CA1084522A - Alkyl 3-cyano-3-(phenoxyphenyl)-2-ketopropionates and their preparation - Google Patents
Alkyl 3-cyano-3-(phenoxyphenyl)-2-ketopropionates and their preparationInfo
- Publication number
- CA1084522A CA1084522A CA250,187A CA250187A CA1084522A CA 1084522 A CA1084522 A CA 1084522A CA 250187 A CA250187 A CA 250187A CA 1084522 A CA1084522 A CA 1084522A
- Authority
- CA
- Canada
- Prior art keywords
- general formula
- process according
- bromine
- carbon atoms
- alkyl group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 13
- -1 Alkyl 3-cyano-3-(phenoxyphenyl)-2-ketopropionates Chemical class 0.000 title claims description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims abstract description 25
- 150000001875 compounds Chemical class 0.000 claims abstract description 20
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical class N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 claims abstract description 9
- 235000006408 oxalic acid Nutrition 0.000 claims abstract description 8
- 150000002912 oxalic acid derivatives Chemical class 0.000 claims abstract description 8
- 150000002148 esters Chemical class 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 20
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 16
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 16
- 229910052794 bromium Inorganic materials 0.000 claims description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- DKGMALJGFUHPGB-UHFFFAOYSA-N 2-(3-phenoxyphenyl)acetonitrile Chemical group N#CCC1=CC=CC(OC=2C=CC=CC=2)=C1 DKGMALJGFUHPGB-UHFFFAOYSA-N 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 5
- DUFGSCFYUYOMER-UHFFFAOYSA-N ethyl 3-cyano-2-oxo-3-(3-phenoxyphenyl)propanoate Chemical compound CCOC(=O)C(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 DUFGSCFYUYOMER-UHFFFAOYSA-N 0.000 claims description 5
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 4
- 150000003901 oxalic acid esters Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical group [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims 1
- 230000036647 reaction Effects 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229940116315 oxalic acid Drugs 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- OSPQRCCNLQAIPV-UHFFFAOYSA-N 3-cyano-2-oxo-3-(3-phenoxyphenyl)propanoic acid Chemical compound OC(=O)C(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OSPQRCCNLQAIPV-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- UJUNUASMYSTBSK-UHFFFAOYSA-N 1-(bromomethyl)-3-phenoxybenzene Chemical compound BrCC1=CC=CC(OC=2C=CC=CC=2)=C1 UJUNUASMYSTBSK-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 3
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000001117 sulphuric acid Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- UDONPJKEOAWFGI-UHFFFAOYSA-N 1-methyl-3-phenoxybenzene Chemical compound CC1=CC=CC(OC=2C=CC=CC=2)=C1 UDONPJKEOAWFGI-UHFFFAOYSA-N 0.000 description 1
- NETAEENURPVOMI-UHFFFAOYSA-N 2-(2,3,4,5,6-pentachlorophenyl)acetonitrile Chemical compound ClC1=C(Cl)C(Cl)=C(CC#N)C(Cl)=C1Cl NETAEENURPVOMI-UHFFFAOYSA-N 0.000 description 1
- JRMAQQQTXDJDNC-UHFFFAOYSA-M 2-ethoxy-2-oxoacetate Chemical compound CCOC(=O)C([O-])=O JRMAQQQTXDJDNC-UHFFFAOYSA-M 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB18438/75 | 1975-05-02 | ||
| GB18438/75A GB1536411A (en) | 1975-05-02 | 1975-05-02 | Process for the preparation of oxalic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1084522A true CA1084522A (en) | 1980-08-26 |
Family
ID=10112450
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA250,187A Expired CA1084522A (en) | 1975-05-02 | 1976-04-13 | Alkyl 3-cyano-3-(phenoxyphenyl)-2-ketopropionates and their preparation |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4010190A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS6011690B2 (cg-RX-API-DMAC10.html) |
| BR (1) | BR7602696A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1084522A (cg-RX-API-DMAC10.html) |
| CH (1) | CH626602A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2619321C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2309507A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1536411A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7604573A (cg-RX-API-DMAC10.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE69206299T2 (de) * | 1991-03-29 | 1996-03-28 | Tokuyama Corp | Cyanoketonderivat und dieses als Wirkstoff enthaltendes Herbizid. |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3865821A (en) * | 1972-08-23 | 1975-02-11 | Paul Cordier | Process for the preparation of dihydrometoxazinone derivatives and products so obtained |
-
1975
- 1975-05-02 GB GB18438/75A patent/GB1536411A/en not_active Expired
-
1976
- 1976-04-13 CA CA250,187A patent/CA1084522A/en not_active Expired
- 1976-04-29 NL NL7604573A patent/NL7604573A/xx not_active Application Discontinuation
- 1976-04-29 CH CH540676A patent/CH626602A5/de not_active IP Right Cessation
- 1976-04-30 US US05/681,939 patent/US4010190A/en not_active Expired - Lifetime
- 1976-04-30 JP JP51048657A patent/JPS6011690B2/ja not_active Expired
- 1976-04-30 DE DE2619321A patent/DE2619321C2/de not_active Expired
- 1976-04-30 BR BR2696/76A patent/BR7602696A/pt unknown
- 1976-04-30 FR FR7612918A patent/FR2309507A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1536411A (en) | 1978-12-20 |
| FR2309507B1 (cg-RX-API-DMAC10.html) | 1980-03-28 |
| JPS51133247A (en) | 1976-11-18 |
| JPS6011690B2 (ja) | 1985-03-27 |
| NL7604573A (nl) | 1976-11-04 |
| FR2309507A1 (fr) | 1976-11-26 |
| CH626602A5 (cg-RX-API-DMAC10.html) | 1981-11-30 |
| US4010190A (en) | 1977-03-01 |
| DE2619321A1 (de) | 1976-11-11 |
| DE2619321C2 (de) | 1984-05-17 |
| BR7602696A (pt) | 1976-11-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR101257217B1 (ko) | 1-(2-할로비페닐-4-일)-시클로프로판카르복실릭 엑시드 유도체를 제조하는 방법 | |
| KR101737653B1 (ko) | 1-(2-할로비페닐-4-일)-시클로프로판카복실산 유도체의 제조 방법 | |
| US4377533A (en) | Process for introducing alkyl radicals into carbon chains having a functional group and compounds prepared by said process | |
| US4665226A (en) | Process for preparing 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid | |
| US4596885A (en) | Process for the preparation of phenylglyoxylic acid esters | |
| CA1084522A (en) | Alkyl 3-cyano-3-(phenoxyphenyl)-2-ketopropionates and their preparation | |
| KR101437038B1 (ko) | (+) 및 (-)-1-(3,4-디클로로페닐)-3-아자비시클로[3.1.0]헥산의 합성 방법 | |
| JPS6241578B2 (cg-RX-API-DMAC10.html) | ||
| CA1328116C (en) | Process for the preparation of bronopol | |
| US4174348A (en) | Preparation of cyclopropanecarbonitriles | |
| EP4101833B1 (en) | Processes for preparing a (1,2-dimethyl-3-methylenecyclopentyl)acetate compound and (1,2-dimethyl-3-methylenecyclopentyl)acetaldehyde | |
| US4393008A (en) | 2-Cyano-2-(3-phenoxy-phenyl)-propionic acid amide and preparation thereof | |
| US6307091B1 (en) | Trifluoro-substituted benzoic acid, esters thereof and processes for preparing the same | |
| US4948916A (en) | Process for producing aminooxyacetic acid salts | |
| DD285349A5 (de) | Verfahren zur herstellung von substituierten pyridylalkylketonen | |
| CN114315512B (zh) | 一种α-松油醇的合成方法 | |
| US4908479A (en) | N-phenyl-2,2,6,6-tetrahalocyclohexaneimine | |
| US3703597A (en) | Preparation of benzilic acid compounds | |
| US4808340A (en) | Process for preparing methyl 4-oxo-5-tetradecynoate | |
| JPH06157418A (ja) | 還元的脱ハロゲン化法 | |
| US4234507A (en) | Process for preparing cyanohydrin esters | |
| US4031136A (en) | Process for the preparation of trans, trans-muconic acid | |
| Aleksandrov et al. | Synthesis of 1-substituted 12-oxahexacyclo [7.2. 1.02, 8.03, 7.04, 11.06, 10] dodecanes and their transformation into pentacyclo [6.3. 0.02, 6.03, 10.05, 9] undecane derivatives | |
| JP3234838B2 (ja) | 2,4,5−トリフルオロ−3−ヒドロキシ安息香酸の製造方法 | |
| CZ281994A3 (en) | Process for preparing alkyl esters of high purity and yields from fluorobenzoic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |