CA1069902A - 1,4-dihydropyridines - Google Patents
1,4-dihydropyridinesInfo
- Publication number
- CA1069902A CA1069902A CA245,000A CA245000A CA1069902A CA 1069902 A CA1069902 A CA 1069902A CA 245000 A CA245000 A CA 245000A CA 1069902 A CA1069902 A CA 1069902A
- Authority
- CA
- Canada
- Prior art keywords
- ester
- acid
- mmols
- acetoacetic
- beta
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 title abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 249
- 150000001412 amines Chemical class 0.000 claims abstract description 11
- 239000002253 acid Substances 0.000 claims description 394
- -1 acetoacetic acid ester Chemical class 0.000 claims description 272
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 181
- 150000002148 esters Chemical class 0.000 claims description 133
- 229910021529 ammonia Inorganic materials 0.000 claims description 90
- 150000004702 methyl esters Chemical class 0.000 claims description 73
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 claims description 56
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 claims description 49
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 44
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 31
- 125000003545 alkoxy group Chemical group 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- WOFAGNLBCJWEOE-UHFFFAOYSA-N Benzyl acetoacetate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1 WOFAGNLBCJWEOE-UHFFFAOYSA-N 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 150000001299 aldehydes Chemical class 0.000 claims description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 12
- GVIIRWAJDFKJMJ-UHFFFAOYSA-N propan-2-yl 3-oxobutanoate Chemical compound CC(C)OC(=O)CC(C)=O GVIIRWAJDFKJMJ-UHFFFAOYSA-N 0.000 claims description 12
- CJBFCOOECPQZDM-VOTSOKGWSA-N methyl (e)-5-(2-nitrophenyl)-3-oxopent-4-enoate Chemical compound COC(=O)CC(=O)\C=C\C1=CC=CC=C1[N+]([O-])=O CJBFCOOECPQZDM-VOTSOKGWSA-N 0.000 claims description 11
- PLHCSZRZWOWUBW-UHFFFAOYSA-N 2-methoxyethyl 3-oxobutanoate Chemical compound COCCOC(=O)CC(C)=O PLHCSZRZWOWUBW-UHFFFAOYSA-N 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 9
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 9
- VAIHMTKIAQSRRR-UHFFFAOYSA-N (3-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=CC(Cl)=C1 VAIHMTKIAQSRRR-UHFFFAOYSA-N 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- FSOYSMKPRYWSAC-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C(F)(F)F)C=C1 FSOYSMKPRYWSAC-UHFFFAOYSA-N 0.000 claims description 6
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 6
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims description 6
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 125000003944 tolyl group Chemical group 0.000 claims description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 3
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 3
- 125000004188 dichlorophenyl group Chemical group 0.000 claims description 3
- 125000005805 dimethoxy phenyl group Chemical group 0.000 claims description 3
- 125000001680 trimethoxyphenyl group Chemical group 0.000 claims description 3
- GSBJXOIVIOYPOW-UHFFFAOYSA-N 1-phenylethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC(C)C1=CC=CC=C1 GSBJXOIVIOYPOW-UHFFFAOYSA-N 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 7
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 4
- WXAVSTZWKNIWCN-UHFFFAOYSA-N 1-(1-phenylethoxy)ethylbenzene Chemical compound C=1C=CC=CC=1C(C)OC(C)C1=CC=CC=C1 WXAVSTZWKNIWCN-UHFFFAOYSA-N 0.000 claims 3
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims 3
- YXYDBRQYOFBJQF-UHFFFAOYSA-N 3-o-[(3-chlorophenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 YXYDBRQYOFBJQF-UHFFFAOYSA-N 0.000 claims 2
- ILXKUSBVKYPTMJ-UHFFFAOYSA-N 3-o-methyl 5-o-[[4-(trifluoromethyl)phenyl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(=CC=2)C(F)(F)F)C1C1=CC=CC([N+]([O-])=O)=C1 ILXKUSBVKYPTMJ-UHFFFAOYSA-N 0.000 claims 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims 2
- VUAHTMHCIZYMEO-UHFFFAOYSA-N 5-o-[(3-chlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 VUAHTMHCIZYMEO-UHFFFAOYSA-N 0.000 claims 2
- DFCMHZMOHTZEBA-UHFFFAOYSA-N 5-o-[1-(4-chlorophenyl)ethyl] 3-o-(2-methoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C=2C=CC(Cl)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 DFCMHZMOHTZEBA-UHFFFAOYSA-N 0.000 claims 2
- XBIMVOAFFBILAE-UHFFFAOYSA-N 5-o-benzyl 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1[N+]([O-])=O XBIMVOAFFBILAE-UHFFFAOYSA-N 0.000 claims 2
- LEAXDOAMTDBJAR-UHFFFAOYSA-N 5-o-propan-2-yl 3-o-[[4-(trifluoromethyl)phenyl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(=CC=2)C(F)(F)F)C1C1=CC=CC([N+]([O-])=O)=C1 LEAXDOAMTDBJAR-UHFFFAOYSA-N 0.000 claims 2
- XEXXORROSNTCDJ-UHFFFAOYSA-N 1-(4-chlorophenyl)ethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC(C)C1=CC=C(Cl)C=C1 XEXXORROSNTCDJ-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 7
- 239000002220 antihypertensive agent Substances 0.000 abstract description 3
- 239000000812 cholinergic antagonist Substances 0.000 abstract description 3
- 230000002048 spasmolytic effect Effects 0.000 abstract description 2
- 238000011065 in-situ storage Methods 0.000 abstract 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 239000003218 coronary vasodilator agent Substances 0.000 abstract 1
- 230000000875 corresponding effect Effects 0.000 abstract 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 486
- 238000010438 heat treatment Methods 0.000 description 243
- 239000000243 solution Substances 0.000 description 240
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- 238000002844 melting Methods 0.000 description 44
- 230000008018 melting Effects 0.000 description 43
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 36
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 33
- 125000004494 ethyl ester group Chemical group 0.000 description 33
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 29
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 27
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 17
- 229960004592 isopropanol Drugs 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 14
- 229940095076 benzaldehyde Drugs 0.000 description 13
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical compound OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 9
- XJRIDJAGAYGJCK-UHFFFAOYSA-N (1-acetyl-5-bromoindol-3-yl) acetate Chemical compound C1=C(Br)C=C2C(OC(=O)C)=CN(C(C)=O)C2=C1 XJRIDJAGAYGJCK-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 7
- 125000005843 halogen group Chemical group 0.000 description 7
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 6
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 6
- MDHYEMXUFSJLGV-UHFFFAOYSA-N phenethyl acetate Chemical compound CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 5
- BSIUTVXEBSLZFS-UHFFFAOYSA-N (4-methylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C)C=C1 BSIUTVXEBSLZFS-UHFFFAOYSA-N 0.000 description 5
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 5
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 5
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 5
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 5
- XCVDXVFGPDLBLG-UHFFFAOYSA-N (3,4-dichlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Cl)C(Cl)=C1 XCVDXVFGPDLBLG-UHFFFAOYSA-N 0.000 description 4
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 4
- OWKVONYXJNKQRG-UHFFFAOYSA-N 2-phenoxyethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCOC1=CC=CC=C1 OWKVONYXJNKQRG-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 241001072332 Monia Species 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- MCVVUJPXSBQTRZ-ONEGZZNKSA-N methyl (e)-but-2-enoate Chemical compound COC(=O)\C=C\C MCVVUJPXSBQTRZ-ONEGZZNKSA-N 0.000 description 4
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 4
- AAEIYCKYVQEKRI-UHFFFAOYSA-N (4-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Cl)C=C1 AAEIYCKYVQEKRI-UHFFFAOYSA-N 0.000 description 3
- KQPGVCMZXFBYMM-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-oxobutanoate Chemical group CC(=O)CC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 KQPGVCMZXFBYMM-UHFFFAOYSA-N 0.000 description 3
- PAWSVPVNIXFKOS-IHWYPQMZSA-N (Z)-2-aminobutenoic acid Chemical compound C\C=C(/N)C(O)=O PAWSVPVNIXFKOS-IHWYPQMZSA-N 0.000 description 3
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 3
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 3
- VNMMLNVSLPRZDK-UHFFFAOYSA-N 3-oxo-5-phenylpent-4-enoic acid Chemical compound OC(=O)CC(=O)C=CC1=CC=CC=C1 VNMMLNVSLPRZDK-UHFFFAOYSA-N 0.000 description 3
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000008279 sol Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- WTZXTWAKAQXSJH-UHFFFAOYSA-N (2-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1Cl WTZXTWAKAQXSJH-UHFFFAOYSA-N 0.000 description 2
- KDHRQKPVXJRBIX-UHFFFAOYSA-N (4-methoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=C(COC(=O)CC(C)=O)C=C1 KDHRQKPVXJRBIX-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- ZYXNLVMBIHVDRH-UHFFFAOYSA-N 2-Methylpropyl 3-oxobutanoate Chemical compound CC(C)COC(=O)CC(C)=O ZYXNLVMBIHVDRH-UHFFFAOYSA-N 0.000 description 2
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- QOMFXOOKFCCSND-UHFFFAOYSA-N 2-phenylethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCC1=CC=CC=C1 QOMFXOOKFCCSND-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- OSLAYKKXCYSJSF-UHFFFAOYSA-N 4-aminopent-3-en-2-one Chemical compound CC(N)=CC(C)=O OSLAYKKXCYSJSF-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- PYAYHRBYGXEUCT-UHFFFAOYSA-N 4-nitro-3-oxo-5-phenylpent-4-enoic acid Chemical compound OC(=O)CC(=O)C([N+]([O-])=O)=CC1=CC=CC=C1 PYAYHRBYGXEUCT-UHFFFAOYSA-N 0.000 description 2
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 2
- OOKUSDZYOMYKEJ-UHFFFAOYSA-N 6-phenylhex-5-ene-2,4-dione Chemical compound CC(=O)CC(=O)C=CC1=CC=CC=C1 OOKUSDZYOMYKEJ-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 241000282320 Panthera leo Species 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- NCPTYZLUYHXITE-QHHAFSJGSA-N benzyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OCC1=CC=CC=C1 NCPTYZLUYHXITE-QHHAFSJGSA-N 0.000 description 2
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 2
- WTWBUQJHJGUZCY-UHFFFAOYSA-N cuminaldehyde Chemical compound CC(C)C1=CC=C(C=O)C=C1 WTWBUQJHJGUZCY-UHFFFAOYSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- UGZNCYLVFNJCGV-UHFFFAOYSA-N cyclopentyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCC1 UGZNCYLVFNJCGV-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000001077 hypotensive effect Effects 0.000 description 2
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 230000001256 tonic effect Effects 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- IXTVRWMFPAPNFB-UHFFFAOYSA-N (3,4,5-trimethoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC(COC(=O)CC(C)=O)=CC(OC)=C1OC IXTVRWMFPAPNFB-UHFFFAOYSA-N 0.000 description 1
- YXTKKIWFXLGENS-UHFFFAOYSA-N (3-chloro-4-methylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C)C(Cl)=C1 YXTKKIWFXLGENS-UHFFFAOYSA-N 0.000 description 1
- YSGBDRCLWLVPNL-UHFFFAOYSA-N (3-methoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=CC(COC(=O)CC(C)=O)=C1 YSGBDRCLWLVPNL-UHFFFAOYSA-N 0.000 description 1
- UHXAJKAFTOQDFI-UHFFFAOYSA-N (4-aminophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(N)C=C1 UHXAJKAFTOQDFI-UHFFFAOYSA-N 0.000 description 1
- VRPCQUFOHMYIGR-UHFFFAOYSA-N (4-bromo-3-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Br)C(Cl)=C1 VRPCQUFOHMYIGR-UHFFFAOYSA-N 0.000 description 1
- JGQTVYFZNZWAFX-UHFFFAOYSA-N (4-carbamoylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C(N)=O)C=C1 JGQTVYFZNZWAFX-UHFFFAOYSA-N 0.000 description 1
- MAGQINDMZBNWLG-UHFFFAOYSA-N (4-chlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(Cl)C=C1 MAGQINDMZBNWLG-UHFFFAOYSA-N 0.000 description 1
- OOCADVIIRMYREE-UHFFFAOYSA-N (4-cyanophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C#N)C=C1 OOCADVIIRMYREE-UHFFFAOYSA-N 0.000 description 1
- JWPKOCDHGKWCAK-UHFFFAOYSA-N (4-fluorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(F)C=C1 JWPKOCDHGKWCAK-UHFFFAOYSA-N 0.000 description 1
- GXHHLAFHJDPBDD-UHFFFAOYSA-N (4-hydroxyphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(O)C=C1 GXHHLAFHJDPBDD-UHFFFAOYSA-N 0.000 description 1
- LAQIXNDRSOLATB-ONEGZZNKSA-N (4-methoxyphenyl)methyl (e)-but-2-enoate Chemical compound COC1=CC=C(COC(=O)\C=C\C)C=C1 LAQIXNDRSOLATB-ONEGZZNKSA-N 0.000 description 1
- HRBFOJZKFCYFDR-ONEGZZNKSA-N (4-methylphenyl)methyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OCC1=CC=C(C)C=C1 HRBFOJZKFCYFDR-ONEGZZNKSA-N 0.000 description 1
- KRSRWTKKEBSRGE-UHFFFAOYSA-N (4-methylsulfanylphenyl)methyl 3-oxobutanoate Chemical compound CSC1=CC=C(COC(=O)CC(C)=O)C=C1 KRSRWTKKEBSRGE-UHFFFAOYSA-N 0.000 description 1
- WJURQDOIIDZPRS-UHFFFAOYSA-N (4-methylsulfinylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(S(C)=O)C=C1 WJURQDOIIDZPRS-UHFFFAOYSA-N 0.000 description 1
- MUGIXZYKJBYPKZ-UHFFFAOYSA-N (4-propan-2-ylphenyl)methyl 3-oxobutanoate Chemical compound CC(C)C1=CC=C(COC(=O)CC(C)=O)C=C1 MUGIXZYKJBYPKZ-UHFFFAOYSA-N 0.000 description 1
- JQJQKHLGKIOAEB-UHFFFAOYSA-N (4-sulfamoylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(S(N)(=O)=O)C=C1 JQJQKHLGKIOAEB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- GISVICWQYMUPJF-UHFFFAOYSA-N 2,4-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(C)=C1 GISVICWQYMUPJF-UHFFFAOYSA-N 0.000 description 1
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 1
- SSKNCEBGIYDNQC-UHFFFAOYSA-N 2,6-dimethyl-4-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridine Chemical compound CC=1NC(=CC(C1)C1=CC(=CC=C1)C(F)(F)F)C SSKNCEBGIYDNQC-UHFFFAOYSA-N 0.000 description 1
- WHFZQNNDIJKLIO-UHFFFAOYSA-N 2,6-dinitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1C=O WHFZQNNDIJKLIO-UHFFFAOYSA-N 0.000 description 1
- DGPBVJWCIDNDPN-UHFFFAOYSA-N 2-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=CC=C1C=O DGPBVJWCIDNDPN-UHFFFAOYSA-N 0.000 description 1
- LWFQGLZKTGSAQC-UHFFFAOYSA-N 2-(dimethylamino)ethyl 3-oxobutanoate Chemical compound CN(C)CCOC(=O)CC(C)=O LWFQGLZKTGSAQC-UHFFFAOYSA-N 0.000 description 1
- CPHXLFKIUVVIOQ-UHFFFAOYSA-N 2-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC=C1C=O CPHXLFKIUVVIOQ-UHFFFAOYSA-N 0.000 description 1
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 1
- IIBAAYFFTSJSFH-UHFFFAOYSA-N 2-butylbenzaldehyde Chemical compound CCCCC1=CC=CC=C1C=O IIBAAYFFTSJSFH-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- ZVDXHSUCDWVQEY-UHFFFAOYSA-N 2-cyclopropylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C1CC1 ZVDXHSUCDWVQEY-UHFFFAOYSA-N 0.000 description 1
- DHEJIZSVHGOKMJ-UHFFFAOYSA-N 2-ethenylbenzaldehyde Chemical compound C=CC1=CC=CC=C1C=O DHEJIZSVHGOKMJ-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- LLVLGFMFODDBTA-ONEGZZNKSA-N 2-methoxyethyl (e)-but-2-enoate Chemical compound COCCOC(=O)\C=C\C LLVLGFMFODDBTA-ONEGZZNKSA-N 0.000 description 1
- PJKVFARRVXDXAD-UHFFFAOYSA-N 2-naphthaldehyde Chemical compound C1=CC=CC2=CC(C=O)=CC=C21 PJKVFARRVXDXAD-UHFFFAOYSA-N 0.000 description 1
- DTALCVXXATYTQJ-UHFFFAOYSA-N 2-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC=C1C=O DTALCVXXATYTQJ-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- FICAQKBMCKEFDI-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazole Chemical compound CC=1C=C(C)ON=1 FICAQKBMCKEFDI-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- WUJQTKBVPNTQLU-UHFFFAOYSA-N 3-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=CC(C=O)=C1 WUJQTKBVPNTQLU-UHFFFAOYSA-N 0.000 description 1
- FQEVHRCPXFKJHF-UHFFFAOYSA-N 3-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC(C=O)=C1 FQEVHRCPXFKJHF-UHFFFAOYSA-N 0.000 description 1
- UCJDGRYGBYCWMS-UHFFFAOYSA-N 3-azidobenzaldehyde Chemical compound [N-]=[N+]=NC1=CC=CC(C=O)=C1 UCJDGRYGBYCWMS-UHFFFAOYSA-N 0.000 description 1
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 1
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 1
- QOOSQNQQQLHMEX-UHFFFAOYSA-N 3-o-[(4-methylphenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(C)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 QOOSQNQQQLHMEX-UHFFFAOYSA-N 0.000 description 1
- FBHYWYVNVKCGGG-UHFFFAOYSA-N 3-o-methyl 5-o-[(4-methylphenyl)methyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(C)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O FBHYWYVNVKCGGG-UHFFFAOYSA-N 0.000 description 1
- FFQXEFNKZVGJDI-UHFFFAOYSA-N 3-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC(C=O)=C1 FFQXEFNKZVGJDI-UHFFFAOYSA-N 0.000 description 1
- KWXVVLHKADHVRM-UHFFFAOYSA-N 3-sulfanylbenzaldehyde Chemical compound SC1=CC=CC(C=O)=C1 KWXVVLHKADHVRM-UHFFFAOYSA-N 0.000 description 1
- AGWQUSGRLMFZAM-UHFFFAOYSA-N 4-(2-nitrophenyl)-2-(oxomethylidene)-3,4-dihydro-1h-pyridine-5-carboxylic acid Chemical compound OC(=O)C1=CNC(=C=O)CC1C1=CC=CC=C1[N+]([O-])=O AGWQUSGRLMFZAM-UHFFFAOYSA-N 0.000 description 1
- DFJZCOWXAPXGAK-UHFFFAOYSA-N 4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CNC=CC1C1=CC=CC([N+]([O-])=O)=C1 DFJZCOWXAPXGAK-UHFFFAOYSA-N 0.000 description 1
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 1
- FNMKFVXIVPDFBL-UHFFFAOYSA-N 4-(methylamino)pent-3-en-2-one Chemical compound CNC(C)=CC(C)=O FNMKFVXIVPDFBL-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- ARIREUPIXAKDAY-UHFFFAOYSA-N 4-butylbenzaldehyde Chemical compound CCCCC1=CC=C(C=O)C=C1 ARIREUPIXAKDAY-UHFFFAOYSA-N 0.000 description 1
- MZPNQUMLOFWSEK-UHFFFAOYSA-N 4-chloro-2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1C=O MZPNQUMLOFWSEK-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- CZUQVKFJAJAHGK-UHFFFAOYSA-N 4-cyclopropylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1CC1 CZUQVKFJAJAHGK-UHFFFAOYSA-N 0.000 description 1
- GVWRWNKPXVHRPJ-UHFFFAOYSA-N 4-formyl-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1C=O GVWRWNKPXVHRPJ-UHFFFAOYSA-N 0.000 description 1
- QWDCXCRLPNMJIH-UHFFFAOYSA-N 4-formylbenzamide Chemical compound NC(=O)C1=CC=C(C=O)C=C1 QWDCXCRLPNMJIH-UHFFFAOYSA-N 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- QRVYABWJVXXOTN-UHFFFAOYSA-N 4-methylsulfanylbenzaldehyde Chemical compound CSC1=CC=C(C=O)C=C1 QRVYABWJVXXOTN-UHFFFAOYSA-N 0.000 description 1
- PSVPUHBSBYJSMQ-UHFFFAOYSA-N 4-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=C(C=O)C=C1 PSVPUHBSBYJSMQ-UHFFFAOYSA-N 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- AHISYUZBWDSPQL-UHFFFAOYSA-N 6-methylpyridine-2-carbaldehyde Chemical compound CC1=CC=CC(C=O)=N1 AHISYUZBWDSPQL-UHFFFAOYSA-N 0.000 description 1
- RHXHGRAEPCAFML-UHFFFAOYSA-N 7-cyclopentyl-n,n-dimethyl-2-[(5-piperazin-1-ylpyridin-2-yl)amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide Chemical compound N1=C2N(C3CCCC3)C(C(=O)N(C)C)=CC2=CN=C1NC(N=C1)=CC=C1N1CCNCC1 RHXHGRAEPCAFML-UHFFFAOYSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 241000003910 Baronia <angiosperm> Species 0.000 description 1
- HBYUJKSZAARWGO-SNAWJCMRSA-N CC=1C=C(COC(\C=C\C)=O)C=CC=1C Chemical compound CC=1C=C(COC(\C=C\C)=O)C=CC=1C HBYUJKSZAARWGO-SNAWJCMRSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 244000168525 Croton tiglium Species 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 241000490229 Eucephalus Species 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000270878 Hyla Species 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 229920000715 Mucilage Polymers 0.000 description 1
- 101100388057 Mus musculus Poln gene Proteins 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 208000036366 Sensation of pressure Diseases 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- WXMPHCXJKNKNBX-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methyl acetate Chemical compound CC(=O)OCC1=CC=CC(C(F)(F)F)=C1 WXMPHCXJKNKNBX-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- FWZUNOYOVVKUNF-UHFFFAOYSA-N allyl acetate Chemical compound CC(=O)OCC=C FWZUNOYOVVKUNF-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- DELPEVZSDFCVSF-SGAXSIHGSA-N benzyl (Z)-2-aminobut-2-enoate Chemical compound C\C=C(/N)C(=O)OCC1=CC=CC=C1 DELPEVZSDFCVSF-SGAXSIHGSA-N 0.000 description 1
- PUDIIPUVMIJJNZ-UHFFFAOYSA-N benzyl 1,4-dihydropyridine-3-carboxylate Chemical compound C=1NC=CCC=1C(=O)OCC1=CC=CC=C1 PUDIIPUVMIJJNZ-UHFFFAOYSA-N 0.000 description 1
- FHCKAWWVFLGIBR-UHFFFAOYSA-N benzyl 3-oxo-5-phenylpent-4-enoate Chemical compound C=1C=CC=CC=1COC(=O)CC(=O)C=CC1=CC=CC=C1 FHCKAWWVFLGIBR-UHFFFAOYSA-N 0.000 description 1
- ZRIZDTNKLLTMDO-UHFFFAOYSA-N benzyl 3-oxopentanoate Chemical compound CCC(=O)CC(=O)OCC1=CC=CC=C1 ZRIZDTNKLLTMDO-UHFFFAOYSA-N 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 206010061592 cardiac fibrillation Diseases 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- GJOSRMAVDXJBCZ-UHFFFAOYSA-N cyclohexyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCCC1 GJOSRMAVDXJBCZ-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- XCLDSQRVMMXWMS-UHFFFAOYSA-N ethyl 4-methyl-3-oxopentanoate Chemical compound CCOC(=O)CC(=O)C(C)C XCLDSQRVMMXWMS-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940028332 halog Drugs 0.000 description 1
- DGCTVLNZTFDPDJ-UHFFFAOYSA-N heptane-3,5-dione Chemical compound CCC(=O)CC(=O)CC DGCTVLNZTFDPDJ-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropyl acetate Chemical compound CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- HORFVOWTVOJVAN-UHFFFAOYSA-N isoquinoline-1-carbaldehyde Chemical compound C1=CC=C2C(C=O)=NC=CC2=C1 HORFVOWTVOJVAN-UHFFFAOYSA-N 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VCDOXKMVZZSCQK-ARJAWSKDSA-N methyl (z)-2-aminobut-2-enoate Chemical compound COC(=O)C(\N)=C\C VCDOXKMVZZSCQK-ARJAWSKDSA-N 0.000 description 1
- FCRJJPWNWLNCPA-UHFFFAOYSA-N methyl 3-oxo-5-phenylpent-4-enoate Chemical compound COC(=O)CC(=O)C=CC1=CC=CC=C1 FCRJJPWNWLNCPA-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005186 naphthyloxy group Chemical group C1(=CC=CC2=CC=CC=C12)O* 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- CSXNKDHJFCFQOY-UHFFFAOYSA-N nonane-2,6-dione Chemical compound CCCC(=O)CCCC(C)=O CSXNKDHJFCFQOY-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- ONTHIOPVTJEYLT-UHFFFAOYSA-N prop-2-ynyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC#C ONTHIOPVTJEYLT-UHFFFAOYSA-N 0.000 description 1
- UAMWVGXRMMDVCS-UHFFFAOYSA-N propan-2-yl 3-oxo-5-phenylpent-4-enoate Chemical compound C(C)(C)OC(CC(=O)C=CC1=CC=CC=C1)=O UAMWVGXRMMDVCS-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- ZSKGQVFRTSEPJT-UHFFFAOYSA-N pyrrole-2-carboxaldehyde Chemical compound O=CC1=CC=CN1 ZSKGQVFRTSEPJT-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 238000009491 slugging Methods 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752508181 DE2508181A1 (de) | 1975-02-26 | 1975-02-26 | 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1069902A true CA1069902A (en) | 1980-01-15 |
Family
ID=5939797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA245,000A Expired CA1069902A (en) | 1975-02-26 | 1976-02-04 | 1,4-dihydropyridines |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4044141A (enFirst) |
| JP (1) | JPS6025424B2 (enFirst) |
| AT (1) | AT351024B (enFirst) |
| BE (1) | BE838924A (enFirst) |
| CA (1) | CA1069902A (enFirst) |
| CH (1) | CH622506A5 (enFirst) |
| CS (1) | CS188994B2 (enFirst) |
| DD (1) | DD125483A5 (enFirst) |
| DE (1) | DE2508181A1 (enFirst) |
| DK (1) | DK78876A (enFirst) |
| ES (1) | ES445508A1 (enFirst) |
| FI (1) | FI61483C (enFirst) |
| FR (1) | FR2302093A1 (enFirst) |
| GB (1) | GB1477114A (enFirst) |
| HU (1) | HU171717B (enFirst) |
| IE (1) | IE42643B1 (enFirst) |
| IL (1) | IL49095A (enFirst) |
| IN (1) | IN142197B (enFirst) |
| LU (1) | LU74424A1 (enFirst) |
| NL (1) | NL7601823A (enFirst) |
| NO (1) | NO146393C (enFirst) |
| PL (1) | PL100906B1 (enFirst) |
| PT (1) | PT64840B (enFirst) |
| RO (1) | RO68479A (enFirst) |
| SE (1) | SE7602317L (enFirst) |
| SU (1) | SU574150A3 (enFirst) |
| ZA (1) | ZA761118B (enFirst) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2747513A1 (de) * | 1977-10-22 | 1979-05-03 | Bayer Ag | Dihydropyridine mit schwefelhaltigen estergruppierungen |
| DE2837477A1 (de) * | 1978-08-28 | 1980-03-13 | Bayer Ag | Sila-substituierte 1,4-dihydropyridin- derivate |
| DE2841667A1 (de) * | 1978-09-25 | 1980-04-10 | Bayer Ag | Fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2847236A1 (de) * | 1978-10-31 | 1980-05-14 | Bayer Ag | Neue dihydropyridine mit substituierten estergruppierungen, mehrer verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2935451A1 (de) * | 1979-09-01 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Optisch aktive 1,4-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung als arneimittel |
| BE886259A (fr) * | 1979-11-23 | 1981-05-20 | Sandoz Sa | Nouveaux medicament a base de derives de la 1,4-dihydropyridine, pour le traitement de l'insuffisance cerebrovasculaire ou a action spamolytique |
| DE3018259A1 (de) * | 1980-05-13 | 1981-11-19 | Bayer Ag, 5090 Leverkusen | 1,4-dihydropyridine mit unterschiedlichen substituenten in 2- und 6-position, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
| JPS57171968A (en) * | 1981-04-17 | 1982-10-22 | Kyowa Hakko Kogyo Co Ltd | 1,4-dihydropyridine derivative |
| JPS57200364A (en) * | 1981-06-04 | 1982-12-08 | Yoshitomi Pharmaceut Ind Ltd | 1,4-dihydropyridine-3,5-dicarboxylic ester derivative and its salt |
| CH655110A5 (de) * | 1982-09-03 | 1986-03-27 | Otsuka Pharma Co Ltd | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. |
| US4656181A (en) * | 1982-11-24 | 1987-04-07 | Cermol S.A. | Esters of 1,4-dihydropyridines, processes for the preparation of the new esters, and medicaments containing the same |
| JPS60120861A (ja) * | 1983-12-02 | 1985-06-28 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体 |
| US5137889A (en) * | 1983-12-02 | 1992-08-11 | Otsuka Pharmaceutical Co., Ltd. | Dihydropyridine derivatives and process for preparing the same |
| DE4342196A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Neue 4-Phenyl-substituierte 1,4-Dihydropyridine |
| JPS60248693A (ja) * | 1984-04-19 | 1985-12-09 | Nippon Shinyaku Co Ltd | ピリジン誘導体及び製法 |
| US4672068A (en) * | 1984-05-04 | 1987-06-09 | Fujirebio Kabushiki Kaisha | Antihypertensive 1,4-dihydropyridines having a conjugated ester |
| DE3424342A1 (de) * | 1984-07-03 | 1986-01-09 | Bayer Ag, 5090 Leverkusen | 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-pyridin-3,5-dicarbonsaeure-isopropyl-(2-(3-trifluormethylphenoxy)-ethyl)-ester, mehrere verfahren zu seiner herstellung sowie seine verwendung in arzneimitteln |
| JPS6143165A (ja) * | 1984-08-07 | 1986-03-01 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体の製造法 |
| US4994476A (en) * | 1984-10-31 | 1991-02-19 | Bristol-Myers Company | Dihydropyridin-3,5-dicarboxylates incorporating aryloxypropanolamine moieties |
| US4757071A (en) * | 1984-12-14 | 1988-07-12 | Nisshin Flour Milling Co., Ltd. | 1,4-dihydropyridine derivatives, and pharmaceutical compositions containing same, useful for treating cardiovascular diseases |
| IL77843A (en) * | 1985-02-11 | 1989-07-31 | Syntex Inc | Dihydropyridine derivatives,process and novel intermediates for their preparation and pharmaceutical compositions containing them |
| US4595690A (en) * | 1985-02-11 | 1986-06-17 | Syntex (U.S.A.) Inc. | Antihypertensive dihydropyridine derivatives |
| US4593033A (en) * | 1985-04-24 | 1986-06-03 | Merck & Co., Inc. | Substituted indeno[2,1-c] pyridines useful as calcium channel blockers |
| US4605660A (en) * | 1985-06-03 | 1986-08-12 | Merck & Co., Inc. | Indeno[2,1-c]pyridine compounds, and their use as calcium channel blockers |
| US4670443A (en) * | 1985-07-02 | 1987-06-02 | Merck & Co., Inc. | Benzo(f)isoquinoline compounds useful as calcium entry blockers |
| US4721708A (en) * | 1985-11-26 | 1988-01-26 | Merck & Co., Inc. | Cyclized N-substituted-tetrahydropyridine compounds and cardiovascular use |
| US4788203A (en) * | 1985-11-26 | 1988-11-29 | Merck & Co., Inc. | Cyclized N-substituted-tetrahydropyridine compounds, useful in the treatment of cardiovascular disorders |
| DE3601196A1 (de) * | 1986-01-17 | 1987-07-23 | Merck Patent Gmbh | 1,4-dihydropyridine |
| DK114587A (da) * | 1986-03-12 | 1987-09-13 | Byk Gulden Lomberg Chem Fab | Monocycliske esterderivater |
| US4761420A (en) * | 1986-06-13 | 1988-08-02 | Laboratoires Syntex S.A. | Antihypertensive dihydropyridine derivatives |
| JPH0688973B2 (ja) * | 1987-03-12 | 1994-11-09 | 京都薬品工業株式会社 | 1,4−ジヒドロピリジン誘導体 |
| ZA889252B (en) * | 1987-12-11 | 1990-08-29 | Syntex Lab | Neuroprotective compounds |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
| KR940003492B1 (ko) * | 1988-10-27 | 1994-04-23 | 주식회사 유한양행 | 1,4-디하이드로피리딘유도체 및 그의 제조방법 |
| JPH01151557A (ja) * | 1988-11-15 | 1989-06-14 | Otsuka Pharmaceut Co Ltd | 降圧剤 |
| DE4125271A1 (de) * | 1991-07-31 | 1993-02-11 | Bayer Ag | Neue n-alkylierte 1,4-dihydropyridindicarbonsaeureester |
| GB9119983D0 (en) * | 1991-09-19 | 1991-11-06 | Erba Carlo Spa | Dihydropyridine derivatives useful in antitumor therapy |
| DE4342193A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Arylsubstituierte Alkoxycarbonyl-1,4-dihydropyridin-5-carbonsäureester |
| EE03192B1 (et) * | 1993-12-10 | 1999-06-15 | Bayer Aktiengesellschaft | Isopropüül-(2-metoksüetüül)-4-(2-kloro-3-tsüanofenüül)-1,4-dihüdro-2,6-dimetüülpüri diin-3,5-dikarboksülaat, selle enantiomeerid ja vaheühend, meetodid nimetatud ühendite valmistamiseks ja kasutamine |
| SE9600086D0 (sv) * | 1996-01-10 | 1996-01-10 | Astra Ab | New manufacturing process |
| CN106380405B (zh) * | 2016-08-24 | 2019-01-29 | 郑州瑞康制药有限公司 | 一种2-(3-硝基亚苄基)乙酰乙酸异丙酯的合成方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL77955C (enFirst) * | 1948-11-17 | |||
| DE1670824C3 (de) * | 1967-03-20 | 1978-08-03 | Bayer Ag, 5090 Leverkusen | 1,4-Dihydropyridin-33-dicarbonsäurealkylester |
| DE1670827C3 (de) * | 1967-03-20 | 1974-10-24 | Bayer Ag, 5090 Leverkusen | 4-(2'-Nitrophenyl)-2,6-dimethyl-3,5-dicarbmethoxy-1,4-dihydropyridin |
| DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2218644C3 (de) * | 1972-04-18 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | Basische Ester von 1,4-Dihydropyridinen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| JPS5649909B2 (enFirst) | 1973-05-02 | 1981-11-25 |
-
1975
- 1975-02-26 DE DE19752508181 patent/DE2508181A1/de active Granted
- 1975-10-24 GB GB4376375A patent/GB1477114A/en not_active Expired
-
1976
- 1976-01-29 IN IN163/CAL/76A patent/IN142197B/en unknown
- 1976-02-02 US US05/654,278 patent/US4044141A/en not_active Expired - Lifetime
- 1976-02-04 CA CA245,000A patent/CA1069902A/en not_active Expired
- 1976-02-13 NO NO76760470A patent/NO146393C/no unknown
- 1976-02-20 CH CH214876A patent/CH622506A5/de not_active IP Right Cessation
- 1976-02-20 JP JP51017182A patent/JPS6025424B2/ja not_active Expired
- 1976-02-20 SU SU7602324514A patent/SU574150A3/ru active
- 1976-02-23 CS CS761175A patent/CS188994B2/cs unknown
- 1976-02-23 NL NL7601823A patent/NL7601823A/xx not_active Application Discontinuation
- 1976-02-24 PT PT64840A patent/PT64840B/pt unknown
- 1976-02-24 AT AT132976A patent/AT351024B/de not_active IP Right Cessation
- 1976-02-24 FI FI760475A patent/FI61483C/fi not_active IP Right Cessation
- 1976-02-24 LU LU74424A patent/LU74424A1/xx unknown
- 1976-02-24 IL IL7649095A patent/IL49095A/xx unknown
- 1976-02-24 DD DD191458A patent/DD125483A5/xx unknown
- 1976-02-25 IE IE369/76A patent/IE42643B1/en unknown
- 1976-02-25 DK DK78876*#A patent/DK78876A/da unknown
- 1976-02-25 ES ES445508A patent/ES445508A1/es not_active Expired
- 1976-02-25 RO RO7684916A patent/RO68479A/ro unknown
- 1976-02-25 ZA ZA761118A patent/ZA761118B/xx unknown
- 1976-02-25 PL PL1976187499A patent/PL100906B1/pl unknown
- 1976-02-25 BE BE164628A patent/BE838924A/xx unknown
- 1976-02-25 SE SE7602317A patent/SE7602317L/xx unknown
- 1976-02-25 HU HU76BA00003374A patent/HU171717B/hu not_active IP Right Cessation
- 1976-02-26 FR FR7605383A patent/FR2302093A1/fr active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1069902A (en) | 1,4-dihydropyridines | |
| CA1212672A (en) | Dihydropyridines with a positive inotropic action, new compounds, their use in medicaments, and processes for their preparation | |
| US4248873A (en) | Nitro-substituted 1,4-dihydropyridines, processes for _their production and their medicinal use | |
| EP0089167B1 (en) | Dihydropyridine anti-ischaemic and antihypertensive agents, processes for their production, and pharmaceutical compositions containing them | |
| US4705797A (en) | N-(3,3-diphenylpropyl) aminoethyl esters of 1,4-dihydro-2,6-dimethyl-pyridine-3,5-dicarboxylic acid, compositions and use | |
| US4551467A (en) | Vasodilating cyanoalkyl esters of 1,4-dihydropyridines | |
| US4510310A (en) | 1,4-Dihydro-2,6-dimethyl-4-(2'-chlorophenyl)-3,5-dicarboxylic acid,methyl or ethyl,trifluoroethyl ester | |
| CA2178414A1 (en) | Dihydropyridine npy antagonists: nitrogen heterocyclic derivatives | |
| US3905983A (en) | 3,5,6-Tricarboxy- and 2,3,5,6-tetracarboxy-1,4-dihydropyridine derivatives | |
| CA1306261C (fr) | 1,4-dihydropyridines, leur procede de preparation et leur application comme medicaments | |
| CA1108615A (en) | Dihydropyridine compounds, their production and their medicinal use | |
| CH642353A5 (de) | 2-methyl-dihydropyridin-verbindung, verfahren zu ihrer herstellung und sie enthaltendes pharmazeutisches mittel. | |
| CA1185182A (en) | Pharmaceutical compositions containing diethyl-2- methyl-6-propyl-4-(3-nitrophenyl)-1,4- dihydropyridine-3,5-dicarboxylate | |
| CA1179342A (en) | 1,4-dihydropyridine compounds linked in the c-3 position, their production and their medicinal use | |
| PL94266B1 (enFirst) | ||
| CA1276636C (en) | Pyridopyrimidines, several processes for their preparation and their use as medicaments | |
| SK47894A3 (en) | 2-amino-4-chinolyl-dihydropyridines, method of their production treatments containing thereof, method of their production, and using of these compounds | |
| US4360520A (en) | 1,4-Dihydropyridazine compounds, and their medicinal use | |
| KR800000850B1 (ko) | 1,4-디하이드로 피리딘 카복실산 아르알킬 에스테르의 제조방법 | |
| IL46593A (en) | 2-amino-6-dialkylamino-dihydropyridines their production and pharmaceutical compositions containing them | |
| CA1296731C (en) | 5-phenyl-1,4-dihydropyridines, process for their preparation and their use in medicaments | |
| JPS6317068B2 (enFirst) | ||
| US4348395A (en) | 1,4-Dihydropyridazine compounds | |
| US4252956A (en) | Derivatives of 1,4-dihydropyridine-3-carbothiol acids | |
| CA1322753C (en) | 2-(aminoalkylthio)methyl-1,4-dihydropyridine, a method for the preparation thereof and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |