=CC=C1 PJBJJXCZRAHMCK-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- VGIBGUSAECPPNB-UHFFFAOYSA-L nonaaluminum;magnesium;tripotassium;1,3-dioxido-2,4,5-trioxa-1,3-disilabicyclo[1.1.1]pentane;iron(2+);oxygen(2-);fluoride;hydroxide Chemical compound [OH-].[O-2].[O-2].[O-2].[O-2].[O-2].[F-].[Mg+2].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[K+].[K+].[K+].[Fe+2].O1[Si]2([O-])O[Si]1([O-])O2.O1[Si]2([O-])O[Si]1([O-])O2.O1[Si]2([O-])O[Si]1([O-])O2.O1[Si]2([O-])O[Si]1([O-])O2.O1[Si]2([O-])O[Si]1([O-])O2.O1[Si]2([O-])O[Si]1([O-])O2.O1[Si]2([O-])O[Si]1([O-])O2 VGIBGUSAECPPNB-UHFFFAOYSA-L 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 239000013618 particulate matter Substances 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- SATVIFGJTRRDQU-UHFFFAOYSA-N potassium hypochlorite Chemical compound [K+].Cl[O-] SATVIFGJTRRDQU-UHFFFAOYSA-N 0.000 description 1
- IFIDXBCRSWOUSB-UHFFFAOYSA-M potassium;1,5-dichloro-4,6-dioxo-1,3,5-triazin-2-olate Chemical compound [K+].ClN1C(=O)[N-]C(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-M 0.000 description 1
- JTXIPOLAHSBNJM-UHFFFAOYSA-M potassium;decyl sulfate Chemical compound [K+].CCCCCCCCCCOS([O-])(=O)=O JTXIPOLAHSBNJM-UHFFFAOYSA-M 0.000 description 1
- BLICYBQMZAINGS-UHFFFAOYSA-M potassium;octadecane-2-sulfonate Chemical compound [K+].CCCCCCCCCCCCCCCCC(C)S([O-])(=O)=O BLICYBQMZAINGS-UHFFFAOYSA-M 0.000 description 1
- PFMVLFSAAABWQD-UHFFFAOYSA-M potassium;octadecyl sulfate Chemical compound [K+].CCCCCCCCCCCCCCCCCCOS([O-])(=O)=O PFMVLFSAAABWQD-UHFFFAOYSA-M 0.000 description 1
- DQFWABVCOIFBPO-UHFFFAOYSA-M potassium;tetradecyl sulfate Chemical compound [K+].CCCCCCCCCCCCCCOS([O-])(=O)=O DQFWABVCOIFBPO-UHFFFAOYSA-M 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 239000010458 rotten stone Substances 0.000 description 1
- 229910000275 saponite Inorganic materials 0.000 description 1
- 238000009991 scouring Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- MSFGZHUJTJBYFA-UHFFFAOYSA-M sodium dichloroisocyanurate Chemical compound [Na+].ClN1C(=O)[N-]C(=O)N(Cl)C1=O MSFGZHUJTJBYFA-UHFFFAOYSA-M 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- 229950005425 sodium myristyl sulfate Drugs 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- 235000019794 sodium silicate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- PYILKOIEIHHYGD-UHFFFAOYSA-M sodium;1,5-dichloro-4,6-dioxo-1,3,5-triazin-2-olate;dihydrate Chemical compound O.O.[Na+].[O-]C1=NC(=O)N(Cl)C(=O)N1Cl PYILKOIEIHHYGD-UHFFFAOYSA-M 0.000 description 1
- AIMUHNZKNFEZSN-UHFFFAOYSA-M sodium;decane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCS([O-])(=O)=O AIMUHNZKNFEZSN-UHFFFAOYSA-M 0.000 description 1
- XZTJQQLJJCXOLP-UHFFFAOYSA-M sodium;decyl sulfate Chemical compound [Na+].CCCCCCCCCCOS([O-])(=O)=O XZTJQQLJJCXOLP-UHFFFAOYSA-M 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- NWZBFJYXRGSRGD-UHFFFAOYSA-M sodium;octadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCCCOS([O-])(=O)=O NWZBFJYXRGSRGD-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- UPUIQOIQVMNQAP-UHFFFAOYSA-M sodium;tetradecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O UPUIQOIQVMNQAP-UHFFFAOYSA-M 0.000 description 1
- HORYMJBELMKQJH-UHFFFAOYSA-M sodium;tridecane-2-sulfonate Chemical compound [Na+].CCCCCCCCCCCC(C)S([O-])(=O)=O HORYMJBELMKQJH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229960002799 stannous fluoride Drugs 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- ASTWEMOBIXQPPV-UHFFFAOYSA-K trisodium;phosphate;dodecahydrate Chemical class O.O.O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[O-]P([O-])([O-])=O ASTWEMOBIXQPPV-UHFFFAOYSA-K 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/395—Bleaching agents
- C11D3/3956—Liquid compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/046—Salts
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
- C11D3/1266—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite in liquid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US753,070 | 1976-12-21 | ||
| US05/753,070 US4051055A (en) | 1976-12-21 | 1976-12-21 | Cleansing compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1095802A true CA1095802A (en) | 1981-02-17 |
Family
ID=25029025
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA293,410A Expired CA1095802A (en) | 1976-12-21 | 1977-12-19 | Cleansing composition |
Country Status (8)
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4235732A (en) * | 1978-02-08 | 1980-11-25 | The Procter & Gamble Company | Liquid bleaching compositions |
| US4248728A (en) * | 1979-02-28 | 1981-02-03 | Chemed Corporation | Liquid scouring cleanser |
| US4228048A (en) * | 1979-05-25 | 1980-10-14 | Chemed Corporation | Foam cleaner for food plants |
| NL7908798A (nl) * | 1979-12-05 | 1981-07-01 | Unilever Nv | Vloeibaar, verdikt chloorbleekmiddel. |
| US4264466A (en) * | 1980-02-14 | 1981-04-28 | The Procter & Gamble Company | Mulls containing chain structure clay suspension aids |
| US4302253A (en) * | 1980-02-19 | 1981-11-24 | R. T. Vanderbilt Company, Inc. | Thickeners for acid cleaning compositions |
| EP0038100B1 (en) * | 1980-04-11 | 1984-04-11 | Unilever N.V. | Machine dishwashing composition |
| US4287079A (en) * | 1980-06-02 | 1981-09-01 | Purex Corporation | Liquid cleanser formula |
| DE3138425A1 (de) * | 1981-09-26 | 1983-04-14 | Henkel KGaA, 4000 Düsseldorf | "verwendung eines pastoesen reinigers in geschirrspuelmaschinen" |
| DE3246080A1 (de) * | 1982-12-13 | 1984-06-14 | Henkel KGaA, 4000 Düsseldorf | Reinigungsverfahren |
| GB8328076D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| GB8328078D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| JPS6096773A (ja) * | 1983-10-31 | 1985-05-30 | Nippon Parkerizing Co Ltd | アルミニウム合金の化成処理の前処理方法 |
| US4599186A (en) * | 1984-04-20 | 1986-07-08 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4657692A (en) * | 1984-04-20 | 1987-04-14 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| NZ212921A (en) * | 1984-08-13 | 1988-06-30 | Colgate Palmolive Co | Process for the manufacture of thixotropic detergent compositions |
| GB8504862D0 (en) * | 1985-02-26 | 1985-03-27 | Unilever Plc | Liquid detergent composition |
| US5213705A (en) * | 1985-04-30 | 1993-05-25 | Ecolab Inc. | Encapsulated halogen bleaches and methods of preparation and use |
| US4784788A (en) * | 1985-12-14 | 1988-11-15 | Colgate-Palmolive Co. | Cleaning paste with soluble abrasive |
| NZ218730A (en) * | 1986-01-03 | 1990-04-26 | Bristol Myers Co | Bleaching composition including thickening agent |
| JPS62285999A (ja) * | 1986-06-02 | 1987-12-11 | マツダ株式会社 | 塗膜上のカビ除去剤 |
| US4772414A (en) * | 1986-07-24 | 1988-09-20 | Ppg Industries, Inc. | Bleaching composition |
| GB8711059D0 (en) * | 1987-05-11 | 1987-06-17 | Unilever Plc | Detergent liquid |
| US4943429A (en) * | 1988-05-23 | 1990-07-24 | Church & Dwight Co., Inc. | Dentifrice gels containing sodium bicarbonate |
| WO1990010095A1 (en) * | 1989-02-24 | 1990-09-07 | Itc Uniadvice Limited | Polymeric coating compositions for corrosion protection |
| WO1994015577A1 (de) * | 1993-01-14 | 1994-07-21 | Hawe Neos Dental Dr. H. V. Weissenfluh Ag | Zahnpasta |
| US5612305A (en) * | 1995-01-12 | 1997-03-18 | Huntsman Petrochemical Corporation | Mixed surfactant systems for low foam applications |
| GB2305434B (en) * | 1995-09-19 | 1999-03-10 | Reckitt & Colmann Sa | Abrasive cleaning composition |
| DE19646520A1 (de) * | 1996-11-12 | 1998-05-14 | Henkel Kgaa | Geschirrspülmittel mit verstärkter Reinigungswirkung |
| PL197860B1 (pl) * | 1999-06-04 | 2008-05-30 | Unilever Nv | Doustna kompozycja do czyszczenia zębów zawierająca perlit |
| US6281169B1 (en) * | 1999-07-29 | 2001-08-28 | Biolab Services, Inc. | Aqueous suspensions of low solubility and low stability water additives |
| WO2001018167A1 (fr) * | 1999-09-03 | 2001-03-15 | Settsu Oil Mill., Ltd. | Composition de blanchiment |
| US20040101881A1 (en) * | 2002-02-01 | 2004-05-27 | Gerard Durmowicz | Surfactant/oxidizing agent solution and methods of use |
| US11452778B2 (en) | 2011-03-18 | 2022-09-27 | Urgo Us, Inc. | Stabilized hypohalous acid solutions |
| DK2685832T3 (da) | 2011-03-18 | 2019-08-12 | Realm Therapeutics Inc | Stabiliserede hypohalogensyreopløsninger |
| US9381214B2 (en) | 2011-03-18 | 2016-07-05 | Puricore, Inc. | Methods for treating skin irritation |
