CA1070325A - Fungicidal substituted 2-cyanoacetamide derivatives - Google Patents
Fungicidal substituted 2-cyanoacetamide derivativesInfo
- Publication number
- CA1070325A CA1070325A CA260,764A CA260764A CA1070325A CA 1070325 A CA1070325 A CA 1070325A CA 260764 A CA260764 A CA 260764A CA 1070325 A CA1070325 A CA 1070325A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- formula
- methyl
- cyano
- plants
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000855 fungicidal effect Effects 0.000 title description 3
- DGJMPUGMZIKDRO-NJFSPNSNSA-N 2-cyanoacetamide Chemical class NC(=O)[14CH2]C#N DGJMPUGMZIKDRO-NJFSPNSNSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 54
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims abstract description 6
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims abstract 5
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims abstract 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 150000001450 anions Chemical class 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 5
- 238000004519 manufacturing process Methods 0.000 claims 3
- 208000031888 Mycoses Diseases 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical group 0.000 claims 2
- 230000020477 pH reduction Effects 0.000 claims 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Chemical group 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 15
- 201000010099 disease Diseases 0.000 abstract description 14
- 241000196324 Embryophyta Species 0.000 description 36
- 239000000203 mixture Substances 0.000 description 29
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000009472 formulation Methods 0.000 description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 9
- 238000011282 treatment Methods 0.000 description 9
- 241000233866 Fungi Species 0.000 description 8
- -1 potas~ium cyanate Chemical compound 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 241000227653 Lycopersicon Species 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 238000011534 incubation Methods 0.000 description 5
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 5
- 229920000940 maneb Polymers 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241000233679 Peronosporaceae Species 0.000 description 4
- 241000233622 Phytophthora infestans Species 0.000 description 4
- 235000002595 Solanum tuberosum Nutrition 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000003905 agrochemical Substances 0.000 description 4
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- 244000061456 Solanum tuberosum Species 0.000 description 3
- 229960000892 attapulgite Drugs 0.000 description 3
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 3
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 3
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 3
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000417 fungicide Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 229910052625 palygorskite Inorganic materials 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical class CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 3
- ORQGCZICHIRLTG-UHFFFAOYSA-N 2-amino-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CON=C(C#N)C(N)=O ORQGCZICHIRLTG-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000212342 Sium Species 0.000 description 2
- JZFICWYCTCCINF-UHFFFAOYSA-N Thiadiazin Chemical compound S=C1SC(C)NC(C)N1CCN1C(=S)SC(C)NC1C JZFICWYCTCCINF-UHFFFAOYSA-N 0.000 description 2
- 241000219094 Vitaceae Species 0.000 description 2
- 240000006365 Vitis vinifera Species 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 2
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 2
- 235000021021 grapes Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- QJGRPCPCQQPZLZ-UHFFFAOYSA-N n-carbamoyl-2-cyanoacetamide Chemical compound NC(=O)NC(=O)CC#N QJGRPCPCQQPZLZ-UHFFFAOYSA-N 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000001850 reproductive effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 229960002447 thiram Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 1
- DNGAVRSBTQPGRB-UHFFFAOYSA-N 2-(cyclopropylcarbamoylamino)-n-ethoxy-2-oxoethanimidoyl cyanide Chemical compound CCON=C(C#N)C(=O)NC(=O)NC1CC1 DNGAVRSBTQPGRB-UHFFFAOYSA-N 0.000 description 1
- OYRAAGJEBRMKQS-UHFFFAOYSA-N 2-(cyclopropylcarbamoylamino)-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CON=C(C#N)C(=O)NC(=O)NC1CC1 OYRAAGJEBRMKQS-UHFFFAOYSA-N 0.000 description 1
- WUIRJQNUUSLNIW-UHFFFAOYSA-N 2-(cyclopropylmethylcarbamoylamino)-N-methoxy-2-oxoethanimidoyl cyanide Chemical compound C(#N)C(C(=O)NC(NCC1CC1)=O)=NOC WUIRJQNUUSLNIW-UHFFFAOYSA-N 0.000 description 1
- AYEZRZNKFKXZDT-UHFFFAOYSA-N 2-(cyclopropylmethylcarbamoylamino)-n-ethoxy-2-oxoethanimidoyl cyanide Chemical compound CCON=C(C#N)C(=O)NC(=O)NCC1CC1 AYEZRZNKFKXZDT-UHFFFAOYSA-N 0.000 description 1
- JEWXOXBFMQZNAQ-UHFFFAOYSA-N 2-[carbamoyl(3-methoxypropyl)amino]-N-ethoxy-2-oxoethanimidoyl cyanide Chemical compound C(#N)C(C(=O)N(CCCOC)C(N)=O)=NOCC JEWXOXBFMQZNAQ-UHFFFAOYSA-N 0.000 description 1
- OMJLFBFEDGKJCK-UHFFFAOYSA-N 2-cyano-2-hydroxyimino-N-(3-methoxypropylcarbamoyl)acetamide Chemical compound COCCCNC(=O)NC(=O)C(=NO)C#N OMJLFBFEDGKJCK-UHFFFAOYSA-N 0.000 description 1
- CAFXGFHPOQBGJP-UHFFFAOYSA-N 2-cyano-2-hydroxyiminoacetamide Chemical compound NC(=O)C(=NO)C#N CAFXGFHPOQBGJP-UHFFFAOYSA-N 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- SJCBTGYXKOFNHX-UHFFFAOYSA-N 3-methoxypropylurea Chemical compound COCCCNC(N)=O SJCBTGYXKOFNHX-UHFFFAOYSA-N 0.000 description 1
- 102100027522 Baculoviral IAP repeat-containing protein 7 Human genes 0.000 description 1
- 101710177963 Baculoviral IAP repeat-containing protein 7 Proteins 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 239000005766 Dodine Substances 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 241000269801 Perca Species 0.000 description 1
- 241001270527 Phyllosticta citrullina Species 0.000 description 1
- 241000233614 Phytophthora Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 239000005843 Thiram Substances 0.000 description 1
- 239000005848 Tribasic copper sulfate Substances 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- RKZXQQPEDGMHBJ-LIGJGSPWSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentakis[[(z)-octadec-9-enoyl]oxy]hexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC RKZXQQPEDGMHBJ-LIGJGSPWSA-N 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000676 alkoxyimino group Chemical group 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 239000011717 all-trans-retinol Substances 0.000 description 1
- 235000019169 all-trans-retinol Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012677 causal agent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 1
- CLMGCKCDSPUQEE-UHFFFAOYSA-N cyclopropylurea Chemical compound NC(=O)NC1CC1 CLMGCKCDSPUQEE-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- WURGXGVFSMYFCG-UHFFFAOYSA-N dichlofluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1 WURGXGVFSMYFCG-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 239000012021 ethylating agents Substances 0.000 description 1
- AWYFNIZYMPNGAI-UHFFFAOYSA-N ethylenebis(dithiocarbamic acid) Chemical class SC(=S)NCCNC(S)=S AWYFNIZYMPNGAI-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 230000005094 fruit set Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 235000021374 legumes Nutrition 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical class [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Chemical class 0.000 description 1
- AFCCDDWKHLHPDF-UHFFFAOYSA-M metam-sodium Chemical compound [Na+].CNC([S-])=S AFCCDDWKHLHPDF-UHFFFAOYSA-M 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- VCBXDDWTBDJIQH-UHFFFAOYSA-N n-(4,5-dihydro-1,3-thiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)benzamide Chemical compound C=1C=CC(N2C(C3=CC=CC=C3C2=O)=O)=CC=1C(=O)NC1=NCCS1 VCBXDDWTBDJIQH-UHFFFAOYSA-N 0.000 description 1
- TYOPHXTUNRZBPI-UHFFFAOYSA-N n-methoxy-2-(methoxymethylcarbamoylamino)-2-oxoethanimidoyl cyanide Chemical compound COCNC(=O)NC(=O)C(C#N)=NOC TYOPHXTUNRZBPI-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- IJIHYLHFNAWUGR-UHFFFAOYSA-N propylene 1,2-bis(dithiocarbamic acid) Chemical class SC(=S)NC(C)CNC(S)=S IJIHYLHFNAWUGR-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- LITQZINTSYBKIU-UHFFFAOYSA-F tetracopper;hexahydroxide;sulfate Chemical compound [OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Cu+2].[Cu+2].[Cu+2].[Cu+2].[O-]S([O-])(=O)=O LITQZINTSYBKIU-UHFFFAOYSA-F 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- SBXWFLISHPUINY-UHFFFAOYSA-N triphenyltin Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 SBXWFLISHPUINY-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/612,548 US3984568A (en) | 1975-09-11 | 1975-09-11 | Fungicidal cyclopropyl substituted 2-cyanoacetamide derivatives |
| US05/612,547 US3979518A (en) | 1975-09-11 | 1975-09-11 | Fungicidal alkoxy substituted 2-cyanoacetamide derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1070325A true CA1070325A (en) | 1980-01-22 |
Family
ID=27086790
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA260,764A Expired CA1070325A (en) | 1975-09-11 | 1976-09-08 | Fungicidal substituted 2-cyanoacetamide derivatives |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS5236626A (enExample) |
| AR (1) | AR215593A1 (enExample) |
| AU (1) | AU507860B2 (enExample) |
| BR (1) | BR7605933A (enExample) |
| CA (1) | CA1070325A (enExample) |
| CS (1) | CS189030B2 (enExample) |
| DD (1) | DD128479A5 (enExample) |
| DE (1) | DE2635967A1 (enExample) |
| DK (1) | DK333276A (enExample) |
| ES (1) | ES451451A1 (enExample) |
| FR (1) | FR2323684A1 (enExample) |
| GB (1) | GB1510035A (enExample) |
| HU (1) | HU178512B (enExample) |
| IT (1) | IT1078771B (enExample) |
| NZ (1) | NZ182013A (enExample) |
| PL (1) | PL100076B1 (enExample) |
| PT (1) | PT65576B (enExample) |
| RO (1) | RO72554A (enExample) |
| YU (1) | YU222976A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188401A (en) | 1977-06-04 | 1980-02-12 | Bayer Aktiengesellschaft | Combating fungi with 1-(ω-substituted pentyl)-3-(2-cyano-acetyl)-ureas |
| CH640109A5 (en) * | 1978-03-06 | 1983-12-30 | Sandoz Ag | Method for preventing attack by rusts |
| DE2837863A1 (de) * | 1978-09-04 | 1980-03-13 | Ciba Geigy Ag | Oxim-derivate zum schutz von pflanzenkulturen |
| IT1188653B (it) * | 1986-04-15 | 1988-01-20 | Montedison Spa | Cianoacetoammido-derivati ad azione antifungina |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA731111B (en) * | 1972-03-15 | 1974-03-27 | Du Pont | 2-cyano-2-hydroxyiminoacetamides and acetates as plant disease control agents |
| IE38344B1 (en) * | 1972-10-13 | 1978-02-15 | Ciba Geigy Ag | Cyano-hydroxyimino-acetamide derivatives as plant growth regulants and fungicides |
| DE2436655A1 (de) * | 1973-08-02 | 1975-02-20 | Ciba Geigy Ag | (carbamoyl-oximino)-cyanacetyl-harnstoffe |
| US3919284A (en) * | 1974-06-13 | 1975-11-11 | Du Pont | Process for making 2-cyano-2-hydroxyiminoacetamide salts |
-
1976
- 1976-07-23 DK DK333276A patent/DK333276A/da not_active Application Discontinuation
- 1976-08-10 DE DE19762635967 patent/DE2635967A1/de not_active Withdrawn
- 1976-09-08 CS CS583176A patent/CS189030B2/cs unknown
- 1976-09-08 AR AR26462876A patent/AR215593A1/es active
- 1976-09-08 CA CA260,764A patent/CA1070325A/en not_active Expired
- 1976-09-08 DD DD19468376A patent/DD128479A5/xx unknown
- 1976-09-09 PL PL19228976A patent/PL100076B1/pl unknown
- 1976-09-09 JP JP10732476A patent/JPS5236626A/ja active Pending
- 1976-09-09 BR BR7605933A patent/BR7605933A/pt unknown
- 1976-09-10 YU YU222976A patent/YU222976A/xx unknown
- 1976-09-10 FR FR7627282A patent/FR2323684A1/fr active Granted
- 1976-09-10 AU AU17610/76A patent/AU507860B2/en not_active Expired
- 1976-09-10 PT PT6557676A patent/PT65576B/pt unknown
- 1976-09-10 NZ NZ18201376A patent/NZ182013A/xx unknown
- 1976-09-10 HU HUDU000257 patent/HU178512B/hu unknown
- 1976-09-10 IT IT2713176A patent/IT1078771B/it active
- 1976-09-10 GB GB3768476A patent/GB1510035A/en not_active Expired
- 1976-09-10 ES ES451451A patent/ES451451A1/es not_active Expired
- 1976-09-11 RO RO7687510A patent/RO72554A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1510035A (en) | 1978-05-10 |
| RO72554A (ro) | 1982-02-26 |
| PT65576A (en) | 1976-10-01 |
| DK333276A (da) | 1977-03-12 |
| AR215593A1 (es) | 1979-10-31 |
| PL100076B1 (pl) | 1978-08-31 |
| IT1078771B (it) | 1985-05-08 |
| PT65576B (en) | 1978-03-28 |
| JPS5236626A (en) | 1977-03-22 |
| ES451451A1 (es) | 1978-12-01 |
| FR2323684A1 (fr) | 1977-04-08 |
| HU178512B (en) | 1982-05-28 |
| FR2323684B1 (enExample) | 1980-05-30 |
| YU222976A (en) | 1982-10-31 |
| CS189030B2 (en) | 1979-03-30 |
| DD128479A5 (de) | 1977-11-16 |
| DE2635967A1 (de) | 1977-03-17 |
| BR7605933A (pt) | 1977-08-16 |
| NZ182013A (en) | 1978-03-06 |
| AU507860B2 (en) | 1980-02-28 |
| AU1761076A (en) | 1978-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3957847A (en) | 2-cyano-2-hydroxyiminoacetamides as plant disease control agents | |
| CA1040530A (en) | 2-cyano-2-hydroxyiminoacetamides and acetates as plant disease control agents | |
| US4830661A (en) | Substituted tetrazolinones and herbicidal compositions thereof | |
| US3954992A (en) | 2-Cyano-2-hydroxyiminoacetamides as plant disease control agents | |
| US4684398A (en) | Herbicidal cyanoguanidines and cyanoisothioureas | |
| US5019152A (en) | Substituted tetrazolinones and their use as herbicides | |
| US5003075A (en) | Preparation of substituted tetrazolinones | |
| US3564608A (en) | Selected n-acylsubstituted-n'-hydroxyguanidines | |
| CA1070325A (en) | Fungicidal substituted 2-cyanoacetamide derivatives | |
| US2895817A (en) | Herbicidal method and composition employing substituted phenyl parabanic acids | |
| JPS6036467A (ja) | 置換フエニルスルホニルグアニジン誘導体、その中間体、それらの製法及び雑草防除剤 | |
| JP2790299B2 (ja) | ペンゾチアゾール誘導体 | |
| EP0274717A2 (en) | Plant male sterilant | |
| US3979518A (en) | Fungicidal alkoxy substituted 2-cyanoacetamide derivatives | |
| US3984568A (en) | Fungicidal cyclopropyl substituted 2-cyanoacetamide derivatives | |
| US3113968A (en) | 1-phenyl, 1-hydroxyalkyl, 3, 3-dialkyl-ureas | |
| JPS62205063A (ja) | 新規な２−シアノベンゾイミダゾ−ル誘導体、その製造方法および殺菌剤としてのその使用、並びに他の殺菌剤との組合せ物 | |
| US3412101A (en) | Substituted 2-trifluoromethyl benzimidazoles | |
| US3343943A (en) | Herbicidal methods and compositions employing 3, 4-dichloro-phenyl dimethyl and methylethyl ureas | |
| US5120346A (en) | Substituted tetrazolinones for plant growth inhibition | |
| US3383195A (en) | m-(3, 3-dimethylureido) phenyl dimethyl-sulfamate as a herbicide | |
| US2884317A (en) | Herbicidal composition and a method for killing undesired vegetation therewith | |
| US4258060A (en) | Substituted trichloropropylureas as plant disease control agents | |
| US3933469A (en) | Methods for increasing crop yields | |
| US4051255A (en) | 2-cyano-2-hydroxyiminoacetamides as plant disease control agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |