CA1090808A - Herbicidally active 2-(dimethylcarbamoylimino)-1,3,4- thiadiazolin-3-carboxylic acid esters - Google Patents
Herbicidally active 2-(dimethylcarbamoylimino)-1,3,4- thiadiazolin-3-carboxylic acid estersInfo
- Publication number
- CA1090808A CA1090808A CA278,440A CA278440A CA1090808A CA 1090808 A CA1090808 A CA 1090808A CA 278440 A CA278440 A CA 278440A CA 1090808 A CA1090808 A CA 1090808A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- thiadiazolin
- dimethylcarbamoylimino
- carboxylic acid
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PNWXIVHAFKHCRF-UHFFFAOYSA-N 2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylic acid Chemical class CN(C(=O)N=C1SC=NN1C(=O)O)C PNWXIVHAFKHCRF-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 7
- 150000001875 compounds Chemical class 0.000 claims description 181
- 238000000034 method Methods 0.000 claims description 65
- 241000196324 Embryophyta Species 0.000 claims description 27
- -1 3-chloropropyl Chemical group 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 19
- 150000002148 esters Chemical class 0.000 claims description 15
- 150000002736 metal compounds Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000007800 oxidant agent Substances 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 7
- 230000002633 protecting effect Effects 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 239000002699 waste material Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- MKIZCXBFBRAUHT-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-ethylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCS(=O)(=O)C1=NN(C(=O)OC)C(=NC(=O)N(C)C)S1 MKIZCXBFBRAUHT-UHFFFAOYSA-N 0.000 claims description 3
- WFKJKLPLEWIXLO-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-propylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCS(=O)(=O)C1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 WFKJKLPLEWIXLO-UHFFFAOYSA-N 0.000 claims description 3
- NITRGUSNTHABMT-UHFFFAOYSA-N 2,2,2-trichloroethyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CSC1=NN(C(=O)OCC(Cl)(Cl)Cl)C(=NC(=O)N(C)C)S1 NITRGUSNTHABMT-UHFFFAOYSA-N 0.000 claims description 2
- WJWPGCWZJCWDCO-UHFFFAOYSA-N 2-methylpropyl 2-(dimethylcarbamoylimino)-5-hexylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCCCS(=O)(=O)C1=NN(C(=O)OCC(C)C)C(=NC(=O)N(C)C)S1 WJWPGCWZJCWDCO-UHFFFAOYSA-N 0.000 claims description 2
- PHGPCARYJWOZOV-UHFFFAOYSA-N 2-methylpropyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CSC1=NN(C(=O)OCC(C)C)C(=NC(=O)N(C)C)S1 PHGPCARYJWOZOV-UHFFFAOYSA-N 0.000 claims description 2
- AYLWYVAKWIUMPJ-UHFFFAOYSA-N 2-methylpropyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CC(C)COC(=O)N1N=C(S(C)(=O)=O)SC1=NC(=O)N(C)C AYLWYVAKWIUMPJ-UHFFFAOYSA-N 0.000 claims description 2
- 235000003276 Apios tuberosa Nutrition 0.000 claims description 2
- 244000105624 Arachis hypogaea Species 0.000 claims description 2
- 235000010777 Arachis hypogaea Nutrition 0.000 claims description 2
- 235000010744 Arachis villosulicarpa Nutrition 0.000 claims description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 claims description 2
- 244000068988 Glycine max Species 0.000 claims description 2
- 235000010469 Glycine max Nutrition 0.000 claims description 2
- 240000005979 Hordeum vulgare Species 0.000 claims description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 claims description 2
- 240000007594 Oryza sativa Species 0.000 claims description 2
- 235000007164 Oryza sativa Nutrition 0.000 claims description 2
- 240000004713 Pisum sativum Species 0.000 claims description 2
- 235000010582 Pisum sativum Nutrition 0.000 claims description 2
- 244000061456 Solanum tuberosum Species 0.000 claims description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 claims description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 claims description 2
- 235000021307 Triticum Nutrition 0.000 claims description 2
- 244000098338 Triticum aestivum Species 0.000 claims description 2
- 240000008042 Zea mays Species 0.000 claims description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- MNWBHFFKAXSNBL-UHFFFAOYSA-N benzyl 2-(dimethylcarbamoylimino)-5-ethylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C1=CC=CC=C1)OC(=O)N1C(SC(=N1)SCC)=NC(N(C)C)=O MNWBHFFKAXSNBL-UHFFFAOYSA-N 0.000 claims description 2
- ADEXXHUUUUVMRL-UHFFFAOYSA-N benzyl 2-(dimethylcarbamoylimino)-5-ethylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C1=CC=CC=C1)OC(=O)N1C(SC(=N1)S(=O)(=O)CC)=NC(N(C)C)=O ADEXXHUUUUVMRL-UHFFFAOYSA-N 0.000 claims description 2
- AFWVBPDRQSUBHX-UHFFFAOYSA-N benzyl 2-(dimethylcarbamoylimino)-5-pentylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C1=CC=CC=C1)OC(=O)N1C(SC(=N1)SCCCCC)=NC(N(C)C)=O AFWVBPDRQSUBHX-UHFFFAOYSA-N 0.000 claims description 2
- SYHNGBXGISEMEC-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCC(=C)C)=NC(N(C)C)=O SYHNGBXGISEMEC-UHFFFAOYSA-N 0.000 claims description 2
- PNODJTGTJSJWET-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-(2-methylpropylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCC(C)C)=NC(N(C)C)=O PNODJTGTJSJWET-UHFFFAOYSA-N 0.000 claims description 2
- VXHCZOQTDNVASO-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-(2-methylpropylsulfonyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)S(=O)(=O)CC(C)C)=NC(N(C)C)=O VXHCZOQTDNVASO-UHFFFAOYSA-N 0.000 claims description 2
- DOUXLYWKNBLYRU-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-hexylsulfinyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)S(=O)CCCCCC)=NC(N(C)C)=O DOUXLYWKNBLYRU-UHFFFAOYSA-N 0.000 claims description 2
- YFXPCVAXBXYKPG-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-hexylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)S(=O)(=O)CCCCCC)=NC(N(C)C)=O YFXPCVAXBXYKPG-UHFFFAOYSA-N 0.000 claims description 2
- ZSVHBDFRUWPVKA-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)S(=O)(=O)C)=NC(N(C)C)=O ZSVHBDFRUWPVKA-UHFFFAOYSA-N 0.000 claims description 2
- RUUBHXQXIINWNE-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-pentylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCCCCC)=NC(N(C)C)=O RUUBHXQXIINWNE-UHFFFAOYSA-N 0.000 claims description 2
- WOUZLXVBMOTPNP-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-prop-2-enylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCC=C)=NC(N(C)C)=O WOUZLXVBMOTPNP-UHFFFAOYSA-N 0.000 claims description 2
- HYCPJJSOQOUYMK-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SC(C)C)=NC(N(C)C)=O HYCPJJSOQOUYMK-UHFFFAOYSA-N 0.000 claims description 2
- FFYAKFBZVMKTCP-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)S(=O)(=O)C(C)C)=NC(N(C)C)=O FFYAKFBZVMKTCP-UHFFFAOYSA-N 0.000 claims description 2
- UOWTZMMMUSXJQB-UHFFFAOYSA-N butyl 5-but-2-enylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCC=CC)=NC(N(C)C)=O UOWTZMMMUSXJQB-UHFFFAOYSA-N 0.000 claims description 2
- ZKQACGNMTPDKJK-UHFFFAOYSA-N butyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCCCC)=NC(N(C)C)=O ZKQACGNMTPDKJK-UHFFFAOYSA-N 0.000 claims description 2
- MMZCPCKRLGYQJR-UHFFFAOYSA-N butyl 5-butylsulfonyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)S(=O)(=O)CCCC)=NC(N(C)C)=O MMZCPCKRLGYQJR-UHFFFAOYSA-N 0.000 claims description 2
- VWUWDLNNJGVACI-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)OC(=O)N1C(SC(=N1)SCC(=C)C)=NC(N(C)C)=O VWUWDLNNJGVACI-UHFFFAOYSA-N 0.000 claims description 2
- MESJFFQDKMUSPD-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfonyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)OC(=O)N1C(SC(=N1)S(=O)(=O)CC(=C)C)=NC(N(C)C)=O MESJFFQDKMUSPD-UHFFFAOYSA-N 0.000 claims description 2
