CA1055938A - Morpholinone derivatives and their production - Google Patents
Morpholinone derivatives and their productionInfo
- Publication number
- CA1055938A CA1055938A CA254,156A CA254156A CA1055938A CA 1055938 A CA1055938 A CA 1055938A CA 254156 A CA254156 A CA 254156A CA 1055938 A CA1055938 A CA 1055938A
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- morpholinone
- hydrogen
- chlorine
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VSEAAEQOQBMPQF-UHFFFAOYSA-N morpholin-3-one Chemical class O=C1COCCN1 VSEAAEQOQBMPQF-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 47
- 238000000034 method Methods 0.000 claims description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 22
- 239000000460 chlorine Substances 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 19
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 17
- -1 aralkoxy Chemical group 0.000 claims description 16
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- MTJPIKUTDCMUNT-UHFFFAOYSA-N 6-[(4-chlorophenoxy)methyl]-4-phenylmorpholin-2-one Chemical compound C1=CC(Cl)=CC=C1OCC1OC(=O)CN(C=2C=CC=CC=2)C1 MTJPIKUTDCMUNT-UHFFFAOYSA-N 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 239000011737 fluorine Chemical group 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- SBGNJMTZRNVDLY-UHFFFAOYSA-N 1-anilino-3-(4-chlorophenoxy)propan-2-ol Chemical compound C=1C=C(Cl)C=CC=1OCC(O)CNC1=CC=CC=C1 SBGNJMTZRNVDLY-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 7
- 239000000126 substance Substances 0.000 claims 5
- MLSGRWDEDYJNER-UHFFFAOYSA-N ethyl 2-anilinoacetate Chemical compound CCOC(=O)CNC1=CC=CC=C1 MLSGRWDEDYJNER-UHFFFAOYSA-N 0.000 claims 4
- FEWSIACXTZZJMU-UHFFFAOYSA-N 6-[(4-bromophenoxy)methyl]-4-phenylmorpholin-2-one Chemical compound C1=CC(Br)=CC=C1OCC1OC(=O)CN(C=2C=CC=CC=2)C1 FEWSIACXTZZJMU-UHFFFAOYSA-N 0.000 claims 3
- YULBNQBFSZNIOB-UHFFFAOYSA-N 6-[(4-chlorophenyl)sulfanylmethyl]-4-phenylmorpholin-2-one Chemical compound C1=CC(Cl)=CC=C1SCC1OC(=O)CN(C=2C=CC=CC=2)C1 YULBNQBFSZNIOB-UHFFFAOYSA-N 0.000 claims 3
- HSSRCJGKQIBEJD-UHFFFAOYSA-N 6-[(4-fluorophenoxy)methyl]-4-phenylmorpholin-2-one Chemical compound C1=CC(F)=CC=C1OCC1OC(=O)CN(C=2C=CC=CC=2)C1 HSSRCJGKQIBEJD-UHFFFAOYSA-N 0.000 claims 3
- GOLBZWJZSUDMKP-UHFFFAOYSA-N 2-[(4-chlorophenyl)sulfanylmethyl]oxirane Chemical compound C1=CC(Cl)=CC=C1SCC1OC1 GOLBZWJZSUDMKP-UHFFFAOYSA-N 0.000 claims 1
- VCYZVXRKYPKDQB-UHFFFAOYSA-N ethyl 2-fluoroacetate Chemical compound CCOC(=O)CF VCYZVXRKYPKDQB-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 11
- 206010003210 Arteriosclerosis Diseases 0.000 abstract description 3
- 208000011775 arteriosclerosis disease Diseases 0.000 abstract description 3
- 230000002265 prevention Effects 0.000 abstract description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical class CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 abstract description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 150000002118 epoxides Chemical class 0.000 abstract 1
- 150000005331 phenylglycines Chemical class 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 7
- 210000004369 blood Anatomy 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 3
- 229960001214 clofibrate Drugs 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LGJMUZUPVCAVPU-ANOYILKDSA-N (3s,8r,9s,10s,13r,14s,17r)-17-[(2r,5s)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-ol Chemical class C1CC2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CC[C@H](CC)C(C)C)[C@@]1(C)CC2 LGJMUZUPVCAVPU-ANOYILKDSA-N 0.000 description 2
- KSLSZOOZWRMSAP-UHFFFAOYSA-N 2-[(4-chlorophenoxy)methyl]oxirane Chemical compound C1=CC(Cl)=CC=C1OCC1OC1 KSLSZOOZWRMSAP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 235000021045 dietary change Nutrition 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000015500 sitosterol Nutrition 0.000 description 2
- 229940083492 sitosterols Drugs 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- UNWIRWPOOMZPRL-UHFFFAOYSA-N 6-[(4-chlorophenoxy)methyl]-4-(3-chlorophenyl)morpholin-2-one Chemical compound C1=CC(Cl)=CC=C1OCC1OC(=O)CN(C=2C=C(Cl)C=CC=2)C1 UNWIRWPOOMZPRL-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical class IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000001906 cholesterol absorption Effects 0.000 description 1
- 235000020974 cholesterol intake Nutrition 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- ZXALBIGVBSYIGH-UHFFFAOYSA-N n-(3-acetyl-7-chloro-2-methyl-1-benzofuran-5-yl)-2,4,5-trimethylbenzenesulfonamide Chemical compound C1=C2C(C(=O)C)=C(C)OC2=C(Cl)C=C1NS(=O)(=O)C1=CC(C)=C(C)C=C1C ZXALBIGVBSYIGH-UHFFFAOYSA-N 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 235000021003 saturated fats Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- SYHDSBBKRLVLFF-UHFFFAOYSA-N triparanol Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(O)(C=1C=CC(C)=CC=1)CC1=CC=C(Cl)C=C1 SYHDSBBKRLVLFF-UHFFFAOYSA-N 0.000 description 1
- 229950005498 triparanol Drugs 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
- C07D265/32—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings with oxygen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50068925A JPS51146478A (en) | 1975-06-06 | 1975-06-06 | Process for preparing new morpholinone derivatives |
| JP50068926A JPS51146479A (en) | 1975-06-06 | 1975-06-06 | Process for preparing new morpholinone derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1055938A true CA1055938A (en) | 1979-06-05 |
Family
ID=26410108
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA254,156A Expired CA1055938A (en) | 1975-06-06 | 1976-06-04 | Morpholinone derivatives and their production |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4237132A (OSRAM) |
| AR (2) | AR212502A1 (OSRAM) |
| CA (1) | CA1055938A (OSRAM) |
| DE (1) | DE2623275C2 (OSRAM) |
| DK (1) | DK140594B (OSRAM) |
| FR (1) | FR2313067A1 (OSRAM) |
| GB (1) | GB1485607A (OSRAM) |
| NL (1) | NL166472C (OSRAM) |
| SE (1) | SE426820B (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101014595A (zh) * | 2004-08-11 | 2007-08-08 | 杏林制药株式会社 | 新型环状氨基苯甲酸衍生物 |
| EP1862464A4 (en) * | 2005-03-23 | 2010-08-25 | Kyorin Seiyaku Kk | NEW CYCLIC AMINOPHENYL ALKANIC ACID DERIVATIVE |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3073822A (en) * | 1960-05-10 | 1963-01-15 | Gen Aniline & Film Corp | Process of preparing 4-substituted-2-morpholones |
| DE1922003C3 (de) * | 1969-04-30 | 1979-10-11 | Boehringer Mannheim Gmbh, 6800 Mannheim | N-(3-Aryloxy-2-hydroxypropyl)-aminocarbonsäuren, deren Ester, Amide und Salze, Verfahren zur Herstellung dieser Verbindungen und deren Verwendung bei der Bekämpfung von Herzinsuffizienz |
-
1976
- 1976-05-21 GB GB21051/76A patent/GB1485607A/en not_active Expired
- 1976-05-24 DE DE2623275A patent/DE2623275C2/de not_active Expired
- 1976-06-03 SE SE7606282A patent/SE426820B/xx unknown
- 1976-06-04 CA CA254,156A patent/CA1055938A/en not_active Expired
- 1976-06-04 AR AR263519A patent/AR212502A1/es active
- 1976-06-04 US US05/692,879 patent/US4237132A/en not_active Expired - Lifetime
- 1976-06-04 FR FR7617139A patent/FR2313067A1/fr active Granted
- 1976-06-04 DK DK248876AA patent/DK140594B/da unknown
- 1976-06-04 NL NL7606118.A patent/NL166472C/xx not_active IP Right Cessation
- 1976-10-05 AR AR264973A patent/AR213415A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| NL7606118A (nl) | 1976-12-08 |
| DK140594B (da) | 1979-10-08 |
| NL166472B (nl) | 1981-03-16 |
| DE2623275C2 (de) | 1984-02-23 |
| DE2623275A1 (de) | 1976-12-09 |
| SE7606282L (sv) | 1976-12-07 |
| AU1440976A (en) | 1977-07-07 |
| DK140594C (OSRAM) | 1980-02-25 |
| AR212502A1 (es) | 1978-07-31 |
| US4237132A (en) | 1980-12-02 |
| GB1485607A (en) | 1977-09-14 |
| NL166472C (nl) | 1981-08-17 |
| SE426820B (sv) | 1983-02-14 |
| DK248876A (OSRAM) | 1976-12-07 |
| AR213415A1 (es) | 1979-01-31 |
| FR2313067B1 (OSRAM) | 1979-03-02 |
| FR2313067A1 (fr) | 1976-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1202637A (en) | Antifibrinolytically active compounds | |
| Tammara et al. | Morpholinoalkyl ester prodrugs of diclofenac: synthesis, in vitro and in vivo evaluation | |
| US4412998A (en) | Certain 4-(1-piperidino)-phenyl-nicotinates | |
| US4778804A (en) | Nitro aliphatic compounds, process for preparation thereof and use thereof | |
| US4443459A (en) | α-Tocopheryl ester of 5-substituted picolinic acid and hypotensive composition containing it | |
| US4691018A (en) | Pyridine derivatives and their use as anti-allergic agents | |
| DK163580B (da) | Analogifremgangsmaade til fremstilling af cyclohexancarboxylsyrederivater | |
| CA1055938A (en) | Morpholinone derivatives and their production | |
| US4461775A (en) | Hydroxythioether fatty acid derivatives | |
| EP0134337A1 (en) | Substituted 2,2-dimethyl-5-phenoxypentanoic acid benzamides and their production | |
| CA1254214A (en) | Compounds with hypolipemic activity | |
| US5281617A (en) | N-succinimidyl and N-phthalimidyl esters of 2-phenylalkanoic acid derivatives as inhibitors of human leukocyte elastase | |
| CA1216850A (en) | Pyridylalkyl nitrate compound, process for preparation thereof and pharmaceutical composition comprising the same | |
| FR2552433A1 (fr) | Nouveaux derives de 1,3,4-thiadiazole, procede pour leur preparation et leur utilisation comme agents anti-ulcere | |
| CA1247092A (en) | Pyridyl n-oxides | |
| DE4220264A1 (de) | Phenyl-1,2,5-oxadiazol-carbonamid-2-oxide | |
| AU598927B2 (en) | Benzenesulfonamide derivatives and a process for the preparation thereof | |
| US4275068A (en) | Lipid lowering alkylene glycols and ester derivatives thereof | |
| US3979402A (en) | Thiazole derivatives | |
| EA001959B1 (ru) | Новые производные пентаэритрита, их получение и применение , а также промежуточные продукты для их синтеза | |
| US4218475A (en) | Hypolipidemic benzylaminobenzene alkanoic or alkenoic acids | |
| US4092417A (en) | Theophylline salts of 5-methylisoxazole-3-carboxylic acid | |
| US4034045A (en) | 2,4-Disubstituted-4b,5,6,7,8,8a,9,10-octahydro-9-oxo-phenanthrenes | |
| US4183955A (en) | Troponyl-oxamic acid derivatives for treating allergic conditions | |
| US4060617A (en) | Esters of the ophyllinylacetic acid |