CA1075233A - Highly absorbent modified polysaccharides - Google Patents
Highly absorbent modified polysaccharidesInfo
- Publication number
- CA1075233A CA1075233A CA257,545A CA257545A CA1075233A CA 1075233 A CA1075233 A CA 1075233A CA 257545 A CA257545 A CA 257545A CA 1075233 A CA1075233 A CA 1075233A
- Authority
- CA
- Canada
- Prior art keywords
- water
- polysaccharide
- acrylamide
- product
- soluble
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000004676 glycans Chemical class 0.000 title claims abstract description 55
- 239000005017 polysaccharide Substances 0.000 title claims abstract description 55
- 229920001282 polysaccharide Polymers 0.000 title claims abstract description 52
- 239000002250 absorbent Substances 0.000 title abstract description 14
- 230000002745 absorbent Effects 0.000 title abstract description 14
- 239000000178 monomer Substances 0.000 claims abstract description 57
- 238000000034 method Methods 0.000 claims abstract description 45
- 229920002554 vinyl polymer Polymers 0.000 claims abstract description 40
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims abstract description 23
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims abstract description 21
- 229920001577 copolymer Polymers 0.000 claims abstract description 19
- 229920002678 cellulose Polymers 0.000 claims abstract description 15
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims abstract description 14
- 239000001913 cellulose Substances 0.000 claims abstract description 14
- 229920002472 Starch Polymers 0.000 claims abstract description 8
- 235000019698 starch Nutrition 0.000 claims abstract description 6
- 239000008107 starch Substances 0.000 claims abstract description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 92
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 84
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 58
- 239000007788 liquid Substances 0.000 claims description 50
- 238000006243 chemical reaction Methods 0.000 claims description 30
- 229940022682 acetone Drugs 0.000 claims description 28
- 239000000463 material Substances 0.000 claims description 21
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical group C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 claims description 17
- 235000010980 cellulose Nutrition 0.000 claims description 14
- 229920001059 synthetic polymer Polymers 0.000 claims description 13
- 239000003085 diluting agent Substances 0.000 claims description 11
- 239000000376 reactant Substances 0.000 claims description 11
- PQUXFUBNSYCQAL-UHFFFAOYSA-N 1-(2,3-difluorophenyl)ethanone Chemical group CC(=O)C1=CC=CC(F)=C1F PQUXFUBNSYCQAL-UHFFFAOYSA-N 0.000 claims description 10
- 229940047670 sodium acrylate Drugs 0.000 claims description 10
- 229940107304 oxidized cellulose Drugs 0.000 claims description 9
- 239000012429 reaction media Substances 0.000 claims description 9
- 229920002201 Oxidized cellulose Polymers 0.000 claims description 8
- 239000012266 salt solution Substances 0.000 claims description 8
- 238000012546 transfer Methods 0.000 claims description 8
- 238000009835 boiling Methods 0.000 claims description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 6
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 5
- 239000011953 free-radical catalyst Substances 0.000 claims description 5
- 229920002907 Guar gum Polymers 0.000 claims description 4
- 239000000665 guar gum Substances 0.000 claims description 4
- 235000010417 guar gum Nutrition 0.000 claims description 4
- 229960002154 guar gum Drugs 0.000 claims description 4
- 229940032147 starch Drugs 0.000 claims 2
- GUBGYTABKSRVRQ-QRZGKKJRSA-N beta-cellobiose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QRZGKKJRSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 17
- 229940117913 acrylamide Drugs 0.000 abstract description 16
- 238000004132 cross linking Methods 0.000 abstract description 6
- 150000004804 polysaccharides Polymers 0.000 abstract description 3
- 238000010526 radical polymerization reaction Methods 0.000 abstract description 2
- 239000000047 product Substances 0.000 description 102
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 56
- 239000000243 solution Substances 0.000 description 50
- 238000010521 absorption reaction Methods 0.000 description 44
- 230000009102 absorption Effects 0.000 description 43
- 239000011780 sodium chloride Substances 0.000 description 28
- 229920000742 Cotton Polymers 0.000 description 21
- 239000000499 gel Substances 0.000 description 15
- 239000002002 slurry Substances 0.000 description 15
- 229920000642 polymer Polymers 0.000 description 13
- 239000007787 solid Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- -1 divinyl compound Chemical class 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 9
- 239000012190 activator Substances 0.000 description 9
- 238000007792 addition Methods 0.000 description 9
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 9
- 229920002785 Croscarmellose sodium Polymers 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- 229920001519 homopolymer Polymers 0.000 description 7
- 229920001131 Pulp (paper) Polymers 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 6
- 239000000835 fiber Substances 0.000 description 6
- 239000002198 insoluble material Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 5
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 4
- 239000004971 Cross linker Substances 0.000 description 4
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 4
- 229940105329 carboxymethylcellulose Drugs 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229940124024 weight reducing agent Drugs 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 230000036571 hydration Effects 0.000 description 3
- 238000006703 hydration reaction Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- SKMHHHHLLBKNKR-UHFFFAOYSA-M sodium;prop-2-enamide;prop-2-enoate Chemical compound [Na+].NC(=O)C=C.[O-]C(=O)C=C SKMHHHHLLBKNKR-UHFFFAOYSA-M 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000332 continued effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- 229940071826 hydroxyethyl cellulose Drugs 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- AOSFMYBATFLTAQ-UHFFFAOYSA-N 1-amino-3-(benzimidazol-1-yl)propan-2-ol Chemical compound C1=CC=C2N(CC(O)CN)C=NC2=C1 AOSFMYBATFLTAQ-UHFFFAOYSA-N 0.000 description 1
- SXLIFQSDMYZOBA-UHFFFAOYSA-N 2,5-bis(ethenyl)pyridine Chemical compound C=CC1=CC=C(C=C)N=C1 SXLIFQSDMYZOBA-UHFFFAOYSA-N 0.000 description 1
- TURITJIWSQEMDB-UHFFFAOYSA-N 2-methyl-n-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCNC(=O)C(C)=C TURITJIWSQEMDB-UHFFFAOYSA-N 0.000 description 1
- HIWGDJVTAWTBNH-UHFFFAOYSA-N 2-methylidene-5-sulfopentanoic acid Chemical class OC(=O)C(=C)CCCS(O)(=O)=O HIWGDJVTAWTBNH-UHFFFAOYSA-N 0.000 description 1
- XKIGDOOFWYHZDA-UHFFFAOYSA-M 5-ethenyl-1,2-dimethylpyridin-1-ium;methyl sulfate Chemical class COS([O-])(=O)=O.CC1=CC=C(C=C)C=[N+]1C XKIGDOOFWYHZDA-UHFFFAOYSA-M 0.000 description 1
- GONFBOIJNUKKST-UHFFFAOYSA-N 5-ethylsulfanyl-2h-tetrazole Chemical compound CCSC=1N=NNN=1 GONFBOIJNUKKST-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 229910002567 K2S2O8 Inorganic materials 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 101000688202 Rattus norvegicus Intestinal-type alkaline phosphatase 1 Proteins 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- 208000036366 Sensation of pressure Diseases 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- TVFDJXOCXUVLDH-RNFDNDRNSA-N cesium-137 Chemical compound [137Cs] TVFDJXOCXUVLDH-RNFDNDRNSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- IMBKASBLAKCLEM-UHFFFAOYSA-L ferrous ammonium sulfate (anhydrous) Chemical compound [NH4+].[NH4+].[Fe+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IMBKASBLAKCLEM-UHFFFAOYSA-L 0.000 description 1
- 238000010559 graft polymerization reaction Methods 0.000 description 1
- 239000013529 heat transfer fluid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- TWNIBLMWSKIRAT-VFUOTHLCSA-N levoglucosan Chemical group O[C@@H]1[C@@H](O)[C@H](O)[C@H]2CO[C@@H]1O2 TWNIBLMWSKIRAT-VFUOTHLCSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- IHBKAGRPNRKYAO-UHFFFAOYSA-M methyl sulfate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium Chemical class COS([O-])(=O)=O.CC(=C)C(=O)OCC[N+](C)(C)C IHBKAGRPNRKYAO-UHFFFAOYSA-M 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 235000019394 potassium persulphate Nutrition 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- XYKIUTSFQGXHOW-UHFFFAOYSA-N propan-2-one;toluene Chemical compound CC(C)=O.CC1=CC=CC=C1 XYKIUTSFQGXHOW-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical group [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 239000002594 sorbent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F251/00—Macromolecular compounds obtained by polymerising monomers on to polysaccharides or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Polymerisation Methods In General (AREA)
- Absorbent Articles And Supports Therefor (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/625,332 US4028290A (en) | 1975-10-23 | 1975-10-23 | Highly absorbent modified polysaccharides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1075233A true CA1075233A (en) | 1980-04-08 |
Family
ID=24505572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA257,545A Expired CA1075233A (en) | 1975-10-23 | 1976-07-22 | Highly absorbent modified polysaccharides |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4028290A (show.php) |
| JP (1) | JPS6021164B2 (show.php) |
| AU (1) | AU507842B2 (show.php) |
| BE (1) | BE846610A (show.php) |
| BR (1) | BR7607083A (show.php) |
| CA (1) | CA1075233A (show.php) |
| DE (1) | DE2647420C2 (show.php) |
| ES (1) | ES451462A1 (show.php) |
| FR (1) | FR2328719A1 (show.php) |
| GB (1) | GB1535574A (show.php) |
| IT (1) | IT1069013B (show.php) |
| MX (1) | MX144321A (show.php) |
| NL (1) | NL174149C (show.php) |
| SE (1) | SE433222B (show.php) |
Families Citing this family (91)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4200557A (en) * | 1973-12-07 | 1980-04-29 | Personal Products Company | Absorbent product including grafted insolubilized cellulose ether |
| US4194998A (en) * | 1976-12-06 | 1980-03-25 | The United States Of America As Represented By The Secretary Of Agriculture | Highly absorbent polyhydroxy polymer graft copolymers without saponification |
| US4134863A (en) * | 1976-12-06 | 1979-01-16 | The United States Of America As Represented By The Secretary Of Agriculture | Highly absorbent graft copolymers of polyhydroxy polymers, acrylonitrile, and acrylic comonomers |
| GB1594389A (en) * | 1977-06-03 | 1981-07-30 | Max Planck Gesellschaft | Dressing material for wounds |
| US4242242A (en) * | 1977-06-10 | 1980-12-30 | Akzona Incorporated | Highly absorbent fibers of rayon with sulfonic acid polymer incorporated |
| US4131576A (en) * | 1977-12-15 | 1978-12-26 | National Starch And Chemical Corporation | Process for the preparation of graft copolymers of a water soluble monomer and polysaccharide employing a two-phase reaction system |
| US4153585A (en) * | 1978-05-08 | 1979-05-08 | National Starch And Chemical Corporation | Starch ether derivatives and process for the preparation thereof |
| US4267103A (en) * | 1978-12-07 | 1981-05-12 | The B. F. Goodrich Company | Solvent polymerization of carboxyl containing monomers |
| DE2900110A1 (de) * | 1979-01-03 | 1980-07-10 | Wolff Walsrode Ag | Loesliche makromolekularsubstanzen mit hohem dispergier-, suspendier- und fluessigkeitsrueckhaltevermoegen, verfahren zu ihrer herstellung und verwendung |
| US4204983A (en) * | 1979-05-07 | 1980-05-27 | Illinois Cereal Mills | Absorbent polymeric compositions derived from amylaceous material-formaldehyde substrates |
| US4394930A (en) * | 1981-03-27 | 1983-07-26 | Johnson & Johnson | Absorbent foam products |
| US4341215A (en) * | 1980-09-04 | 1982-07-27 | Tampax Incorporated | Absorbent device |
| US4517351A (en) * | 1982-08-11 | 1985-05-14 | National Starch And Chemical Corporation | Process for reacting quaternary ammonium monomer in the presence of anionic polymers |
| US4663163A (en) * | 1983-02-14 | 1987-05-05 | Hou Kenneth C | Modified polysaccharide supports |
| SE8301955D0 (sv) * | 1983-04-08 | 1983-04-08 | Bengt Gustav Ranby | Hogabsorberande ympsampolymerisat av sterkelse och akrylnitril |
| DE3339860A1 (de) * | 1983-11-04 | 1985-05-15 | Wolff Walsrode Ag, 3030 Walsrode | Wasserloesliche, mit polymeren modifizierte hydroxyalkylmethylcellulose und deren verwendung als zusatzmittel fuer asbestfreie fliesenkleber-formulierungen |
| US4587284A (en) * | 1985-06-14 | 1986-05-06 | Ed. Geistlich Sohne Ag Fur Chemische Industrie | Absorbent polymer material and its preparation |
| US4690996A (en) * | 1985-08-28 | 1987-09-01 | National Starch And Chemical Corporation | Inverse emulsions |
| DE3801633A1 (de) * | 1988-01-21 | 1989-07-27 | Starchem Gmbh | Verfahren zur herstellung von wasserabsorbierenden und wasserquellbaren polysaccharid-pfropfpolymeren |
| FR2628764B1 (fr) * | 1988-03-16 | 1990-10-12 | Du Pin Cellulose | Procede de fabrication de produits fibreux a base de cellulose modifiee presentant des proprietes absorbantes ameliorees et produits obtenus |
| AU645512B2 (en) * | 1989-08-08 | 1994-01-20 | Macdonald Johnston Engineering Company Pty Limited | Improvements relating to rubbish compactor paddles |
| MX213505B (show.php) * | 1993-02-24 | 2003-04-03 | ||
| US5580910A (en) * | 1993-04-12 | 1996-12-03 | Kimberly-Clark Corporation | Self sealing film |
| US5466518A (en) * | 1993-08-17 | 1995-11-14 | Kimberly-Clark Corporation | Binder compositions and web materials formed thereby |
| US5496874A (en) * | 1994-11-02 | 1996-03-05 | Kimberly-Clark Corporation | Moldable hydrodisintegratable material and products formed thereby |
| US5700553A (en) * | 1995-11-16 | 1997-12-23 | Kimberly-Clark Corporation | Multilayer hydrodisintegratable film |
| US5868991A (en) * | 1996-07-26 | 1999-02-09 | Kimberly-Clark Worldwide, Inc. | Method for low temperature injection molding of hydrodisintegratable compositions |
| DE19905947B4 (de) * | 1999-02-12 | 2004-05-27 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verfahren zur Herstellung von Superabsorbern und mittels eines solchen Verfahrens hergestellte Superabsorber und deren Verwendung |
| US7087556B2 (en) | 2001-04-16 | 2006-08-08 | Wsp Chemicals & Technology, L.L.C. | Compositions for treating subterranean zones penetrated by well bores |
| FI113375B (fi) * | 2001-05-16 | 2004-04-15 | Cerefi Oy | Menetelmä absorboivien aineiden valmistamiseksi lignoselluloosamateriaalista |
| CA2382419A1 (en) * | 2002-04-24 | 2003-10-24 | Le Groupe Lysac Inc. | Synergistic blends of polysaccharides as biodegradable absorbent materials or superabsorbents |
| US20030220632A1 (en) * | 2002-05-23 | 2003-11-27 | Wolfgang Strasser | Method of using gel sheets for laser treatment |
| DE10308753A1 (de) * | 2003-02-28 | 2004-09-09 | Bayer Ag | Kationische Stärke-Pfropfcopolymere und neues Verfahren zur Herstellung von kationischen Stärke-Pfropfcopolymeren |
| SE0302509D0 (sv) * | 2003-09-19 | 2003-09-19 | Amersham Biosciences Ab | Matrix for separation of polyethers and method of separation |
| US8173171B2 (en) * | 2003-11-17 | 2012-05-08 | Taiwan Textile Research Institute | Hydrogel microparticle composition, application thereof and method for preparing the same |
| TW200517128A (en) * | 2003-11-17 | 2005-06-01 | China Testile Inst | Micro-particles of hydrogel containing polysaccharide or its derivatives composition and method for preparing the same |
| US8217219B2 (en) * | 2003-12-29 | 2012-07-10 | Kimberly-Clark Worldwide, Inc. | Anatomically conforming vaginal insert |
| US7842382B2 (en) * | 2004-03-11 | 2010-11-30 | Knauf Insulation Gmbh | Binder compositions and associated methods |
| WO2006044302A1 (en) * | 2004-10-13 | 2006-04-27 | Knauf Insulation Gmbh | Polyester binding compositions |
| ITTO20040918A1 (it) * | 2004-12-29 | 2005-03-29 | Luigi Ambrosio | Idrogel polimerici superassorbenti biodegradabili e procedimento per la loro preparazione |
| US7888445B2 (en) * | 2005-07-26 | 2011-02-15 | Knauf Insulation Gmbh | Fibrous products and methods for producing the same |
| US7645806B2 (en) * | 2006-10-02 | 2010-01-12 | Weyerhaeuser Nr Company | Methods for the preparation of superabsorbent particles containing carboxyalkyl cellulose |
| US20080081165A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Fibrous superabsorbent composite containing cellulose |
| US7785710B2 (en) | 2006-10-02 | 2010-08-31 | Weyerhaeuser Nr Company | Superabsorbent particles containing carboxyalkyl cellulose and temporary metal crosslinks |
| US20080078514A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Methods for the preparation of cellulose fibers having superabsorbent particles adhered thereto |
| US7625463B2 (en) | 2006-10-02 | 2009-12-01 | Weyerhaeuser Nr Company | Methods for the preparation of fibrous superabsorbent composite containing cellulose |
| US20080082065A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Mixed polymer superabsorbent fibers containing cellulose |
| US20080079188A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Methods for the preparation of mixed polymer superabsorbent fibers |
| US7717995B2 (en) * | 2006-10-02 | 2010-05-18 | Weyerhaeuser Nr Company | Methods for the preparation of mixed polymer superabsorbent fibers containing cellulose |
| ES2526345T3 (es) * | 2007-01-25 | 2015-01-09 | Knauf Insulation | Producto de aislamiento de fibras minerales que no contienen formaldehído |
| WO2008089848A1 (en) * | 2007-01-25 | 2008-07-31 | Knauf Insulation Limited | Mineral fibre insulation |
| SI2108006T1 (sl) | 2007-01-25 | 2021-02-26 | Knauf Insulation Gmbh | Veziva in s tem narejeni materiali |
| US8082609B2 (en) * | 2007-01-25 | 2011-12-27 | Best Bath Systems, Inc. | Walk-in bathtub having a flip-up seat portion over a rearward foot well recess |
| US8501838B2 (en) | 2007-01-25 | 2013-08-06 | Knauf Insulation Sprl | Composite wood board |
| DK2125650T3 (da) | 2007-01-25 | 2024-08-05 | Knauf Insulation | Mineralfiberplade |
| EP2137223B1 (en) | 2007-04-13 | 2019-02-27 | Knauf Insulation GmbH | Composite maillard-resole binders |
| US7749317B2 (en) | 2007-06-25 | 2010-07-06 | Weyerhaeuser Nr Company | Fibrous blend and method of making |
| US20080318772A1 (en) * | 2007-06-25 | 2008-12-25 | Weyerhaeuser Co. | Mixed polymer composite fiber and cellulose fiber |
| US7591891B2 (en) * | 2007-06-25 | 2009-09-22 | Weyerhaeuser Nr Company | Fibrous blend and methods of preparation |
| BRPI0814014A2 (pt) * | 2007-07-05 | 2015-02-03 | Knauf Insulation Gmbh | Material colante de maillard de base ácido hidróxi-monocarboxílico |
| GB0715100D0 (en) | 2007-08-03 | 2007-09-12 | Knauf Insulation Ltd | Binders |
| US7833384B2 (en) * | 2008-06-30 | 2010-11-16 | Weyerhaeuser Nr Company | Method for making fiber having biodegradable superabsorbent particles attached thereto |
| US8101543B2 (en) * | 2008-06-30 | 2012-01-24 | Weyerhaeuser Nr Company | Biodegradable superabsorbent particles |
| US8084391B2 (en) * | 2008-06-30 | 2011-12-27 | Weyerhaeuser Nr Company | Fibers having biodegradable superabsorbent particles attached thereto |
| US8641869B2 (en) * | 2008-06-30 | 2014-02-04 | Weyerhaeuser Nr Company | Method for making biodegradable superabsorbent particles |
| US20090325797A1 (en) * | 2008-06-30 | 2009-12-31 | Weyerhaeuser Co. | Biodegradable Superabsorbent Particles |
| US7959762B2 (en) * | 2008-06-30 | 2011-06-14 | Weyerhaeuser Nr Company | Method for making biodegradable superabsorbent particles |
| US20090326180A1 (en) * | 2008-06-30 | 2009-12-31 | Weyerhaeuser Co. | Biodegradable Superabsorbent Particles Containing Cellulose Fiber |
| WO2011015946A2 (en) | 2009-08-07 | 2011-02-10 | Knauf Insulation | Molasses binder |
| US8399590B2 (en) | 2009-10-07 | 2013-03-19 | Akzo Nobel Chemicals International B.V. | Superhydrophilic amphiphilic copolymers and processes for making the same |
| US11173106B2 (en) * | 2009-10-07 | 2021-11-16 | Johnson & Johnson Consumer Inc. | Compositions comprising a superhydrophilic amphiphilic copolymer and a micellar thickener |
| US8258250B2 (en) | 2009-10-07 | 2012-09-04 | Johnson & Johnson Consumer Companies, Inc. | Compositions comprising superhydrophilic amphiphilic copolymers and methods of use thereof |
| EP2368924A1 (en) * | 2010-03-22 | 2011-09-28 | Kemira Germany GmbH | Composition for improving dry strength |
| KR101835899B1 (ko) | 2010-05-07 | 2018-03-07 | 크나우프 인설레이션, 인크. | 탄수화물 결합제 및 이를 이용하여 제조된 물질 |
| US20130059075A1 (en) | 2010-05-07 | 2013-03-07 | Knauf Insulation | Carbohydrate polyamine binders and materials made therewith |
| WO2011154368A1 (en) | 2010-06-07 | 2011-12-15 | Knauf Insulation | Fiber products having temperature control additives |
| WO2012152731A1 (en) | 2011-05-07 | 2012-11-15 | Knauf Insulation | Liquid high solids binder composition |
| GB201206193D0 (en) | 2012-04-05 | 2012-05-23 | Knauf Insulation Ltd | Binders and associated products |
| GB201214734D0 (en) | 2012-08-17 | 2012-10-03 | Knauf Insulation Ltd | Wood board and process for its production |
| EP2928936B1 (en) | 2012-12-05 | 2022-04-13 | Knauf Insulation SPRL | Binder |
| WO2015120252A1 (en) | 2014-02-07 | 2015-08-13 | Knauf Insulation, Llc | Uncured articles with improved shelf-life |
| GB201408909D0 (en) | 2014-05-20 | 2014-07-02 | Knauf Insulation Ltd | Binders |
| GB201412709D0 (en) | 2014-07-17 | 2014-09-03 | Knauf Insulation And Knauf Insulation Ltd | Improved binder compositions and uses thereof |
| GB201517867D0 (en) | 2015-10-09 | 2015-11-25 | Knauf Insulation Ltd | Wood particle boards |
| CN105692847B (zh) * | 2016-01-29 | 2018-04-20 | 浙江赛维环保科技有限公司 | 一种在合成纤维素基絮凝材料过程中循环利用未反应单体的方法 |
| CN105777994A (zh) * | 2016-03-16 | 2016-07-20 | 张学健 | 一种硅藻土基复合材料及其制备方法 |
| GB201610063D0 (en) | 2016-06-09 | 2016-07-27 | Knauf Insulation Ltd | Binders |
| GB201701569D0 (en) | 2017-01-31 | 2017-03-15 | Knauf Insulation Ltd | Improved binder compositions and uses thereof |
| GB201804907D0 (en) | 2018-03-27 | 2018-05-09 | Knauf Insulation Ltd | Composite products |
| GB201804908D0 (en) | 2018-03-27 | 2018-05-09 | Knauf Insulation Ltd | Binder compositions and uses thereof |
| CN113826887A (zh) * | 2021-09-22 | 2021-12-24 | 湖州草本连生物科技有限公司 | 降压降脂降血糖营养粉、植物提取物及其应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2922768A (en) * | 1956-04-12 | 1960-01-26 | Mino Guido | Process for polymerization of a vinylidene monomer in the presence of a ceric salt and an organic reducing agent |
| US3065041A (en) * | 1958-04-23 | 1962-11-20 | American Cyanamid Co | Method of graft-polymerizing acrylate monomers onto paper in presence of ethylene dimethacrylate, and resulting product |
| US3125406A (en) * | 1961-02-28 | 1964-03-17 | Process for making them | |
| US3184421A (en) * | 1961-05-24 | 1965-05-18 | Eastman Kodak Co | Polymeric composition prepared from cellulose sulfate and alkyl acrylate and textilematerial coated therewith |
| US3297786A (en) * | 1961-10-03 | 1967-01-10 | Yardney International Corp | Method of graft polymerizing onto hydrophobic substrates |
| US3455853A (en) * | 1964-03-09 | 1969-07-15 | Union Oil Co | Method for preparing polysaccharide graft copolymers |
| NL125103C (show.php) * | 1965-08-20 | |||
| US3809664A (en) * | 1973-08-16 | 1974-05-07 | Us Agriculture | Method of preparing starch graft polymers |
-
1975
- 1975-10-23 US US05/625,332 patent/US4028290A/en not_active Expired - Lifetime
-
1976
- 1976-07-22 CA CA257,545A patent/CA1075233A/en not_active Expired
- 1976-09-11 ES ES451462A patent/ES451462A1/es not_active Expired
- 1976-09-21 FR FR7628254A patent/FR2328719A1/fr active Granted
- 1976-09-24 BE BE170963A patent/BE846610A/xx not_active IP Right Cessation
- 1976-09-27 JP JP51115731A patent/JPS6021164B2/ja not_active Expired
- 1976-09-30 MX MX166507A patent/MX144321A/es unknown
- 1976-10-20 DE DE2647420A patent/DE2647420C2/de not_active Expired
- 1976-10-21 NL NLAANVRAGE7611635,A patent/NL174149C/xx not_active IP Right Cessation
- 1976-10-22 IT IT28629/76A patent/IT1069013B/it active
- 1976-10-22 AU AU18909/76A patent/AU507842B2/en not_active Expired
- 1976-10-22 SE SE7611761A patent/SE433222B/xx unknown
- 1976-10-23 BR BR7607083A patent/BR7607083A/pt unknown
- 1976-10-25 GB GB44238/76A patent/GB1535574A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE433222B (sv) | 1984-05-14 |
| IT1069013B (it) | 1985-03-21 |
| FR2328719A1 (fr) | 1977-05-20 |
| NL174149C (nl) | 1984-05-01 |
| GB1535574A (en) | 1978-12-13 |
| NL174149B (nl) | 1983-12-01 |
| ES451462A1 (es) | 1977-12-16 |
| BR7607083A (pt) | 1977-09-06 |
| US4028290A (en) | 1977-06-07 |
| FR2328719B1 (show.php) | 1980-10-31 |
| MX144321A (es) | 1981-09-29 |
| AU507842B2 (en) | 1980-02-28 |
| AU1890976A (en) | 1978-04-27 |
| NL7611635A (nl) | 1977-04-26 |
| JPS5251482A (en) | 1977-04-25 |
| JPS6021164B2 (ja) | 1985-05-25 |
| SE7611761L (sv) | 1977-04-24 |
| DE2647420A1 (de) | 1977-04-28 |
| DE2647420C2 (de) | 1982-12-02 |
| BE846610A (fr) | 1977-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1075233A (en) | Highly absorbent modified polysaccharides | |
| US4155888A (en) | Water-absorbent starches | |
| CA1090553A (en) | Method of improving the absorption rate of absorbent polymers | |
| US5145906A (en) | Super-absorbent polymer having improved absorbency properties | |
| US4115332A (en) | Water-absorbent starch copolymerizates | |
| US5340853A (en) | Polymer-based swelling and absorbing agents with an improved degradability and an improved absorption for water, aqueous solutions and body liquids and the use of said agents for the production of hygienic articles and for soil conditioning | |
| US6958429B2 (en) | Water-absorbing polymers with supramolecular hollow molecules, method for producing them and use of the same | |
| US4351922A (en) | Process for the production of highly water-absorbing but less water-soluble hydrogels | |
| US5032628A (en) | Process for the preparation of a highly water absorptive resin from acrylic resin, epoxy crosslinker and hydrophilic silicate | |
| EP2838939B2 (en) | Compounded surface treated carboxyalkylated starch polyacrylate composites | |
| JP2877255B2 (ja) | 耐久性の優れた吸水性樹脂の製造方法 | |
| JPS6134722B2 (show.php) | ||
| US5331021A (en) | Grafted copolymers highly absorbent to aqueous electrolyte solutions used in diapers and paper towels | |
| US4194998A (en) | Highly absorbent polyhydroxy polymer graft copolymers without saponification | |
| Fanta et al. | Absorbent polymers from starch and flour through graft polymerization of acrylonitrile and comonomer mixtures | |
| EP0287970B1 (en) | Process for producing highly water absorptive polymer | |
| US4116899A (en) | Increasing absorbency of polymeric compositions by curing | |
| KR101718473B1 (ko) | 이타콘산 그래프트 전분 공중합체 및 이의 제조방법 | |
| US5886124A (en) | Liquid-absorbent polymer and gelatinoid product | |
| EP0000247B1 (en) | Water-absorbent starch copolymerisates and method for their preparation. | |
| US5225506A (en) | Superabsorbent polymers | |
| US5180800A (en) | Process for the preparation of finely divided, water-swellable polysaccharide graft polymers | |
| JPS6343930A (ja) | 高吸水性ポリマ−の製造法 | |
| US5439983A (en) | Grafted copolymers highly absorbent to aqueous electrolyte solutions | |
| CN119409888A (zh) | 一种防霉改性淀粉基高吸水树脂及其制备方法和应用 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |