CA1078699A - Manicuring unit - Google Patents
Manicuring unitInfo
- Publication number
- CA1078699A CA1078699A CA264,837A CA264837A CA1078699A CA 1078699 A CA1078699 A CA 1078699A CA 264837 A CA264837 A CA 264837A CA 1078699 A CA1078699 A CA 1078699A
- Authority
- CA
- Canada
- Prior art keywords
- gear
- motor
- unit
- manicuring
- casing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002596 correlated effect Effects 0.000 claims abstract description 5
- 230000002093 peripheral effect Effects 0.000 claims description 3
- 230000000295 complement effect Effects 0.000 claims 1
- 230000000717 retained effect Effects 0.000 abstract description 2
- 210000000282 nail Anatomy 0.000 description 18
- 230000003370 grooming effect Effects 0.000 description 8
- 238000005498 polishing Methods 0.000 description 6
- 230000003068 static effect Effects 0.000 description 5
- 210000004905 finger nail Anatomy 0.000 description 4
- 210000004906 toe nail Anatomy 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 3
- 230000000994 depressogenic effect Effects 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BALXUFOVQVENIU-KXNXZCPBSA-N pseudoephedrine hydrochloride Chemical compound [H+].[Cl-].CN[C@@H](C)[C@@H](O)C1=CC=CC=C1 BALXUFOVQVENIU-KXNXZCPBSA-N 0.000 description 2
- 238000005476 soldering Methods 0.000 description 2
- 101150034533 ATIC gene Proteins 0.000 description 1
- 241000282979 Alces alces Species 0.000 description 1
- 229930186657 Lat Natural products 0.000 description 1
- 101100286668 Mus musculus Irak1bp1 gene Proteins 0.000 description 1
- 102100026933 Myelin-associated neurite-outgrowth inhibitor Human genes 0.000 description 1
- 241000237509 Patinopecten sp. Species 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000006854 communication Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 235000020637 scallop Nutrition 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- ACXGJHCPFCFILV-UHFFFAOYSA-M sodium;2-(4-chloro-2-methylphenoxy)acetate;3,6-dichloro-2-methoxybenzoic acid Chemical compound [Na+].COC1=C(Cl)C=CC(Cl)=C1C(O)=O.CC1=CC(Cl)=CC=C1OCC([O-])=O ACXGJHCPFCFILV-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45D—HAIRDRESSING OR SHAVING EQUIPMENT; EQUIPMENT FOR COSMETICS OR COSMETIC TREATMENTS, e.g. FOR MANICURING OR PEDICURING
- A45D29/00—Manicuring or pedicuring implements
- A45D29/18—Manicure or pedicure sets, e.g. combinations without case, etui, or the like
Landscapes
- Brushes (AREA)
- Finish Polishing, Edge Sharpening, And Grinding By Specific Grinding Devices (AREA)
- Connection Of Motors, Electrical Generators, Mechanical Devices, And The Like (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA340,224A CA1082072A (en) | 1976-05-06 | 1979-11-20 | Manicuring unit |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/683,854 US4103694A (en) | 1976-05-06 | 1976-05-06 | Manicuring unit |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1078699A true CA1078699A (en) | 1980-06-03 |
Family
ID=24745721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA264,837A Expired CA1078699A (en) | 1976-05-06 | 1976-11-03 | Manicuring unit |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4103694A (member.php) |
| JP (1) | JPS534653A (member.php) |
| AU (1) | AU503372B2 (member.php) |
| BE (1) | BE854154A (member.php) |
| CA (1) | CA1078699A (member.php) |
| CH (1) | CH621053A5 (member.php) |
| DE (2) | DE2720496C3 (member.php) |
| DK (1) | DK145772C (member.php) |
| FR (1) | FR2350069A1 (member.php) |
| GB (2) | GB1548558A (member.php) |
| GR (1) | GR69595B (member.php) |
| HK (2) | HK77779A (member.php) |
| IE (1) | IE45050B1 (member.php) |
| IT (1) | IT1078189B (member.php) |
| LU (1) | LU77267A1 (member.php) |
| NL (1) | NL172297C (member.php) |
| SE (1) | SE7705180L (member.php) |
| ZA (1) | ZA772657B (member.php) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5535639A (en) * | 1978-08-31 | 1980-03-12 | Matsushita Electric Works Ltd | Motor manicure instrument |
| JPS5535640A (en) * | 1978-08-31 | 1980-03-12 | Matsushita Electric Works Ltd | Motor manicure instrument |
| USD266111S (en) | 1980-06-19 | 1982-09-07 | Doyel John S | Personal care appliance |
| US4408623A (en) * | 1981-06-26 | 1983-10-11 | Grant Murray | Electrical manicuring device |
| US4683897A (en) * | 1985-05-08 | 1987-08-04 | Mcbride Julia K | Electric nail filing device |
| US4854334A (en) * | 1987-11-19 | 1989-08-08 | Su Hsiu Kuei | Nail trimmer |
| DE3934373A1 (de) * | 1989-10-14 | 1991-04-25 | Johann Binder | Handbuerste |
| US5643062A (en) * | 1995-05-23 | 1997-07-01 | James R. Joseph | Manicure machine |
| US6799579B2 (en) | 2003-01-29 | 2004-10-05 | James R. Joseph | Fingernail and toenail shaping apparatus |
| US6865812B1 (en) | 2004-03-31 | 2005-03-15 | Roy C. Martin, Jr. | Nail trimmer |
| US7694419B2 (en) | 2005-04-27 | 2010-04-13 | The Gillette Company | Battery-operated appliances |
| GB2427136A (en) * | 2005-06-18 | 2006-12-20 | Shiann-Torng Chern | Motorised fingernail filing assembly |
| US20100000557A1 (en) * | 2008-07-07 | 2010-01-07 | Adam Barnett Keene | Illuminated Filing Device |
| USD600413S1 (en) * | 2008-07-10 | 2009-09-15 | Telebrands Corp. | Pet nail filer |
| KR101260227B1 (ko) * | 2011-03-11 | 2013-05-02 | 송용능 | 각질 제거장치 |
| US10396294B2 (en) * | 2013-12-27 | 2019-08-27 | Samsung Electronics Co., Ltd. | Carbazole compound and organic light-emitting device including the same |
| USD781496S1 (en) * | 2015-03-05 | 2017-03-14 | Reckitt Benckiser (Brands) Limited | Nail care instrument |
| USD781497S1 (en) * | 2015-03-05 | 2017-03-14 | Reckitt Benckiser (Brands) Limited | Nail care instrument without lid |
| USD751762S1 (en) | 2015-07-27 | 2016-03-15 | E. Mishan & Sons, Inc. | Nail buffer |
| US9901157B2 (en) | 2015-08-11 | 2018-02-27 | Soft Lines International, Ltd. | Nail care device |
| USD788981S1 (en) * | 2015-08-11 | 2017-06-06 | Soft Lines International, Ltd. | Nail and skin abrasion device |
| USD788369S1 (en) * | 2015-08-11 | 2017-05-30 | Soft Lines International, Ltd. | Nail care device |
| USD788983S1 (en) * | 2015-11-25 | 2017-06-06 | Soft Lines International, Ltd. | Nail and skin abrasion device |
| USD788984S1 (en) * | 2015-11-25 | 2017-06-06 | Soft Lines International, Ltd. | Nail care device |
| USD798505S1 (en) * | 2016-04-07 | 2017-09-26 | James Crosson | Electric nail file |
| US11612229B1 (en) | 2019-04-30 | 2023-03-28 | Pedicure, Inc. | Long handled motorized toenail trimmer |
| USD1030146S1 (en) | 2020-09-25 | 2024-06-04 | Church & Dwight Co., Inc. | Nail trimming device |
| USD1026326S1 (en) | 2020-11-02 | 2024-05-07 | Church & Dwight Co., Inc. | Pedicure device |
| USD1058932S1 (en) | 2020-11-02 | 2025-01-21 | Church & Dwight Co., Inc. | Pedicure device |
| USD1067522S1 (en) * | 2024-09-12 | 2025-03-18 | Mingliang Yuan | Foot grinder |
| USD1074061S1 (en) * | 2024-10-18 | 2025-05-06 | Cuihong Huang | Electric foot callus remover |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1666619A (en) * | 1927-01-15 | 1928-04-17 | Eberhardt Edward Leonard | Manicuring implement |
| US1915305A (en) * | 1929-11-06 | 1933-06-27 | Miles H Gallagher | Manicuring device |
| US2258012A (en) * | 1939-08-07 | 1941-10-07 | Jeannotte Emile Alexandre | Nail manicure machine |
| US2597525A (en) * | 1948-06-15 | 1952-05-20 | Aristocraft Manicuring Company | Power-driven manicuring device |
| FR1126287A (fr) * | 1955-06-18 | 1956-11-19 | Meules électriques pour la toilette des ongles | |
| US2880737A (en) * | 1956-04-27 | 1959-04-07 | John W Tone | Manicuring device |
| DE1457446A1 (de) * | 1963-09-20 | 1969-01-16 | Paul Kg Alfred | Geraet zum Pflegen von Finger- und Zehennaegeln |
| US3420250A (en) * | 1966-04-25 | 1969-01-07 | Gen Electric | Electric manicurist power handle |
| DE1782586A1 (de) * | 1968-09-20 | 1971-10-14 | Bosch Gmbh Robert | Manikuergeraet |
| JPS4818371B1 (member.php) * | 1969-01-20 | 1973-06-05 | ||
| BE738159A (member.php) * | 1969-08-29 | 1970-02-02 |
-
1976
- 1976-05-06 US US05/683,854 patent/US4103694A/en not_active Expired - Lifetime
- 1976-11-03 CA CA264,837A patent/CA1078699A/en not_active Expired
-
1977
- 1977-04-26 GR GR53295A patent/GR69595B/el unknown
- 1977-04-27 AU AU24609/77A patent/AU503372B2/en not_active Expired
- 1977-04-29 FR FR7712960A patent/FR2350069A1/fr active Granted
- 1977-04-29 BE BE177179A patent/BE854154A/xx not_active IP Right Cessation
- 1977-05-03 ZA ZA00772657A patent/ZA772657B/xx unknown
- 1977-05-03 NL NLAANVRAGE7704852,A patent/NL172297C/xx not_active IP Right Cessation
- 1977-05-04 IT IT49261/77A patent/IT1078189B/it active
- 1977-05-04 DK DK196677A patent/DK145772C/da not_active IP Right Cessation
- 1977-05-04 SE SE7705180A patent/SE7705180L/ unknown
- 1977-05-05 GB GB18883/77A patent/GB1548558A/en not_active Expired
- 1977-05-05 IE IE914/77A patent/IE45050B1/en unknown
- 1977-05-05 LU LU77267A patent/LU77267A1/xx unknown
- 1977-05-06 DE DE2720496A patent/DE2720496C3/de not_active Expired
- 1977-05-06 CH CH572477A patent/CH621053A5/de not_active IP Right Cessation
- 1977-05-06 DE DE19777714455U patent/DE7714455U1/de not_active Expired
- 1977-05-06 JP JP5190777A patent/JPS534653A/ja active Pending
-
1978
- 1978-07-12 GB GB29631/78A patent/GB1548559A/en not_active Expired
-
1979
- 1979-11-08 HK HK777/79A patent/HK77779A/xx unknown
- 1979-11-08 HK HK776/79A patent/HK77679A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1548558A (en) | 1979-07-18 |
| LU77267A1 (member.php) | 1977-12-13 |
| IT1078189B (it) | 1985-05-08 |
| DK145772C (da) | 1983-08-29 |
| GR69595B (member.php) | 1982-07-05 |
| AU503372B2 (en) | 1979-08-30 |
| US4103694A (en) | 1978-08-01 |
| GB1548559A (en) | 1979-07-18 |
| DE2720496A1 (de) | 1977-12-08 |
| DE2720496C3 (de) | 1982-02-25 |
| FR2350069A1 (fr) | 1977-12-02 |
| NL172297B (nl) | 1983-03-16 |
| IE45050L (en) | 1977-11-06 |
| DK196677A (da) | 1977-11-07 |
| SE7705180L (sv) | 1977-11-07 |
| FR2350069B1 (member.php) | 1984-02-17 |
| DE2720496B2 (de) | 1981-07-02 |
| NL172297C (nl) | 1983-08-16 |
| CH621053A5 (member.php) | 1981-01-15 |
| DE7714455U1 (de) | 1980-03-13 |
| IE45050B1 (en) | 1982-06-16 |
| BE854154A (fr) | 1977-10-31 |
| HK77679A (en) | 1979-11-16 |
| HK77779A (en) | 1979-11-16 |
| JPS534653A (en) | 1978-01-17 |
| ZA772657B (en) | 1978-08-30 |
| AU2460977A (en) | 1978-11-02 |
| NL7704852A (nl) | 1977-11-08 |
| DK145772B (da) | 1983-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1078699A (en) | Manicuring unit | |
| US4213471A (en) | Manicuring unit | |
| EP1960162B1 (en) | Hair-cutting device for self-users | |
| EP0899066A2 (en) | Power tool having interchangeable tool head | |
| US4854334A (en) | Nail trimmer | |
| US3921298A (en) | Dental and surgical appliance | |
| EP0936032A2 (en) | Power tool | |
| EP1982613A2 (en) | Electric nail polisher | |
| US4815507A (en) | Socket mounted pencil sharpener for cosmetic facial pencil | |
| DE2755975A1 (de) | Motorisch getriebenes zahnpflegegeraet | |
| US5513411A (en) | Battery contact cleaning tool | |
| CA1082072A (en) | Manicuring unit | |
| KR200367485Y1 (ko) | 돋보기가 구비된 손톱깍기 | |
| KR200242010Y1 (ko) | 전동식 손톱소제기 | |
| KR101901288B1 (ko) | 전동식 네일 미용기 | |
| CN218354998U (zh) | 一种电动磨甲器 | |
| KR200220262Y1 (ko) | 휴대용 미니 손톱정리기 | |
| CN2211740Y (zh) | 电动指甲修磨器 | |
| CN218875518U (zh) | 可拆卸更换刀头组件的修毛器 | |
| KR100458742B1 (ko) | 손톱미용용 확대경 | |
| KR200207431Y1 (ko) | 전기 손톱깎이 | |
| KR19990062335A (ko) | 자동 손톱깎이 | |
| KR20030037662A (ko) | 손톱연마기 | |
| JP3060688U (ja) | 多目的工具 | |
| JP2002186517A (ja) | 万能型爪整形器 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |