CA1056104A - Protective gaiter - Google Patents
Protective gaiterInfo
- Publication number
- CA1056104A CA1056104A CA224,518A CA224518A CA1056104A CA 1056104 A CA1056104 A CA 1056104A CA 224518 A CA224518 A CA 224518A CA 1056104 A CA1056104 A CA 1056104A
- Authority
- CA
- Canada
- Prior art keywords
- gaiter
- edge
- wearer
- edges
- fabric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 210000001699 lower leg Anatomy 0.000 title claims abstract description 120
- 230000001681 protective effect Effects 0.000 title claims abstract description 83
- 210000002414 leg Anatomy 0.000 claims abstract description 33
- 238000004519 manufacturing process Methods 0.000 claims abstract description 11
- 210000002303 tibia Anatomy 0.000 claims abstract description 9
- 210000003127 knee Anatomy 0.000 claims abstract description 7
- 210000003205 muscle Anatomy 0.000 claims abstract description 5
- 239000004744 fabric Substances 0.000 claims description 74
- 238000000034 method Methods 0.000 claims description 43
- 239000000543 intermediate Substances 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 18
- 238000009958 sewing Methods 0.000 claims description 9
- 239000011358 absorbing material Substances 0.000 claims description 3
- 229940000425 combination drug Drugs 0.000 claims description 2
- 230000037081 physical activity Effects 0.000 claims description 2
- 210000002454 frontal bone Anatomy 0.000 claims 2
- 230000000694 effects Effects 0.000 claims 1
- 230000013011 mating Effects 0.000 claims 1
- 210000000988 bone and bone Anatomy 0.000 abstract description 4
- 210000002683 foot Anatomy 0.000 description 10
- 239000004677 Nylon Substances 0.000 description 8
- 229920001778 nylon Polymers 0.000 description 8
- 238000009964 serging Methods 0.000 description 7
- 210000003423 ankle Anatomy 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 3
- 230000002633 protecting effect Effects 0.000 description 2
- NSMXQKNUPPXBRG-SECBINFHSA-N (R)-lisofylline Chemical compound O=C1N(CCCC[C@H](O)C)C(=O)N(C)C2=C1N(C)C=N2 NSMXQKNUPPXBRG-SECBINFHSA-N 0.000 description 1
- KUVIULQEHSCUHY-XYWKZLDCSA-N Beclometasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(Cl)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(=O)CC)(OC(=O)CC)[C@@]1(C)C[C@@H]2O KUVIULQEHSCUHY-XYWKZLDCSA-N 0.000 description 1
- 230000000386 athletic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 101150008563 spir gene Proteins 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B71/00—Games or sports accessories not covered in groups A63B1/00 - A63B69/00
- A63B71/08—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions
- A63B71/12—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions for the body or the legs, e.g. for the shoulders
- A63B71/1225—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions for the body or the legs, e.g. for the shoulders for the legs, e.g. thighs, knees, ankles, feet
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B71/00—Games or sports accessories not covered in groups A63B1/00 - A63B69/00
- A63B71/08—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions
- A63B71/12—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions for the body or the legs, e.g. for the shoulders
- A63B71/1225—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions for the body or the legs, e.g. for the shoulders for the legs, e.g. thighs, knees, ankles, feet
- A63B2071/1258—Body-protectors for players or sportsmen, i.e. body-protecting accessories affording protection of body parts against blows or collisions for the body or the legs, e.g. for the shoulders for the legs, e.g. thighs, knees, ankles, feet for the shin, e.g. shin guards
Landscapes
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Physical Education & Sports Medicine (AREA)
- Professional, Industrial, Or Sporting Protective Garments (AREA)
- Orthopedics, Nursing, And Contraception (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46115674A | 1974-04-15 | 1974-04-15 | |
| US05/552,551 US4001953A (en) | 1974-04-15 | 1975-02-24 | Protective gaiter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1056104A true CA1056104A (en) | 1979-06-12 |
Family
ID=27039929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA224,518A Expired CA1056104A (en) | 1974-04-15 | 1975-04-14 | Protective gaiter |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4001953A (enExample) |
| JP (1) | JPS5761433B2 (enExample) |
| CA (1) | CA1056104A (enExample) |
| DE (1) | DE2516388A1 (enExample) |
| FR (1) | FR2267060B1 (enExample) |
| GB (1) | GB1494698A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2024055092A1 (en) * | 2022-09-12 | 2024-03-21 | INA International Ltd. | Adaptable shin guard assembly |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55125372U (enExample) * | 1979-02-26 | 1980-09-05 | ||
| US4306315A (en) * | 1979-04-30 | 1981-12-22 | Casco Marketing Corporation | Shin guard |
| US4461030A (en) * | 1982-09-30 | 1984-07-17 | Knudsen Phillip E | Bag and closure therefor |
| US4624015A (en) * | 1984-08-27 | 1986-11-25 | Bottoms James D | Karate and kick boxing protective boot |
| US4896437A (en) * | 1985-10-07 | 1990-01-30 | Johnson David R | Insulated boot and gaiter combination |
| US4669126A (en) * | 1986-09-15 | 1987-06-02 | Jones Thomas L | Athletic sock |
| US4756026A (en) * | 1987-05-04 | 1988-07-12 | Pierce Jr Alfred R | Limb protector |
| US4926501A (en) * | 1988-11-21 | 1990-05-22 | Goosen Carl C | Disposable anterior lower leg guard |
| US4959875A (en) * | 1989-03-29 | 1990-10-02 | Moon Theodore L | Limb protector device |
| USD354615S (en) | 1993-08-13 | 1995-01-24 | Parker Pamela A | Half chap leg covering |
| US5570470A (en) * | 1995-07-03 | 1996-11-05 | Miller; Kent M. | Leg protection device |
| US5572888A (en) * | 1995-07-19 | 1996-11-12 | Sara Lee Corporation | Garment blank, lower torso garment and method of making |
| US5625896A (en) * | 1995-08-01 | 1997-05-06 | Labarbera; Joseph P. | Light weight shin protector |
| US5815948A (en) * | 1997-02-07 | 1998-10-06 | Dzielak; James E. | Waterproof gaiter |
| USD395158S (en) | 1997-02-19 | 1998-06-16 | Glenn Lindaman | Sock with receptacle for shin guard |
| USD394543S (en) | 1997-02-21 | 1998-05-26 | Glenn Lindaman | Sock with ankle strap |
| US5742945A (en) * | 1997-02-21 | 1998-04-28 | Lindaman; Glenn | Sock with shin guard fastener |
| US5890224A (en) * | 1997-07-30 | 1999-04-06 | Clark; Larry N | Protective guard for extremity of a human body |
| US5911310A (en) * | 1998-04-23 | 1999-06-15 | Bridgers; Leo W. | Inflatable shin guard |
| US6105164A (en) * | 1999-05-03 | 2000-08-22 | Excellence Sporting Goods Co., Ltd. | Integrally molded protective shin guard barrier |
| US6381756B1 (en) | 1999-05-06 | 2002-05-07 | Lane F. Smith | Gaiter-sock combination |
| US6298484B1 (en) * | 1999-12-23 | 2001-10-09 | David Edward Beckman | Protective guard |
| JP3613633B2 (ja) * | 2001-04-23 | 2005-01-26 | 吉徳 柴田 | スポーツ用ストッキング |
| US6385778B1 (en) * | 2001-06-15 | 2002-05-14 | Dorothy L. Johnson | Shape enhancing hosiery |
| US7069670B1 (en) * | 2003-07-17 | 2006-07-04 | Gerke William P | Protective foot wear |
| US20050076421A1 (en) * | 2003-10-09 | 2005-04-14 | Littzi Aaron J. | Athletic sock |
| DE102005036170A1 (de) * | 2005-08-02 | 2007-02-08 | Scheffer, Harald | Schienbeinschützer |
| USD551828S1 (en) | 2005-12-02 | 2007-10-02 | Winjum Jim G | Gaiter |
| US20080127394A1 (en) * | 2006-11-27 | 2008-06-05 | Tammany Paige Atkinson | Protective garments |
| US20110289657A1 (en) * | 2006-11-29 | 2011-12-01 | Charles Starr | Specialized sock having removeable insert |
| US20090000012A1 (en) * | 2007-06-26 | 2009-01-01 | Hsieh Hung-Yu | Stocking capable of the convenient holding of articles |
| SE532791C2 (sv) * | 2008-02-14 | 2010-04-13 | Bergmann & De Jounge Ab | Skydd för en kroppsdel hos en användare |
| AU2010292961B2 (en) * | 2009-09-11 | 2014-07-31 | Clads4Pads Pty Ltd | Pad cover |
| US20110239487A1 (en) * | 2010-04-01 | 2011-10-06 | Maureen Renkes | Boot covers |
| US10150027B2 (en) * | 2010-10-22 | 2018-12-11 | Nike, Inc. | Shin guard sleeve |
| US20120174442A1 (en) * | 2011-01-06 | 2012-07-12 | Wanda Marie Castle | Decorative Boot Clip |
| USD649333S1 (en) * | 2011-01-24 | 2011-11-29 | Cheryl Miller | Gaiter |
| US9173438B2 (en) | 2012-02-21 | 2015-11-03 | Annie Morgan Blumenfeld | Reusable rash preventing shin guard system |
| CA145110S (en) * | 2012-04-10 | 2013-08-09 | Paz Performance Clothing Ltd | Athletic ankle guard |
| US20140007462A1 (en) * | 2012-07-06 | 2014-01-09 | Rayanne Engel-Currin | Article of Footwear for Leg Protection in Barrel Racing |
| US20140259260A1 (en) * | 2013-03-15 | 2014-09-18 | Nike, Inc. | Protective Ankle And Calf Sleeve |
| US9955738B2 (en) * | 2013-08-13 | 2018-05-01 | Beverly Pillow | Enhancement legwear with removable pads |
| USD782787S1 (en) * | 2014-08-27 | 2017-04-04 | Diamond Dust Design LLC | Clothing article |
| US20170095723A1 (en) * | 2014-12-16 | 2017-04-06 | Adrian Mark Sushko | Shin Guard With Variable and Interchangeable Protection |
| USD838943S1 (en) | 2017-11-20 | 2019-01-29 | Gail V. Russell | Gaiter |
| US20190184263A1 (en) * | 2017-12-20 | 2019-06-20 | Monnet | Tibia and/or foot protection article comprising at least one shock absorbing pad |
| US20190216163A1 (en) * | 2018-01-16 | 2019-07-18 | Boot Quarters, Llc | Footwear accessory |
| WO2021084465A1 (en) * | 2019-11-01 | 2021-05-06 | Kci Licensing, Inc. | Decompression therapy treatment system |
| US12274636B2 (en) | 2019-11-01 | 2025-04-15 | Kci Manufacturing Unlimited Company | Decompression therapy treatment system |
| USD1021340S1 (en) * | 2020-12-23 | 2024-04-09 | Stone Glacier, Inc. | Gaiter with stirrup |
| WO2023137169A1 (en) * | 2022-01-14 | 2023-07-20 | Filip Postolek | Gaiter and related methods |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7148791U (de) * | 1972-04-13 | Ritter O | Beinschutz für Sportler | |
| NL18867C (enExample) * | 1925-10-31 | |||
| US2552177A (en) * | 1949-03-14 | 1951-05-08 | Kendall & Co | Protector |
| US2544065A (en) * | 1949-04-29 | 1951-03-06 | Richard E Carr | Stocking attachment |
| CH400052A (de) * | 1963-03-19 | 1965-10-15 | Ours Sport Ag Bern | Strumpf mit Schienbeinschoner |
| US3191185A (en) * | 1963-08-21 | 1965-06-29 | Robert F Martin | Snake-proof trousers and the like |
| US3189919A (en) * | 1963-12-05 | 1965-06-22 | George Frost Company | Cushioned protector |
| DE2310149A1 (de) * | 1973-03-01 | 1974-09-05 | Walter Auracher | Unterschenkelschuetzer |
-
1975
- 1975-02-24 US US05/552,551 patent/US4001953A/en not_active Expired - Lifetime
- 1975-04-11 GB GB15010/75A patent/GB1494698A/en not_active Expired
- 1975-04-14 CA CA224,518A patent/CA1056104A/en not_active Expired
- 1975-04-15 DE DE19752516388 patent/DE2516388A1/de not_active Withdrawn
- 1975-04-15 FR FR7511706A patent/FR2267060B1/fr not_active Expired
- 1975-04-15 JP JP50044881A patent/JPS5761433B2/ja not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2024055092A1 (en) * | 2022-09-12 | 2024-03-21 | INA International Ltd. | Adaptable shin guard assembly |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2267060B1 (enExample) | 1981-06-19 |
| FR2267060A1 (enExample) | 1975-11-07 |
| DE2516388A1 (de) | 1975-10-23 |
| US4001953A (en) | 1977-01-11 |
| JPS50146439A (enExample) | 1975-11-25 |
| JPS5761433B2 (enExample) | 1982-12-24 |
| GB1494698A (en) | 1977-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1056104A (en) | Protective gaiter | |
| US4344189A (en) | Limb protector for athletes | |
| CA2324158C (en) | Sports glove | |
| US5033119A (en) | Glove for enhancing athletic performance | |
| US4756026A (en) | Limb protector | |
| US9226534B2 (en) | Shoulder stabilization shirt | |
| EP0834264B1 (en) | Shoulder and upper limb protecting clothes | |
| CA1222853A (en) | Lacrosse glove | |
| US4951317A (en) | Athletic sleeve for protecting limbs | |
| US6832391B1 (en) | Weight lifting glove | |
| CA2473750C (en) | Compression short | |
| US4987613A (en) | All-in-one slider sport pants | |
| US5218720A (en) | Inner liner for garment suitable for athletic activities | |
| US4488314A (en) | Pantlegged garment with knee protection | |
| US4024584A (en) | Pad and garment assembly | |
| US20040199095A1 (en) | Knee band for front and side protection of the knee from impacts | |
| CA2197784A1 (en) | Therapeutic glove | |
| CA2115524A1 (en) | Hockey goaltender's body pad with size adjustment | |
| US5800371A (en) | Sportsman's knee brace | |
| US4035860A (en) | Protective gaiter | |
| US6591426B1 (en) | Sleeping bag | |
| CA2836058C (en) | Shoulder stabilization shirt | |
| CN218682121U (zh) | 加强收腹功能的运动塑形瑜伽裤 | |
| JP3043438U (ja) | ゴルフ用小物入れ | |
| GB2170992A (en) | Gaiter |