| US9657256B2 (en) * | 2015-09-14 | 2017-05-23 | Mega Products, Llc | Environmentally safe porcelain cleaning formulation, method and kit |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA685393A (en) * | 1964-04-28 | Colgate-Palmolive Company | Liquid abrasive cleanser containing alkali metal halide | |
| US1894207A (en) * | 1929-10-24 | 1933-01-10 | Mathieson Alkali Works Inc | Detergent composition |
| US2285676A (en) * | 1940-03-13 | 1942-06-09 | Blockson Chemical Co | Detergent composition |
| NL66550C (US20100223739A1-20100909-C00005.png) * | 1947-01-20 | |||
| NL6412998A (US20100223739A1-20100909-C00005.png) * | 1963-11-08 | 1965-05-10 | ||
| US3551338A (en) * | 1967-09-15 | 1970-12-29 | Lever Brothers Ltd | Prevention of discoloration of cloth |
| US3577347A (en) * | 1968-04-03 | 1971-05-04 | John Alexander Monick | Water-soluble scouring composition |
| US3630922A (en) * | 1968-06-03 | 1971-12-28 | Procter & Gamble | Liquid detergent composition |
| US3640878A (en) * | 1969-05-29 | 1972-02-08 | Colgate Palmolive Co | Alkaline detergent composition |
| US3629124A (en) * | 1969-08-27 | 1971-12-21 | Monsanto Co | Bleaching sterilizing disinfecting and deterging compositions |
| US3843543A (en) * | 1972-10-13 | 1974-10-22 | Colgate Palmolive Co | Soap curd dispersant |
| US4005027A (en) * | 1973-07-10 | 1977-01-25 | The Procter & Gamble Company | Scouring compositions |
| GB1495549A (en) * | 1974-04-17 | 1977-12-21 | Procter & Gamble | Scouring compositions |
-
1976
- 1976-12-21 US US05/753,070 patent/US4051055A/en not_active Expired - Lifetime
-
1977
- 1977-12-17 DE DE19772756414 patent/DE2756414A1/de not_active Withdrawn
- 1977-12-19 CA CA293,410A patent/CA1095802A/en not_active Expired
- 1977-12-20 GB GB52939/77A patent/GB1590744A/en not_active Expired
- 1977-12-20 FR FR7738507A patent/FR2375321A1/fr active Granted
- 1977-12-20 AU AU31779/77A patent/AU511950B2/en not_active Expired
- 1977-12-20 IT IT30951/77A patent/IT1089977B/it active
- 1977-12-21 JP JP15423677A patent/JPS53114808A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AU511950B2 (en) | 1980-09-11 |
| GB1590744A (en) | 1981-06-10 |
| JPS53114808A (en) | 1978-10-06 |
| US4051055A (en) | 1977-09-27 |
| FR2375321B1 (US20100223739A1-20100909-C00005.png) | 1982-06-18 |
| IT1089977B (it) | 1985-06-18 |
| AU3177977A (en) | 1979-06-28 |
| FR2375321A1 (fr) | 1978-07-21 |
| DE2756414A1 (de) | 1978-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1095802A (en) | Cleansing composition | |
| CA1120370A (en) | Liquid bleaching compositions | |
| CA1123700A (en) | Thixotropic abrasive liquid scouring composition | |
| CA2253337C (en) | Thickened abrasive-free cleaning composition containing a low concentration of calcium ions | |
| US4005027A (en) | Scouring compositions | |
| US4287080A (en) | Detergent compositions which contain certain tertiary alcohols | |
| CA2239586C (en) | Process for manufacturing bleaching compositions | |
| US4657692A (en) | Thickened aqueous abrasive scouring cleanser | |
| US3519569A (en) | Abrasive scouring cleanser | |
| US4289640A (en) | Cleaning compositions | |
| EP0206534A1 (en) | Thickened aqueous cleanser | |
| EP0811050B1 (en) | Method of cleaning drains utilizing foaming composition | |
| US5346641A (en) | Thickened aqueous abrasive cleanser with improved colloidal stability | |
| JPS593517B2 (ja) | 磨き剤組成物 | |
| NZ204916A (en) | Thixotropic,automatic dishwasher composition | |
| JPH023500A (ja) | 強化された長期の相安定性を有する濃厚化液状研磨クレンザー | |
| US4248728A (en) | Liquid scouring cleanser | |
| US4772414A (en) | Bleaching composition | |
| US5279755A (en) | Thickening aqueous abrasive cleaner with improved colloidal stability | |
| US3214380A (en) | Liquid scouring cleanser for removing organic stains from hard surfaces | |
| US3458446A (en) | Abrasive scouring cleanser | |
| US5298181A (en) | Thickened pourable aqueous abrasive cleanser | |
| GB2304113A (en) | Hard surface cleaner | |
| EP0271189B1 (en) | Aqueous acidic hard surface cleaner | |
| JP2987817B2 (ja) | 滴下可能で研磨性を有する濃縮洗剤水溶液 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |