CA1052497A - Linear polyesters based on s-triazine-dicarboxylic acids - Google Patents
Linear polyesters based on s-triazine-dicarboxylic acidsInfo
- Publication number
- CA1052497A CA1052497A CA232,369A CA232369A CA1052497A CA 1052497 A CA1052497 A CA 1052497A CA 232369 A CA232369 A CA 232369A CA 1052497 A CA1052497 A CA 1052497A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- radical
- atoms
- denotes
- represent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000728 polyester Polymers 0.000 title claims abstract description 39
- YRRVVVZMCUENFO-UHFFFAOYSA-N 1,3,5-triazine-2,4-dicarboxylic acid Chemical class OC(=O)C1=NC=NC(C(O)=O)=N1 YRRVVVZMCUENFO-UHFFFAOYSA-N 0.000 title claims abstract description 15
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 7
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 7
- 239000003054 catalyst Substances 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 21
- 150000002009 diols Chemical class 0.000 claims description 20
- -1 aliphatic radical Chemical class 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 150000003254 radicals Chemical class 0.000 claims description 14
- 230000008569 process Effects 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001246 bromo group Chemical group Br* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- JOMCLWBPUJDERM-UHFFFAOYSA-N 4,5,6,7-tetrachloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C(Cl)=C2N(CCO)C(=O)N(CCO)C2=C1Cl JOMCLWBPUJDERM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000727 fraction Substances 0.000 claims description 2
- 235000013350 formula milk Nutrition 0.000 claims 26
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims 2
- NRDMXCPJCFIBPA-UHFFFAOYSA-N 3-(2-hydroxyethyl)-1-[[3-(2-hydroxyethyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-5,5-dimethylimidazolidine-2,4-dione Chemical compound O=C1N(CCO)C(=O)C(C)(C)N1CN1C(C)(C)C(=O)N(CCO)C1=O NRDMXCPJCFIBPA-UHFFFAOYSA-N 0.000 claims 1
- XOWRZAOKTWBEQX-UHFFFAOYSA-N ethyl 4-[[4-(diethylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)OCC)=NC(N(CC)CC)=N1 XOWRZAOKTWBEQX-UHFFFAOYSA-N 0.000 claims 1
- 238000000576 coating method Methods 0.000 abstract description 4
- 239000000463 material Substances 0.000 abstract description 4
- 238000001746 injection moulding Methods 0.000 abstract description 3
- 230000000930 thermomechanical effect Effects 0.000 abstract description 3
- 238000005266 casting Methods 0.000 abstract description 2
- 239000011248 coating agent Substances 0.000 abstract description 2
- 229920006351 engineering plastic Polymers 0.000 abstract description 2
- 238000001125 extrusion Methods 0.000 abstract description 2
- 238000007493 shaping process Methods 0.000 abstract description 2
- 239000012815 thermoplastic material Substances 0.000 abstract description 2
- 239000000203 mixture Substances 0.000 description 17
- 238000006068 polycondensation reaction Methods 0.000 description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- 230000009477 glass transition Effects 0.000 description 13
- 229920001634 Copolyester Polymers 0.000 description 11
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000009833 condensation Methods 0.000 description 9
- 230000005494 condensation Effects 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000000306 component Substances 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 4
- 238000005809 transesterification reaction Methods 0.000 description 4
- UARFFANGBYNLQT-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CCO)C(=O)N(CCO)C2=C1 UARFFANGBYNLQT-UHFFFAOYSA-N 0.000 description 3
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 3
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 3
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 3
- 239000001639 calcium acetate Substances 0.000 description 3
- 235000011092 calcium acetate Nutrition 0.000 description 3
- 229960005147 calcium acetate Drugs 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000004246 zinc acetate Substances 0.000 description 3
- WKQKLCTYZKFNTG-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CCO)C(=O)N(CCO)C2=C1Br WKQKLCTYZKFNTG-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical compound C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229920001577 copolymer Chemical class 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- XFFVMMHIMRQJPG-UHFFFAOYSA-N 1-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-5,5-dimethylimidazolidine-2,4-dione Chemical compound O=C1NC(=O)C(C)(C)N1CN1C(C)(C)C(=O)NC1=O XFFVMMHIMRQJPG-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- OMRXVBREYFZQHU-UHFFFAOYSA-N 2,4-dichloro-1,3,5-triazine Chemical compound ClC1=NC=NC(Cl)=N1 OMRXVBREYFZQHU-UHFFFAOYSA-N 0.000 description 1
- PYVLZVPALRXDIK-UHFFFAOYSA-N 3-(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)NC(=O)N(CCO)C1=O PYVLZVPALRXDIK-UHFFFAOYSA-N 0.000 description 1
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 1
- IVUXTERJSYTZQX-UHFFFAOYSA-N 5,6-dibromo-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C=C2N(CCO)C(=O)N(CCO)C2=C1 IVUXTERJSYTZQX-UHFFFAOYSA-N 0.000 description 1
- AHLDKBSLFFPEFT-UHFFFAOYSA-N 5,6-dichloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C=C2N(CCO)C(=O)N(CCO)C2=C1 AHLDKBSLFFPEFT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102100037709 Desmocollin-3 Human genes 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 101000968042 Homo sapiens Desmocollin-2 Proteins 0.000 description 1
- 101000880960 Homo sapiens Desmocollin-3 Proteins 0.000 description 1
- 241000286904 Leptothecata Species 0.000 description 1
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229920006125 amorphous polymer Polymers 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- 229940075103 antimony Drugs 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 150000008641 benzimidazolones Chemical class 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical class OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- JQFGPUPJIJQUGP-UHFFFAOYSA-N ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-(n-phenylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)OCC)=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 JQFGPUPJIJQUGP-UHFFFAOYSA-N 0.000 description 1
- WUHHMSUVJJUIJV-UHFFFAOYSA-N ethyl 4-[[4-(dicyclohexylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)OCC)=NC(N(C2CCCCC2)C2CCCCC2)=N1 WUHHMSUVJJUIJV-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000004660 morphological change Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002480 polybenzimidazole Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002076 thermal analysis method Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000001757 thermogravimetry curve Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/685—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen
- C08G63/6854—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6856—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Paints Or Removers (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1047774A CH598295A5 (enExample) | 1974-07-30 | 1974-07-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1052497A true CA1052497A (en) | 1979-04-10 |
Family
ID=4363652
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA232,369A Expired CA1052497A (en) | 1974-07-30 | 1975-07-28 | Linear polyesters based on s-triazine-dicarboxylic acids |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4034018A (enExample) |
| JP (1) | JPS5137188A (enExample) |
| CA (1) | CA1052497A (enExample) |
| CH (1) | CH598295A5 (enExample) |
| DE (1) | DE2533715A1 (enExample) |
| FR (1) | FR2280668A1 (enExample) |
| GB (1) | GB1483429A (enExample) |
| NL (1) | NL7508796A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4228281A (en) * | 1977-09-23 | 1980-10-14 | Ciba-Geigy Corporation | Dicarboxylic acids containing triazine rings |
| US4157360A (en) * | 1978-04-26 | 1979-06-05 | Allied Chemical Corporation | Thermoformable compositions comprising a crosslinked polycyanurate polymer and a thermoplastic polymer |
| US4281103A (en) * | 1978-09-18 | 1981-07-28 | Ciba-Geigy Corporation | Dicarboxylic acids containing triazine rings, and polyesters formed from these dicarboxylic acids |
| DE3676400D1 (de) * | 1985-09-16 | 1991-02-07 | Ciba Geigy Ag | Verzweigte polyester. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH569747A5 (enExample) * | 1972-08-25 | 1975-11-28 | Ciba Geigy Ag | |
| CH569748A5 (enExample) * | 1972-08-25 | 1975-11-28 | Ciba Geigy Ag |
-
1974
- 1974-07-30 CH CH1047774A patent/CH598295A5/xx not_active IP Right Cessation
-
1975
- 1975-07-21 US US05/597,609 patent/US4034018A/en not_active Expired - Lifetime
- 1975-07-23 NL NL7508796A patent/NL7508796A/xx not_active Application Discontinuation
- 1975-07-23 JP JP50090015A patent/JPS5137188A/ja active Pending
- 1975-07-28 CA CA232,369A patent/CA1052497A/en not_active Expired
- 1975-07-28 DE DE19752533715 patent/DE2533715A1/de not_active Withdrawn
- 1975-07-29 GB GB31775/75A patent/GB1483429A/en not_active Expired
- 1975-07-29 FR FR7523608A patent/FR2280668A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2533715A1 (de) | 1976-02-12 |
| US4034018A (en) | 1977-07-05 |
| FR2280668A1 (fr) | 1976-02-27 |
| GB1483429A (en) | 1977-08-17 |
| NL7508796A (nl) | 1976-02-03 |
| FR2280668B1 (enExample) | 1977-12-09 |
| CH598295A5 (enExample) | 1978-04-28 |
| JPS5137188A (en) | 1976-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3856754A (en) | Linear homopolyesters and copolyesters based on methylene-bis(hydroxyalkyldimethyl hydantoins) | |
| JP3399465B2 (ja) | イソソルビドをコモノマーとして含有させたポリエステルおよびそれの製造方法 | |
| US4259478A (en) | Process for preparing high molecular weight copolyesters | |
| US6297330B1 (en) | Polymerizations based on cyclic oligomer | |
| JP2002512268A (ja) | イソソルビド含有ポリエステルおよびそれの製造方法 | |
| KR970001412A (ko) | 폴리에스테르 및 코폴리에스테르의 제조방법, 당해 방법에 의해 제조된 생성물 및 이의 용도 | |
| US4338422A (en) | Preparation of polyesters and poly(ester-carbonates) by acidolysis of aromatic polycarbonates | |
| US3546320A (en) | Polyalkylene terephthalate molding composition | |
| US4002600A (en) | Linear copolyesters based on terephthalic acid and/or isophthalic acid, a process for their manufacture and their use | |
| US3194794A (en) | Process of preparing polymers of nuclearly polychlorinated aromatic dicarboxylic acids and diamines having at least 4 carbons | |
| US3860564A (en) | Linear homopolyesters and copolyesters based on bis(hydroxyalkyl)benzimidazolones | |
| CA1048688A (en) | Linear copolyesters based on terephthalic acid and/or isophthalic acid | |
| CA1052497A (en) | Linear polyesters based on s-triazine-dicarboxylic acids | |
| CA1046194A (en) | Poly(alkylenetrimellitate imides) and method of preparation | |
| EP0376380A1 (en) | Polymer processeable from the melt | |
| CA1096866A (en) | Dicarboxylic acids containing triazine rings, and polyesters formed from these dicarboxylic acids | |
| CA1078094A (en) | Linear polyesters based on heterocyclic dicarboxylic acids | |
| JPH09510246A (ja) | 再利用ポリエステルのコポリマー | |
| CA1101595A (en) | Thermoplastic polyesters and processes for their manufacture | |
| CA1039442A (en) | Flame-resistant, thermoplastic polyesters | |
| JPS581134B2 (ja) | センジヨウ ネツソセイポリエステルノ セイゾウホウホウ | |
| US4139512A (en) | Copolyesters of triazinedicarboxylic acids | |
| US3994864A (en) | Linear, thermoplastic polyesters | |
| CA1041694A (en) | Linear, thermoplastic polyesters | |
| EP0409334A2 (en) | Anisotropic polymers based on an S-triazine derivative |