CA1071056A - Bleaching assistants - Google Patents
Bleaching assistantsInfo
- Publication number
- CA1071056A CA1071056A CA264,640A CA264640A CA1071056A CA 1071056 A CA1071056 A CA 1071056A CA 264640 A CA264640 A CA 264640A CA 1071056 A CA1071056 A CA 1071056A
- Authority
- CA
- Canada
- Prior art keywords
- bleaching
- weight
- percompounds
- acid
- melting point
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004061 bleaching Methods 0.000 title claims abstract description 55
- 239000000203 mixture Substances 0.000 claims abstract description 40
- 239000012190 activator Substances 0.000 claims abstract description 27
- 239000003381 stabilizer Substances 0.000 claims abstract description 22
- 238000002844 melting Methods 0.000 claims abstract description 9
- 230000008018 melting Effects 0.000 claims abstract description 9
- 238000005406 washing Methods 0.000 claims abstract description 9
- 239000004094 surface-active agent Substances 0.000 claims abstract description 7
- 150000004651 carbonic acid esters Chemical class 0.000 claims abstract description 5
- 239000011361 granulated particle Substances 0.000 claims abstract description 5
- 150000003009 phosphonic acids Chemical class 0.000 claims abstract description 3
- 239000003599 detergent Substances 0.000 claims description 25
- -1 alkali metal salts Chemical class 0.000 claims description 16
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical group CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 claims description 12
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 11
- 239000007844 bleaching agent Substances 0.000 claims description 11
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical group OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 claims description 11
- 239000002245 particle Substances 0.000 claims description 10
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 150000004965 peroxy acids Chemical class 0.000 claims description 6
- 239000004133 Sodium thiosulphate Substances 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 5
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 3
- 238000005507 spraying Methods 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000000320 mechanical mixture Substances 0.000 claims description 2
- 238000007873 sieving Methods 0.000 claims description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 claims 1
- 229960001484 edetic acid Drugs 0.000 claims 1
- 239000000843 powder Substances 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 12
- 239000008187 granular material Substances 0.000 description 11
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000003860 storage Methods 0.000 description 7
- 239000003760 tallow Substances 0.000 description 7
- 239000002002 slurry Substances 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229940116254 phosphonic acid Drugs 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229960001922 sodium perborate Drugs 0.000 description 3
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RKHMZKDESOMZLE-UHFFFAOYSA-N (1,3-diacetyl-5-acetyloxyimidazolidin-4-yl) acetate Chemical compound CC(=O)OC1C(OC(C)=O)N(C(C)=O)CN1C(C)=O RKHMZKDESOMZLE-UHFFFAOYSA-N 0.000 description 1
- NIHKFGMYMWGERR-UHFFFAOYSA-N (3-chlorobenzoyl) 3-chlorobenzoate Chemical compound ClC1=CC=CC(C(=O)OC(=O)C=2C=C(Cl)C=CC=2)=C1 NIHKFGMYMWGERR-UHFFFAOYSA-N 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- NGULNJDDRUSDPR-UHFFFAOYSA-N (diacetylamino) acetate Chemical compound CC(=O)ON(C(C)=O)C(C)=O NGULNJDDRUSDPR-UHFFFAOYSA-N 0.000 description 1
- VAVZXZURPCYUHS-RQOWECAXSA-N (z)-3-(hydrazinecarbonyl)-4-oxopent-2-enoic acid Chemical compound OC(=O)/C=C(C(=O)C)\C(=O)NN VAVZXZURPCYUHS-RQOWECAXSA-N 0.000 description 1
- BZJTUOGZUKFLQT-UHFFFAOYSA-N 1,3,5,7-tetramethylcyclooctane Chemical group CC1CC(C)CC(C)CC(C)C1 BZJTUOGZUKFLQT-UHFFFAOYSA-N 0.000 description 1
- CMPBGADGVYNAAG-UHFFFAOYSA-N 1,3-di(propanoyl)imidazolidine-2,4-dione Chemical compound CCC(=O)N1CC(=O)N(C(=O)CC)C1=O CMPBGADGVYNAAG-UHFFFAOYSA-N 0.000 description 1
- HUPQMDDKEZELTH-UHFFFAOYSA-N 1,3-diacetyl-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC(=O)N1C(=O)N(C(C)=O)C(C)(C)C1=O HUPQMDDKEZELTH-UHFFFAOYSA-N 0.000 description 1
- JTZUXKIKHMIVSD-UHFFFAOYSA-N 1-(carbamoylamino)propan-2-ylurea Chemical compound NC(=O)NC(C)CNC(N)=O JTZUXKIKHMIVSD-UHFFFAOYSA-N 0.000 description 1
- MUSGYYOCMDPAEO-UHFFFAOYSA-N 2,4,6,8-tetrazabicyclo[3.3.1]nonane-3,7-dione Chemical compound C1C2NC(=O)NC1NC(=O)N2 MUSGYYOCMDPAEO-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical compound OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- JDSQBDGCMUXRBM-UHFFFAOYSA-N 2-[2-(2-butoxypropoxy)propoxy]propan-1-ol Chemical group CCCCOC(C)COC(C)COC(C)CO JDSQBDGCMUXRBM-UHFFFAOYSA-N 0.000 description 1
- WFXJWACFHGTNEH-UHFFFAOYSA-N 3,6-dimethyl-1,4-di(propanoyl)piperazine-2,5-dione Chemical compound CCC(=O)N1C(C)C(=O)N(C(=O)CC)C(C)C1=O WFXJWACFHGTNEH-UHFFFAOYSA-N 0.000 description 1
- BTTRMCQEPDPCPA-UHFFFAOYSA-N 4-chlorophthalic anhydride Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1 BTTRMCQEPDPCPA-UHFFFAOYSA-N 0.000 description 1
- UXVMHSYMNTYLPO-UHFFFAOYSA-N 4-ethoxycarbonyloxybenzoic acid Chemical compound CCOC(=O)OC1=CC=C(C(O)=O)C=C1 UXVMHSYMNTYLPO-UHFFFAOYSA-N 0.000 description 1
- YNSJJJCTNXHMEW-UHFFFAOYSA-N 4-methoxy-n-methyl-n-methylsulfonylbenzamide Chemical compound COC1=CC=C(C(=O)N(C)S(C)(=O)=O)C=C1 YNSJJJCTNXHMEW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229940120146 EDTMP Drugs 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000004380 ashing Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002193 fatty amides Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UJPCOKISUIXFFR-UHFFFAOYSA-N n-acetyl-n-(4-methylphenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(C)C=C1 UJPCOKISUIXFFR-UHFFFAOYSA-N 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- QGILZBNKDUVXNM-UHFFFAOYSA-N n-methyl-n-methylsulfonyl-4-nitrobenzamide Chemical compound CS(=O)(=O)N(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1 QGILZBNKDUVXNM-UHFFFAOYSA-N 0.000 description 1
- DDNVNUWFESEAHN-UHFFFAOYSA-N n-methyl-n-methylsulfonylacetamide Chemical compound CC(=O)N(C)S(C)(=O)=O DDNVNUWFESEAHN-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- BXRNXXXXHLBUKK-UHFFFAOYSA-N piperazine-2,5-dione Chemical class O=C1CNC(=O)CN1 BXRNXXXXHLBUKK-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 229940098424 potassium pyrophosphate Drugs 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3937—Stabilising agents
- C11D3/394—Organic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Ink Jet (AREA)
- Surgical Instruments (AREA)
- Particle Formation And Scattering Control In Inkjet Printers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB45661/75A GB1561333A (en) | 1975-11-03 | 1975-11-03 | Bleaching assistants |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1071056A true CA1071056A (en) | 1980-02-05 |
Family
ID=10438086
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA264,640A Expired CA1071056A (en) | 1975-11-03 | 1976-11-02 | Bleaching assistants |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4111826A (OSRAM) |
| JP (1) | JPS5284189A (OSRAM) |
| AT (1) | AT357508B (OSRAM) |
| BE (1) | BE847937A (OSRAM) |
| CA (1) | CA1071056A (OSRAM) |
| CH (1) | CH626399A5 (OSRAM) |
| DE (1) | DE2650429C2 (OSRAM) |
| DK (1) | DK496576A (OSRAM) |
| ES (1) | ES452957A1 (OSRAM) |
| FI (1) | FI62137C (OSRAM) |
| FR (1) | FR2329747A1 (OSRAM) |
| GB (1) | GB1561333A (OSRAM) |
| NL (1) | NL164897C (OSRAM) |
| NO (1) | NO145802C (OSRAM) |
| PT (1) | PT65784B (OSRAM) |
| SE (1) | SE425096B (OSRAM) |
| ZA (1) | ZA766592B (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2963842D1 (en) * | 1978-06-26 | 1982-11-18 | Procter & Gamble | Particulate detergent additive product |
| FI64639C (fi) * | 1978-09-27 | 1983-12-12 | Unilever Nv | Bleknings- och rengoeringskomposition |
| IE49996B1 (en) * | 1979-07-06 | 1986-01-22 | Unilever Ltd | Particulate bleach compositions |
| IE51848B1 (en) * | 1980-11-06 | 1987-04-15 | Procter & Gamble | Bleach activator compositions,preparation thereof and use in granular detergent compositions |
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| GB8321923D0 (en) * | 1983-08-15 | 1983-09-14 | Unilever Plc | Machine-dishwashing compositions |
| GB8334159D0 (en) * | 1983-12-22 | 1984-02-01 | Unilever Plc | Perfume |
| GB8422158D0 (en) * | 1984-09-01 | 1984-10-03 | Procter & Gamble Ltd | Bleach compositions |
| US5580841A (en) * | 1985-05-29 | 1996-12-03 | Zeneca Limited | Solid, phytoactive compositions and method for their preparation |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| GB2213159B (en) * | 1987-12-03 | 1992-07-29 | Richardson Vicks Ltd | Cleansing compositions |
| DE3812693A1 (de) * | 1988-03-19 | 1989-09-28 | Reckitt Gmbh | Reinigungstablette fuer zahnprothesen |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| GB8904007D0 (en) * | 1989-02-22 | 1989-04-05 | Procter & Gamble | Stabilized,bleach containing,liquid detergent compositions |
| US4988451A (en) * | 1989-06-14 | 1991-01-29 | Lever Brothers Company, Division Of Conopco, Inc. | Stabilization of particles containing quaternary ammonium bleach precursors |
| US5258132A (en) * | 1989-11-15 | 1993-11-02 | Lever Brothers Company, Division Of Conopco, Inc. | Wax-encapsulated particles |
| US5200236A (en) * | 1989-11-15 | 1993-04-06 | Lever Brothers Company, Division Of Conopco, Inc. | Method for wax encapsulating particles |
| US5230822A (en) * | 1989-11-15 | 1993-07-27 | Lever Brothers Company, Division Of Conopco, Inc. | Wax-encapsulated particles |
| US5055217A (en) * | 1990-11-20 | 1991-10-08 | Lever Brothers Company, Division Of Conopco, Inc. | Polymer protected bleach precursors |
| DE19605526A1 (de) | 1996-02-15 | 1997-08-21 | Hoechst Ag | Ammoniumnitrile und deren Verwendung als Bleichaktivatoren |
| EP0816483A1 (en) * | 1996-06-27 | 1998-01-07 | The Procter & Gamble Company | Granular bleaching compositions |
| DE19719397A1 (de) * | 1997-05-07 | 1998-11-12 | Clariant Gmbh | Bleichaktive Metall-Komplexe |
| DE19728021A1 (de) * | 1997-07-01 | 1999-01-07 | Clariant Gmbh | Metall-Komplexe als Bleichaktivatoren |
| DE19943254A1 (de) | 1999-09-10 | 2001-03-15 | Clariant Gmbh | Bleichaktive Metallkomplexe |
| DE10019877A1 (de) | 2000-04-20 | 2001-10-25 | Clariant Gmbh | Wasch- und Reinigungsmittel enthaltend bleichaktive Dendrimer-Liganden und deren Metall-Komplexe |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL211065A (OSRAM) * | 1955-10-03 | |||
| NL97449C (OSRAM) * | 1959-06-19 | |||
| GB1204123A (en) * | 1966-11-29 | 1970-09-03 | Unilever Ltd | Detergent composition |
| DE2060762A1 (de) * | 1970-12-10 | 1972-06-22 | Henkel & Cie Gmbh | Mittel zur Herstellung von Kaltbleichflotten,insbesondere von kaltbleichwirksamen Waschlaugen |
| DE2115081A1 (en) * | 1971-03-29 | 1972-10-05 | Complexing agent for bleaches - consisting of paraffin-coated disodium ethylenediaminetetraacetate dihydrate particles | |
| GB1392284A (en) * | 1971-03-30 | 1975-04-30 | Unilever Ltd | Stabilisation of active oxygen releasing compounds |
| GB1395006A (en) * | 1971-04-30 | 1975-05-21 | Unilever Ltd | Activators for per compounds |
| DE2141280A1 (de) * | 1971-08-18 | 1973-03-01 | Henkel & Cie Gmbh | Zur verwendung in aktivsauerstoff enthaltenden bleich- und waschmitteln bestimmtes eingehuelltes aethylendiamintetraacetat |
| AT339246B (de) * | 1974-08-14 | 1977-10-10 | Henkel & Cie Gmbh | Als bestandteil von pulverformigen wasch- und bleichmitteln geeignetes bleichhilfsmittel |
| AT326611B (de) * | 1972-07-31 | 1975-12-29 | Henkel & Cie Gmbh | Als bestandteil von pulverförmigen wasch- und bleichmitteln geeignetes bleichhilfsmittel |
-
1975
- 1975-11-03 GB GB45661/75A patent/GB1561333A/en not_active Expired
-
1976
- 1976-11-02 US US05/737,980 patent/US4111826A/en not_active Expired - Lifetime
- 1976-11-02 FR FR7633015A patent/FR2329747A1/fr active Granted
- 1976-11-02 PT PT65784A patent/PT65784B/pt unknown
- 1976-11-02 CA CA264,640A patent/CA1071056A/en not_active Expired
- 1976-11-03 CH CH1388076A patent/CH626399A5/de not_active IP Right Cessation
- 1976-11-03 DK DK496576A patent/DK496576A/da not_active Application Discontinuation
- 1976-11-03 ZA ZA00766592A patent/ZA766592B/xx unknown
- 1976-11-03 NO NO763733A patent/NO145802C/no unknown
- 1976-11-03 FI FI763142A patent/FI62137C/fi not_active IP Right Cessation
- 1976-11-03 DE DE2650429A patent/DE2650429C2/de not_active Expired
- 1976-11-03 ES ES452957A patent/ES452957A1/es not_active Expired
- 1976-11-03 NL NL7612164.A patent/NL164897C/xx not_active IP Right Cessation
- 1976-11-03 BE BE172041A patent/BE847937A/xx not_active IP Right Cessation
- 1976-11-03 SE SE7612254A patent/SE425096B/xx not_active IP Right Cessation
- 1976-11-03 AT AT813876A patent/AT357508B/de not_active IP Right Cessation
- 1976-11-04 JP JP13274376A patent/JPS5284189A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE425096B (sv) | 1982-08-30 |
| NL164897C (nl) | 1981-02-16 |
| FI62137C (fi) | 1982-11-10 |
| NL7612164A (nl) | 1977-05-05 |
| SE7612254L (sv) | 1977-05-04 |
| NO145802B (no) | 1982-02-22 |
| FI62137B (fi) | 1982-07-30 |
| FI763142A7 (OSRAM) | 1977-05-04 |
| JPS5760400B2 (OSRAM) | 1982-12-18 |
| GB1561333A (en) | 1980-02-20 |
| ATA813876A (de) | 1979-12-15 |
| PT65784A (en) | 1976-12-01 |
| PT65784B (de) | 1978-10-10 |
| NL164897B (nl) | 1980-09-15 |
| US4111826A (en) | 1978-09-05 |
| DE2650429A1 (de) | 1977-05-05 |
| FR2329747A1 (fr) | 1977-05-27 |
| DE2650429C2 (de) | 1982-09-23 |
| FR2329747B1 (OSRAM) | 1980-05-09 |
| JPS5284189A (en) | 1977-07-13 |
| ZA766592B (en) | 1978-06-28 |
| NO145802C (no) | 1982-06-02 |
| NO763733L (OSRAM) | 1977-05-04 |
| BE847937A (fr) | 1977-05-03 |
| CH626399A5 (OSRAM) | 1981-11-13 |
| ES452957A1 (es) | 1978-01-16 |
| AT357508B (de) | 1980-07-10 |
| DK496576A (da) | 1977-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1071056A (en) | Bleaching assistants | |
| US6133216A (en) | Coated ammonium nitrile bleach activator granules | |
| CA1168806A (en) | Bleach activator granules and preparation thereof | |
| CA2004269C (en) | Coloring stabilized bleach activator extrudates | |
| KR100564071B1 (ko) | 피복된 과립 형태의 암모늄 니트릴계 표백 활성화제 | |
| CA1135589A (en) | Bleaching and cleaning compositions | |
| EP0486078B1 (en) | Silicate composition | |
| US20030207784A1 (en) | Process for producing coated bleach activator granules | |
| US5167852A (en) | Process for preparing particulate detergent additive bodies and use thereof in detergent compositions | |
| AU666918B2 (en) | Granular percarbonate laundry bleach containing layered silicate stabilizer | |
| CA1105658A (en) | Activated bleaching process and compositions therefor | |
| US5055217A (en) | Polymer protected bleach precursors | |
| AU619964B2 (en) | Particulate detergent additive product, preparation and use thereof in detergent compositions | |
| EP0241962B1 (en) | Granular non-phosphorus detergent bleach compositions | |
| EP0427314B1 (en) | Bleaching composition | |
| US6498133B2 (en) | Particulate bleach activators based on acetonitriles | |
| CA1062981A (en) | Preparation of detergent compositions | |
| CA1337041C (en) | Granular detergent compositions having improved solubility | |
| JPH06501723A (ja) | 過炭酸塩を含有する洗剤 | |
| IE53182B1 (en) | Bleaching activator granules,their preparation and their use in detergent and bleaching compositions | |
| US5702635A (en) | Granular laundry bleaching composition | |
| CA2199130C (en) | Bleaching agent | |
| JPH0391599A (ja) | 顆粒状漂白剤活性化剤粒子 | |
| MXPA00002645A (en) | Bleaching activators based on ammonium nitrile in the form of coated granules | |
| CA2055423A1 (en) | Polymer-protected bleach precursors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |