CA1065103A - Binder compositions - Google Patents
Binder compositionsInfo
- Publication number
- CA1065103A CA1065103A CA261,203A CA261203A CA1065103A CA 1065103 A CA1065103 A CA 1065103A CA 261203 A CA261203 A CA 261203A CA 1065103 A CA1065103 A CA 1065103A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- starch hydrolysate
- alkali metal
- binder composition
- metal silicate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011230 binding agent Substances 0.000 title claims abstract description 28
- 239000000203 mixture Substances 0.000 title claims description 45
- 229920002472 Starch Polymers 0.000 claims abstract description 34
- 235000019698 starch Nutrition 0.000 claims abstract description 34
- 239000008107 starch Substances 0.000 claims abstract description 33
- 239000000413 hydrolysate Substances 0.000 claims abstract description 31
- 239000004576 sand Substances 0.000 claims abstract description 16
- 229920002245 Dextrose equivalent Polymers 0.000 claims abstract description 12
- 239000000243 solution Substances 0.000 claims description 19
- 239000004115 Sodium Silicate Substances 0.000 claims description 17
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 16
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 16
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 14
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 12
- 239000007787 solid Substances 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000006188 syrup Substances 0.000 claims description 9
- 235000020357 syrup Nutrition 0.000 claims description 9
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 6
- 239000001569 carbon dioxide Substances 0.000 claims description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 239000011236 particulate material Substances 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000000306 component Substances 0.000 claims 2
- 238000010348 incorporation Methods 0.000 claims 1
- 150000005846 sugar alcohols Polymers 0.000 claims 1
- 230000015556 catabolic process Effects 0.000 abstract description 7
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical group [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 abstract description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- 239000000377 silicon dioxide Substances 0.000 description 6
- 229930006000 Sucrose Natural products 0.000 description 5
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 5
- 229910052914 metal silicate Inorganic materials 0.000 description 5
- 239000005720 sucrose Substances 0.000 description 5
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 230000006835 compression Effects 0.000 description 4
- 238000007906 compression Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- 239000008121 dextrose Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- FBEHFRAORPEGFH-UHFFFAOYSA-N Allyxycarb Chemical compound CNC(=O)OC1=CC(C)=C(N(CC=C)CC=C)C(C)=C1 FBEHFRAORPEGFH-UHFFFAOYSA-N 0.000 description 2
- 229920001908 Hydrogenated starch hydrolysate Polymers 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- 150000008163 sugars Chemical class 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- MBYLVOKEDDQJDY-UHFFFAOYSA-N tris(2-aminoethyl)amine Chemical compound NCCN(CCN)CCN MBYLVOKEDDQJDY-UHFFFAOYSA-N 0.000 description 2
- 239000004348 Glyceryl diacetate Substances 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 235000018734 Sambucus australis Nutrition 0.000 description 1
- 244000180577 Sambucus australis Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 241000196247 Ulvales Species 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000002817 coal dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N ferric oxide Chemical compound O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000019443 glyceryl diacetate Nutrition 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- -1 sucrose Chemical class 0.000 description 1
- AMIGYDGSJCJWSD-UHFFFAOYSA-N thiocane Chemical compound C1CCCSCCC1 AMIGYDGSJCJWSD-UHFFFAOYSA-N 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22C—FOUNDRY MOULDING
- B22C1/00—Compositions of refractory mould or core materials; Grain structures thereof; Chemical or physical features in the formation or manufacture of moulds
- B22C1/16—Compositions of refractory mould or core materials; Grain structures thereof; Chemical or physical features in the formation or manufacture of moulds characterised by the use of binding agents; Mixtures of binding agents
- B22C1/18—Compositions of refractory mould or core materials; Grain structures thereof; Chemical or physical features in the formation or manufacture of moulds characterised by the use of binding agents; Mixtures of binding agents of inorganic agents
- B22C1/186—Compositions of refractory mould or core materials; Grain structures thereof; Chemical or physical features in the formation or manufacture of moulds characterised by the use of binding agents; Mixtures of binding agents of inorganic agents contaming ammonium or metal silicates, silica sols
- B22C1/188—Alkali metal silicates
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22C—FOUNDRY MOULDING
- B22C1/00—Compositions of refractory mould or core materials; Grain structures thereof; Chemical or physical features in the formation or manufacture of moulds
- B22C1/16—Compositions of refractory mould or core materials; Grain structures thereof; Chemical or physical features in the formation or manufacture of moulds characterised by the use of binding agents; Mixtures of binding agents
- B22C1/167—Mixtures of inorganic and organic binding agents
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Inorganic Chemistry (AREA)
- Mold Materials And Core Materials (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB37884/75A GB1546079A (en) | 1975-09-15 | 1975-09-15 | Alkali metal silicate binder compositions |
| GB3387376 | 1976-08-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1065103A true CA1065103A (en) | 1979-10-30 |
Family
ID=26262059
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA261,203A Expired CA1065103A (en) | 1975-09-15 | 1976-09-14 | Binder compositions |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4070196A (enExample) |
| AR (1) | AR211782A1 (enExample) |
| AT (1) | AT346508B (enExample) |
| AU (1) | AU502546B2 (enExample) |
| BR (1) | BR7606063A (enExample) |
| CA (1) | CA1065103A (enExample) |
| DE (2) | DE2660613C2 (enExample) |
| FR (1) | FR2323466A1 (enExample) |
| IN (1) | IN148044B (enExample) |
| IT (1) | IT1068750B (enExample) |
| MX (1) | MX143816A (enExample) |
| NL (1) | NL183028C (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1566417A (en) * | 1976-11-11 | 1980-04-30 | Foseco Int | Alkali metal silicate binder compositions |
| FR2445191A1 (fr) * | 1978-12-29 | 1980-07-25 | Roquette Freres | Moyens pour la fabrication des moules de fonderie |
| DE3060868D1 (en) * | 1979-02-27 | 1982-11-04 | Foseco Int | Alkali metal silicate binder compositions |
| WO1980001768A1 (en) * | 1979-02-27 | 1980-09-04 | Foseco Int | Alkali metal silicate binder compositions |
| DE2946500A1 (de) * | 1979-11-17 | 1981-05-27 | Henkel KGaA, 4000 Düsseldorf | Bindemittel auf basis von alkalimetallsilikatloesungen und deren verwendung |
| DE3104763C2 (de) * | 1981-02-11 | 1985-09-05 | Maizena Gmbh, 2000 Hamburg | Furanharzbindemittel für Gießereiform- und -kernsand |
| JPS58500055A (ja) * | 1981-02-20 | 1983-01-13 | ザ ホワイト シ− アンド バルテイツク カンパニ− リミテイド | シリケ−ト溶液,それらの製造及び粘結剤としての使用 |
| EP0111398B1 (en) * | 1982-12-11 | 1987-01-21 | Foseco International Limited | Alkali metal silicate binder compositions |
| DE3403583A1 (de) * | 1984-02-02 | 1985-08-08 | Seaders, John, Corvallis, Oreg. | Bindemittelgemisch zur verfestigung |
| US4640361A (en) * | 1985-12-13 | 1987-02-03 | Halliburton Company | Thermally responsive aqueous silicate mixtures and use thereof |
| US4836269A (en) * | 1986-07-14 | 1989-06-06 | Roberts Corporation | Forming apparatus having catalyst introduction simultaneous with sand injection |
| DE3908560A1 (de) * | 1989-03-16 | 1990-09-20 | Henkel Kgaa | Bindemittel auf basis waessriger alkalimetallsilikatloesungen und deren verwendung |
| US5089186A (en) * | 1990-07-11 | 1992-02-18 | Advanced Plastics Partnership | Process for core removal from molded products |
| US5658603A (en) * | 1992-08-11 | 1997-08-19 | E. Khashoggi Industries | Systems for molding articles having an inorganically filled organic polymer matrix |
| US5580624A (en) * | 1992-08-11 | 1996-12-03 | E. Khashoggi Industries | Food and beverage containers made from inorganic aggregates and polysaccharide, protein, or synthetic organic binders, and the methods of manufacturing such containers |
| US5800647A (en) * | 1992-08-11 | 1998-09-01 | E. Khashoggi Industries, Llc | Methods for manufacturing articles from sheets having a highly inorganically filled organic polymer matrix |
| US5660900A (en) * | 1992-08-11 | 1997-08-26 | E. Khashoggi Industries | Inorganically filled, starch-bound compositions for manufacturing containers and other articles having a thermodynamically controlled cellular matrix |
| US5679145A (en) * | 1992-08-11 | 1997-10-21 | E. Khashoggi Industries | Starch-based compositions having uniformly dispersed fibers used to manufacture high strength articles having a fiber-reinforced, starch-bound cellular matrix |
| US5830548A (en) * | 1992-08-11 | 1998-11-03 | E. Khashoggi Industries, Llc | Articles of manufacture and methods for manufacturing laminate structures including inorganically filled sheets |
| US5506046A (en) * | 1992-08-11 | 1996-04-09 | E. Khashoggi Industries | Articles of manufacture fashioned from sheets having a highly inorganically filled organic polymer matrix |
| US5683772A (en) * | 1992-08-11 | 1997-11-04 | E. Khashoggi Industries | Articles having a starch-bound cellular matrix reinforced with uniformly dispersed fibers |
| US5851634A (en) * | 1992-08-11 | 1998-12-22 | E. Khashoggi Industries | Hinges for highly inorganically filled composite materials |
| US5508072A (en) * | 1992-08-11 | 1996-04-16 | E. Khashoggi Industries | Sheets having a highly inorganically filled organic polymer matrix |
| US5810961A (en) * | 1993-11-19 | 1998-09-22 | E. Khashoggi Industries, Llc | Methods for manufacturing molded sheets having a high starch content |
| US5660903A (en) * | 1992-08-11 | 1997-08-26 | E. Khashoggi Industries | Sheets having a highly inorganically filled organic polymer matrix |
| US5830305A (en) * | 1992-08-11 | 1998-11-03 | E. Khashoggi Industries, Llc | Methods of molding articles having an inorganically filled organic polymer matrix |
| US5582670A (en) * | 1992-08-11 | 1996-12-10 | E. Khashoggi Industries | Methods for the manufacture of sheets having a highly inorganically filled organic polymer matrix |
| US5662731A (en) * | 1992-08-11 | 1997-09-02 | E. Khashoggi Industries | Compositions for manufacturing fiber-reinforced, starch-bound articles having a foamed cellular matrix |
| US5709827A (en) * | 1992-08-11 | 1998-01-20 | E. Khashoggi Industries | Methods for manufacturing articles having a starch-bound cellular matrix |
| US5928741A (en) * | 1992-08-11 | 1999-07-27 | E. Khashoggi Industries, Llc | Laminated articles of manufacture fashioned from sheets having a highly inorganically filled organic polymer matrix |
| US5618341A (en) * | 1992-08-11 | 1997-04-08 | E. Khashoggi Industries | Methods for uniformly dispersing fibers within starch-based compositions |
| US5545450A (en) * | 1992-08-11 | 1996-08-13 | E. Khashoggi Industries | Molded articles having an inorganically filled organic polymer matrix |
| US5716675A (en) * | 1992-11-25 | 1998-02-10 | E. Khashoggi Industries | Methods for treating the surface of starch-based articles with glycerin |
| DK169728B1 (da) * | 1993-02-02 | 1995-01-23 | Stein Gaasland | Fremgangsmåde til frigørelse af cellulosebaserede fibre fra hinanden i vand og støbemasse til plastisk formning af celluloseholdige fiberprodukter |
| US5738921A (en) * | 1993-08-10 | 1998-04-14 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing sealable, liquid-tight containers comprising an inorganically filled matrix |
| US6083586A (en) * | 1993-11-19 | 2000-07-04 | E. Khashoggi Industries, Llc | Sheets having a starch-based binding matrix |
| US5736209A (en) * | 1993-11-19 | 1998-04-07 | E. Kashoggi, Industries, Llc | Compositions having a high ungelatinized starch content and sheets molded therefrom |
| US5843544A (en) * | 1994-02-07 | 1998-12-01 | E. Khashoggi Industries | Articles which include a hinged starch-bound cellular matrix |
| US5705203A (en) * | 1994-02-07 | 1998-01-06 | E. Khashoggi Industries | Systems for molding articles which include a hinged starch-bound cellular matrix |
| US5776388A (en) * | 1994-02-07 | 1998-07-07 | E. Khashoggi Industries, Llc | Methods for molding articles which include a hinged starch-bound cellular matrix |
| US6168857B1 (en) | 1996-04-09 | 2001-01-02 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing starch-based compositions |
| US20080060778A1 (en) * | 2006-09-08 | 2008-03-13 | Abraham Velasco-Tellez | Binder composition and method of forming foundry sand cores and molds |
| WO2009012102A1 (en) * | 2007-07-13 | 2009-01-22 | Advanced Ceramics Manufacturing, Llc | Aggregate-based mandrels for composite part production and composite part production methods |
| MX339544B (es) * | 2008-12-18 | 2016-05-31 | Tenedora Nemak Sa De Cv | Metodo y composicion de aglomerante para fabricacion de moldes y/o corazones de arena para fundicion. |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD36632A (enExample) * | ||||
| US2024123A (en) * | 1932-07-02 | 1935-12-10 | Coating composition and method of | |
| BE551767A (enExample) * | 1955-10-14 | |||
| LU34969A1 (enExample) * | 1956-02-29 | |||
| DE1105566B (de) * | 1956-11-24 | 1961-04-27 | Maizena Werke G M B H Deutsche | Verfahren zur Herstellung von Kernbindemitteln fuer Giessereizwecke |
| US3287213A (en) * | 1965-06-30 | 1966-11-22 | Janssen Pharmaceutica Nv | Method of combatting arachnids and fungi |
| US3433691A (en) * | 1968-04-03 | 1969-03-18 | Diamond Shamrock Corp | Borated dextrin-silicate adhesives |
| AU2236370A (en) * | 1969-11-17 | 1972-05-18 | Minerals, Binders, Clays (Proprietary) Limited | Improvements in the co2 process for bonding, moulding and core sands in foundries |
| US3642503A (en) * | 1970-06-08 | 1972-02-15 | Foseco Int | Process for bonding particulate materials |
-
1976
- 1976-08-31 US US05/719,151 patent/US4070196A/en not_active Expired - Lifetime
- 1976-09-13 BR BR7606063A patent/BR7606063A/pt unknown
- 1976-09-13 MX MX166278A patent/MX143816A/es unknown
- 1976-09-14 AU AU17721/76A patent/AU502546B2/en not_active Expired
- 1976-09-14 DE DE2660613A patent/DE2660613C2/de not_active Expired
- 1976-09-14 DE DE2641249A patent/DE2641249B2/de not_active Ceased
- 1976-09-14 CA CA261,203A patent/CA1065103A/en not_active Expired
- 1976-09-14 IT IT69236/76A patent/IT1068750B/it active
- 1976-09-15 NL NLAANVRAGE7610279,A patent/NL183028C/xx not_active IP Right Cessation
- 1976-09-15 AR AR264719A patent/AR211782A1/es active
- 1976-09-15 FR FR7627661A patent/FR2323466A1/fr active Granted
- 1976-09-15 AT AT683376A patent/AT346508B/de not_active IP Right Cessation
-
1977
- 1977-07-23 IN IN1137/CAL/77A patent/IN148044B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2641249A1 (de) | 1977-03-31 |
| IN148044B (enExample) | 1980-10-04 |
| MX143816A (es) | 1981-07-22 |
| IT1068750B (it) | 1985-03-21 |
| NL7610279A (nl) | 1977-03-17 |
| US4070196A (en) | 1978-01-24 |
| FR2323466B1 (enExample) | 1980-09-19 |
| AR211782A1 (es) | 1978-03-15 |
| AU1772176A (en) | 1978-03-23 |
| DE2641249B2 (de) | 1981-04-16 |
| FR2323466A1 (fr) | 1977-04-08 |
| AU502546B2 (en) | 1979-08-02 |
| NL183028B (nl) | 1988-02-01 |
| DE2660613C2 (de) | 1983-11-03 |
| ATA683376A (de) | 1978-03-15 |
| BR7606063A (pt) | 1977-08-23 |
| NL183028C (nl) | 1988-07-01 |
| AT346508B (de) | 1978-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1065103A (en) | Binder compositions | |
| EP0024395B1 (en) | Alkali metal silicate binder compositions | |
| US4426467A (en) | Foundry molding compositions and process | |
| US4226277A (en) | Novel method of making foundry molds and adhesively bonded composites | |
| US4194918A (en) | Alkali metal silicate binder compositions | |
| US4178429A (en) | Catalyst for curing resins | |
| US4391642A (en) | Alkali metal silicate binder compositions | |
| US4341559A (en) | Binders based upon solutions of alkali metal silicates | |
| KR900000388B1 (ko) | 주형 또는 코어의 제조방법 | |
| US2926098A (en) | Binder for foundry molds | |
| NO810406L (no) | Materiale for stoepeform og fremgangsmaate for fremstilling av stoepeformer og- kjerner | |
| KR101830081B1 (ko) | 주물을 위한 모래주형 및/또는 코어를 만들기 위한 바인더 조성물 및 그 제조방법 | |
| US2952553A (en) | Method for forming a metal casting mold | |
| US3326701A (en) | Formation of solid bodies | |
| US4572272A (en) | Method of casting using non-silica based ceramic cores for castings | |
| US4541869A (en) | Process for forming foundry components | |
| KR800000495B1 (ko) | 접착제 조성물 | |
| US4121942A (en) | Molding method | |
| US3970462A (en) | Self setting molding process | |
| US4383861A (en) | Metal silico-phosphate binders and foundry shapes produced therefrom | |
| AU645403B2 (en) | Alkaline resol phenol-aldehyde resin binder compositions | |
| US3209420A (en) | Mold and core binder for foundry use | |
| SU1717270A1 (ru) | Смесь дл изготовлени литейных форм | |
| GB1602122A (en) | Foundry binder | |
| KR810000572B1 (ko) | 알칼리 금속 귀산염 결합제 조성물 |