CA1048688A - Linear copolyesters based on terephthalic acid and/or isophthalic acid - Google Patents
Linear copolyesters based on terephthalic acid and/or isophthalic acidInfo
- Publication number
- CA1048688A CA1048688A CA75232357A CA232357A CA1048688A CA 1048688 A CA1048688 A CA 1048688A CA 75232357 A CA75232357 A CA 75232357A CA 232357 A CA232357 A CA 232357A CA 1048688 A CA1048688 A CA 1048688A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- atoms
- denotes
- mol
- triazine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001634 Copolyester Polymers 0.000 title claims abstract description 44
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims abstract description 20
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 title claims abstract description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 14
- YRRVVVZMCUENFO-UHFFFAOYSA-N 1,3,5-triazine-2,4-dicarboxylic acid Chemical compound OC(=O)C1=NC=NC(C(O)=O)=N1 YRRVVVZMCUENFO-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229920006344 thermoplastic copolyester Polymers 0.000 claims abstract description 4
- 235000013350 formula milk Nutrition 0.000 claims description 45
- 238000000034 method Methods 0.000 claims description 35
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 34
- 239000003054 catalyst Substances 0.000 claims description 29
- -1 aliphatic radical Chemical class 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- JQFGPUPJIJQUGP-UHFFFAOYSA-N ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-(n-phenylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)OCC)=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 JQFGPUPJIJQUGP-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- JKVDEDJXZDILBN-UHFFFAOYSA-N 6-[[4-(5-carboxypentylamino)-6-(N-phenylanilino)-1,3,5-triazin-2-yl]amino]hexanoic acid Chemical compound OC(=O)CCCCCNC1=NC(NCCCCCC(O)=O)=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 JKVDEDJXZDILBN-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- CZRBJACESSICCS-UHFFFAOYSA-N methyl 4-[[4-(diethylamino)-6-(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound N=1C(NC=2C=CC(=CC=2)C(=O)OC)=NC(N(CC)CC)=NC=1NC1=CC=C(C(=O)OC)C=C1 CZRBJACESSICCS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 3
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 3
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 claims 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 claims 1
- WUHHMSUVJJUIJV-UHFFFAOYSA-N ethyl 4-[[4-(dicyclohexylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)OCC)=NC(N(C2CCCCC2)C2CCCCC2)=N1 WUHHMSUVJJUIJV-UHFFFAOYSA-N 0.000 claims 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 claims 1
- 239000000463 material Substances 0.000 abstract description 7
- 238000000576 coating method Methods 0.000 abstract description 4
- 238000001746 injection moulding Methods 0.000 abstract description 4
- 229920006351 engineering plastic Polymers 0.000 abstract description 3
- 238000001125 extrusion Methods 0.000 abstract description 3
- 230000000930 thermomechanical effect Effects 0.000 abstract description 3
- UARFFANGBYNLQT-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CCO)C(=O)N(CCO)C2=C1 UARFFANGBYNLQT-UHFFFAOYSA-N 0.000 abstract description 2
- 238000005266 casting Methods 0.000 abstract description 2
- 239000011248 coating agent Substances 0.000 abstract description 2
- 238000007493 shaping process Methods 0.000 abstract description 2
- 229920001169 thermoplastic Polymers 0.000 abstract description 2
- 239000004416 thermosoftening plastic Substances 0.000 abstract description 2
- JEBCMUZICWMOMY-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)imidazolidine-2,4-dione Chemical compound OCCN1CC(=O)N(CCO)C1=O JEBCMUZICWMOMY-UHFFFAOYSA-N 0.000 abstract 1
- 229940091173 hydantoin Drugs 0.000 abstract 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 25
- 230000009477 glass transition Effects 0.000 description 19
- 229920001707 polybutylene terephthalate Polymers 0.000 description 16
- 238000003756 stirring Methods 0.000 description 15
- 238000006068 polycondensation reaction Methods 0.000 description 14
- 229920000728 polyester Polymers 0.000 description 13
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 10
- 238000009833 condensation Methods 0.000 description 10
- 230000005494 condensation Effects 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- 239000005020 polyethylene terephthalate Substances 0.000 description 8
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 7
- 239000001639 calcium acetate Substances 0.000 description 7
- 235000011092 calcium acetate Nutrition 0.000 description 7
- 229960005147 calcium acetate Drugs 0.000 description 7
- 229920000139 polyethylene terephthalate Polymers 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 238000005809 transesterification reaction Methods 0.000 description 7
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000004246 zinc acetate Substances 0.000 description 6
- 239000008187 granular material Substances 0.000 description 5
- VRDCRJDCTHRDCI-UHFFFAOYSA-N 4-[[4-(4-carboxyanilino)-6-(diethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid Chemical compound N=1C(NC=2C=CC(=CC=2)C(O)=O)=NC(N(CC)CC)=NC=1NC1=CC=C(C(O)=O)C=C1 VRDCRJDCTHRDCI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 3
- VBGJKRHYRCISAH-UHFFFAOYSA-N 4-[[4-(4-carboxyanilino)-6-(n-phenylanilino)-1,3,5-triazin-2-yl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(O)=O)=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 VBGJKRHYRCISAH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 description 3
- 229940071125 manganese acetate Drugs 0.000 description 3
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052787 antimony Inorganic materials 0.000 description 2
- 229940075103 antimony Drugs 0.000 description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 2
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical compound C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 description 2
- 150000008641 benzimidazolones Chemical class 0.000 description 2
- 229940074995 bromine Drugs 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- XOWRZAOKTWBEQX-UHFFFAOYSA-N ethyl 4-[[4-(diethylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)OCC)=NC(N(CC)CC)=N1 XOWRZAOKTWBEQX-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001757 thermogravimetry curve Methods 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ATIAIEWDRRJGSL-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(CCO)C(=O)N(CCO)C1=O ATIAIEWDRRJGSL-UHFFFAOYSA-N 0.000 description 1
- XFFVMMHIMRQJPG-UHFFFAOYSA-N 1-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-5,5-dimethylimidazolidine-2,4-dione Chemical compound O=C1NC(=O)C(C)(C)N1CN1C(C)(C)C(=O)NC1=O XFFVMMHIMRQJPG-UHFFFAOYSA-N 0.000 description 1
- OMRXVBREYFZQHU-UHFFFAOYSA-N 2,4-dichloro-1,3,5-triazine Chemical compound ClC1=NC=NC(Cl)=N1 OMRXVBREYFZQHU-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- LFRBMLUBOIUCOA-UHFFFAOYSA-N 4,5,6,7-tetrabromobenzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=NC(=O)N=C21 LFRBMLUBOIUCOA-UHFFFAOYSA-N 0.000 description 1
- JOMCLWBPUJDERM-UHFFFAOYSA-N 4,5,6,7-tetrachloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C(Cl)=C2N(CCO)C(=O)N(CCO)C2=C1Cl JOMCLWBPUJDERM-UHFFFAOYSA-N 0.000 description 1
- LJJLNIIWZTWCKL-UHFFFAOYSA-N 4,5-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound OCCC1=C(C=2C(=NC(N2)=O)C=C1)CCO LJJLNIIWZTWCKL-UHFFFAOYSA-N 0.000 description 1
- VYLNEPJXMCFMAS-UHFFFAOYSA-N 4-[[4-(4-carboxyanilino)-1,3,5-triazin-2-yl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC1=NC=NC(NC=2C=CC(=CC=2)C(O)=O)=N1 VYLNEPJXMCFMAS-UHFFFAOYSA-N 0.000 description 1
- VIKVFVYZVSIBSS-UHFFFAOYSA-N 5,6-dibromo-4,7-dichloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Cl)=C2N(CCO)C(=O)N(CCO)C2=C1Cl VIKVFVYZVSIBSS-UHFFFAOYSA-N 0.000 description 1
- DVVKNTAJNFQTTK-UHFFFAOYSA-N 5,6-dibromobenzimidazol-2-one Chemical compound BrC1=CC=2C(=NC(N2)=O)C=C1Br DVVKNTAJNFQTTK-UHFFFAOYSA-N 0.000 description 1
- IIRNEOAVAYRZQH-UHFFFAOYSA-N 5,6-dichlorobenzimidazol-2-one Chemical compound C1=C(Cl)C(Cl)=CC2=NC(=O)N=C21 IIRNEOAVAYRZQH-UHFFFAOYSA-N 0.000 description 1
- 241001279686 Allium moly Species 0.000 description 1
- 229920008790 Amorphous Polyethylene terephthalate Polymers 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920008651 Crystalline Polyethylene terephthalate Polymers 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940052651 anticholinergic tertiary amines Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- YAJKDIAFXCMNBC-UHFFFAOYSA-N ethyl 4-(1,3,5-triazin-2-ylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NC2=NC=NC=N2)C=C1 YAJKDIAFXCMNBC-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- JYVWXXDFSCSFPF-UHFFFAOYSA-N methyl 4-[[4-(4-methoxycarbonylanilino)-4-(n-phenylanilino)-1h-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(N=CN1)=NC1(N(C=1C=CC=CC=1)C=1C=CC=CC=1)NC1=CC=C(C(=O)OC)C=C1 JYVWXXDFSCSFPF-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004660 morphological change Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002480 polybenzimidazole Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002076 thermal analysis method Methods 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/685—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen
- C08G63/6854—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6856—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1047674A CH597274A5 (https=) | 1974-07-30 | 1974-07-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1048688A true CA1048688A (en) | 1979-02-13 |
Family
ID=4363640
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA75232357A Expired CA1048688A (en) | 1974-07-30 | 1975-07-28 | Linear copolyesters based on terephthalic acid and/or isophthalic acid |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4034019A (https=) |
| JP (1) | JPS5845451B2 (https=) |
| CA (1) | CA1048688A (https=) |
| CH (1) | CH597274A5 (https=) |
| DE (1) | DE2533675A1 (https=) |
| FR (1) | FR2280667A1 (https=) |
| GB (1) | GB1500565A (https=) |
| NL (1) | NL7509088A (https=) |
| SU (1) | SU625619A3 (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4228281A (en) * | 1977-09-23 | 1980-10-14 | Ciba-Geigy Corporation | Dicarboxylic acids containing triazine rings |
| US4281103A (en) * | 1978-09-18 | 1981-07-28 | Ciba-Geigy Corporation | Dicarboxylic acids containing triazine rings, and polyesters formed from these dicarboxylic acids |
| CH635814A5 (de) * | 1978-09-29 | 1983-04-29 | Ciba Geigy Ag | Umesterungsverfahren. |
| AU5464599A (en) * | 1998-08-06 | 2000-02-28 | Sig Combibloc Inc. | Containers prepared from laminate structures having a foamed polymer layer |
| EP1655303B1 (en) | 2000-05-19 | 2011-02-23 | Basf Se | Process for the Controlled Increase in Molecular Weight of Polyethylene or Polyethylene Blends |
| MY145571A (en) | 2003-12-19 | 2012-02-29 | Ciba Holding Inc | Fluorocarbon terminated oligo-and poly-carbonates as surface modifiers |
| US7579428B2 (en) * | 2006-08-16 | 2009-08-25 | Eastman Chemical Company | Process for preparation of polyesters without solid state polymerization |
| CN114989406B (zh) * | 2022-07-11 | 2024-01-12 | 青岛大学 | 一种非金属有机化合物在dmt法合成聚酯中的应用、dmt法功能共聚酯及其制法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH569747A5 (https=) * | 1972-08-25 | 1975-11-28 | Ciba Geigy Ag | |
| CH569748A5 (https=) * | 1972-08-25 | 1975-11-28 | Ciba Geigy Ag |
-
1974
- 1974-07-30 CH CH1047674A patent/CH597274A5/xx not_active IP Right Cessation
-
1975
- 1975-07-21 US US05/597,610 patent/US4034019A/en not_active Expired - Lifetime
- 1975-07-24 SU SU752159080A patent/SU625619A3/ru active
- 1975-07-28 DE DE19752533675 patent/DE2533675A1/de not_active Withdrawn
- 1975-07-28 CA CA75232357A patent/CA1048688A/en not_active Expired
- 1975-07-29 FR FR7523607A patent/FR2280667A1/fr active Granted
- 1975-07-29 GB GB31774/75A patent/GB1500565A/en not_active Expired
- 1975-07-30 JP JP50092988A patent/JPS5845451B2/ja not_active Expired
- 1975-07-30 NL NL7509088A patent/NL7509088A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| US4034019A (en) | 1977-07-05 |
| DE2533675A1 (de) | 1976-02-19 |
| FR2280667A1 (fr) | 1976-02-27 |
| GB1500565A (en) | 1978-02-08 |
| NL7509088A (nl) | 1976-02-03 |
| SU625619A3 (ru) | 1978-09-25 |
| FR2280667B1 (https=) | 1977-12-09 |
| JPS5845451B2 (ja) | 1983-10-11 |
| JPS5137992A (en) | 1976-03-30 |
| CH597274A5 (https=) | 1978-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3856754A (en) | Linear homopolyesters and copolyesters based on methylene-bis(hydroxyalkyldimethyl hydantoins) | |
| US2945008A (en) | Condensation polymers derived from spiroglycols | |
| US3008934A (en) | Filament and film forming interpolyesters of bibenzoic acid, certain aromatic acids and a dihydric alcohol | |
| US3546320A (en) | Polyalkylene terephthalate molding composition | |
| US4390687A (en) | High melt strength elastometric copolyesters | |
| EP1414884A1 (en) | Sulfonated aliphatic-aromatic copolyesters | |
| US4002600A (en) | Linear copolyesters based on terephthalic acid and/or isophthalic acid, a process for their manufacture and their use | |
| GB2109804A (en) | Modified polyethylene terephthalate molding material | |
| CA1048688A (en) | Linear copolyesters based on terephthalic acid and/or isophthalic acid | |
| US3194794A (en) | Process of preparing polymers of nuclearly polychlorinated aromatic dicarboxylic acids and diamines having at least 4 carbons | |
| US3860564A (en) | Linear homopolyesters and copolyesters based on bis(hydroxyalkyl)benzimidazolones | |
| US4223106A (en) | Block copolyesters which crystallize rapidly | |
| US3053810A (en) | Process for the production of | |
| US4034018A (en) | Linear polyesters based on s-triazinedicarboxylic acids | |
| CA1078094A (en) | Linear polyesters based on heterocyclic dicarboxylic acids | |
| US3008929A (en) | Interpolyesters of bibenzoic acid | |
| JP3365450B2 (ja) | 高重合度ポリエステルの製造方法 | |
| CA1101595A (en) | Thermoplastic polyesters and processes for their manufacture | |
| WO1996029357A1 (en) | Use of 1,3,5-triazines which are substituted in the 2-, 4- and 6-position or tautomers thereof for controlling the crystallization of linear polyesters and/or polyester polyols and method for the preparation thereof | |
| US4254243A (en) | Halogen containing copolyester resins | |
| EP0119731B1 (en) | Copolyester of polyethylene terephthalate, process for making it and its use in producing molded articles | |
| US4139512A (en) | Copolyesters of triazinedicarboxylic acids | |
| US4547563A (en) | Copolyester of polyethylene terephthalate and bis (4-beta hydroxy ethoxy phenyl) sulfone | |
| US2852492A (en) | Nu, nu'-bis (p-carboalkoxybenzoyl) piperazines and polyesters therefrom | |
| US4145335A (en) | Thermoplastic copolyesters based on poly-1,4-butylene terephthalate |