CA1061348A - Iminoisoindolinone metal complex - Google Patents
Iminoisoindolinone metal complexInfo
- Publication number
- CA1061348A CA1061348A CA237,662A CA237662A CA1061348A CA 1061348 A CA1061348 A CA 1061348A CA 237662 A CA237662 A CA 237662A CA 1061348 A CA1061348 A CA 1061348A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- isoindolinone
- carbon atoms
- group
- metal complex
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Iminoisoindolinone metal complex Chemical class 0.000 title claims abstract description 28
- 229910052751 metal Inorganic materials 0.000 claims abstract description 18
- 239000002184 metal Substances 0.000 claims abstract description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical group [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 15
- 229910017052 cobalt Inorganic materials 0.000 claims description 15
- 239000010941 cobalt Chemical group 0.000 claims description 15
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical group [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 239000010949 copper Chemical group 0.000 claims description 10
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical group [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052802 copper Inorganic materials 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229910052759 nickel Chemical group 0.000 claims description 5
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 4
- 229910052793 cadmium Inorganic materials 0.000 claims description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical group [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 3
- 239000005864 Sulphur Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 150000004696 coordination complex Chemical class 0.000 claims 5
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract description 6
- 125000005843 halogen group Chemical group 0.000 abstract description 5
- MMBYJYAFFGKUDC-UHFFFAOYSA-N 3-aminoisoindol-1-one Chemical compound C1=CC=C2C(N)=NC(=O)C2=C1 MMBYJYAFFGKUDC-UHFFFAOYSA-N 0.000 abstract description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract description 3
- 150000001342 alkaline earth metals Chemical class 0.000 abstract description 3
- 125000004429 atom Chemical group 0.000 abstract description 2
- 239000011368 organic material Substances 0.000 abstract description 2
- 230000000485 pigmenting effect Effects 0.000 abstract description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 150000005840 aryl radicals Chemical class 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 description 35
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000049 pigment Substances 0.000 description 20
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical compound C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 description 14
- 239000002966 varnish Substances 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 229940022663 acetate Drugs 0.000 description 9
- 239000000975 dye Substances 0.000 description 9
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 229940011182 cobalt acetate Drugs 0.000 description 6
- 229920000915 polyvinyl chloride Polymers 0.000 description 6
- 239000004800 polyvinyl chloride Substances 0.000 description 6
- 230000005012 migration Effects 0.000 description 5
- 238000013508 migration Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZGYAWBOXRVLUOK-UHFFFAOYSA-N 4-imino-3ah-isoindole-1,3-dione Chemical compound N=C1C=CC=C2C(=O)NC(=O)C12 ZGYAWBOXRVLUOK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 3
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229940078494 nickel acetate Drugs 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 239000004246 zinc acetate Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- 239000004925 Acrylic resin Substances 0.000 description 2
- 229920000178 Acrylic resin Polymers 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229920000180 alkyd Polymers 0.000 description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N anhydrous diethylene glycol Natural products OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 150000007980 azole derivatives Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000000740 bleeding effect Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000004700 cobalt complex Chemical class 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- BQAVZKPCEICBRV-UHFFFAOYSA-N 2-amino-3h-isoindol-1-one Chemical class C1=CC=C2C(=O)N(N)CC2=C1 BQAVZKPCEICBRV-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- CUVAUYUUVFGQAI-UHFFFAOYSA-N 3,3,4,5,6,7-hexachloro-2h-isoindol-1-one Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)NC(Cl)(Cl)C2=C1Cl CUVAUYUUVFGQAI-UHFFFAOYSA-N 0.000 description 1
- SFKMSIYUSLUNOL-UHFFFAOYSA-N 3-amino-4,5,7-trichloro-6-phenylsulfanylisoindol-1-one Chemical compound ClC=1C(Cl)=C2C(=N)NC(=O)C2=C(Cl)C=1SC1=CC=CC=C1 SFKMSIYUSLUNOL-UHFFFAOYSA-N 0.000 description 1
- KLICXIFDRLZSGO-UHFFFAOYSA-N 3-amino-6-chloroisoindol-1-one Chemical compound ClC1=CC=C2C(N)=NC(=O)C2=C1 KLICXIFDRLZSGO-UHFFFAOYSA-N 0.000 description 1
- RCEQJAZJQDYBSL-UHFFFAOYSA-N 3-amino-6-ethoxyisoindol-1-one Chemical compound CCOC1=CC=C2C(=N)NC(=O)C2=C1 RCEQJAZJQDYBSL-UHFFFAOYSA-N 0.000 description 1
- AYSYFLHEZBKBHJ-UHFFFAOYSA-N 3-amino-6-methoxyisoindol-1-one Chemical compound COC1=CC=C2C(N)=NC(=O)C2=C1 AYSYFLHEZBKBHJ-UHFFFAOYSA-N 0.000 description 1
- QSOBIPHMKDGPKR-UHFFFAOYSA-N 3-amino-6-methylisoindol-1-one Chemical compound CC1=CC=C2C(N)=NC(=O)C2=C1 QSOBIPHMKDGPKR-UHFFFAOYSA-N 0.000 description 1
- JWKUYVREWFAFLB-UHFFFAOYSA-N 3-amino-6-methylsulfanylisoindol-1-one Chemical compound CSC1=CC=C2C(=N)NC(=O)C2=C1 JWKUYVREWFAFLB-UHFFFAOYSA-N 0.000 description 1
- NWODCABIQVPNBA-UHFFFAOYSA-N 3-amino-6-nitroisoindol-1-one Chemical compound [O-][N+](=O)C1=CC=C2C(N)=NC(=O)C2=C1 NWODCABIQVPNBA-UHFFFAOYSA-N 0.000 description 1
- MCRRMASEMUHCNO-UHFFFAOYSA-N 3-amino-6-phenoxyisoindol-1-one Chemical compound C=1C=C2C(=N)NC(=O)C2=CC=1OC1=CC=CC=C1 MCRRMASEMUHCNO-UHFFFAOYSA-N 0.000 description 1
- CDPPJWFJXVLIIW-UHFFFAOYSA-N 3-amino-6-phenylisoindol-1-one Chemical compound C=1C=C2C(=N)NC(=O)C2=CC=1C1=CC=CC=C1 CDPPJWFJXVLIIW-UHFFFAOYSA-N 0.000 description 1
- LOZPOKCWMBZWBP-UHFFFAOYSA-N 3-amino-7-chloroisoindol-1-one Chemical compound C1=CC=C(Cl)C2=C1C(N)=NC2=O LOZPOKCWMBZWBP-UHFFFAOYSA-N 0.000 description 1
- SMTLWUNXQBUCBT-UHFFFAOYSA-N 3-amino-7-nitroisoindol-1-one Chemical compound [O-][N+](=O)C1=CC=CC2=C1C(=O)NC2=N SMTLWUNXQBUCBT-UHFFFAOYSA-N 0.000 description 1
- ULVDMKRXBIKOMK-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2,3-dihydroisoindol-1-one Chemical class ClC1=C(Cl)C(Cl)=C2CNC(=O)C2=C1Cl ULVDMKRXBIKOMK-UHFFFAOYSA-N 0.000 description 1
- AIBQGOMAISTKSR-UHFFFAOYSA-N 6-chloro-1,3-benzothiazole Chemical compound ClC1=CC=C2N=CSC2=C1 AIBQGOMAISTKSR-UHFFFAOYSA-N 0.000 description 1
- NZUORMKRSZZVPM-UHFFFAOYSA-N 6-ethoxy-1h-benzimidazol-2-amine Chemical compound CCOC1=CC=C2N=C(N)NC2=C1 NZUORMKRSZZVPM-UHFFFAOYSA-N 0.000 description 1
- 241001589086 Bellapiscis medius Species 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- TTXAQHBYLAOCDN-UHFFFAOYSA-N ClC1=C2C(NC(C2=C(C(=C1Cl)SC)Cl)=O)=N.ClC=1C(=C2C(NC(C2=C(C1OC1=CC=CC=C1)Cl)=O)=N)OC1=CC=CC=C1.ClC=1C(=C2C(NC(C2=C(C1OC)Cl)=O)=N)OC Chemical compound ClC1=C2C(NC(C2=C(C(=C1Cl)SC)Cl)=O)=N.ClC=1C(=C2C(NC(C2=C(C1OC1=CC=CC=C1)Cl)=O)=N)OC1=CC=CC=C1.ClC=1C(=C2C(NC(C2=C(C1OC)Cl)=O)=N)OC TTXAQHBYLAOCDN-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229920003264 Maprenal® Polymers 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 239000004640 Melamine resin Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- 125000005116 aryl carbamoyl group Chemical group 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000001058 brown pigment Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- OIQPTROHQCGFEF-UHFFFAOYSA-L chembl1371409 Chemical compound [Na+].[Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 OIQPTROHQCGFEF-UHFFFAOYSA-L 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- JUPWRUDTZGBNEX-UHFFFAOYSA-N cobalt;pentane-2,4-dione Chemical compound [Co].CC(=O)CC(C)=O.CC(=O)CC(C)=O.CC(=O)CC(C)=O JUPWRUDTZGBNEX-UHFFFAOYSA-N 0.000 description 1
- 238000012505 colouration Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000005108 dry cleaning Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 238000009998 heat setting Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- ZHPGYHIZEBRBFF-UHFFFAOYSA-N hypochlorous acid 4-imino-3aH-isoindole-1,3-dione Chemical compound ClO.N=C1C=CC=C2C(=O)NC(=O)C12 ZHPGYHIZEBRBFF-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- XYQXGZLLGNQFSL-UHFFFAOYSA-N methyl 2,3,4,5-tetrachloro-6-cyanobenzoate Chemical compound COC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C#N XYQXGZLLGNQFSL-UHFFFAOYSA-N 0.000 description 1
- BAKKCCVQOIFVKD-UHFFFAOYSA-N n-(1,3-benzothiazol-2-yl)-1,3-benzothiazol-2-amine Chemical compound C1=CC=C2SC(NC=3SC4=CC=CC=C4N=3)=NC2=C1 BAKKCCVQOIFVKD-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- AIYYMMQIMJOTBM-UHFFFAOYSA-L nickel(ii) acetate Chemical compound [Ni+2].CC([O-])=O.CC([O-])=O AIYYMMQIMJOTBM-UHFFFAOYSA-L 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- IZMJMCDDWKSTTK-UHFFFAOYSA-N quinoline yellow Chemical compound C1=CC=CC2=NC(C3C(C4=CC=CC=C4C3=O)=O)=CC=C21 IZMJMCDDWKSTTK-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- JMHCCAYJTTWMCX-QWPJCUCISA-M sodium;(2s)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate;pentahydrate Chemical compound O.O.O.O.O.[Na+].IC1=CC(C[C@H](N)C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 JMHCCAYJTTWMCX-QWPJCUCISA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/04—Isoindoline dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Indole Compounds (AREA)
- Paints Or Removers (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1391974A CH606335A5 (enExample) | 1974-10-17 | 1974-10-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1061348A true CA1061348A (en) | 1979-08-28 |
Family
ID=4396467
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA237,662A Expired CA1061348A (en) | 1974-10-17 | 1975-10-15 | Iminoisoindolinone metal complex |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4065462A (enExample) |
| JP (1) | JPS5916578B2 (enExample) |
| AR (1) | AR207790A1 (enExample) |
| AU (1) | AU507331B2 (enExample) |
| BE (1) | BE834558A (enExample) |
| CA (1) | CA1061348A (enExample) |
| CH (1) | CH606335A5 (enExample) |
| DE (1) | DE2546038A1 (enExample) |
| ES (1) | ES441831A1 (enExample) |
| FR (1) | FR2330737A1 (enExample) |
| GB (1) | GB1512554A (enExample) |
| NL (1) | NL7512165A (enExample) |
| SU (1) | SU635880A3 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2736652A1 (de) * | 1977-08-13 | 1979-02-22 | Boehringer Sohn Ingelheim | 2,6-bis-(aminocylamino)-benzo- eckige klammer auf 1,2-d zu 5,4-d' eckige klammer zu -bisthiazole und 2-amino-6-(aminoacylamino)-benzo- eckige klammer auf 1,2-d zu 5,4-d' eckige klammer zu -bisthiazole, verfahren zu ihrer herstellung und arzneimittel |
| DE2848622A1 (de) * | 1978-11-09 | 1980-05-22 | Bayer Ag | Saure monomethin-metallkomplexfarbstoffe |
| DE2916697A1 (de) * | 1979-04-25 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von unloeslichen metallkomplexfarbstoffen |
| CH644145A5 (de) * | 1979-05-02 | 1984-07-13 | Sandoz Ag | Metallkomplexe von oximinoverbindungen und ihre verwendung als pigmente. |
| EP0023889B1 (de) * | 1979-08-03 | 1983-03-09 | Ciba-Geigy Ag | Imino-isoindolinon-Metallkomplexe, Verfahren zu deren Herstellung, Verfahren zum Pigmentieren von hochmolekularem organischem Material und hochmolekulares organisches, einen solchen Metallkomplex enthaltendes Material |
| EP0465421A1 (de) * | 1990-07-04 | 1992-01-08 | Ciba-Geigy Ag | Isoindolinonverbindungen mit langkettigen Alkylthioethergruppen |
| US6180788B1 (en) * | 1997-12-16 | 2001-01-30 | Exxon Research And Engineering Company | Catalyst compositions |
| EP1245571A4 (en) * | 2000-01-07 | 2003-09-17 | Mitsui Chemicals Inc | BENZBISAZOLE COMPOUND AND OPTICAL RECORDING MEDIUM CONTAINING THE SAME |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH580678A5 (enExample) * | 1972-12-04 | 1976-10-15 | Ciba Geigy Ag |
-
1974
- 1974-10-17 CH CH1391974A patent/CH606335A5/xx not_active IP Right Cessation
-
1975
- 1975-01-01 AR AR260802A patent/AR207790A1/es active
- 1975-10-06 US US05/619,889 patent/US4065462A/en not_active Expired - Lifetime
- 1975-10-06 SU SU752177448A patent/SU635880A3/ru active
- 1975-10-14 DE DE19752546038 patent/DE2546038A1/de active Granted
- 1975-10-15 CA CA237,662A patent/CA1061348A/en not_active Expired
- 1975-10-15 FR FR7531507A patent/FR2330737A1/fr active Granted
- 1975-10-16 ES ES441831A patent/ES441831A1/es not_active Expired
- 1975-10-16 NL NL7512165A patent/NL7512165A/xx not_active Application Discontinuation
- 1975-10-16 AU AU85765/75A patent/AU507331B2/en not_active Expired
- 1975-10-16 GB GB42376/75A patent/GB1512554A/en not_active Expired
- 1975-10-16 BE BE160975A patent/BE834558A/xx unknown
- 1975-10-17 JP JP50125234A patent/JPS5916578B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES441831A1 (es) | 1977-06-01 |
| BE834558A (fr) | 1976-04-16 |
| FR2330737A1 (fr) | 1977-06-03 |
| US4065462A (en) | 1977-12-27 |
| JPS5164530A (en) | 1976-06-04 |
| DE2546038C2 (enExample) | 1988-02-18 |
| DE2546038A1 (de) | 1976-04-22 |
| AR207790A1 (es) | 1976-10-29 |
| NL7512165A (nl) | 1976-04-21 |
| CH606335A5 (enExample) | 1978-10-31 |
| FR2330737B1 (enExample) | 1979-04-27 |
| GB1512554A (en) | 1978-06-01 |
| AU507331B2 (en) | 1980-02-14 |
| SU635880A3 (ru) | 1978-11-30 |
| JPS5916578B2 (ja) | 1984-04-16 |
| AU8576575A (en) | 1977-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3646033A (en) | Derivatives of isoindoline | |
| US3897439A (en) | Certain isoindolinone pigments containing heavy metals | |
| US4044036A (en) | Metal complexes of bis-azomethines from hydroxy-aldehydes and alkylene diamines | |
| CA1061348A (en) | Iminoisoindolinone metal complex | |
| EP1046681B1 (en) | Hybrid pigments | |
| US5755875A (en) | Fluorescent chromophores containing cyanimino groups | |
| USRE27575E (en) | Water-insoluble benzimidazolone containing monoazo dyestuffs | |
| CA1064950A (en) | Bis-azomethine metal complex colorants of hydroxycoumarin derivatives or hydroxychromone derivatives and process for their manufacture | |
| US3892750A (en) | New azomethine pigments and processes for their manufacture | |
| CA1083590A (en) | Water-insoluble disazo methine compounds process for their preparation and their use as dyestuffs | |
| US4689403A (en) | Disazo pigment from condensation of carboxylic acid chloride with 2,5-dichloro-1,4-phenylene diamine | |
| CA1066292A (en) | Mixed complexes of methine dyes | |
| US5527922A (en) | Pyrrolo[3,4-c]pyrroles containing cyanimino groups | |
| US3242179A (en) | Perimidone-g,y-dicareoxylic imides, their production and use as pigment dyes | |
| CA1142929A (en) | Process for the preparation of metal complexes of isoindolinazines | |
| US3971805A (en) | Iminoisoindolinone pigments and process for their manufacture | |
| US4052410A (en) | Iminoisoindoline pigments | |
| US3272821A (en) | Delta form of quinacridone pigment | |
| US5785720A (en) | Process for coloring high molecular weight material with polycyclic compounds | |
| CA2116064A1 (en) | Diketopyrrolopyrroles containing nitroxyl groups | |
| US4070367A (en) | Isoindolinone pigments and process for their manufacture | |
| JPS58164648A (ja) | イソインドリン染料及びその使用 | |
| US4088641A (en) | 4-Methyl-5-(benzimidazolonylazo)-6-hydroxypyridone-2 pigment | |
| US3994899A (en) | Metal complex pigments | |
| US4327024A (en) | Iminoisoindolinone pigments, process for their production and use thereof |