CA1073401A - Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen - Google Patents
Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogenInfo
- Publication number
- CA1073401A CA1073401A CA216,850A CA216850A CA1073401A CA 1073401 A CA1073401 A CA 1073401A CA 216850 A CA216850 A CA 216850A CA 1073401 A CA1073401 A CA 1073401A
- Authority
- CA
- Canada
- Prior art keywords
- alkali metal
- chloride
- compartment
- cathode
- anode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 title claims abstract description 56
- 239000004155 Chlorine dioxide Substances 0.000 title claims abstract description 28
- 235000019398 chlorine dioxide Nutrition 0.000 title claims abstract description 28
- 239000000460 chlorine Substances 0.000 title claims abstract description 27
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 title claims abstract description 26
- 229910052801 chlorine Inorganic materials 0.000 title claims abstract description 21
- 229910052739 hydrogen Inorganic materials 0.000 title claims abstract description 21
- 239000001257 hydrogen Substances 0.000 title claims abstract description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 title claims abstract description 19
- 150000008044 alkali metal hydroxides Chemical class 0.000 title claims abstract description 16
- 238000004519 manufacturing process Methods 0.000 title abstract description 15
- 239000012528 membrane Substances 0.000 claims abstract description 89
- 238000000034 method Methods 0.000 claims abstract description 42
- -1 alkali metal chlorate Chemical class 0.000 claims abstract description 40
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims abstract description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 25
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims abstract description 17
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims abstract description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 17
- 229910001868 water Inorganic materials 0.000 claims abstract description 17
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims abstract description 16
- 229920001577 copolymer Polymers 0.000 claims description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 27
- 229920000642 polymer Polymers 0.000 claims description 23
- 239000000243 solution Substances 0.000 claims description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 15
- 239000003518 caustics Substances 0.000 claims description 13
- 229910000510 noble metal Inorganic materials 0.000 claims description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- 239000010439 graphite Substances 0.000 claims description 11
- 229910002804 graphite Inorganic materials 0.000 claims description 11
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 11
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 10
- 239000004800 polyvinyl chloride Substances 0.000 claims description 10
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 9
- 150000001768 cations Chemical class 0.000 claims description 9
- 238000005868 electrolysis reaction Methods 0.000 claims description 9
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 9
- 239000011780 sodium chloride Substances 0.000 claims description 9
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 8
- 150000004706 metal oxides Chemical class 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- 229910052719 titanium Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910001902 chlorine oxide Inorganic materials 0.000 claims description 6
- 229920002313 fluoropolymer Polymers 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 6
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 6
- 229910000831 Steel Inorganic materials 0.000 claims description 5
- 239000010425 asbestos Substances 0.000 claims description 5
- 229910052697 platinum Inorganic materials 0.000 claims description 5
- 229910052895 riebeckite Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000010959 steel Substances 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910044991 metal oxide Inorganic materials 0.000 claims description 4
- 229910052715 tantalum Inorganic materials 0.000 claims description 4
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 3
- 150000001336 alkenes Chemical class 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052707 ruthenium Inorganic materials 0.000 claims description 3
- 229910006095 SO2F Inorganic materials 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 150000003841 chloride salts Chemical class 0.000 claims description 2
- 239000012527 feed solution Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910003202 NH4 Inorganic materials 0.000 claims 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 229920005601 base polymer Polymers 0.000 claims 1
- 230000008569 process Effects 0.000 abstract description 18
- 239000000047 product Substances 0.000 abstract description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract description 8
- 238000006243 chemical reaction Methods 0.000 abstract description 8
- 238000004061 bleaching Methods 0.000 abstract description 6
- 229920001131 Pulp (paper) Polymers 0.000 abstract description 3
- 239000006227 byproduct Substances 0.000 abstract description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 abstract description 2
- 238000012545 processing Methods 0.000 abstract description 2
- 238000004537 pulping Methods 0.000 abstract description 2
- 239000002023 wood Substances 0.000 abstract 1
- 210000004027 cell Anatomy 0.000 description 48
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 10
- 239000004812 Fluorinated ethylene propylene Substances 0.000 description 9
- 229920009441 perflouroethylene propylene Polymers 0.000 description 9
- 230000007062 hydrolysis Effects 0.000 description 8
- 238000006460 hydrolysis reaction Methods 0.000 description 8
- 239000000178 monomer Substances 0.000 description 7
- 239000002585 base Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000012986 modification Methods 0.000 description 5
- 229920001155 polypropylene Polymers 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 239000004743 Polypropylene Substances 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000003792 electrolyte Substances 0.000 description 4
- 238000005342 ion exchange Methods 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229920000557 Nafion® Polymers 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229920001429 chelating resin Polymers 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000008246 gaseous mixture Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000005956 quaternization reaction Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- 102100033680 Bombesin receptor-activated protein C6orf89 Human genes 0.000 description 2
- 101710086147 Bombesin receptor-activated protein C6orf89 Proteins 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical group OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000005576 amination reaction Methods 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 210000002421 cell wall Anatomy 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical group FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 2
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 2
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- DJKGDNKYTKCJKD-BPOCMEKLSA-N (1s,4r,5s,6r)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid Chemical compound ClC1=C(Cl)[C@]2(Cl)[C@H](C(=O)O)[C@H](C(O)=O)[C@@]1(Cl)C2(Cl)Cl DJKGDNKYTKCJKD-BPOCMEKLSA-N 0.000 description 1
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- DIJKNPFEDYLJPV-UHFFFAOYSA-N 4-[[3-[(2-amino-4-chlorophenyl)carbamoylamino]phenyl]sulfonylamino]benzoic acid Chemical compound Nc1cc(Cl)ccc1NC(=O)Nc1cccc(c1)S(=O)(=O)Nc1ccc(cc1)C(O)=O DIJKNPFEDYLJPV-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920001774 Perfluoroether Polymers 0.000 description 1
- 240000005428 Pistacia lentiscus Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000010405 anode material Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 210000005056 cell body Anatomy 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- QEEKASZBZSQJIA-UHFFFAOYSA-N chloric acid hydrochloride Chemical compound Cl.O[Cl](=O)=O QEEKASZBZSQJIA-UHFFFAOYSA-N 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- UJMWVICAENGCRF-UHFFFAOYSA-N oxygen difluoride Chemical compound FOF UJMWVICAENGCRF-UHFFFAOYSA-N 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US429997A US3904496A (en) | 1974-01-02 | 1974-01-02 | Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1073401A true CA1073401A (en) | 1980-03-11 |
Family
ID=23705631
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA216,850A Expired CA1073401A (en) | 1974-01-02 | 1974-12-20 | Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3904496A (enFirst) |
| JP (1) | JPS5322959B2 (enFirst) |
| AU (1) | AU475763B2 (enFirst) |
| BR (1) | BR7410912D0 (enFirst) |
| CA (1) | CA1073401A (enFirst) |
| FI (1) | FI376874A7 (enFirst) |
| FR (1) | FR2256262B1 (enFirst) |
| SE (1) | SE409885B (enFirst) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS551351B2 (enFirst) * | 1974-03-07 | 1980-01-12 | ||
| JPS529700A (en) * | 1975-07-15 | 1977-01-25 | Asahi Chem Ind Co Ltd | Manufacturing method of high purity caustic soda solution |
| JPS5214584A (en) * | 1975-07-25 | 1977-02-03 | Asahi Glass Co Ltd | Electrodialysis method of a base-containing solution |
| JPS5222867A (en) * | 1975-08-15 | 1977-02-21 | Victor Co Of Japan Ltd | Demodulation system for angle modulated wave signal |
| US4012541A (en) * | 1975-10-01 | 1977-03-15 | Basf Wyandotte Corporation | Method for wetting hydrophobic diaphragms for use in chlor-alkali cells |
| JPS5248598A (en) * | 1975-10-17 | 1977-04-18 | Asahi Glass Co Ltd | Method for producing alkali hydroxide |
| US4113585A (en) * | 1975-10-20 | 1978-09-12 | E. I. Du Pont De Nemours And Company | Method and apparatus for electrolysis of alkali or alkaline earth metal halide |
| JPS5926671B2 (ja) * | 1975-11-19 | 1984-06-29 | 呉羽化学工業株式会社 | イオンコウカンマクデンカイホウホウ |
| FR2370000A1 (fr) * | 1976-11-03 | 1978-06-02 | Elf Aquitaine | Decyanuration d'eaux residuaires |
| US4144381A (en) * | 1977-09-20 | 1979-03-13 | Energy Development Associates | Electrochemical pH control |
| JPS5670135A (en) * | 1979-11-08 | 1981-06-11 | Meninguhofu Gmbh Unto Co Kg Ma | Electromagnetic clutch or controller |
| US4248681A (en) * | 1980-02-13 | 1981-02-03 | Sweeney Charles T | Generation of chlorine/chlorine dioxide mixtures |
| US4308117A (en) * | 1980-02-13 | 1981-12-29 | Sweeney Charles T | Generation of chlorine-chlorine dioxide mixtures |
| US4435256A (en) | 1981-03-23 | 1984-03-06 | Olin Corporation | Process for making potassium ferrate [Fe(VI)] by the electrochemical formation of sodium ferrate |
| US4451338A (en) * | 1981-03-23 | 1984-05-29 | Olin Corporation | Process for making a calcium/sodium ferrate adduct by the electrochemical formation of sodium ferrate |
| US4435257A (en) | 1981-03-23 | 1984-03-06 | Olin Corporation | Process for the electrochemical production of sodium ferrate [Fe(VI)] |
| US4426263A (en) | 1981-04-23 | 1984-01-17 | Diamond Shamrock Corporation | Method and electrocatalyst for making chlorine dioxide |
| US4381290A (en) * | 1981-04-23 | 1983-04-26 | Diamond Shamrock Corporation | Method and catalyst for making chlorine dioxide |
| US4362707A (en) * | 1981-04-23 | 1982-12-07 | Diamond Shamrock Corporation | Preparation of chlorine dioxide with platinum group metal oxide catalysts |
| US4501824A (en) * | 1982-02-01 | 1985-02-26 | Eltech Systems Corporation | Catalyst for making chlorine dioxide |
| CA1287815C (en) * | 1987-05-29 | 1991-08-20 | Marek Lipsztajn | Electrolytic production of chlorine dioxide |
| US4853096A (en) * | 1988-02-18 | 1989-08-01 | Tenneco Canada Inc. | Production of chlorine dioxide in an electrolytic cell |
| CA1322543C (en) * | 1988-10-20 | 1993-09-28 | Marek Lipsztajn | Production of chloric acid |
| US5092970A (en) * | 1989-12-20 | 1992-03-03 | Olin Corporation | Electrochemical process for producing chlorine dioxide solutions from chlorites |
| US5106465A (en) * | 1989-12-20 | 1992-04-21 | Olin Corporation | Electrochemical process for producing chlorine dioxide solutions from chlorites |
| US5248397A (en) * | 1990-02-06 | 1993-09-28 | Olin Corporation | Chlorine dioxide generation from chloric acid - alkali metal chlorate mixtures |
| US5242552A (en) * | 1990-03-21 | 1993-09-07 | Eltech Systems Corporation | System for electrolytically generating strong solutions by halogen oxyacids |
| US5108560A (en) * | 1990-03-30 | 1992-04-28 | Olin Corporation | Electrochemical process for production of chloric acid from hypochlorous acid |
| US5089095A (en) * | 1990-03-30 | 1992-02-18 | Olin Corporation | Electrochemical process for producing chlorine dioxide from chloric acid |
| US6306281B1 (en) | 1999-11-30 | 2001-10-23 | Joseph Matthew Kelley | Electrolytic process for the generation of stable solutions of chlorine dioxide |
| CA2463378A1 (en) * | 2001-10-22 | 2003-12-24 | Felice Dimascio | Electrolytic process and apparatus |
| US20040101438A1 (en) * | 2002-09-10 | 2004-05-27 | Nelson Philip E. | Method and apparatus for sterilizing food containers |
| US6913741B2 (en) * | 2002-09-30 | 2005-07-05 | Halox Technologies, Inc. | System and process for producing halogen oxides |
| US7241435B2 (en) * | 2002-09-30 | 2007-07-10 | Halox Technologies, Inc. | System and process for producing halogen oxides |
| US7179363B2 (en) * | 2003-08-12 | 2007-02-20 | Halox Technologies, Inc. | Electrolytic process for generating chlorine dioxide |
| US20080003507A1 (en) * | 2006-06-30 | 2008-01-03 | Chenniah Nanjundiah | Formulation Of Electrolyte Solutions For Electrochemical Chlorine Dioxide Generators |
| EA200901629A1 (ru) * | 2007-06-28 | 2010-06-30 | Калера Корпорейшн | Способы и системы опреснения, включающие осаждение карбонатных соединений |
| US7753618B2 (en) | 2007-06-28 | 2010-07-13 | Calera Corporation | Rocks and aggregate, and methods of making and using the same |
| CN101275233B (zh) * | 2007-12-27 | 2010-12-15 | 复旦大学 | 一种采用醇类为原料的制氢方法 |
| US20100239467A1 (en) | 2008-06-17 | 2010-09-23 | Brent Constantz | Methods and systems for utilizing waste sources of metal oxides |
| US7749476B2 (en) | 2007-12-28 | 2010-07-06 | Calera Corporation | Production of carbonate-containing compositions from material comprising metal silicates |
| US7754169B2 (en) | 2007-12-28 | 2010-07-13 | Calera Corporation | Methods and systems for utilizing waste sources of metal oxides |
| BRPI0821515A2 (pt) | 2007-12-28 | 2019-09-24 | Calera Corp | métodos de captura de co2 |
| US7993500B2 (en) | 2008-07-16 | 2011-08-09 | Calera Corporation | Gas diffusion anode and CO2 cathode electrolyte system |
| EP2245214B1 (en) | 2008-07-16 | 2014-10-15 | Calera Corporation | Electrochemical system and method for co2 utilization |
| JP2011528405A (ja) * | 2008-07-16 | 2011-11-17 | カレラ コーポレイション | 二酸化炭素ガスを使用する低エネルギー4セル電気化学システム |
| US7966250B2 (en) | 2008-09-11 | 2011-06-21 | Calera Corporation | CO2 commodity trading system and method |
| US7939336B2 (en) | 2008-09-30 | 2011-05-10 | Calera Corporation | Compositions and methods using substances containing carbon |
| CA2700770C (en) | 2008-09-30 | 2013-09-03 | Calera Corporation | Co2-sequestering formed building materials |
| US8869477B2 (en) | 2008-09-30 | 2014-10-28 | Calera Corporation | Formed building materials |
| US7815880B2 (en) | 2008-09-30 | 2010-10-19 | Calera Corporation | Reduced-carbon footprint concrete compositions |
| US9133581B2 (en) | 2008-10-31 | 2015-09-15 | Calera Corporation | Non-cementitious compositions comprising vaterite and methods thereof |
| WO2010093713A1 (en) * | 2009-02-10 | 2010-08-19 | Calera Corporation | Low-voltage alkaline production from brines |
| CN101918614A (zh) | 2009-02-10 | 2010-12-15 | 卡勒拉公司 | 用氢和电催化电极低电压生产碱 |
| CA2694959A1 (en) | 2009-03-02 | 2010-09-02 | Calera Corporation | Gas stream multi-pollutants control systems and methods |
| US20100224503A1 (en) * | 2009-03-05 | 2010-09-09 | Kirk Donald W | Low-energy electrochemical hydroxide system and method |
| US20100229725A1 (en) | 2009-03-10 | 2010-09-16 | Kasra Farsad | Systems and Methods for Processing CO2 |
| US7993511B2 (en) | 2009-07-15 | 2011-08-09 | Calera Corporation | Electrochemical production of an alkaline solution using CO2 |
| US8882972B2 (en) | 2011-07-19 | 2014-11-11 | Ecolab Usa Inc | Support of ion exchange membranes |
| US8562810B2 (en) | 2011-07-26 | 2013-10-22 | Ecolab Usa Inc. | On site generation of alkalinity boost for ware washing applications |
| US20130146473A1 (en) * | 2011-12-13 | 2013-06-13 | Ralph A. Lambert | Dual diaphragm electrolysis cell assembly and method for generating a cleaning solution without any salt residues and simultaneously generating a sanitizing solution having a predetermined level of available free chlorine and pH |
| WO2016094591A1 (en) | 2014-12-09 | 2016-06-16 | Miox Corporation | Methods for the direct electrolytic production of stable, high concentration aqueous halosulfamate or halosulfonamide solutions |
| CN105821436B (zh) * | 2016-05-09 | 2018-07-24 | 复旦大学 | 一种基于三电极体系的双电解槽两步法氯碱电解方法及装置 |
| US20230402635A1 (en) * | 2020-02-12 | 2023-12-14 | Joseph Peter MACEDA | Novel electrochemical cells, stacks, modules and systems |
| CN118145602A (zh) * | 2024-03-21 | 2024-06-07 | 盐城师范学院 | 一种催化激活亚氯酸盐制备二氧化氯的方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3438879A (en) * | 1967-07-31 | 1969-04-15 | Hooker Chemical Corp | Protection of permselective diaphragm during electrolysis |
| US3496077A (en) * | 1967-12-18 | 1970-02-17 | Hal B H Cooper | Electrolyzing of salt solutions |
-
1974
- 1974-01-02 US US429997A patent/US3904496A/en not_active Expired - Lifetime
- 1974-11-27 AU AU75814/74A patent/AU475763B2/en not_active Expired
- 1974-12-20 CA CA216,850A patent/CA1073401A/en not_active Expired
- 1974-12-26 JP JP751085A patent/JPS5322959B2/ja not_active Expired
- 1974-12-27 FI FI3768/74A patent/FI376874A7/fi unknown
- 1974-12-27 BR BR10912/74A patent/BR7410912D0/pt unknown
- 1974-12-30 FR FR7443248A patent/FR2256262B1/fr not_active Expired
- 1974-12-30 SE SE7416363A patent/SE409885B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE7416363L (enFirst) | 1975-07-03 |
| FR2256262B1 (enFirst) | 1976-12-31 |
| JPS5098498A (enFirst) | 1975-08-05 |
| FR2256262A1 (enFirst) | 1975-07-25 |
| AU475763B2 (en) | 1976-09-02 |
| US3904496A (en) | 1975-09-09 |
| FI376874A7 (enFirst) | 1975-07-03 |
| JPS5322959B2 (enFirst) | 1978-07-12 |
| SE409885B (sv) | 1979-09-10 |
| BR7410912D0 (pt) | 1975-09-02 |
| AU7581474A (en) | 1976-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1073401A (en) | Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen | |
| CA1043736A (en) | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen | |
| CA1073402A (en) | Electrolytic manufacture of chlorates using a plurality of electrolytic cells | |
| US3899403A (en) | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes | |
| US4272338A (en) | Process for the treatment of anolyte brine | |
| SU1313352A3 (ru) | Катионообменна мембрана дл использовани при электролизе хлорида натри | |
| CA1056768A (en) | Coating metal anodes to decrease consumption rates | |
| US4012303A (en) | Trifluorostyrene sulfonic acid membranes | |
| US5223103A (en) | Electrochemical process for producing chloric acid-alkali metal chlorate mixtures | |
| KR850000052B1 (ko) | 불소화 혼성막 | |
| US4124477A (en) | Electrolytic cell utilizing pretreated semi-permeable membranes | |
| JPH0237936B2 (enFirst) | ||
| US3884778A (en) | Electrolytic production of hydrogen peroxide and alkali metal hydroxide | |
| CA1066222A (en) | Electrolytic cell including buffer, sulphate, acid, and chlorine dioxide compartments | |
| US3878072A (en) | Electrolytic method for the manufacture of chlorates | |
| US4053376A (en) | Electrolytic production of hydrogen iodide | |
| US3954579A (en) | Electrolytic method for the simultaneous manufacture of concentrated and dilute aqueous hydroxide solutions | |
| CA1076060A (en) | Electrolytic method for the manufacture of hypochlorites | |
| US3905879A (en) | Electrolytic manufacture of dithionites | |
| JPH0573834B2 (enFirst) | ||
| US3920551A (en) | Electrolytic method for the manufacture of dithionites | |
| US4584071A (en) | Process for electrolysis of brine with iodide impurities | |
| CA1179635A (en) | Technique of prestressing semi-permeable membranes | |
| US3935096A (en) | Production of aqueous metal hydroxide solutions of low metal halide concentration | |
| US4062743A (en) | Electrolytic process for potassium hydroxide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |