CA1070582A - Valve rotator for internal combustion engines - Google Patents
Valve rotator for internal combustion enginesInfo
- Publication number
- CA1070582A CA1070582A CA292,672A CA292672A CA1070582A CA 1070582 A CA1070582 A CA 1070582A CA 292672 A CA292672 A CA 292672A CA 1070582 A CA1070582 A CA 1070582A
- Authority
- CA
- Canada
- Prior art keywords
- ramp
- parts
- rotator
- valve
- ball
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002485 combustion reaction Methods 0.000 title description 4
- 230000007423 decrease Effects 0.000 claims description 7
- 230000007246 mechanism Effects 0.000 abstract description 6
- 230000009471 action Effects 0.000 description 8
- 238000010276 construction Methods 0.000 description 6
- 238000005096 rolling process Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- 230000008901 benefit Effects 0.000 description 3
- ZPEZUAAEBBHXBT-WCCKRBBISA-N (2s)-2-amino-3-methylbutanoic acid;2-amino-3-methylbutanoic acid Chemical class CC(C)C(N)C(O)=O.CC(C)[C@H](N)C(O)=O ZPEZUAAEBBHXBT-WCCKRBBISA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000012886 linear function Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F01—MACHINES OR ENGINES IN GENERAL; ENGINE PLANTS IN GENERAL; STEAM ENGINES
- F01L—CYCLICALLY OPERATING VALVES FOR MACHINES OR ENGINES
- F01L1/00—Valve-gear or valve arrangements, e.g. lift-valve gear
- F01L1/32—Valve-gear or valve arrangements, e.g. lift-valve gear characterised by the provision of means for rotating lift valves, e.g. to diminish wear
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Valve-Gear Or Valve Arrangements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/754,074 US4141325A (en) | 1976-12-23 | 1976-12-23 | Valve rotator |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1070582A true CA1070582A (en) | 1980-01-29 |
Family
ID=25033382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA292,672A Expired CA1070582A (en) | 1976-12-23 | 1977-12-08 | Valve rotator for internal combustion engines |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4141325A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5379113A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7708484A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1070582A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2757455A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2375446A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1570797A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1088574B (cg-RX-API-DMAC10.html) |
| SE (1) | SE432123B (cg-RX-API-DMAC10.html) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55112005U (cg-RX-API-DMAC10.html) * | 1979-02-02 | 1980-08-06 | ||
| US4227493A (en) * | 1979-02-07 | 1980-10-14 | Trw Inc. | Valve rotator |
| FI67606C (fi) * | 1980-08-08 | 1985-04-10 | Maerkisches Werk Gmbh | Ventilvridningsanordning |
| US4538558A (en) * | 1980-12-10 | 1985-09-03 | Trw Inc. | Valve rotating device |
| JPS6226506U (cg-RX-API-DMAC10.html) * | 1985-07-30 | 1987-02-18 | ||
| US5148779A (en) * | 1990-05-09 | 1992-09-22 | Koyo Seiko Co., Ltd. | Valve rotating apparatus of internal-combustion engine |
| JPH0868304A (ja) * | 1994-08-29 | 1996-03-12 | Fuji Oozx Inc | エンジンバルブ用ローテータ |
| JPH08303216A (ja) * | 1995-05-08 | 1996-11-19 | Fuji Oozx Inc | 内燃機関用タペットの製造方法 |
| DE10015417A1 (de) | 2000-03-28 | 2001-01-25 | Michael Engesser | Ventildrehvorrichtung |
| HK1033238A2 (en) | 2001-01-20 | 2001-08-03 | 刘富华 | A control device for an air valve of an internal combustion engine |
| DE10315493B4 (de) | 2003-04-04 | 2005-03-17 | Engesser, Michael, Dr. | Ventildrehvorrichtung |
| US20060196457A1 (en) * | 2005-03-03 | 2006-09-07 | Timken Us Corporation | Valve actuator assembly |
| WO2009134680A1 (en) * | 2008-04-30 | 2009-11-05 | Florek Bronislaw B | Improved ball type valve rotator |
| US8714184B1 (en) | 2011-02-17 | 2014-05-06 | Bronislaw B. Florek | Caged ball and spring valve rotator |
| DE102017126541B3 (de) * | 2017-11-13 | 2018-11-22 | Federal-Mogul Valvetrain Gmbh | Ventildrehvorrichtung für Verbrennungsmotoren |
| DE102020111090A1 (de) * | 2020-04-23 | 2021-10-28 | Federal-Mogul Valvetrain Gmbh | Deckelkörper für ventildrehvorrichtung, entsprechende ventildrehvorrichtung und verfahren zur herstellung des deckelkörpers |
| DE102021122847A1 (de) | 2021-09-03 | 2023-03-09 | Federal-Mogul Valvetrain Gmbh | Ventildrehvorrichtung und Verbundkomponente dafür |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2582060A (en) * | 1947-09-29 | 1952-01-08 | Thompson Prod Inc | Valve rotating device |
| GB698549A (en) * | 1950-10-26 | 1953-10-21 | Clifton Llewellyn Stancliff | Mechanical silent tappet |
| US2662511A (en) * | 1951-04-10 | 1953-12-15 | Thompson Prod Inc | Automatic mechanical clearance regulator |
| US2775232A (en) * | 1953-06-19 | 1956-12-25 | Julius E Witzky | Valve rotator |
| US2875740A (en) * | 1955-08-29 | 1959-03-03 | James M Leake | Stamped valve rotator cage |
| US2935058A (en) * | 1958-01-03 | 1960-05-03 | William D Dooley | Valve rotating device |
| DE1955820B1 (de) * | 1969-11-06 | 1971-08-26 | Teves Thompson Gmbh | Vorrichtung zum Drehen eines Tellerventils fuer Brennkraftmaschinen |
| US3890943A (en) * | 1972-12-12 | 1975-06-24 | Teves Thompson Gmbh | Valve rotating devices |
| US3952713A (en) * | 1975-04-23 | 1976-04-27 | Trw Inc. | Valve rotator |
| US4075987A (en) * | 1975-04-23 | 1978-02-28 | Trw Inc. | Valve rotator |
-
1976
- 1976-12-23 US US05/754,074 patent/US4141325A/en not_active Expired - Lifetime
-
1977
- 1977-12-08 CA CA292,672A patent/CA1070582A/en not_active Expired
- 1977-12-13 GB GB51856/77A patent/GB1570797A/en not_active Expired
- 1977-12-20 BR BR7708484A patent/BR7708484A/pt unknown
- 1977-12-21 IT IT31011/77A patent/IT1088574B/it active
- 1977-12-21 FR FR7738697A patent/FR2375446A1/fr active Granted
- 1977-12-22 SE SE7714664A patent/SE432123B/sv not_active IP Right Cessation
- 1977-12-22 JP JP15507277A patent/JPS5379113A/ja active Granted
- 1977-12-22 DE DE19772757455 patent/DE2757455A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| BR7708484A (pt) | 1978-08-08 |
| IT1088574B (it) | 1985-06-10 |
| JPS5534286B2 (cg-RX-API-DMAC10.html) | 1980-09-05 |
| US4141325A (en) | 1979-02-27 |
| FR2375446B1 (cg-RX-API-DMAC10.html) | 1983-07-22 |
| SE432123B (sv) | 1984-03-19 |
| GB1570797A (en) | 1980-07-09 |
| FR2375446A1 (fr) | 1978-07-21 |
| SE7714664L (sv) | 1978-06-24 |
| JPS5379113A (en) | 1978-07-13 |
| DE2757455C2 (cg-RX-API-DMAC10.html) | 1991-01-03 |
| DE2757455A1 (de) | 1978-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1070582A (en) | Valve rotator for internal combustion engines | |
| US4926835A (en) | Ball bearing type bow string release | |
| US4522085A (en) | Variable lobe cam mechanism | |
| EP0067311B1 (en) | Variable valve timing arrangement for an internal combustion engine or the like | |
| DE4210143C2 (de) | Ventilantrieb für eine Brennkraftmaschine | |
| DE4446725A1 (de) | Verfahren und Vorrichtung zur variablen Steuerung eines Ventils einer Brennkraftmaschine | |
| US4607600A (en) | Valve actuating apparatus in internal combustion engine | |
| GB1604707A (en) | Valve control mechanism | |
| US5746166A (en) | CAM lobe with offset angular movement | |
| US5671706A (en) | Variable valve timing | |
| US4075987A (en) | Valve rotator | |
| DE2758199C2 (cg-RX-API-DMAC10.html) | ||
| US1905888A (en) | Screw type mechanical lash adjuster for valves | |
| US4538558A (en) | Valve rotating device | |
| JPS6214689B2 (cg-RX-API-DMAC10.html) | ||
| DE102008052413A1 (de) | Ventiltrieb einer Brennkraftmaschine | |
| US20060196457A1 (en) | Valve actuator assembly | |
| US3952713A (en) | Valve rotator | |
| DE19825308A1 (de) | Variabler Ventiltrieb für eine Brennkraftmaschine | |
| US4003353A (en) | Valve rotator | |
| US5694892A (en) | Roller camshaft for internal combustion engine | |
| DE19825964A1 (de) | Ventiltrieb einer Brennkraftmaschine | |
| US3537325A (en) | Valve rotator | |
| EP1022443B1 (de) | Vorrichtung zur variablen Steuerung eines Ventils einer Brennkraftmaschine | |
| US3482555A (en) | Internal combustion engine valve spring arrangement |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |