CA1083152A - Phenyl-tetrazolyl-pyrimidin-4-one therapeutic agents - Google Patents
Phenyl-tetrazolyl-pyrimidin-4-one therapeutic agentsInfo
- Publication number
- CA1083152A CA1083152A CA271,406A CA271406A CA1083152A CA 1083152 A CA1083152 A CA 1083152A CA 271406 A CA271406 A CA 271406A CA 1083152 A CA1083152 A CA 1083152A
- Authority
- CA
- Canada
- Prior art keywords
- integer
- alkyl
- mixture
- oxo
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003814 drug Substances 0.000 title description 8
- 229940124597 therapeutic agent Drugs 0.000 title description 4
- CFRPQKFSEAAADD-UHFFFAOYSA-N 5-phenyl-2-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one Chemical compound C1(=CC=CC=C1)C=1C(NC(=NC1)C1=NN=NN1)=O CFRPQKFSEAAADD-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 121
- 238000002360 preparation method Methods 0.000 claims abstract description 95
- 238000000034 method Methods 0.000 claims abstract description 88
- 230000008569 process Effects 0.000 claims abstract description 22
- -1 (lower)-alkoxy Chemical group 0.000 claims description 108
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 42
- 125000000217 alkyl group Chemical group 0.000 claims description 41
- 238000010992 reflux Methods 0.000 claims description 38
- 150000003839 salts Chemical class 0.000 claims description 38
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 31
- 239000002904 solvent Substances 0.000 claims description 31
- 125000003545 alkoxy group Chemical group 0.000 claims description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 125000003282 alkyl amino group Chemical group 0.000 claims description 19
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 18
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 16
- 239000003960 organic solvent Substances 0.000 claims description 15
- 150000003937 benzamidines Chemical class 0.000 claims description 14
- 239000007858 starting material Substances 0.000 claims description 13
- 235000019270 ammonium chloride Nutrition 0.000 claims description 10
- 125000005336 allyloxy group Chemical group 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 7
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- KTMGNAIGXYODKQ-UHFFFAOYSA-N ethyl 2-cyano-3-ethoxyprop-2-enoate Chemical compound CCOC=C(C#N)C(=O)OCC KTMGNAIGXYODKQ-UHFFFAOYSA-N 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 159000000000 sodium salts Chemical class 0.000 claims description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical class NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims 4
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- 150000002169 ethanolamines Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 130
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 abstract description 13
- 208000006673 asthma Diseases 0.000 abstract description 9
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 7
- 208000030603 inherited susceptibility to asthma Diseases 0.000 abstract description 6
- 206010020751 Hypersensitivity Diseases 0.000 abstract description 4
- 230000001404 mediated effect Effects 0.000 abstract description 4
- 230000000172 allergic effect Effects 0.000 abstract description 3
- 208000010668 atopic eczema Diseases 0.000 abstract description 3
- 201000010099 disease Diseases 0.000 abstract description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 3
- 238000011321 prophylaxis Methods 0.000 abstract description 3
- 241000124008 Mammalia Species 0.000 abstract description 2
- 239000003112 inhibitor Substances 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 197
- 239000000243 solution Substances 0.000 description 113
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 95
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 66
- 235000019441 ethanol Nutrition 0.000 description 66
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 64
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 58
- 229910001868 water Inorganic materials 0.000 description 54
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 49
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 45
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 41
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- 239000000047 product Substances 0.000 description 38
- 239000007787 solid Substances 0.000 description 34
- 239000005457 ice water Substances 0.000 description 30
- 229960000583 acetic acid Drugs 0.000 description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000000725 suspension Substances 0.000 description 19
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- 229910052708 sodium Inorganic materials 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 15
- 229910021529 ammonia Inorganic materials 0.000 description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 14
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 14
- 239000000463 material Substances 0.000 description 14
- 235000011054 acetic acid Nutrition 0.000 description 13
- 239000000427 antigen Substances 0.000 description 13
- 102000036639 antigens Human genes 0.000 description 13
- 108091007433 antigens Proteins 0.000 description 13
- 239000000460 chlorine Substances 0.000 description 13
- 238000001953 recrystallisation Methods 0.000 description 13
- 235000011121 sodium hydroxide Nutrition 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 125000001424 substituent group Chemical group 0.000 description 13
- 241000700159 Rattus Species 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 12
- 150000002825 nitriles Chemical class 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 238000010790 dilution Methods 0.000 description 11
- 239000012895 dilution Substances 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 235000011167 hydrochloric acid Nutrition 0.000 description 11
- 229960000443 hydrochloric acid Drugs 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 10
- 239000000543 intermediate Substances 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 9
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 9
- 229940083608 sodium hydroxide Drugs 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- MJBWDEQAUQTVKK-IAGOWNOFSA-N aflatoxin M1 Chemical compound C=1([C@]2(O)C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O MJBWDEQAUQTVKK-IAGOWNOFSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 230000000875 corresponding effect Effects 0.000 description 8
- SBNKFTQSBPKMBZ-UHFFFAOYSA-N ethenzamide Chemical compound CCOC1=CC=CC=C1C(N)=O SBNKFTQSBPKMBZ-UHFFFAOYSA-N 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- XVIAPHVAGFEFFN-UHFFFAOYSA-N pyrimidine-5-carbonitrile Chemical compound N#CC1=CN=CN=C1 XVIAPHVAGFEFFN-UHFFFAOYSA-N 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- 210000002966 serum Anatomy 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 235000011181 potassium carbonates Nutrition 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000002002 slurry Substances 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 7
- 125000003831 tetrazolyl group Chemical group 0.000 description 7
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 229960000265 cromoglicic acid Drugs 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- 239000012258 stirred mixture Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- VPSOCYILUWQTLX-UHFFFAOYSA-N benzenecarboximidamide;methyl hydrogen sulfate Chemical compound COS(O)(=O)=O.NC(=N)C1=CC=CC=C1 VPSOCYILUWQTLX-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- UQSQSQZYBQSBJZ-UHFFFAOYSA-M fluorosulfonate Chemical compound [O-]S(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-M 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- MBXNQZHITVCSLJ-UHFFFAOYSA-N methyl fluorosulfonate Chemical compound COS(F)(=O)=O MBXNQZHITVCSLJ-UHFFFAOYSA-N 0.000 description 5
- 230000020477 pH reduction Effects 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- QDXGKRWDQCEABB-UHFFFAOYSA-N pyrimidine-5-carboxamide Chemical compound NC(=O)C1=CN=CN=C1 QDXGKRWDQCEABB-UHFFFAOYSA-N 0.000 description 5
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 5
- ARRHAFFWXFQZSR-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CCOC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 ARRHAFFWXFQZSR-UHFFFAOYSA-N 0.000 description 4
- HNTRYPFDBNXKOS-UHFFFAOYSA-N 2-(2-methylpropoxy)benzenecarboximidamide Chemical compound CC(C)COC1=CC=CC=C1C(N)=N HNTRYPFDBNXKOS-UHFFFAOYSA-N 0.000 description 4
- OIEYSUXLJYFFPI-UHFFFAOYSA-N 2-ethoxybenzenecarboximidamide;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CCOC1=CC=CC=C1C(N)=N OIEYSUXLJYFFPI-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 108010058846 Ovalbumin Proteins 0.000 description 4
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- XZHKVYYQQVEUBZ-UHFFFAOYSA-N [amino-(2-propoxyphenyl)methylidene]azanium;chloride Chemical compound Cl.CCCOC1=CC=CC=C1C(N)=N XZHKVYYQQVEUBZ-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000001045 blue dye Substances 0.000 description 4
- 150000003857 carboxamides Chemical class 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 238000007429 general method Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 4
- 229940092253 ovalbumin Drugs 0.000 description 4
- 229940066827 pertussis vaccine Drugs 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- WZODLFCLKIXWGA-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)C)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] WZODLFCLKIXWGA-UHFFFAOYSA-N 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- YGSJZZHYXOPQFQ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)benzamide Chemical compound NC(=O)C1=CC=CC=C1OCC1CC1 YGSJZZHYXOPQFQ-UHFFFAOYSA-N 0.000 description 3
- VPTQXJGFCHOGAN-UHFFFAOYSA-N 2-butoxybenzamide Chemical compound CCCCOC1=CC=CC=C1C(N)=O VPTQXJGFCHOGAN-UHFFFAOYSA-N 0.000 description 3
- OEXRGFMNBITBTE-UHFFFAOYSA-N 2-ethoxybenzenecarboximidamide;methyl hydrogen sulfate Chemical compound COS(O)(=O)=O.CCOC1=CC=CC=C1C(N)=N OEXRGFMNBITBTE-UHFFFAOYSA-N 0.000 description 3
- CBGLJVDZNPPGKJ-UHFFFAOYSA-N 5-chloro-2-ethoxybenzamide Chemical compound CCOC1=CC=C(Cl)C=C1C(N)=O CBGLJVDZNPPGKJ-UHFFFAOYSA-N 0.000 description 3
- JQCXHLMDSPVRLE-UHFFFAOYSA-N 5-methoxy-2-propoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCOC1=CC=C(OC)C=C1C(N)=N JQCXHLMDSPVRLE-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 241000588832 Bordetella pertussis Species 0.000 description 3
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 206010070834 Sensitisation Diseases 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 3
- 239000000043 antiallergic agent Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 230000003053 immunization Effects 0.000 description 3
- 238000002649 immunization Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Chemical class 0.000 description 3
- 239000002184 metal Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 230000008313 sensitization Effects 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 150000003536 tetrazoles Chemical class 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- 239000003656 tris buffered saline Substances 0.000 description 3
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 2
- HCKPJFSKECFIMT-UHFFFAOYSA-N 2-(2-methylpropoxy)benzenecarboximidamide;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CC(C)COC1=CC=CC=C1C(N)=N HCKPJFSKECFIMT-UHFFFAOYSA-N 0.000 description 2
- NWELOPILLFFSFZ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)benzenecarboximidamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=CC=C1OCC1CC1 NWELOPILLFFSFZ-UHFFFAOYSA-N 0.000 description 2
- YNJQOVDUKUWUQT-UHFFFAOYSA-N 2-butoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCOC1=CC=CC=C1C(N)=N YNJQOVDUKUWUQT-UHFFFAOYSA-N 0.000 description 2
- DERAACKMMNJAFU-UHFFFAOYSA-N 2-ethoxy-1,3-dioxane-4,6-dione Chemical compound CCOC1OC(=O)CC(=O)O1 DERAACKMMNJAFU-UHFFFAOYSA-N 0.000 description 2
- BAFPIVSUZRAYKE-UHFFFAOYSA-N 2-ethoxy-5-methoxybenzamide Chemical compound CCOC1=CC=C(OC)C=C1C(N)=O BAFPIVSUZRAYKE-UHFFFAOYSA-N 0.000 description 2
- JNYOMPUIZRNERF-UHFFFAOYSA-N 2-ethoxy-5-methoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCOC1=CC=C(OC)C=C1C(N)=N JNYOMPUIZRNERF-UHFFFAOYSA-N 0.000 description 2
- GOSDGLKRVHPJEV-UHFFFAOYSA-N 2-ethoxybenzenecarboximidamide Chemical compound CCOC1=CC=CC=C1C(N)=N GOSDGLKRVHPJEV-UHFFFAOYSA-N 0.000 description 2
- KNOPIPOLVBCPEN-UHFFFAOYSA-N 2-ethylsulfanylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCSC1=CC=CC=C1C(N)=N KNOPIPOLVBCPEN-UHFFFAOYSA-N 0.000 description 2
- UYPHFBKQVOALNA-UHFFFAOYSA-N 2-methoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C(N)=N UYPHFBKQVOALNA-UHFFFAOYSA-N 0.000 description 2
- BTHLVVULQLRTBK-UHFFFAOYSA-N 2-propan-2-yloxybenzamide Chemical compound CC(C)OC1=CC=CC=C1C(N)=O BTHLVVULQLRTBK-UHFFFAOYSA-N 0.000 description 2
- IOJAQFYHZXUYDH-UHFFFAOYSA-N 2-propan-2-yloxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CC(C)OC1=CC=CC=C1C(N)=N IOJAQFYHZXUYDH-UHFFFAOYSA-N 0.000 description 2
- FAVIQMSTEFBUJX-UHFFFAOYSA-N 2-propoxybenzamide Chemical compound CCCOC1=CC=CC=C1C(N)=O FAVIQMSTEFBUJX-UHFFFAOYSA-N 0.000 description 2
- PKHNMHLTBWZQCA-UHFFFAOYSA-N 5-chloro-2-ethoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCOC1=CC=C(Cl)C=C1C(N)=N PKHNMHLTBWZQCA-UHFFFAOYSA-N 0.000 description 2
- VTEHZGVDOYGWFI-UHFFFAOYSA-N 5-methoxy-2-propoxybenzamide Chemical compound CCCOC1=CC=C(OC)C=C1C(N)=O VTEHZGVDOYGWFI-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229910017974 NH40H Inorganic materials 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 206010039085 Rhinitis allergic Diseases 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- OQIQSTLJSLGHID-WNWIJWBNSA-N aflatoxin B1 Chemical compound C=1([C@@H]2C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O OQIQSTLJSLGHID-WNWIJWBNSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 201000010105 allergic rhinitis Diseases 0.000 description 2
- 229910021502 aluminium hydroxide Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 235000011116 calcium hydroxide Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- NHBDYNVEEOSTIH-UHFFFAOYSA-N chembl14922 Chemical compound CCCOC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 NHBDYNVEEOSTIH-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- NTOYIGNATVNWOU-UHFFFAOYSA-N ethyl 2-(2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OCC NTOYIGNATVNWOU-UHFFFAOYSA-N 0.000 description 2
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 2
- IVBFHLYXRBKTMG-UHFFFAOYSA-N ethyl 6-oxo-2-(2-propoxyphenyl)-1h-pyrimidine-5-carboxylate Chemical compound CCCOC1=CC=CC=C1C1=NC=C(C(=O)OCC)C(=O)N1 IVBFHLYXRBKTMG-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 230000008570 general process Effects 0.000 description 2
- 229910001679 gibbsite Inorganic materials 0.000 description 2
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 230000002163 immunogen Effects 0.000 description 2
- 229940090044 injection Drugs 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical class [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 235000012254 magnesium hydroxide Nutrition 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- WYTKHSAZZPUCPK-UHFFFAOYSA-N methyl 3-carbamimidoyl-4-ethoxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C=C1C(N)=N WYTKHSAZZPUCPK-UHFFFAOYSA-N 0.000 description 2
- NSNDIPJPWIDPBY-UHFFFAOYSA-N methyl 3-carbamoyl-4-ethoxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C=C1C(N)=O NSNDIPJPWIDPBY-UHFFFAOYSA-N 0.000 description 2
- PCIWGHJCGMRZDJ-UHFFFAOYSA-N methyl hydrogen sulfate;2-propoxybenzenecarboximidamide Chemical compound COS(O)(=O)=O.CCCOC1=CC=CC=C1C(N)=N PCIWGHJCGMRZDJ-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 239000008024 pharmaceutical diluent Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 125000005920 sec-butoxy group Chemical group 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- NGMHLSBQVIXGNZ-UHFFFAOYSA-N (2-ethoxybenzenecarboximidoyl)azanium;chloride Chemical compound Cl.CCOC1=CC=CC=C1C(N)=N NGMHLSBQVIXGNZ-UHFFFAOYSA-N 0.000 description 1
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 1
- 229930182837 (R)-adrenaline Natural products 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSEQXVZVJXJVFP-UHFFFAOYSA-N 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile Chemical compound O1CC2=CC(C#N)=CC=C2C1(CCCN(C)C)C1=CC=C(F)C=C1 WSEQXVZVJXJVFP-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- OHDVRMGJIHLLMB-UHFFFAOYSA-N 2,4-dimethoxybenzenecarboximidamide Chemical compound COC1=CC=C(C(N)=N)C(OC)=C1 OHDVRMGJIHLLMB-UHFFFAOYSA-N 0.000 description 1
- OVOJUAKDTOOXRF-UHFFFAOYSA-N 2,4-dinitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O OVOJUAKDTOOXRF-UHFFFAOYSA-N 0.000 description 1
- KLYZILOJVQMYSK-UHFFFAOYSA-N 2,5-dimethoxybenzamide Chemical compound COC1=CC=C(OC)C(C(N)=O)=C1 KLYZILOJVQMYSK-UHFFFAOYSA-N 0.000 description 1
- MLVYVEAUXWOKLK-UHFFFAOYSA-N 2,5-dimethoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.COC1=CC=C(OC)C(C(N)=N)=C1 MLVYVEAUXWOKLK-UHFFFAOYSA-N 0.000 description 1
- QVPVUXUNYUXCRY-UHFFFAOYSA-N 2-(2-aminophenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound NC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 QVPVUXUNYUXCRY-UHFFFAOYSA-N 0.000 description 1
- UACKEROANJJXAG-UHFFFAOYSA-N 2-(2-butan-2-yloxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CCC(C)OC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 UACKEROANJJXAG-UHFFFAOYSA-N 0.000 description 1
- NQVBXZFIKXHLLS-UHFFFAOYSA-N 2-(2-butan-2-yloxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylic acid Chemical compound CCC(C)OC1=CC=CC=C1C1=NC=C(C(O)=O)C(=O)N1 NQVBXZFIKXHLLS-UHFFFAOYSA-N 0.000 description 1
- DIOIUBFOJHVCEV-UHFFFAOYSA-N 2-(2-chlorophenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound ClC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 DIOIUBFOJHVCEV-UHFFFAOYSA-N 0.000 description 1
- JDMAVDMBAAYFMV-UHFFFAOYSA-N 2-(2-fluorophenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound FC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 JDMAVDMBAAYFMV-UHFFFAOYSA-N 0.000 description 1
- SBZSBHNPMBQOJQ-UHFFFAOYSA-N 2-(2-methoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound COC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 SBZSBHNPMBQOJQ-UHFFFAOYSA-N 0.000 description 1
- FVPWCKBAQIZSFS-UHFFFAOYSA-N 2-(2-methylpropoxy)benzamide Chemical compound CC(C)COC1=CC=CC=C1C(N)=O FVPWCKBAQIZSFS-UHFFFAOYSA-N 0.000 description 1
- PAAWXHPCTIZMJD-UHFFFAOYSA-N 2-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one Chemical compound N1N=NN=C1C1=NC=CC(N1)=O PAAWXHPCTIZMJD-UHFFFAOYSA-N 0.000 description 1
- YNTJKQDWYXUTLZ-UHFFFAOYSA-N 2-(3-chlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=CC(Cl)=C1 YNTJKQDWYXUTLZ-UHFFFAOYSA-N 0.000 description 1
- GCSGRYMRVIGNHY-UHFFFAOYSA-N 2-(3-methoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound COC1=CC=CC(C=2NC(=O)C(C#N)=CN=2)=C1 GCSGRYMRVIGNHY-UHFFFAOYSA-N 0.000 description 1
- SGHARSMKWKRMJE-UHFFFAOYSA-N 2-(4-methoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound C1=CC(OC)=CC=C1C1=NC=C(C#N)C(=O)N1 SGHARSMKWKRMJE-UHFFFAOYSA-N 0.000 description 1
- OOPGLDFHTIKXCN-UHFFFAOYSA-N 2-(morpholin-4-ylmethylidene)propanedioic acid Chemical compound OC(=O)C(C(O)=O)=CN1CCOCC1 OOPGLDFHTIKXCN-UHFFFAOYSA-N 0.000 description 1
- BGOGGIDZXPDNGA-UHFFFAOYSA-N 2-(piperidin-1-ylmethylidene)propanedioic acid Chemical compound OC(=O)C(C(O)=O)=CN1CCCCC1 BGOGGIDZXPDNGA-UHFFFAOYSA-N 0.000 description 1
- AYCLFVLPXDMBEB-UHFFFAOYSA-N 2-[2-(2-methylpropoxy)phenyl]-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CC(C)COC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 AYCLFVLPXDMBEB-UHFFFAOYSA-N 0.000 description 1
- WVJYIBLJGJMIHO-UHFFFAOYSA-N 2-[2-(2-methylpropoxy)phenyl]-6-oxo-1h-pyrimidine-5-carboxamide Chemical compound CC(C)COC1=CC=CC=C1C1=NC=C(C(N)=O)C(=O)N1 WVJYIBLJGJMIHO-UHFFFAOYSA-N 0.000 description 1
- JWPSFPLNNQCTJH-UHFFFAOYSA-N 2-[2-(cyclopropylmethoxy)phenyl]-3-ethylpyrimidin-4-one Chemical compound C(C)N1C(=NC=CC1=O)C1=C(C=CC=C1)OCC1CC1 JWPSFPLNNQCTJH-UHFFFAOYSA-N 0.000 description 1
- UUIYULWYHDSXHL-NSHDSACASA-N 2-[[3-[(2s)-2-amino-2-carboxyethyl]-2,6-dioxopyrimidin-1-yl]methyl]benzoic acid Chemical compound O=C1N(C[C@H](N)C(O)=O)C=CC(=O)N1CC1=CC=CC=C1C(O)=O UUIYULWYHDSXHL-NSHDSACASA-N 0.000 description 1
- JZQLRTAGAUZWRH-UHFFFAOYSA-N 2-aminoethanol;hydrate Chemical compound [OH-].[NH3+]CCO JZQLRTAGAUZWRH-UHFFFAOYSA-N 0.000 description 1
- XWPPEESBKICTHP-UHFFFAOYSA-N 2-butan-2-yloxybenzamide Chemical compound CCC(C)OC1=CC=CC=C1C(N)=O XWPPEESBKICTHP-UHFFFAOYSA-N 0.000 description 1
- NDBMNHFFDSSFHG-UHFFFAOYSA-N 2-butan-2-yloxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCC(C)OC1=CC=CC=C1C(N)=N NDBMNHFFDSSFHG-UHFFFAOYSA-N 0.000 description 1
- BFLMZPFXXUVDMO-UHFFFAOYSA-N 2-ethylsulfanylbenzonitrile Chemical compound CCSC1=CC=CC=C1C#N BFLMZPFXXUVDMO-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- MNWSGMTUGXNYHJ-UHFFFAOYSA-N 2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(N)=O MNWSGMTUGXNYHJ-UHFFFAOYSA-N 0.000 description 1
- IFHHVUXPFHPHBQ-UHFFFAOYSA-N 2-methylsulfanylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CSC1=CC=CC=C1C(N)=N IFHHVUXPFHPHBQ-UHFFFAOYSA-N 0.000 description 1
- AUXXZZHQJXFJTC-UHFFFAOYSA-N 2-nitrobenzenecarboximidamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=CC=C1[N+]([O-])=O AUXXZZHQJXFJTC-UHFFFAOYSA-N 0.000 description 1
- HNUKTDKISXPDPA-UHFFFAOYSA-N 2-oxopropyl Chemical group [CH2]C(C)=O HNUKTDKISXPDPA-UHFFFAOYSA-N 0.000 description 1
- JJXBLRJIMBFLMY-UHFFFAOYSA-N 2-phenyl-1h-pyrimidin-6-one Chemical compound OC1=CC=NC(C=2C=CC=CC=2)=N1 JJXBLRJIMBFLMY-UHFFFAOYSA-N 0.000 description 1
- UXVZNLSQKHVKBJ-UHFFFAOYSA-N 2-propan-2-yloxybenzenecarboximidamide Chemical compound CC(C)OC1=CC=CC=C1C(N)=N UXVZNLSQKHVKBJ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- CLXPJHFVNFNTAR-UHFFFAOYSA-N 2-propoxybenzenecarboximidamide Chemical compound CCCOC1=CC=CC=C1C(N)=N CLXPJHFVNFNTAR-UHFFFAOYSA-N 0.000 description 1
- YPACMOORZSDQDQ-UHFFFAOYSA-N 3-(4-aminobenzoyl)oxypropyl 4-aminobenzoate Chemical compound C1=CC(N)=CC=C1C(=O)OCCCOC(=O)C1=CC=C(N)C=C1 YPACMOORZSDQDQ-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- AEDNEIUPKSLIDZ-UHFFFAOYSA-N 5-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one Chemical class O=C1NC=NC=C1C1=NN=NN1 AEDNEIUPKSLIDZ-UHFFFAOYSA-N 0.000 description 1
- NNHMQZBVJPQCAK-UHFFFAOYSA-N 5-chloro-2-hydroxybenzamide Chemical compound NC(=O)C1=CC(Cl)=CC=C1O NNHMQZBVJPQCAK-UHFFFAOYSA-N 0.000 description 1
- UPDIZRAYBADYSG-UHFFFAOYSA-N 6-oxo-2-(2-propan-2-yloxyphenyl)-1h-pyrimidine-5-carbonitrile Chemical compound CC(C)OC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 UPDIZRAYBADYSG-UHFFFAOYSA-N 0.000 description 1
- JKHROBFSYBALSG-UHFFFAOYSA-N 6-oxo-2-[3-(trifluoromethyl)phenyl]-1h-pyrimidine-5-carbonitrile Chemical compound FC(F)(F)C1=CC=CC(C=2NC(=O)C(C#N)=CN=2)=C1 JKHROBFSYBALSG-UHFFFAOYSA-N 0.000 description 1
- YHGNZQGATDHUHG-UHFFFAOYSA-N 6-oxo-2-phenyl-1h-pyrimidine-5-carboxamide Chemical class N1C(=O)C(C(=O)N)=CN=C1C1=CC=CC=C1 YHGNZQGATDHUHG-UHFFFAOYSA-N 0.000 description 1
- HADBIMYTRIMUAO-UHFFFAOYSA-N 6-oxo-2-phenyl-1h-pyrimidine-5-carboxylic acid Chemical class N1C(=O)C(C(=O)O)=CN=C1C1=CC=CC=C1 HADBIMYTRIMUAO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000220479 Acacia Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 208000019300 CLIPPERS Diseases 0.000 description 1
- 101100181929 Caenorhabditis elegans lin-3 gene Proteins 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 229910004149 HFSO3 Inorganic materials 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 101100385364 Listeria seeligeri serovar 1/2b (strain ATCC 35967 / DSM 20751 / CCM 3970 / CIP 100100 / NCTC 11856 / SLCC 3954 / 1120) cas13 gene Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 241001072332 Monia Species 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- FIWILGQIZHDAQG-UHFFFAOYSA-N NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F Chemical compound NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F FIWILGQIZHDAQG-UHFFFAOYSA-N 0.000 description 1
- 101100513046 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) eth-1 gene Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical compound NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- GPEHQHXBPDGGDP-UHFFFAOYSA-N acetonitrile;propan-2-one Chemical compound CC#N.CC(C)=O GPEHQHXBPDGGDP-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003741 agents affecting lipid metabolism Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229940024545 aluminum hydroxide Drugs 0.000 description 1
- 229940024546 aluminum hydroxide gel Drugs 0.000 description 1
- YDPLDMLRERBXAV-UHFFFAOYSA-N aluminum;triazide Chemical compound [Al+3].[N-]=[N+]=[N-].[N-]=[N+]=[N-].[N-]=[N+]=[N-] YDPLDMLRERBXAV-UHFFFAOYSA-N 0.000 description 1
- SMYKVLBUSSNXMV-UHFFFAOYSA-K aluminum;trihydroxide;hydrate Chemical compound O.[OH-].[OH-].[OH-].[Al+3] SMYKVLBUSSNXMV-UHFFFAOYSA-K 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 229940046545 animal allergen extract Drugs 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 230000009830 antibody antigen interaction Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- AVXQMQQYGHZGQA-UHFFFAOYSA-N benzenecarboximidamide;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.NC(=N)C1=CC=CC=C1 AVXQMQQYGHZGQA-UHFFFAOYSA-N 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-M benzenecarboximidate Chemical compound [NH-]C(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 238000012754 cardiac puncture Methods 0.000 description 1
- 101150098304 cas13a gene Proteins 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- FXYFCHIWHHJQLC-UHFFFAOYSA-N chembl15044 Chemical compound CCC(C)OC1=CC=CC=C1C(N=C1O)=NC=C1C1=NNN=N1 FXYFCHIWHHJQLC-UHFFFAOYSA-N 0.000 description 1
- IJOQOJJGZSTHEC-UHFFFAOYSA-N chembl15703 Chemical compound COC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 IJOQOJJGZSTHEC-UHFFFAOYSA-N 0.000 description 1
- ZXWFWNPZBJUFHU-UHFFFAOYSA-N chembl277963 Chemical compound CCCOC1=CC=C(N)C=C1C(NC1=O)=NC=C1C1=NN=NN1 ZXWFWNPZBJUFHU-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 208000021930 chronic lymphocytic inflammation with pontine perivascular enhancement responsive to steroids Diseases 0.000 description 1
- 229960001653 citalopram Drugs 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 230000000332 continued effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000003793 cyclohexylpropoxy group Chemical group [H]C([H])(O*)C([H])([H])C([H])([H])C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- OWZREIFADZCYQD-NSHGMRRFSA-N deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000009429 distress Effects 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229960005139 epinephrine Drugs 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- MFTDNOFYYUJVQN-UHFFFAOYSA-N ethyl 2-(2,4-dimethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=C(OC)C=C1OC MFTDNOFYYUJVQN-UHFFFAOYSA-N 0.000 description 1
- SGOISQDWJKLELV-UHFFFAOYSA-N ethyl 2-(2,5-dimethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC(OC)=CC=C1OC SGOISQDWJKLELV-UHFFFAOYSA-N 0.000 description 1
- QCQYODARJSKOCU-UHFFFAOYSA-N ethyl 2-(2-butoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound CCCCOC1=CC=CC=C1C1=NC=C(C(=O)OCC)C(=O)N1 QCQYODARJSKOCU-UHFFFAOYSA-N 0.000 description 1
- HHCBTMADUMSFOZ-UHFFFAOYSA-N ethyl 2-(2-ethoxy-5-nitrophenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC([N+]([O-])=O)=CC=C1OCC HHCBTMADUMSFOZ-UHFFFAOYSA-N 0.000 description 1
- BCXUQKLCLIQWQM-UHFFFAOYSA-N ethyl 2-(2-nitrophenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1[N+]([O-])=O BCXUQKLCLIQWQM-UHFFFAOYSA-N 0.000 description 1
- QRCGEXTZQXTKPB-UHFFFAOYSA-N ethyl 2-(4-chlorophenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=C(Cl)C=C1 QRCGEXTZQXTKPB-UHFFFAOYSA-N 0.000 description 1
- IKKKBBJLLAAYDF-UHFFFAOYSA-N ethyl 2-(5-amino-2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC(N)=CC=C1OCC IKKKBBJLLAAYDF-UHFFFAOYSA-N 0.000 description 1
- MJJUQSNYKBJGIC-UHFFFAOYSA-N ethyl 2-(5-methoxy-2-propoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound CCCOC1=CC=C(OC)C=C1C1=NC=C(C(=O)OCC)C(=O)N1 MJJUQSNYKBJGIC-UHFFFAOYSA-N 0.000 description 1
- QKMGPGCWMCPNJL-UHFFFAOYSA-N ethyl 2-(cyclopropylmethoxy)benzenecarboximidate Chemical compound CCOC(=N)C1=CC=CC=C1OCC1CC1 QKMGPGCWMCPNJL-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- IZSAXSKPGGVDKQ-UHFFFAOYSA-N ethyl 6-oxo-2-(2-prop-2-enoxyphenyl)-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OCC=C IZSAXSKPGGVDKQ-UHFFFAOYSA-N 0.000 description 1
- HJJTUMWNCSKZNW-UHFFFAOYSA-N ethyl 6-oxo-2-(2-propan-2-yloxyphenyl)-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OC(C)C HJJTUMWNCSKZNW-UHFFFAOYSA-N 0.000 description 1
- JSIHCFJCICVJHJ-UHFFFAOYSA-N ethyl 6-oxo-2-phenyl-1h-pyrimidine-5-carboxylate Chemical class N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1 JSIHCFJCICVJHJ-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- KRRYGFCJUCTWMH-UHFFFAOYSA-N fluorosulfonyloxyethane Chemical compound CCOS(F)(=O)=O KRRYGFCJUCTWMH-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- VQGDVXIMWWGBNY-UHFFFAOYSA-N methyl 2-carbamimidoylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C(N)=N VQGDVXIMWWGBNY-UHFFFAOYSA-N 0.000 description 1
- NZCNQOPLKTYKQB-UHFFFAOYSA-N methyl 2-ethoxy-5-methoxybenzenecarboximidate;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CCOC1=CC=C(OC)C=C1C(=N)OC NZCNQOPLKTYKQB-UHFFFAOYSA-N 0.000 description 1
- YXOZOCRLGICTPN-UHFFFAOYSA-N methyl 2-ethoxybenzenecarboximidate;methyl hydrogen sulfate Chemical compound COS(O)(=O)=O.CCOC1=CC=CC=C1C(=N)OC YXOZOCRLGICTPN-UHFFFAOYSA-N 0.000 description 1
- KBVGDNOKQIRHSD-UHFFFAOYSA-N methyl 3-carbamimidoyl-4-ethoxybenzoate Chemical compound C(=O)(OC)C=1C=CC(=C(C(=N)N)C1)OCC.C(=O)(OC)C=1C=CC(=C(C(=N)N)C1)OCC KBVGDNOKQIRHSD-UHFFFAOYSA-N 0.000 description 1
- OHSWRVNWUHUSSN-UHFFFAOYSA-N methyl 3-carbamoyl-4-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C(C(N)=O)=C1 OHSWRVNWUHUSSN-UHFFFAOYSA-N 0.000 description 1
- FGFLVXMKWVVLRQ-UHFFFAOYSA-N methyl hydrogen sulfate;methyl 2-propoxybenzenecarboximidate Chemical compound COS(O)(=O)=O.CCCOC1=CC=CC=C1C(=N)OC FGFLVXMKWVVLRQ-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical class COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TUGMLEAKHAEWFA-UHFFFAOYSA-N n-propoxybenzamide Chemical compound CCCONC(=O)C1=CC=CC=C1 TUGMLEAKHAEWFA-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004673 propylcarbonyl group Chemical group 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229960000581 salicylamide Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000013223 sprague-dawley female rat Methods 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229960001005 tuberculin Drugs 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
- C07D239/36—One oxygen atom as doubly bound oxygen atom or as unsubstituted hydroxy radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pulmonology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65778776A | 1976-02-13 | 1976-02-13 | |
| US657,787 | 1976-02-13 | ||
| US05/748,851 US4082751A (en) | 1976-02-13 | 1976-12-08 | Therapeutic agents |
| US748,851 | 1991-08-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1083152A true CA1083152A (en) | 1980-08-05 |
Family
ID=27097492
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA271,406A Expired CA1083152A (en) | 1976-02-13 | 1977-02-09 | Phenyl-tetrazolyl-pyrimidin-4-one therapeutic agents |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS52118481A (enExample) |
| AU (1) | AU508970B2 (enExample) |
| CA (1) | CA1083152A (enExample) |
| CH (1) | CH635339A5 (enExample) |
| DE (1) | DE2705609A1 (enExample) |
| DK (1) | DK149044C (enExample) |
| FI (1) | FI62533C (enExample) |
| FR (1) | FR2340943A1 (enExample) |
| GB (1) | GB1541351A (enExample) |
| IE (1) | IE44603B1 (enExample) |
| LU (1) | LU76722A1 (enExample) |
| NL (1) | NL173055C (enExample) |
| SE (1) | SE433494B (enExample) |
| YU (1) | YU41567B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4419357A (en) * | 1982-01-18 | 1983-12-06 | The Dow Chemical Company | 3-(1H-Tetrazol-5-yl)-4(3H)-quinazolinones |
| CN101747282A (zh) * | 2008-12-10 | 2010-06-23 | 上海特化医药科技有限公司 | 一类含有嘧啶酮苯基的化合物、其药物组合物及其制备方法和用途 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3883653A (en) * | 1972-10-24 | 1975-05-13 | Pfizer | Method of preventing asthmatic symptoms |
-
1977
- 1977-02-03 AU AU21895/77A patent/AU508970B2/en not_active Expired
- 1977-02-08 LU LU76722A patent/LU76722A1/xx unknown
- 1977-02-09 GB GB5437/77A patent/GB1541351A/en not_active Expired
- 1977-02-09 CA CA271,406A patent/CA1083152A/en not_active Expired
- 1977-02-09 FI FI770427A patent/FI62533C/fi not_active IP Right Cessation
- 1977-02-09 FR FR7703650A patent/FR2340943A1/fr active Granted
- 1977-02-10 DE DE19772705609 patent/DE2705609A1/de active Granted
- 1977-02-10 DK DK57377A patent/DK149044C/da not_active IP Right Cessation
- 1977-02-11 CH CH173477A patent/CH635339A5/de not_active IP Right Cessation
- 1977-02-11 SE SE7701552A patent/SE433494B/xx not_active IP Right Cessation
- 1977-02-11 YU YU354/77A patent/YU41567B/xx unknown
- 1977-02-11 IE IE297/77A patent/IE44603B1/en unknown
- 1977-02-11 NL NLAANVRAGE7701483,A patent/NL173055C/xx not_active IP Right Cessation
- 1977-02-14 JP JP1433577A patent/JPS52118481A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE433494B (sv) | 1984-05-28 |
| IE44603B1 (en) | 1982-01-27 |
| IE44603L (en) | 1977-08-13 |
| DE2705609A1 (de) | 1977-08-25 |
| FI62533C (fi) | 1983-01-10 |
| YU35477A (en) | 1982-10-31 |
| NL7701483A (nl) | 1977-08-16 |
| FI62533B (fi) | 1982-09-30 |
| JPS6139947B2 (enExample) | 1986-09-06 |
| FR2340943A1 (fr) | 1977-09-09 |
| FI770427A7 (enExample) | 1977-08-14 |
| LU76722A1 (enExample) | 1977-08-18 |
| YU41567B (en) | 1987-10-31 |
| SE7701552L (sv) | 1977-09-23 |
| NL173055C (nl) | 1983-12-01 |
| DK57377A (da) | 1977-08-14 |
| DK149044B (da) | 1985-12-30 |
| DK149044C (da) | 1986-06-02 |
| GB1541351A (en) | 1979-02-28 |
| AU2189577A (en) | 1978-08-10 |
| DE2705609C2 (enExample) | 1988-12-15 |
| NL173055B (nl) | 1983-07-01 |
| JPS52118481A (en) | 1977-10-04 |
| CH635339A5 (en) | 1983-03-31 |
| FR2340943B1 (enExample) | 1981-01-09 |
| AU508970B2 (en) | 1980-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1098520A (en) | Optionally substituted 3-(1h-tetrazol-5-yl)-4h- pyrido¬1,2-a| pyrimidin-4-ones | |
| US4880810A (en) | Quinazolinediones and pyridopyrimidinediones | |
| NZ227125A (en) | Quinazoline derivatives and pharmaceutical compositions | |
| CA1248532A (en) | Pyrazolo¬3,4-b|pyridine derivatives and process for producing them | |
| JPH09301958A (ja) | 新規ピリミジン化合物及び抗ロタウイルス剤 | |
| US4829058A (en) | Substituted bis-(4-aminophenyl)-sulfones | |
| JPS6312871B2 (enExample) | ||
| NZ207761A (en) | Pyrimidine derivatives and pharmaceutical compositions | |
| US4082751A (en) | Therapeutic agents | |
| CA1083152A (en) | Phenyl-tetrazolyl-pyrimidin-4-one therapeutic agents | |
| US4031093A (en) | 1,6-Dihydro-6-oxo-2-(ortho-substituted phenyl)pyrimidine-5-carboxylic acid derivatives | |
| US4209620A (en) | Substituted 3-(1H-tetrazol-5-yl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives having antiallergy activity | |
| EP0244201B1 (en) | 3-hydroxypyridines | |
| US4797403A (en) | Quinazolinediones and pyridopyrimidinediones | |
| CA1117112A (en) | Pyrido¬1,2-a|pyrimidine-3-n-(1h-tetrazol-5-yl| carboxamide derivatives | |
| IE41673B1 (en) | Fused pyrimidines and preparation thereof | |
| CA1050556A (en) | Aminopyrrole derivatives | |
| CA1060441A (en) | Anti-allergic n-(5-tetrazolyl)-1-oxo-1h-6-alkox-ypyrimido (1,2-a)-quinoline-2-carboxamides and intermediates therefor | |
| US3968213A (en) | Method of preventing asthmatic symptoms | |
| Habib et al. | Ylides of heterocycles. VII.. I‐, N‐, P‐and S‐ylides of pyrimidones | |
| US3974161A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| US3957784A (en) | Bis(4-[4'-hydroxy-5'-carboxy-2'-pyrimidinyl]phenoxy)alkanes | |
| US3927214A (en) | Method of preventing asthmatic symptoms | |
| US4044134A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| Becher et al. | Pyridinethiones. IX preparation of ricinidine, thioricinidine and other 2 (1H)‐pyridones and‐thiones related to nicotinic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |