CA1048541A - Purification of chlorobutyronitrile - Google Patents
Purification of chlorobutyronitrileInfo
- Publication number
- CA1048541A CA1048541A CA76249559A CA249559A CA1048541A CA 1048541 A CA1048541 A CA 1048541A CA 76249559 A CA76249559 A CA 76249559A CA 249559 A CA249559 A CA 249559A CA 1048541 A CA1048541 A CA 1048541A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- chlorobutyronitrile
- reaction
- carbon atoms
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WTDNWEITCUMXGW-UHFFFAOYSA-N 2-chlorobutanenitrile Chemical compound CCC(Cl)C#N WTDNWEITCUMXGW-UHFFFAOYSA-N 0.000 title claims abstract description 49
- 238000000746 purification Methods 0.000 title abstract description 7
- 239000003054 catalyst Substances 0.000 claims abstract description 67
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- -1 Chloro alkyl nitriles Chemical class 0.000 claims abstract description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 21
- 239000012074 organic phase Substances 0.000 claims abstract description 19
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 15
- 239000008346 aqueous phase Substances 0.000 claims abstract description 14
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 12
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 9
- 239000012071 phase Substances 0.000 claims abstract description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims abstract description 8
- 239000000460 chlorine Substances 0.000 claims abstract description 7
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 7
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims abstract description 7
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000001450 anions Chemical class 0.000 claims abstract description 4
- IPILPUZVTYHGIL-UHFFFAOYSA-M tributyl(methyl)azanium;chloride Chemical compound [Cl-].CCCC[N+](C)(CCCC)CCCC IPILPUZVTYHGIL-UHFFFAOYSA-M 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 25
- 230000008569 process Effects 0.000 claims description 22
- 239000000047 product Substances 0.000 claims description 18
- CIBGXJVJPZCMFX-UHFFFAOYSA-N 2-bromobutanenitrile Chemical compound CCC(Br)C#N CIBGXJVJPZCMFX-UHFFFAOYSA-N 0.000 claims description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 12
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims description 12
- 238000005406 washing Methods 0.000 claims description 9
- 239000006227 byproduct Substances 0.000 claims description 7
- 239000011780 sodium chloride Substances 0.000 claims description 6
- 229910001513 alkali metal bromide Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 239000012535 impurity Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 abstract description 38
- 150000003841 chloride salts Chemical class 0.000 abstract description 9
- 239000000356 contaminant Substances 0.000 abstract description 9
- 238000004821 distillation Methods 0.000 abstract description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract description 4
- 150000002500 ions Chemical class 0.000 abstract description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 abstract description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 abstract 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 18
- 229910052751 metal Inorganic materials 0.000 description 12
- 239000002184 metal Substances 0.000 description 12
- 239000000376 reactant Substances 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 229910052799 carbon Chemical group 0.000 description 4
- AUQDITHEDVOTCU-UHFFFAOYSA-N cyclopropyl cyanide Chemical class N#CC1CC1 AUQDITHEDVOTCU-UHFFFAOYSA-N 0.000 description 4
- ZTOMUSMDRMJOTH-UHFFFAOYSA-N glutaronitrile Chemical compound N#CCCCC#N ZTOMUSMDRMJOTH-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000011084 recovery Methods 0.000 description 4
- 239000012266 salt solution Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910001617 alkaline earth metal chloride Inorganic materials 0.000 description 3
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- ATWLRNODAYAMQS-UHFFFAOYSA-N 1,1-dibromopropane Chemical compound CCC(Br)Br ATWLRNODAYAMQS-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 150000003842 bromide salts Chemical class 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 230000002596 correlated effect Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical class CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- DXJLCRNXYNRGRA-UHFFFAOYSA-M tributyl(methyl)azanium;iodide Chemical compound [I-].CCCC[N+](C)(CCCC)CCCC DXJLCRNXYNRGRA-UHFFFAOYSA-M 0.000 description 2
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- CLKQSFUXJOIFAC-UHFFFAOYSA-N 1-bromo-2-(chloromethyl)butane Chemical compound CCC(CCl)CBr CLKQSFUXJOIFAC-UHFFFAOYSA-N 0.000 description 1
- ZKDOQFPDSUOLGF-UHFFFAOYSA-N 1-bromo-3-chloro-2-methylpropane Chemical compound ClCC(C)CBr ZKDOQFPDSUOLGF-UHFFFAOYSA-N 0.000 description 1
- KRLHLXMRZCVRFA-UHFFFAOYSA-N 1-bromo-3-chlorohexane Chemical compound CCCC(Cl)CCBr KRLHLXMRZCVRFA-UHFFFAOYSA-N 0.000 description 1
- PHAOTASRLQMKBE-UHFFFAOYSA-N 2-[4,5,6,7-tetrabromo-2-(dimethylamino)benzimidazol-1-yl]acetic acid Chemical compound BrC1=C(Br)C(Br)=C2N(CC(O)=O)C(N(C)C)=NC2=C1Br PHAOTASRLQMKBE-UHFFFAOYSA-N 0.000 description 1
- YAYWMBSBTYARQJ-UHFFFAOYSA-N 2-bromo-4-chlorohexane Chemical compound CCC(Cl)CC(C)Br YAYWMBSBTYARQJ-UHFFFAOYSA-N 0.000 description 1
- ZFCFBWSVQWGOJJ-UHFFFAOYSA-N 4-chlorobutanenitrile Chemical class ClCCCC#N ZFCFBWSVQWGOJJ-UHFFFAOYSA-N 0.000 description 1
- DREFQIAOGWZJJF-UHFFFAOYSA-L 5-butylnonan-5-yl(dichloro)bismuthane Chemical compound C(CCC)C([Bi](Cl)Cl)(CCCC)CCCC DREFQIAOGWZJJF-UHFFFAOYSA-L 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RUPBZQFQVRMKDG-UHFFFAOYSA-M Didecyldimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC RUPBZQFQVRMKDG-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QSKBBWFEQHKRFS-UHFFFAOYSA-M butyl(tripropyl)azanium;chloride Chemical compound [Cl-].CCCC[N+](CCC)(CCC)CCC QSKBBWFEQHKRFS-UHFFFAOYSA-M 0.000 description 1
- UDFFPWUKZUUZFV-UHFFFAOYSA-M butyl(tripropyl)azanium;iodide Chemical compound [I-].CCCC[N+](CCC)(CCC)CCC UDFFPWUKZUUZFV-UHFFFAOYSA-M 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- USJRLGNYCQWLPF-UHFFFAOYSA-N chlorophosphane Chemical compound ClP USJRLGNYCQWLPF-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 229960004670 didecyldimethylammonium chloride Drugs 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- UTANKHMLGDZXFS-UHFFFAOYSA-M hexyl(tripropyl)azanium;bromide Chemical compound [Br-].CCCCCC[N+](CCC)(CCC)CCC UTANKHMLGDZXFS-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MHQIMVYNMHGQSF-UHFFFAOYSA-N methylphosphanium;bromide Chemical compound [Br-].[PH3+]C MHQIMVYNMHGQSF-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- LMAZKPOSWVOFGY-FBAUPLQOSA-N orine Natural products CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C)[C@H]4C[C@@H](OC(=O)C=Cc5ccccc5)[C@]6(C)[C@@](O)(CC[C@]6(O)[C@]4(O)CC=C3C2)[C@H](C)OC(=O)C=Cc7ccccc7)O[C@H](C)[C@H]1O LMAZKPOSWVOFGY-FBAUPLQOSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- SWPCZDMVJZKIGT-UHFFFAOYSA-M pentyl(tripropyl)azanium;bromide Chemical compound [Br-].CCCCC[N+](CCC)(CCC)CCC SWPCZDMVJZKIGT-UHFFFAOYSA-M 0.000 description 1
- LJESRGYPQNIGHS-UHFFFAOYSA-M pentyl(tripropyl)azanium;chloride Chemical compound [Cl-].CCCCC[N+](CCC)(CCC)CCC LJESRGYPQNIGHS-UHFFFAOYSA-M 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NEZSMXUEXWCBQN-UHFFFAOYSA-M phenyl(tripropyl)azanium;chloride Chemical compound [Cl-].CCC[N+](CCC)(CCC)C1=CC=CC=C1 NEZSMXUEXWCBQN-UHFFFAOYSA-M 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- QTNZUCWMRAIYCB-UHFFFAOYSA-M tributyl(ethyl)azanium;bromide Chemical compound [Br-].CCCC[N+](CC)(CCCC)CCCC QTNZUCWMRAIYCB-UHFFFAOYSA-M 0.000 description 1
- IPOQVGGURGUZNU-UHFFFAOYSA-M tributyl(ethyl)azanium;chloride Chemical compound [Cl-].CCCC[N+](CC)(CCCC)CCCC IPOQVGGURGUZNU-UHFFFAOYSA-M 0.000 description 1
- INTYQVPAIRRSRH-UHFFFAOYSA-M tributyl(ethyl)azanium;iodide Chemical compound [I-].CCCC[N+](CC)(CCCC)CCCC INTYQVPAIRRSRH-UHFFFAOYSA-M 0.000 description 1
- HJHUXWBTVVFLQI-UHFFFAOYSA-N tributyl(methyl)azanium Chemical compound CCCC[N+](C)(CCCC)CCCC HJHUXWBTVVFLQI-UHFFFAOYSA-N 0.000 description 1
- QVOFCQBZXGLNAA-UHFFFAOYSA-M tributyl(methyl)azanium;hydroxide Chemical compound [OH-].CCCC[N+](C)(CCCC)CCCC QVOFCQBZXGLNAA-UHFFFAOYSA-M 0.000 description 1
- JQLOJTZPFXKUIM-UHFFFAOYSA-M tributyl(methyl)phosphanium;chloride Chemical compound [Cl-].CCCC[P+](C)(CCCC)CCCC JQLOJTZPFXKUIM-UHFFFAOYSA-M 0.000 description 1
- YCBRTSYWJMECAH-UHFFFAOYSA-N tributyl(tetradecyl)phosphanium Chemical compound CCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC YCBRTSYWJMECAH-UHFFFAOYSA-N 0.000 description 1
- TWHKUURCWFUXDB-UHFFFAOYSA-N tributyl-chloro-methyl-$l^{5}-arsane Chemical compound CCCC[As](C)(Cl)(CCCC)CCCC TWHKUURCWFUXDB-UHFFFAOYSA-N 0.000 description 1
- PLTCXBMKVMYEQW-UHFFFAOYSA-M tributyl-chloro-methyl-$l^{5}-stibane Chemical compound CCCC[Sb](C)(Cl)(CCCC)CCCC PLTCXBMKVMYEQW-UHFFFAOYSA-M 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/573,940 US4022816A (en) | 1975-05-02 | 1975-05-02 | Purification of chlorobutyronitrile |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1048541A true CA1048541A (en) | 1979-02-13 |
Family
ID=24294012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA76249559A Expired CA1048541A (en) | 1975-05-02 | 1976-04-05 | Purification of chlorobutyronitrile |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4022816A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS51133230A (cg-RX-API-DMAC7.html) |
| BE (1) | BE841131A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1048541A (cg-RX-API-DMAC7.html) |
| CH (1) | CH624095A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2618744C2 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2309518A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1547865A (cg-RX-API-DMAC7.html) |
| NL (1) | NL171701C (cg-RX-API-DMAC7.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52105122A (en) * | 1976-03-01 | 1977-09-03 | Michigan Chem Corp | Method of manufacturing nitrilohalide |
| GB1578139A (en) * | 1976-07-07 | 1980-11-05 | Ici Ltd | Preparation of alicyclic compounds |
| FR2468584A1 (fr) * | 1979-10-26 | 1981-05-08 | Ugine Kuhlmann | Procede de preparation de cyano-3-trimethyl-3,5,5-cyclohexanone |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US564252A (en) * | 1896-07-21 | meaker | ||
| US2415261A (en) * | 1944-12-15 | 1947-02-04 | Du Pont | Production of nitriles |
| US2800497A (en) * | 1954-03-06 | 1957-07-23 | Glanzstoff Ag | Method of manufacturing omegachlorocarboxylic acid nitriles |
| DE2103547A1 (en) * | 1970-02-09 | 1971-08-26 | Continental Oil Co | 1-30 carbon alkyl halide or cyanide prepa-ration |
| US3725458A (en) * | 1971-11-17 | 1973-04-03 | Continental Oil Co | Process for preparing cyano-compounds |
| US3839399A (en) * | 1972-10-04 | 1974-10-01 | Continental Oil Co | Production of organic cyanides |
| US3941827A (en) * | 1974-02-04 | 1976-03-02 | Michigan Chemical Corporation | Preparation of halogenated nitriles |
| US3974199A (en) * | 1975-06-16 | 1976-08-10 | The Dow Chemical Company | Process for production of cyclopropylcyanide |
| FR2342276A1 (fr) * | 1976-02-27 | 1977-09-23 | Michigan Chem Corp | Procede de preparation de 4-halobutyronitriles et nouveaux produits ainsi obtenus |
-
1975
- 1975-05-02 US US05/573,940 patent/US4022816A/en not_active Expired - Lifetime
-
1976
- 1976-04-05 CA CA76249559A patent/CA1048541A/en not_active Expired
- 1976-04-15 GB GB15604/76A patent/GB1547865A/en not_active Expired
- 1976-04-26 BE BE166467A patent/BE841131A/xx unknown
- 1976-04-28 DE DE2618744A patent/DE2618744C2/de not_active Expired
- 1976-04-28 NL NLAANVRAGE7604563,A patent/NL171701C/xx not_active IP Right Cessation
- 1976-04-30 FR FR7612943A patent/FR2309518A1/fr active Granted
- 1976-04-30 JP JP51049776A patent/JPS51133230A/ja active Granted
- 1976-04-30 CH CH546876A patent/CH624095A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5711314B2 (cg-RX-API-DMAC7.html) | 1982-03-03 |
| NL7604563A (nl) | 1976-11-04 |
| BE841131A (fr) | 1976-10-26 |
| NL171701B (nl) | 1982-12-01 |
| NL171701C (nl) | 1983-05-02 |
| DE2618744C2 (de) | 1982-06-03 |
| JPS51133230A (en) | 1976-11-18 |
| US4022816A (en) | 1977-05-10 |
| DE2618744A1 (de) | 1976-11-04 |
| FR2309518B1 (cg-RX-API-DMAC7.html) | 1979-08-31 |
| FR2309518A1 (fr) | 1976-11-26 |
| GB1547865A (en) | 1979-06-27 |
| CH624095A5 (cg-RX-API-DMAC7.html) | 1981-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20090068081A1 (en) | Method for purifying chlorosilanes | |
| WO2005021473A1 (en) | Method for producing 1,1,1,3-tetrachloropropane and other haloalkanes with iron catalyst | |
| JP2004217659A (ja) | アミノシラン製造方法 | |
| JP4827378B2 (ja) | 二次の還流蒸発器及び二次の生産物の回収を使用する1,1,1,3,3−ペンタクロロプロパンの工程における追放の流れの濃度 | |
| JP3880025B2 (ja) | 高純度トリメチルインジウムおよびその合成方法 | |
| CA1241023A (en) | Process for preparing n-alkane-n-alkanolamines | |
| US4935564A (en) | Process for preparing alkyl halides | |
| EP0013586B1 (en) | Process for the combined manufacture of chlorinated hydrocarbons and sodium bicarbonate | |
| CA1048541A (en) | Purification of chlorobutyronitrile | |
| US4119497A (en) | Process for the purification of acetonitrile | |
| US2361072A (en) | Manufacture of trichlorethylene | |
| US3014941A (en) | Process of transalkylating aluminum alkyls | |
| EP0452952B1 (en) | Process for producing benzylamines | |
| US2847484A (en) | Preparation of methyl chloride | |
| JPH01268673A (ja) | メルカプタン化合物の製造方法 | |
| US3401203A (en) | Preparation of amines | |
| GB2199828A (en) | Synthesis of 2-(perfluoroalkyl)ethanethiols | |
| JP2553261B2 (ja) | クロルヒドリンの製造方法 | |
| GB2054585A (en) | Process for producing methylhydrazines | |
| US3113158A (en) | Process for preparing vinyl chloride | |
| EP0921128B1 (en) | Process of preparing iminotris (dimethylamino) phosphorane | |
| JPH0230298B2 (cg-RX-API-DMAC7.html) | ||
| US4496777A (en) | Production of halohydrins | |
| JPH0228583B2 (cg-RX-API-DMAC7.html) | ||
| JPS646177B2 (cg-RX-API-DMAC7.html) |