CA1049520A - Triazines - Google Patents
TriazinesInfo
- Publication number
- CA1049520A CA1049520A CA237,947A CA237947A CA1049520A CA 1049520 A CA1049520 A CA 1049520A CA 237947 A CA237947 A CA 237947A CA 1049520 A CA1049520 A CA 1049520A
- Authority
- CA
- Canada
- Prior art keywords
- triazine
- bis
- alkyl
- carbons
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003918 triazines Chemical class 0.000 title abstract description 16
- 238000006243 chemical reaction Methods 0.000 claims abstract description 22
- 238000002360 preparation method Methods 0.000 claims abstract description 15
- 230000001413 cellular effect Effects 0.000 claims abstract description 14
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims abstract description 13
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 12
- 150000001718 carbodiimides Chemical class 0.000 claims abstract description 12
- 230000003197 catalytic effect Effects 0.000 claims abstract description 7
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 32
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 14
- 229920001228 polyisocyanate Polymers 0.000 claims description 9
- 239000005056 polyisocyanate Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 4
- 150000002513 isocyanates Chemical class 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 claims description 3
- 238000005829 trimerization reaction Methods 0.000 claims description 2
- VNUBUXIOHVTORJ-UHFFFAOYSA-N 2-[[4,6-bis(dibutylamino)-1,3,5-triazin-2-yl]-[3-(dimethylamino)propyl]amino]ethanol Chemical compound CCCCN(CCCC)C1=NC(N(CCO)CCCN(C)C)=NC(N(CCCC)CCCC)=N1 VNUBUXIOHVTORJ-UHFFFAOYSA-N 0.000 claims 2
- ROCGXVAMDKDXGX-UHFFFAOYSA-N 2-[[4,6-bis[2-(diethylamino)ethyl-methylamino]-1,3,5-triazin-2-yl]-methylamino]ethanol Chemical compound CCN(CC)CCN(C)C1=NC(N(C)CCO)=NC(N(C)CCN(CC)CC)=N1 ROCGXVAMDKDXGX-UHFFFAOYSA-N 0.000 claims 2
- ZRQGBVNWXBMGIJ-UHFFFAOYSA-N 2-[[4,6-bis[3-(dimethylamino)propyl-(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]-[3-(dimethylamino)propyl]amino]ethanol Chemical compound CN(C)CCCN(CCO)C1=NC(N(CCO)CCCN(C)C)=NC(N(CCO)CCCN(C)C)=N1 ZRQGBVNWXBMGIJ-UHFFFAOYSA-N 0.000 claims 2
- KOVUSGFXCZTDLS-UHFFFAOYSA-N 2-[[4,6-bis[bis[3-(dimethylamino)propyl]amino]-1,3,5-triazin-2-yl]-methylamino]ethanol Chemical compound CN(C)CCCN(CCCN(C)C)C1=NC(N(C)CCO)=NC(N(CCCN(C)C)CCCN(C)C)=N1 KOVUSGFXCZTDLS-UHFFFAOYSA-N 0.000 claims 2
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 claims 1
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims 1
- 150000001350 alkyl halides Chemical class 0.000 abstract description 10
- 239000006260 foam Substances 0.000 abstract description 8
- -1 dialkylaminoalkyl primary amines Chemical class 0.000 abstract description 6
- 125000001302 tertiary amino group Chemical group 0.000 abstract 1
- 239000000047 product Substances 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000543 intermediate Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 8
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 150000003335 secondary amines Chemical class 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000013019 agitation Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 3
- 229940117927 ethylene oxide Drugs 0.000 description 3
- BXYVQNNEFZOBOZ-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]-n',n'-dimethylpropane-1,3-diamine Chemical compound CN(C)CCCNCCCN(C)C BXYVQNNEFZOBOZ-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 125000006308 propyl amino group Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229940006116 lithium hydroxide Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- OYWRDHBGMCXGFY-UHFFFAOYSA-N 1,2,3-triazinane Chemical compound C1CNNNC1 OYWRDHBGMCXGFY-UHFFFAOYSA-N 0.000 description 1
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- FJSRPVWDOJSWBX-UHFFFAOYSA-N 1-chloro-4-[1-(4-chlorophenyl)-2,2,2-trifluoroethyl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C(F)(F)F)C1=CC=C(Cl)C=C1 FJSRPVWDOJSWBX-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- DTZQQHRKVWXQPP-UHFFFAOYSA-N 2-[3-(dimethylamino)propylamino]ethanol Chemical compound CN(C)CCCNCCO DTZQQHRKVWXQPP-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- VVISQEKWYPFFLK-UHFFFAOYSA-N 2-n,2-n,4-n,4-n-tetrabutyl-6-chloro-1,3,5-triazine-2,4-diamine Chemical compound CCCCN(CCCC)C1=NC(Cl)=NC(N(CCCC)CCCC)=N1 VVISQEKWYPFFLK-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- LJQNMDZRCXJETK-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine;hydron;chloride Chemical compound Cl.CN(C)CCCCl LJQNMDZRCXJETK-UHFFFAOYSA-N 0.000 description 1
- KFRBIVZBTMTQSF-UHFFFAOYSA-N 3-chloro-n-ethylpropan-1-amine Chemical compound CCNCCCCl KFRBIVZBTMTQSF-UHFFFAOYSA-N 0.000 description 1
- 229940105325 3-dimethylaminopropylamine Drugs 0.000 description 1
- 101150058765 BACE1 gene Proteins 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 101100536883 Legionella pneumophila subsp. pneumophila (strain Philadelphia 1 / ATCC 33152 / DSM 7513) thi5 gene Proteins 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 101100240664 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nmt1 gene Proteins 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- UHHKSVZZTYJVEG-UHFFFAOYSA-N oxepane Chemical class C1CCCOCC1 UHHKSVZZTYJVEG-UHFFFAOYSA-N 0.000 description 1
- BOWDPJFAGBREQM-UHFFFAOYSA-N pent-1-ene;pent-2-ene Chemical compound CCCC=C.CCC=CC BOWDPJFAGBREQM-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- HQUQLFOMPYWACS-UHFFFAOYSA-N tris(2-chloroethyl) phosphate Chemical compound ClCCOP(=O)(OCCCl)OCCCl HQUQLFOMPYWACS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/70—Other substituted melamines
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S521/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S521/901—Cellular polymer containing a carbodiimide structure
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/534,436 US3988337A (en) | 1974-12-19 | 1974-12-19 | Substituted triamino-s-triazines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1049520A true CA1049520A (en) | 1979-02-27 |
Family
ID=24130021
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA237,947A Expired CA1049520A (en) | 1974-12-19 | 1975-10-20 | Triazines |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3988337A (show.php) |
| JP (1) | JPS5180878A (show.php) |
| AU (1) | AU497804B2 (show.php) |
| BE (1) | BE835894A (show.php) |
| CA (1) | CA1049520A (show.php) |
| DE (1) | DE2553137A1 (show.php) |
| FR (1) | FR2295031A1 (show.php) |
| GB (1) | GB1516335A (show.php) |
| IT (1) | IT1052393B (show.php) |
| NL (1) | NL7513602A (show.php) |
| ZA (1) | ZA756609B (show.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2716946C2 (de) * | 1977-04-16 | 1986-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von monohydroxyalkylierten Aminen |
| DE3173973D1 (en) * | 1980-08-04 | 1986-04-10 | Matsushita Electric Industrial Co Ltd | Picture image display apparatus |
| US4417184A (en) * | 1980-08-04 | 1983-11-22 | Matsushita Electric Industrial Co., Ltd. | Picture image display apparatus |
| US4356304A (en) * | 1980-11-10 | 1982-10-26 | American Cyanamid Company | Synthesis of oxyalkylated polyamino-1,3,5-triazines |
| DE3135065A1 (de) * | 1981-09-04 | 1983-03-24 | Ruhrchemie Ag, 4200 Oberhausen | N,n,n'-trimethyl-n'-2-hydroxyethyl-propylendiamin, verfahren zu seiner herstellung, polyurethane, die 0,01 bis 5 gew.-% n,n,n'-trimethyl-n'-2-hydroxyethyl-propylendiamin enthalten und seine verwendung als katalysator |
| DE3401675A1 (de) * | 1984-01-19 | 1985-07-25 | Bayer Ag, 5090 Leverkusen | Neue polyamine und ein verfahren zu ihrer herstellung |
| DE3643239C2 (show.php) * | 1985-03-29 | 1990-12-20 | ||
| US5395859A (en) * | 1991-06-21 | 1995-03-07 | Alliedsignal Inc. | Catalysts which stabilize hydrohalocarbon blowing agent in polyisocyanurate foam formulations during polymerization |
| SG11202005468YA (en) | 2017-12-20 | 2020-07-29 | Basf Se | Process for the generation of metal-containing films |
| CN113398973A (zh) * | 2021-06-22 | 2021-09-17 | 北京理工大学 | 一种石墨相氮化碳纳米片及其制备方法与应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3143548A (en) * | 1960-02-19 | 1964-08-04 | Sidney L Vail | Nu, nu'-dimethyl-nu'', nu''-bis (2-hydroxyethyl) melamine |
| DE1620178A1 (de) * | 1965-12-03 | 1970-03-12 | Ruhrchemie Ag | Verfahren zur Herstellung von Aminoalkylamino-s-triazinen |
| JPS4939270A (show.php) * | 1972-08-23 | 1974-04-12 | ||
| US3882118A (en) * | 1972-12-29 | 1975-05-06 | Basf Wyandotte Corp | Process for the preparation of unsymmetrically-substituted alkanolamino-s-triazines |
-
1974
- 1974-12-19 US US05/534,436 patent/US3988337A/en not_active Expired - Lifetime
-
1975
- 1975-10-20 ZA ZA00756609A patent/ZA756609B/xx unknown
- 1975-10-20 GB GB43013/75A patent/GB1516335A/en not_active Expired
- 1975-10-20 CA CA237,947A patent/CA1049520A/en not_active Expired
- 1975-11-04 AU AU86302/75A patent/AU497804B2/en not_active Expired
- 1975-11-20 NL NL7513602A patent/NL7513602A/xx not_active Application Discontinuation
- 1975-11-21 JP JP50139364A patent/JPS5180878A/ja active Pending
- 1975-11-24 DE DE19752553137 patent/DE2553137A1/de active Pending
- 1975-11-25 BE BE1007027A patent/BE835894A/xx unknown
- 1975-11-25 IT IT52378/75A patent/IT1052393B/it active
- 1975-11-26 FR FR7536206A patent/FR2295031A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US3988337A (en) | 1976-10-26 |
| JPS5180878A (show.php) | 1976-07-15 |
| AU497804B2 (en) | 1979-01-11 |
| GB1516335A (en) | 1978-07-05 |
| ZA756609B (en) | 1976-09-29 |
| DE2553137A1 (de) | 1976-07-01 |
| IT1052393B (it) | 1981-06-20 |
| BE835894A (fr) | 1976-05-25 |
| NL7513602A (nl) | 1976-06-22 |
| AU8630275A (en) | 1977-05-12 |
| FR2295031A1 (fr) | 1976-07-16 |
| FR2295031B1 (show.php) | 1978-09-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1049520A (en) | Triazines | |
| EP0114970B1 (en) | Improved process for the preparation of polymethylene polyphenyl polyisocyanates | |
| US2993870A (en) | Process of trimerizing organic isocyanates | |
| ATE31409T1 (de) | Verfahren zur herstellung von stabilisierten polyisocyanaten, stabilisierte polyisocyanate retardierter reaktivitaet und ihre verwendung zur polyurethanherstellung. | |
| US3399151A (en) | Polyurethane foam prepared from an oxyalkylated polyamino-1, 3, 5-triazine-organic polyisocyanate reaction product | |
| US3110732A (en) | Method for preparing basic polyether compositions | |
| US3884917A (en) | Tertiary amines | |
| EP0070573A1 (en) | Flame retardant polyurethane containing alkyl bis(3-hydroxypropyl)phosphine oxide | |
| US2675382A (en) | Aminoalkydhexahydbo- | |
| US3256281A (en) | Alkoxylated mixtures of di- and triamino-1, 3, 5-triazine-polyols and a process for their production | |
| US3668154A (en) | Phosphorus-containing polyols and polyurethanes embodying same | |
| US4054546A (en) | Triazine compositions and their use as catalysts | |
| US3282978A (en) | Process for preparing s-(2-hydroxyl) esters | |
| DE2754011A1 (de) | Verfahren zur herstellung von carbodiimid- und isocyanuratgruppen enthaltenden schaumstoffen | |
| US4356304A (en) | Synthesis of oxyalkylated polyamino-1,3,5-triazines | |
| CA1152071A (en) | Synthesis of oxyalkylated polyamino-1,3,5-triazines | |
| US3265694A (en) | Oxyalkylated isocyanuric acid | |
| US3271411A (en) | Process for cooxyalkylation of cyanoguanidine and a polyfunctional polyol and compositions produced thereby | |
| US3330830A (en) | Process improvement in amino-triazine production and oxyalkylation | |
| US3262941A (en) | Process for the oxyalkylation of cyanoguanidine | |
| US3879501A (en) | Process for preparing phosphorus-containing polyols | |
| US4394330A (en) | Phosphonate derivatives of polyalkylene polyamines as flame retardants | |
| US4544506A (en) | Quaternary ammonium compounds and method for their manufacture | |
| US3558622A (en) | Process for the production of 2,4-diamino-6-alkylthio-s-triazine | |
| US3288733A (en) | Polyurethanes prepared from oxyalkylated cyanoguanidine |