- OVFGZYLIJLMMOS-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-ethylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)OC(=O)N1C(SC(=N1)SCC)=NC(N(C)C)=O OVFGZYLIJLMMOS-UHFFFAOYSA-N 0.000 claims description 2
- GFVQHFDOPMKUFO-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-ethylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCOC(=O)N1N=C(S(=O)(=O)CC)SC1=NC(=O)N(C)C GFVQHFDOPMKUFO-UHFFFAOYSA-N 0.000 claims description 2
- PQHUNICQRBELNW-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCOC(=O)N1N=C(SC)SC1=NC(=O)N(C)C PQHUNICQRBELNW-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- UMRWCJFXLYJWES-UHFFFAOYSA-N hexyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCCC)OC(=O)N1C(SC(=N1)SC)=NC(N(C)C)=O UMRWCJFXLYJWES-UHFFFAOYSA-N 0.000 claims description 2
- NTVSHVWZOIMQKA-UHFFFAOYSA-N hexyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCCC)OC(=O)N1C(SC(=N1)S(=O)(=O)C)=NC(N(C)C)=O NTVSHVWZOIMQKA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 235000009973 maize Nutrition 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- JWFKMJXJIRILME-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound COC(=O)N1N=C(SCC(C)=C)SC1=NC(=O)N(C)C JWFKMJXJIRILME-UHFFFAOYSA-N 0.000 claims description 2
- NRVLKXMRJGTGJC-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-ethylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCSC1=NN(C(=O)OC)C(=NC(=O)N(C)C)S1 NRVLKXMRJGTGJC-UHFFFAOYSA-N 0.000 claims description 2
- CPFFMIWOJNRVDE-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound COC(=O)N1N=C(SC)SC1=NC(=O)N(C)C CPFFMIWOJNRVDE-UHFFFAOYSA-N 0.000 claims description 2
- HOTXYOPRCDCSOP-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound COC(=O)N1N=C(S(C)(=O)=O)SC1=NC(=O)N(C)C HOTXYOPRCDCSOP-UHFFFAOYSA-N 0.000 claims description 2
- SPEDCIDJBOQOLU-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-propylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCSC1=NN(C(=O)OC)C(=NC(=O)N(C)C)S1 SPEDCIDJBOQOLU-UHFFFAOYSA-N 0.000 claims description 2
- YCHYQWHDEFAUDW-UHFFFAOYSA-N methyl 5-but-2-enylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound COC(=O)N1N=C(SCC=CC)SC1=NC(=O)N(C)C YCHYQWHDEFAUDW-UHFFFAOYSA-N 0.000 claims description 2
- UIOKUCVRQRCTOG-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-ethylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)SCC)=NC(N(C)C)=O UIOKUCVRQRCTOG-UHFFFAOYSA-N 0.000 claims description 2
- GCHJRLPOSBCUSO-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)S(=O)(=O)C)=NC(N(C)C)=O GCHJRLPOSBCUSO-UHFFFAOYSA-N 0.000 claims description 2
- WNRIXTZCYAFSJO-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)SC(C)C)=NC(N(C)C)=O WNRIXTZCYAFSJO-UHFFFAOYSA-N 0.000 claims description 2
- PRQHFEVGGQJMSK-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)S(=O)(=O)C(C)C)=NC(N(C)C)=O PRQHFEVGGQJMSK-UHFFFAOYSA-N 0.000 claims description 2
- NTVVQODQIKFJKZ-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-propylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)SCCC)=NC(N(C)C)=O NTVVQODQIKFJKZ-UHFFFAOYSA-N 0.000 claims description 2
- LTQMKJDPXAGXDG-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-propylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)S(=O)(=O)CCC)=NC(N(C)C)=O LTQMKJDPXAGXDG-UHFFFAOYSA-N 0.000 claims description 2
- NCAZTGMXEIWTHQ-UHFFFAOYSA-N phenyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CN(C)C(=O)N=C1SC(SC)=NN1C(=O)OC1=CC=CC=C1 NCAZTGMXEIWTHQ-UHFFFAOYSA-N 0.000 claims description 2
- QOADHLLGMURUNG-UHFFFAOYSA-N prop-2-enyl 2-(dimethylcarbamoylimino)-5-(2-methylpropylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound CC(C)CSC1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 QOADHLLGMURUNG-UHFFFAOYSA-N 0.000 claims description 2
- ABZMLLKVVODUGL-UHFFFAOYSA-N prop-2-enyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CN(C)C(=O)N=C1SC(S(C)(=O)=O)=NN1C(=O)OCC=C ABZMLLKVVODUGL-UHFFFAOYSA-N 0.000 claims description 2
- FILXGDSYXYDAMN-UHFFFAOYSA-N prop-2-enyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CC(C)S(=O)(=O)C1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 FILXGDSYXYDAMN-UHFFFAOYSA-N 0.000 claims description 2
- HACNBSYTQOAGBM-UHFFFAOYSA-N prop-2-enyl 5-but-2-enylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound CC=CCSC1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 HACNBSYTQOAGBM-UHFFFAOYSA-N 0.000 claims description 2
- PJKFBNHWQKHLJN-UHFFFAOYSA-N prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCSC1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 PJKFBNHWQKHLJN-UHFFFAOYSA-N 0.000 claims description 2
- MOBJZNWPENZOPN-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-(2-methylpropylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)SCC(C)C)=NC(N(C)C)=O MOBJZNWPENZOPN-UHFFFAOYSA-N 0.000 claims description 2
- SMRXPJJNPPOUAO-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-(2-methylpropylsulfonyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)S(=O)(=O)CC(C)C)=NC(N(C)C)=O SMRXPJJNPPOUAO-UHFFFAOYSA-N 0.000 claims description 2
- KLLHRFHBNKOWKE-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-ethylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)S(=O)(=O)CC)=NC(N(C)C)=O KLLHRFHBNKOWKE-UHFFFAOYSA-N 0.000 claims description 2
- UQWKOGSMEJVFJD-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)S(=O)(=O)C)=NC(N(C)C)=O UQWKOGSMEJVFJD-UHFFFAOYSA-N 0.000 claims description 2
- HVPAJZYCKDTFSO-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-pentylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)S(=O)(=O)CCCCC)=NC(N(C)C)=O HVPAJZYCKDTFSO-UHFFFAOYSA-N 0.000 claims description 2
- AFLGLGACODWYCU-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-ethylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCSC1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 AFLGLGACODWYCU-UHFFFAOYSA-N 0.000 claims description 2
- QLXVPURMCVSBFL-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-hexylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCCCS(=O)(=O)C1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 QLXVPURMCVSBFL-UHFFFAOYSA-N 0.000 claims description 2
- MPGDMWCVIWYLSI-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)(C)OC(=O)N1C(SC(=N1)S(=O)(=O)C)=NC(N(C)C)=O MPGDMWCVIWYLSI-UHFFFAOYSA-N 0.000 claims description 2
- HFMURDFBAPHSKY-UHFFFAOYSA-N propyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CC)OC(=O)N1C(SC(=N1)SCC(=C)C)=NC(N(C)C)=O HFMURDFBAPHSKY-UHFFFAOYSA-N 0.000 claims description 2
- OHGKIUNKEBPULT-UHFFFAOYSA-N propyl 2-(dimethylcarbamoylimino)-5-hexylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CC)OC(=O)N1C(SC(=N1)S(=O)(=O)CCCCCC)=NC(N(C)C)=O OHGKIUNKEBPULT-UHFFFAOYSA-N 0.000 claims description 2
- 235000009566 rice Nutrition 0.000 claims description 2
- QZMRVRCBMZXZME-UHFFFAOYSA-N prop-2-enyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CSC1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 QZMRVRCBMZXZME-UHFFFAOYSA-N 0.000 claims 2
- IDAFAPNAZCWRKV-UHFFFAOYSA-N 1,1-dimethyl-3-(1,3,4-thiadiazol-2-yl)urea Chemical class CN(C)C(=O)NC1=NN=CS1 IDAFAPNAZCWRKV-UHFFFAOYSA-N 0.000 claims 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 claims 1
- PMRUKVCRVFJRCV-UHFFFAOYSA-N 2-methylpropyl 2-(dimethylcarbamoylimino)-5-hexylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C(C)C)OC(=O)N1C(SC(=N1)SCCCCCC)=NC(N(C)C)=O PMRUKVCRVFJRCV-UHFFFAOYSA-N 0.000 claims 1
- LNGORYLUJOKKDE-UHFFFAOYSA-N 3-chloropropyl 2-(dimethylcarbamoylimino)-5-propylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCSC1=NN(C(=O)OCCCCl)C(=NC(=O)N(C)C)S1 LNGORYLUJOKKDE-UHFFFAOYSA-N 0.000 claims 1
- 240000006394 Sorghum bicolor Species 0.000 claims 1
- ATVSVKZZVQKCJU-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-hexylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SCCCCCC)=NC(N(C)C)=O ATVSVKZZVQKCJU-UHFFFAOYSA-N 0.000 claims 1
- PVYCSOHHHZDPKF-UHFFFAOYSA-N butyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCC)OC(=O)N1C(SC(=N1)SC)=NC(N(C)C)=O PVYCSOHHHZDPKF-UHFFFAOYSA-N 0.000 claims 1
- RGKYKNZRPPLJCY-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-hexylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)OC(=O)N1C(SC(=N1)SCCCCCC)=NC(N(C)C)=O RGKYKNZRPPLJCY-UHFFFAOYSA-N 0.000 claims 1
- HPFKTUCCYFEKFI-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-hexylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)OC(=O)N1C(SC(=N1)S(=O)(=O)CCCCCC)=NC(N(C)C)=O HPFKTUCCYFEKFI-UHFFFAOYSA-N 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- YLCGVEMJQIIEGX-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-hexylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCCCSC1=NN(C(=O)OC)C(=NC(=O)N(C)C)S1 YLCGVEMJQIIEGX-UHFFFAOYSA-N 0.000 claims 1
- LDDLXRPGDPSEFH-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-pentylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCCSC1=NN(C(=O)OC)C(=NC(=O)N(C)C)S1 LDDLXRPGDPSEFH-UHFFFAOYSA-N 0.000 claims 1
- LZJZKPWZKHFBTC-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-prop-2-enylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound COC(=O)N1N=C(SCC=C)SC1=NC(=O)N(C)C LZJZKPWZKHFBTC-UHFFFAOYSA-N 0.000 claims 1
- RDEGPHUKFCYVRH-UHFFFAOYSA-N pentyl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CCCC)OC(=O)N1C(SC(=N1)SC)=NC(N(C)C)=O RDEGPHUKFCYVRH-UHFFFAOYSA-N 0.000 claims 1
- IAGBXQSMFXXOLQ-UHFFFAOYSA-N prop-2-enyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CC(C)SC1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 IAGBXQSMFXXOLQ-UHFFFAOYSA-N 0.000 claims 1
- IECCPJZORVSKEN-UHFFFAOYSA-N prop-2-enyl 5-(dimethylcarbamoylimino)-2-(2-methylpropylsulfonyl)-1,3,4-thiadiazole-2-carboxylate Chemical compound C=CCOC(=O)C1(S(=O)(=O)CC(C)C)SC(=NC(=O)N(C)C)N=N1 IECCPJZORVSKEN-UHFFFAOYSA-N 0.000 claims 1
- NLXYYAFSJGOHNY-UHFFFAOYSA-N prop-2-enyl 5-butylsulfonyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCS(=O)(=O)C1=NN(C(=O)OCC=C)C(=NC(=O)N(C)C)S1 NLXYYAFSJGOHNY-UHFFFAOYSA-N 0.000 claims 1
- PSFFPAZJGNTCLI-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-ethylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)SCC)=NC(N(C)C)=O PSFFPAZJGNTCLI-UHFFFAOYSA-N 0.000 claims 1
- YLLCMXSMWYMCLX-UHFFFAOYSA-N prop-2-ynyl 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C#C)OC(=O)N1C(SC(=N1)SC(C)C)=NC(N(C)C)=O YLLCMXSMWYMCLX-UHFFFAOYSA-N 0.000 claims 1
- MYBPZHYVNADFDS-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-ethylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCS(=O)(=O)C1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 MYBPZHYVNADFDS-UHFFFAOYSA-N 0.000 claims 1
- XBTWBXMPMWTXQH-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-hexylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCCCCSC1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 XBTWBXMPMWTXQH-UHFFFAOYSA-N 0.000 claims 1
- RBHHFXJGDOQCQC-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CSC1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 RBHHFXJGDOQCQC-UHFFFAOYSA-N 0.000 claims 1
- BFZUTKGQUKGURD-UHFFFAOYSA-N propan-2-yl 2-(dimethylcarbamoylimino)-5-propylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound CCCSC1=NN(C(=O)OC(C)C)C(=NC(=O)N(C)C)S1 BFZUTKGQUKGURD-UHFFFAOYSA-N 0.000 claims 1
- WHDCAAUJQJHRLP-UHFFFAOYSA-N propyl 2-(dimethylcarbamoylimino)-5-hexylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(CC)OC(=O)N1C(SC(=N1)SCCCCCC)=NC(N(C)C)=O WHDCAAUJQJHRLP-UHFFFAOYSA-N 0.000 claims 1
- 125000006000 trichloroethyl group Chemical group 0.000 claims 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 abstract description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000013543 active substance Substances 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 230000006378 damage Effects 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 229940099408 Oxidizing agent Drugs 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 230000002363 herbicidal effect Effects 0.000 description 6
- 239000004009 herbicide Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- PFXWXVDBAIXSCP-UHFFFAOYSA-N 1,1-dimethyl-3-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)urea Chemical compound CSC1=NN=C(NC(=O)N(C)C)S1 PFXWXVDBAIXSCP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000220261 Sinapis Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- CMQJDYXIZIONAP-UHFFFAOYSA-N 1,3,4-thiadiazol-2-ylurea Chemical class NC(=O)NC1=NN=CS1 CMQJDYXIZIONAP-UHFFFAOYSA-N 0.000 description 1
- QDWYHFRTJNLKGU-UHFFFAOYSA-N 2-(dimethylcarbamoylimino)-5-methylsulfanyl-1,3,4-thiadiazole-3-carboxylic acid Chemical compound CN(C(=O)N=C1SC(=NN1C(=O)O)SC)C QDWYHFRTJNLKGU-UHFFFAOYSA-N 0.000 description 1
- DKCPUBONIIWSMH-UHFFFAOYSA-N 2-(dimethylcarbamoylimino)-5-propan-2-ylsulfanyl-1,3,4-thiadiazole-3-carboxylic acid Chemical compound CN(C(=O)N=C1SC(=NN1C(=O)O)SC(C)C)C DKCPUBONIIWSMH-UHFFFAOYSA-N 0.000 description 1
- NHTMGNCYIYVIFG-UHFFFAOYSA-N 2-(dimethylcarbamoylimino)-5-propylsulfanyl-1,3,4-thiadiazole-3-carboxylic acid Chemical compound CN(C(=O)N=C1SC(=NN1C(=O)O)SCCC)C NHTMGNCYIYVIFG-UHFFFAOYSA-N 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- GARHMFKENWNGGC-UHFFFAOYSA-N 3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,1-dimethylurea Chemical compound CCSC1=NN=C(S1)NC(=O)N(C)C GARHMFKENWNGGC-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 235000021537 Beetroot Nutrition 0.000 description 1
- HXOLAHIXGIDOCA-UHFFFAOYSA-N CN(C)C(=O)N=C1N=NC(S1)SC Chemical compound CN(C)C(=O)N=C1N=NC(S1)SC HXOLAHIXGIDOCA-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 240000004385 Centaurea cyanus Species 0.000 description 1
- 235000005940 Centaurea cyanus Nutrition 0.000 description 1
- 244000144786 Chrysanthemum segetum Species 0.000 description 1
- 235000005470 Chrysanthemum segetum Nutrition 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000720993 Filos Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000207890 Ipomoea purpurea Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 235000012480 Solanum sp Nutrition 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 240000003829 Sorghum propinquum Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 229940096118 ella Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- KWIPOCASRDNEKH-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylimino)-5-methylsulfonyl-1,3,4-thiadiazole-3-carboxylate Chemical compound C(C)OC(=O)N1C(SC(=N1)S(=O)(=O)C)=NC(N(C)C)=O KWIPOCASRDNEKH-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- GADWHPJWLLEWSM-UHFFFAOYSA-N methyl 2-(dimethylcarbamoylimino)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole-3-carboxylate Chemical compound COC(=O)N1C(SC(=N1)SCC#C)=NC(N(C)C)=O GADWHPJWLLEWSM-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 101150100282 rplK gene Proteins 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- OOLLAFOLCSJHRE-ZHAKMVSLSA-N ulipristal acetate Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(OC(C)=O)C(C)=O)[C@]2(C)C1 OOLLAFOLCSJHRE-ZHAKMVSLSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP2621647.7 | 1976-05-13 | ||
| DE19762621647 DE2621647A1 (de) | 1976-05-13 | 1976-05-13 | 2-(dimethylcarbamoylimino)-1,3,4- thiadiazolin-3-carbonsaeure-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1090808A true CA1090808A (en) | 1980-12-02 |
Family
ID=5978046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA278,440A Expired CA1090808A (en) | 1976-05-13 | 1977-05-12 | Herbicidally active 2-(dimethylcarbamoylimino)-1,3,4- thiadiazolin-3-carboxylic acid esters |
Country Status (29)
| Country | Link |
|---|---|
| US (1) | US4169718A (show.php) |
| JP (1) | JPS52139062A (show.php) |
| AT (1) | AT354802B (show.php) |
| AU (1) | AU2513377A (show.php) |
| BE (1) | BE854614A (show.php) |
| BG (1) | BG27716A3 (show.php) |
| CA (1) | CA1090808A (show.php) |
| CS (1) | CS192480B2 (show.php) |
| DD (1) | DD130201A5 (show.php) |
| DE (1) | DE2621647A1 (show.php) |
| DK (1) | DK114477A (show.php) |
| ES (1) | ES457730A1 (show.php) |
| FI (1) | FI771298A7 (show.php) |
| FR (1) | FR2351110A1 (show.php) |
| GB (1) | GB1583271A (show.php) |
| GR (1) | GR63745B (show.php) |
| IE (1) | IE45053B1 (show.php) |
| IL (1) | IL52033A (show.php) |
| IT (1) | IT1085078B (show.php) |
| LU (1) | LU76938A1 (show.php) |
| NL (1) | NL7703889A (show.php) |
| NO (1) | NO771675L (show.php) |
| PL (1) | PL102602B1 (show.php) |
| PT (1) | PT66533B (show.php) |
| RO (1) | RO72224A (show.php) |
| SE (1) | SE7705508L (show.php) |
| SU (2) | SU649320A3 (show.php) |
| TR (1) | TR19696A (show.php) |
| ZA (1) | ZA772869B (show.php) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE632848A (show.php) * | 1962-05-28 | |||
| DE2124260A1 (de) * | 1971-05-15 | 1972-11-30 | Farbenfabriken Bayer AG, 5090 Le verkusen | Verfahren zur Herstellung von 4 sub stituierten 1,3,4 Thiadiazolon (5) yl (2) harnstoffen |
-
1976
- 1976-05-13 DE DE19762621647 patent/DE2621647A1/de not_active Withdrawn
-
1977
- 1977-03-11 LU LU76938A patent/LU76938A1/xx unknown
- 1977-03-16 DK DK114477A patent/DK114477A/da unknown
- 1977-03-18 CS CS771820A patent/CS192480B2/cs unknown
- 1977-04-07 NL NL7703889A patent/NL7703889A/xx not_active Application Discontinuation
- 1977-04-12 ES ES457730A patent/ES457730A1/es not_active Expired
- 1977-04-12 SU SU772468202A patent/SU649320A3/ru active
- 1977-04-25 FI FI771298A patent/FI771298A7/fi not_active Application Discontinuation
- 1977-04-26 BG BG036125A patent/BG27716A3/xx unknown
- 1977-04-28 SU SU772475610A patent/SU648048A3/ru active
- 1977-05-02 GB GB18232/77A patent/GB1583271A/en not_active Expired
- 1977-05-05 IL IL52033A patent/IL52033A/xx unknown
- 1977-05-06 IE IE928/77A patent/IE45053B1/en unknown
- 1977-05-07 RO RO7790253A patent/RO72224A/ro unknown
- 1977-05-10 US US05/795,642 patent/US4169718A/en not_active Expired - Lifetime
- 1977-05-10 TR TR19696A patent/TR19696A/xx unknown
- 1977-05-11 PT PT66533A patent/PT66533B/pt unknown
- 1977-05-11 SE SE7705508A patent/SE7705508L/xx unknown
- 1977-05-11 GR GR53442A patent/GR63745B/el unknown
- 1977-05-11 AT AT336177A patent/AT354802B/de not_active IP Right Cessation
- 1977-05-11 DD DD7700198870A patent/DD130201A5/xx unknown
- 1977-05-11 PL PL1977198027A patent/PL102602B1/pl unknown
- 1977-05-12 NO NO771675A patent/NO771675L/no unknown
- 1977-05-12 CA CA278,440A patent/CA1090808A/en not_active Expired
- 1977-05-12 IT IT23469/77A patent/IT1085078B/it active
- 1977-05-13 JP JP5523377A patent/JPS52139062A/ja active Granted
- 1977-05-13 ZA ZA00772869A patent/ZA772869B/xx unknown
- 1977-05-13 FR FR7714692A patent/FR2351110A1/fr active Pending
- 1977-05-13 BE BE177559A patent/BE854614A/xx unknown
- 1977-05-13 AU AU25133/77A patent/AU2513377A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| TR19696A (tr) | 1979-10-11 |
| LU76938A1 (show.php) | 1977-07-14 |
| DK114477A (da) | 1977-11-14 |
| FI771298A7 (show.php) | 1977-11-14 |
| IE45053L (en) | 1977-11-13 |
| CS192480B2 (en) | 1979-08-31 |
| ZA772869B (en) | 1978-03-29 |
| JPS5538342B2 (show.php) | 1980-10-03 |
| AU2513377A (en) | 1978-11-16 |
| BE854614A (fr) | 1977-11-14 |
| ES457730A1 (es) | 1978-02-16 |
| JPS52139062A (en) | 1977-11-19 |
| ATA336177A (de) | 1979-06-15 |
| GB1583271A (en) | 1981-01-21 |
| IE45053B1 (en) | 1982-06-16 |
| DE2621647A1 (de) | 1977-12-01 |
| NL7703889A (nl) | 1977-11-15 |
| FR2351110A1 (fr) | 1977-12-09 |
| IL52033A0 (en) | 1977-07-31 |
| SU648048A3 (ru) | 1979-02-15 |
| BG27716A3 (bg) | 1979-12-12 |
| DD130201A5 (de) | 1978-03-15 |
| PT66533B (de) | 1978-10-17 |
| AT354802B (de) | 1979-01-25 |
| RO72224A (ro) | 1982-05-10 |
| PT66533A (de) | 1977-06-01 |
| PL102602B1 (pl) | 1979-04-30 |
| GR63745B (en) | 1979-12-04 |
| US4169718A (en) | 1979-10-02 |
| IL52033A (en) | 1980-03-31 |
| NO771675L (no) | 1977-11-15 |
| SU649320A3 (ru) | 1979-02-25 |
| SE7705508L (sv) | 1977-11-14 |
| IT1085078B (it) | 1985-05-28 |
| PL198027A1 (pl) | 1978-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4293328A (en) | N-(5-t-Butyl-3-isoxazolyl)alkanamide derivatives and herbicidal compositions containing them | |
| US3726892A (en) | Certain 5-sulfamoyl-1,3,4-thiadiazol-2-ylureas | |
| GB1583274A (en) | Herbicidally active benzodioxole derivatives process for their manufacture and their use | |
| CA1090808A (en) | Herbicidally active 2-(dimethylcarbamoylimino)-1,3,4- thiadiazolin-3-carboxylic acid esters | |
| US4239524A (en) | Thiadiazolyl ureas with herbicidal effect | |
| CA1073466A (en) | Herbicidal trifluoremethylphenyl urea derivatives | |
| US4876044A (en) | Thiadiazole compounds and methods of use | |
| CA1090351A (en) | Herbicidally active 2-(dimethylcarbamoylimino)- benzthiazolin-3-ide salts, process for their manufacture and their use | |
| GB1573812A (en) | Herbicidally active 5-alkylureido-1,3,4-thiadiazol-2-yl-sulphonyl-acetic acid derivatives processes for their manufacture and their use | |
| GB1594219A (en) | Selectively herbicidally active diurethanes process for their manufacture and their use | |
| US4257804A (en) | Carbamic acid ester, process for making the same and composition containing same | |
| CA1097673A (en) | Selectively herbicidally active diurethanes, a process for their manufacture and their use | |
| CA1100987A (en) | Herbicidally active carbanilic acid esters | |
| PL81808B1 (show.php) | ||
| GB1575462A (en) | Herbicidally active (5-alkylureido-1,3,4-thiadiazol-2-yl-thio)-acetic acid esters process for their manufacture and their use | |
| PL91496B1 (show.php) | ||
| CA1259310A (en) | Pyrimidyl-thio-carboxanilides | |
| GB1591511A (en) | Herbicidally active 2-(dimethylcarbamoylimino)-benzthiazolin-3-carboxylic acid esters process for their manufacture and their use | |
| PL84425B1 (show.php) | ||
| CA1105033A (en) | [n-(5-t-butyl-3-isoxazolyl)alkanamide derivatives] and herbicidal compositions containing them | |
| GB2107312A (en) | 1,2,3-thiadiazol-5-yl-urea derivatives having a plant growth-regulating and defoliating action | |
| GB2106904A (en) | 1,2,3-thiadiazol-5-yl-urea derivatives having a plant growth-regulating and defoliating action | |
| CA1090350A (en) | Herbicidally active 2-dimethylcarbamoylimino-1,3,4- thiadiazolin-3-ide salts | |
| US4209627A (en) | 2-(Dimethylcarbamoylimino)-1,3,4-thiadiazoline-3-carboxylic acid ester derivatives | |
| GB1577523A (en) | Herbicidally active 2-dimethylcarbamoylimino-1,3,4-thiadiazolin-3-ide derivatives process for their manufacture and their use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |