CA1078090A - Thermoplastic moulding compositions - Google Patents
Thermoplastic moulding compositionsInfo
- Publication number
- CA1078090A CA1078090A CA272,535A CA272535A CA1078090A CA 1078090 A CA1078090 A CA 1078090A CA 272535 A CA272535 A CA 272535A CA 1078090 A CA1078090 A CA 1078090A
- Authority
- CA
- Canada
- Prior art keywords
- moulding compound
- weight
- compound according
- copolyester
- poly
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004415 thermoplastic moulding composition Substances 0.000 title description 2
- 229920001634 Copolyester Polymers 0.000 claims abstract description 34
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims abstract description 12
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 9
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229920001283 Polyalkylene terephthalate Polymers 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 239000004609 Impact Modifier Substances 0.000 claims abstract description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- 239000000206 moulding compound Substances 0.000 claims description 33
- 239000000203 mixture Substances 0.000 claims description 19
- -1 polyethylene Polymers 0.000 claims description 10
- 229920000728 polyester Polymers 0.000 claims description 9
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 239000004698 Polyethylene Substances 0.000 claims description 5
- 238000000465 moulding Methods 0.000 claims description 5
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 239000012763 reinforcing filler Substances 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 238000001125 extrusion Methods 0.000 claims description 3
- 239000003063 flame retardant Substances 0.000 claims description 3
- 238000002347 injection Methods 0.000 claims description 3
- 239000007924 injection Substances 0.000 claims description 3
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims description 3
- 239000004416 thermosoftening plastic Substances 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 238000010348 incorporation Methods 0.000 claims 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims 1
- ALOUNLDAKADEEB-UHFFFAOYSA-N dimethyl sebacate Chemical compound COC(=O)CCCCCCCCC(=O)OC ALOUNLDAKADEEB-UHFFFAOYSA-N 0.000 description 22
- 239000008187 granular material Substances 0.000 description 13
- 229940014772 dimethyl sebacate Drugs 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 8
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 6
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 6
- 229920005601 base polymer Polymers 0.000 description 5
- 230000000630 rising effect Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 229920001577 copolymer Chemical class 0.000 description 3
- 238000001746 injection moulding Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229920001281 polyalkylene Polymers 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- AQPHBYQUCKHJLT-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene Chemical group BrC1=C(Br)C(Br)=C(Br)C(Br)=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br AQPHBYQUCKHJLT-UHFFFAOYSA-N 0.000 description 1
- RUEIBQJFGMERJD-UHFFFAOYSA-N 1,2,3,4,5-pentachloro-6-(2-chlorophenyl)benzene Chemical group ClC1=CC=CC=C1C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl RUEIBQJFGMERJD-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- GBURUDXSBYGPBL-UHFFFAOYSA-N 2,2,3-trimethylhexanedioic acid Chemical compound OC(=O)C(C)(C)C(C)CCC(O)=O GBURUDXSBYGPBL-UHFFFAOYSA-N 0.000 description 1
- ZPJDFKVKOFGAFV-UHFFFAOYSA-N 2-octadecylbutanedioic acid Chemical compound CCCCCCCCCCCCCCCCCCC(C(O)=O)CC(O)=O ZPJDFKVKOFGAFV-UHFFFAOYSA-N 0.000 description 1
- LAWHHRXCBUNWFI-UHFFFAOYSA-N 2-pentylpropanedioic acid Chemical compound CCCCCC(C(O)=O)C(O)=O LAWHHRXCBUNWFI-UHFFFAOYSA-N 0.000 description 1
- SMTKGALBDOEZCA-UHFFFAOYSA-N 2-tetradecylpropanedioic acid Chemical compound CCCCCCCCCCCCCCC(C(O)=O)C(O)=O SMTKGALBDOEZCA-UHFFFAOYSA-N 0.000 description 1
- BJDDKZDZTHIIJB-UHFFFAOYSA-N 4,5,6,7-tetrafluoro-2-benzofuran-1,3-dione Chemical compound FC1=C(F)C(F)=C2C(=O)OC(=O)C2=C1F BJDDKZDZTHIIJB-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- KYXHKHDZJSDWEF-LHLOQNFPSA-N CCCCCCC1=C(CCCCCC)C(\C=C\CCCCCCCC(O)=O)C(CCCCCCCC(O)=O)CC1 Chemical compound CCCCCCC1=C(CCCCCC)C(\C=C\CCCCCCCC(O)=O)C(CCCCCCCC(O)=O)CC1 KYXHKHDZJSDWEF-LHLOQNFPSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- WHHGLZMJPXIBIX-UHFFFAOYSA-N decabromodiphenyl ether Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br WHHGLZMJPXIBIX-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 238000009429 electrical wiring Methods 0.000 description 1
- 229920006351 engineering plastic Polymers 0.000 description 1
- 239000006081 fluorescent whitening agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- WMUFHDYXFASDAE-UHFFFAOYSA-N hydron;2-octadecylpropanedioate Chemical compound CCCCCCCCCCCCCCCCCCC(C(O)=O)C(O)=O WMUFHDYXFASDAE-UHFFFAOYSA-N 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 150000002889 oleic acids Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- ARERIMFZYPFJAV-UHFFFAOYSA-N tetrabromodiphenyl ethers Chemical compound C1=CC(Br)=CC=C1OC1=CC=C(Br)C(Br)=C1Br ARERIMFZYPFJAV-UHFFFAOYSA-N 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000010456 wollastonite Substances 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH239976A CH594715A5 (enExample) | 1976-02-26 | 1976-02-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1078090A true CA1078090A (en) | 1980-05-20 |
Family
ID=4232868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA272,535A Expired CA1078090A (en) | 1976-02-26 | 1977-02-24 | Thermoplastic moulding compositions |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4131595A (enExample) |
| JP (1) | JPS52119658A (enExample) |
| CA (1) | CA1078090A (enExample) |
| CH (1) | CH594715A5 (enExample) |
| DE (1) | DE2707852A1 (enExample) |
| FR (1) | FR2342317A1 (enExample) |
| GB (1) | GB1536832A (enExample) |
| NL (1) | NL190526C (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4381379A (en) * | 1981-03-25 | 1983-04-26 | Daicel Chemical Industries, Ltd. | Polyester containing 2-methyl-1,3-propylene terephthalate units |
| US4336343A (en) * | 1981-06-25 | 1982-06-22 | Morris Township, Morris County | Polyester molding compositions having increased crystallization temperatures |
| US4390668A (en) * | 1981-12-02 | 1983-06-28 | Baxter Travenol Laboratories, Inc. | Autoclavable thermoplastic material which is heat bondable to a cannula and the like |
| US4403990A (en) * | 1981-12-02 | 1983-09-13 | Baxter Travenol Laboratories, Inc. | Support assembly for a cannula and the like |
| US4391938A (en) * | 1982-02-16 | 1983-07-05 | Rohm And Haas Company | Polyethylene terephthalate compositions having improved crystallization rate and surface appearance |
| EP0088263A1 (en) * | 1982-03-03 | 1983-09-14 | General Electric Company | Molding composition |
| DE3239413A1 (de) * | 1982-10-25 | 1984-04-26 | Chemische Werke Hüls AG, 4370 Marl | Formmassen mit hoher zaehigkeit und heisswasserbestaendigkeit |
| TW204357B (enExample) * | 1988-12-29 | 1993-04-21 | Ciba Geigy Ag | |
| CA2020276A1 (en) * | 1989-07-05 | 1991-01-06 | Terutaka Sano | Polybutylene terephthalate resin molded article having pictorial pattern formed thereon and process for preparation thereof |
| CA2021887A1 (en) * | 1989-07-26 | 1991-01-27 | Shigeru Nedzu | Polyalkylene terephthalate resin molded article having pictorial pattern formed thereon and process for preparation thereof |
| CA2022667A1 (en) * | 1989-08-09 | 1991-02-10 | Yoichi Ebina | Polybutylene terephthalate resin molded article having pictorial pattern formed thereon and process for preparing thereof |
| DE4315208A1 (de) * | 1993-05-07 | 1994-11-10 | Basf Ag | Flammgeschützte thermoplastische Copolyesterformmassen |
| US5865530A (en) * | 1996-02-15 | 1999-02-02 | Valeo Sylvania | Filled resin lamp reflector with no base coat and method of making |
| US6475618B1 (en) * | 2001-03-21 | 2002-11-05 | Kimberly-Clark Worldwide, Inc. | Compositions for enhanced thermal bonding |
| US6921803B2 (en) * | 2002-07-11 | 2005-07-26 | E.I. Du Pont De Nemours And Company | Poly(trimethylene terephthalate) fibers, their manufacture and use |
| US6967057B2 (en) * | 2002-12-19 | 2005-11-22 | E.I. Du Pont De Nemours And Company | Poly(trimethylene dicarboxylate) fibers, their manufacture and use |
| ITMI20050452A1 (it) * | 2005-03-18 | 2006-09-19 | Novamont Spa | Poliestere biodegradabile alifatico-aromatico |
| US8148489B2 (en) * | 2006-03-24 | 2012-04-03 | E. I. Du Pont De Nemours And Company | Thermoplastic resins containing PBT units, having reduced organic carbon emissions |
| ITMI20062469A1 (it) * | 2006-12-21 | 2008-06-22 | Novamont Spa | Composizione polimerica comprendente poliolefine e copoliesteri alifatico-aromatici |
| CN107974051A (zh) * | 2016-10-21 | 2018-05-01 | 中国石油化工股份有限公司 | 一种聚酯组合物及其制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE756520A (fr) * | 1969-09-25 | 1971-03-23 | Ici Ltd | Melanges de polymeres thermoplastiques |
| US3644267A (en) * | 1970-01-28 | 1972-02-22 | Eastman Kodak Co | Low-viscosity high-strength thermoplastic adhesive |
| US3673139A (en) * | 1970-04-06 | 1972-06-27 | Sandoz Ltd | Process for the production of injection moulded and extrusion moulded polyester products |
| US3953394A (en) * | 1971-11-15 | 1976-04-27 | General Electric Company | Polyester alloys and molding compositions containing the same |
| US3795644A (en) * | 1972-08-15 | 1974-03-05 | Eastman Kodak Co | Hot melt adhesive composition |
| CA1059676A (en) * | 1973-06-14 | 1979-07-31 | Clyde E. Gleim | Flame retardant polyester compositions |
| DE2440174A1 (de) * | 1973-09-17 | 1975-03-20 | Celanese Corp | Polyestergemische |
| CH595416A5 (enExample) * | 1975-04-18 | 1978-02-15 | Ciba Geigy Ag |
-
1976
- 1976-02-26 CH CH239976A patent/CH594715A5/xx not_active IP Right Cessation
-
1977
- 1977-02-16 US US05/769,357 patent/US4131595A/en not_active Expired - Lifetime
- 1977-02-21 NL NLAANVRAGE7701843,A patent/NL190526C/xx not_active IP Right Cessation
- 1977-02-23 DE DE19772707852 patent/DE2707852A1/de active Granted
- 1977-02-24 CA CA272,535A patent/CA1078090A/en not_active Expired
- 1977-02-25 GB GB8081/77A patent/GB1536832A/en not_active Expired
- 1977-02-26 JP JP2075677A patent/JPS52119658A/ja active Granted
- 1977-02-28 FR FR7705758A patent/FR2342317A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NL190526B (nl) | 1993-11-01 |
| FR2342317A1 (fr) | 1977-09-23 |
| NL7701843A (nl) | 1977-08-30 |
| GB1536832A (en) | 1978-12-20 |
| NL190526C (nl) | 1994-04-05 |
| DE2707852C2 (enExample) | 1993-02-11 |
| JPS6216975B2 (enExample) | 1987-04-15 |
| JPS52119658A (en) | 1977-10-07 |
| CH594715A5 (enExample) | 1978-01-31 |
| US4131595A (en) | 1978-12-26 |
| FR2342317B1 (enExample) | 1979-03-09 |
| DE2707852A1 (de) | 1977-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1078090A (en) | Thermoplastic moulding compositions | |
| CA1052489A (en) | Glass fibre-reinforced flame-resistant thermoplastic polyester moulding compositions | |
| US5965648A (en) | Poly(alkylene ether)s as plasticizers and flow aids in poly (1,4-cyclohexanedimethylene terephthalate) resins | |
| US4125571A (en) | Thermoplastic molding composition | |
| CA1149099A (en) | Modified polyalkylene terephthalate composition | |
| EP0020693B1 (en) | Copolyesters of polybutylene terephthalate | |
| GB1580348A (en) | Filler reinforced moulding compositions | |
| US4772652A (en) | Copolyester and polyester resin composition comprising said copolyester | |
| US4161469A (en) | Polyalkylene terephthalate and organopolysiloxane-polycarbonate block copolymer blends | |
| US3950301A (en) | Light stabilized polyester resin composition | |
| KR960015448B1 (ko) | 개질 폴리에스테르 | |
| EP0484105A2 (en) | Thermoplastic polyester resin composition | |
| CA1080385A (en) | Butylene terephalate copolyestes containing fibrous reinforcement | |
| CA1228195A (en) | Aromatic copolyester derived from aromatic dicarboxylic acid component and aromatic diol component | |
| USH1987H1 (en) | Non-volatile plasticizers and flow aids for polyesters | |
| US4271063A (en) | Thermoplastic molding compositions | |
| US5089598A (en) | Endcapped, chain-extended and branched polyesters | |
| JPH06240121A (ja) | 熱可塑性樹脂組成物 | |
| JPH0473461B2 (enExample) | ||
| JPS5812909B2 (ja) | 耐熱性ポリエステル組成物 | |
| US5994451A (en) | Polytrimethylene terephthalate composition | |
| US4145335A (en) | Thermoplastic copolyesters based on poly-1,4-butylene terephthalate | |
| CA1263787A (en) | Polyethylene terephthalate molding composition | |
| JP3040578B2 (ja) | ポリエステル樹脂組成物 | |
| JP2665074B2 (ja) | ポリエステルの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |