CA1047487A - Monoazo pigments and a process for their manufacture - Google Patents
Monoazo pigments and a process for their manufactureInfo
- Publication number
- CA1047487A CA1047487A CA235,289A CA235289A CA1047487A CA 1047487 A CA1047487 A CA 1047487A CA 235289 A CA235289 A CA 235289A CA 1047487 A CA1047487 A CA 1047487A
- Authority
- CA
- Canada
- Prior art keywords
- amino
- atoms
- benzene
- denotes
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000049 pigment Substances 0.000 title claims abstract description 25
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims abstract description 7
- 238000000034 method Methods 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 28
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 23
- 125000005843 halogen group Chemical group 0.000 claims abstract description 17
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 16
- -1 alkyl radical Chemical class 0.000 claims abstract description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 7
- 125000003118 aryl group Chemical group 0.000 claims abstract description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 6
- 125000001841 imino group Chemical group [H]N=* 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 4
- 150000005840 aryl radicals Chemical class 0.000 claims abstract description 3
- 125000004104 aryloxy group Chemical group 0.000 claims abstract description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims abstract description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 125000001424 substituent group Chemical group 0.000 claims abstract description 3
- 125000004434 sulfur atom Chemical group 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 125000004442 acylamino group Chemical group 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 8
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 239000011368 organic material Substances 0.000 claims description 2
- 238000004040 coloring Methods 0.000 abstract description 2
- 150000002894 organic compounds Chemical class 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 62
- 229940076134 benzene Drugs 0.000 description 56
- 239000000243 solution Substances 0.000 description 23
- 230000008878 coupling Effects 0.000 description 14
- 238000010168 coupling process Methods 0.000 description 14
- 238000005859 coupling reaction Methods 0.000 description 14
- 239000000725 suspension Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000003086 colorant Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 8
- 239000004800 polyvinyl chloride Substances 0.000 description 7
- 229920000915 polyvinyl chloride Polymers 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 238000007639 printing Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- HYDGXDNLVCTECB-UHFFFAOYSA-N N-(6-chloro-3-methoxy-3-nitrocyclohexa-1,5-dien-1-yl)acetamide Chemical compound COC1(CC=C(C(=C1)NC(C)=O)Cl)[N+](=O)[O-] HYDGXDNLVCTECB-UHFFFAOYSA-N 0.000 description 3
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- ZVSKZLHKADLHSD-UHFFFAOYSA-N benzanilide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CC=C1 ZVSKZLHKADLHSD-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- JBXZCPXEYAEMJS-UHFFFAOYSA-N 2,5-dichloro-4-nitroaniline Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl JBXZCPXEYAEMJS-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 150000007656 barbituric acids Chemical class 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- 238000007646 gravure printing Methods 0.000 description 2
- 235000021388 linseed oil Nutrition 0.000 description 2
- 239000000944 linseed oil Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000007645 offset printing Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000004645 polyester resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- ITMIJFPKAIENGX-UHFFFAOYSA-N (2,4-diamino-3,6-dimethylphenyl)-phenylmethanone Chemical compound NC1=C(C(=C(C(=C1)C)C(C1=CC=CC=C1)=O)N)C ITMIJFPKAIENGX-UHFFFAOYSA-N 0.000 description 1
- ZJWAGKRIOBSJHQ-NTSYASGDSA-N (z,12r)-1-butoxy-12-hydroxy-1-oxooctadec-9-ene-2-sulfonic acid Chemical compound CCCCCC[C@@H](O)C\C=C/CCCCCCC(S(O)(=O)=O)C(=O)OCCCC ZJWAGKRIOBSJHQ-NTSYASGDSA-N 0.000 description 1
- MTQKMPGBALVEDL-ZPCKWCKBSA-N (z,12r)-12-hydroxy-2-sulfooctadec-9-enoic acid Chemical class CCCCCC[C@@H](O)C\C=C/CCCCCCC(C(O)=O)S(O)(=O)=O MTQKMPGBALVEDL-ZPCKWCKBSA-N 0.000 description 1
- PKJBRKTYYNRVSN-UHFFFAOYSA-N 10-(aminomethyl)-9,10-dihydroanthracene-1,2-diol Chemical compound OC1=CC=C2C(CN)C3=CC=CC=C3CC2=C1O PKJBRKTYYNRVSN-UHFFFAOYSA-N 0.000 description 1
- XMFGGNMHIVSTGZ-UHFFFAOYSA-N 2,4-dichloro-n-phenylbenzamide Chemical compound ClC1=CC(Cl)=CC=C1C(=O)NC1=CC=CC=C1 XMFGGNMHIVSTGZ-UHFFFAOYSA-N 0.000 description 1
- OAXSBIJZTFSWRG-UHFFFAOYSA-N 2-(2-sulfanylidenepyrrolidin-1-yl)acetamide Chemical compound NC(=O)CN1CCCC1=S OAXSBIJZTFSWRG-UHFFFAOYSA-N 0.000 description 1
- RXAHXBOJWUKKJL-UHFFFAOYSA-N 2-(4-chlorophenoxy)-n-(3,4-dichlorophenyl)acetamide Chemical compound C1=CC(Cl)=CC=C1OCC(=O)NC1=CC=C(Cl)C(Cl)=C1 RXAHXBOJWUKKJL-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- GCIDTLGMBNRXFD-UHFFFAOYSA-N 2-methoxy-n-(4-methoxyphenyl)benzamide Chemical compound C1=CC(OC)=CC=C1NC(=O)C1=CC=CC=C1OC GCIDTLGMBNRXFD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- SFHDVPIEJXCMBP-UHFFFAOYSA-N 4-chloro-n-phenylbenzamide Chemical compound C1=CC(Cl)=CC=C1C(=O)NC1=CC=CC=C1 SFHDVPIEJXCMBP-UHFFFAOYSA-N 0.000 description 1
- PQEOPHYIUYAVDQ-UHFFFAOYSA-N 4-methyl-n-phenylbenzamide Chemical compound C1=CC(C)=CC=C1C(=O)NC1=CC=CC=C1 PQEOPHYIUYAVDQ-UHFFFAOYSA-N 0.000 description 1
- ISAVYTVYFVQUDY-UHFFFAOYSA-N 4-tert-Octylphenol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C=C1 ISAVYTVYFVQUDY-UHFFFAOYSA-N 0.000 description 1
- 241000320892 Clerodendrum phlomidis Species 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- WLDHEUZGFKACJH-UHFFFAOYSA-K amaranth Chemical compound [Na+].[Na+].[Na+].C12=CC=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=C1N=NC1=CC=C(S([O-])(=O)=O)C2=CC=CC=C12 WLDHEUZGFKACJH-UHFFFAOYSA-K 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- YOBAEOGBNPPUQV-UHFFFAOYSA-N iron;trihydrate Chemical compound O.O.O.[Fe].[Fe] YOBAEOGBNPPUQV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- DSSXKBBEJCDMBT-UHFFFAOYSA-M lead(2+);octanoate Chemical compound [Pb+2].CCCCCCCC([O-])=O DSSXKBBEJCDMBT-UHFFFAOYSA-M 0.000 description 1
- 238000007644 letterpress printing Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- XVAIDCNLVLTVFM-UHFFFAOYSA-N methyl ether of paracetamol Natural products COC1=CC=C(NC(C)=O)C=C1 XVAIDCNLVLTVFM-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- UOYARWUTFBWXCA-UHFFFAOYSA-N n-(2-amino-3-methoxyphenyl)benzamide Chemical compound COC1=CC=CC(NC(=O)C=2C=CC=CC=2)=C1N UOYARWUTFBWXCA-UHFFFAOYSA-N 0.000 description 1
- WASAUEQJQJLVAS-UHFFFAOYSA-N n-(2-chloro-4-methoxyphenyl)acetamide Chemical compound COC1=CC=C(NC(C)=O)C(Cl)=C1 WASAUEQJQJLVAS-UHFFFAOYSA-N 0.000 description 1
- CLXWSQCXMNVBQP-UHFFFAOYSA-N n-(3,4-diethoxyphenyl)benzamide Chemical compound C1=C(OCC)C(OCC)=CC=C1NC(=O)C1=CC=CC=C1 CLXWSQCXMNVBQP-UHFFFAOYSA-N 0.000 description 1
- YYERXXFPHLCNRX-UHFFFAOYSA-N n-(3-amino-2,5-dimethoxyphenyl)benzamide Chemical compound COC1=CC(N)=C(OC)C(NC(=O)C=2C=CC=CC=2)=C1 YYERXXFPHLCNRX-UHFFFAOYSA-N 0.000 description 1
- XTXFAVHDQCHWCS-UHFFFAOYSA-N n-(3-amino-4-ethoxyphenyl)acetamide Chemical compound CCOC1=CC=C(NC(C)=O)C=C1N XTXFAVHDQCHWCS-UHFFFAOYSA-N 0.000 description 1
- NFYBCKQFCKDFLI-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)-2-chlorobenzamide Chemical compound C1=C(N)C(OC)=CC=C1NC(=O)C1=CC=CC=C1Cl NFYBCKQFCKDFLI-UHFFFAOYSA-N 0.000 description 1
- OCCQVTDWDHBUTD-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)-4-chlorobenzamide Chemical compound C1=C(N)C(OC)=CC=C1NC(=O)C1=CC=C(Cl)C=C1 OCCQVTDWDHBUTD-UHFFFAOYSA-N 0.000 description 1
- RTDMONGQVSSBBQ-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)-4-methoxybenzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NC1=CC=C(OC)C(N)=C1 RTDMONGQVSSBBQ-UHFFFAOYSA-N 0.000 description 1
- YEXPIFOWAKMGJW-UHFFFAOYSA-N n-(3-amino-4-nitrophenyl)benzamide Chemical compound C1=C([N+]([O-])=O)C(N)=CC(NC(=O)C=2C=CC=CC=2)=C1 YEXPIFOWAKMGJW-UHFFFAOYSA-N 0.000 description 1
- MFAQSPGSUAKCQT-UHFFFAOYSA-N n-(3-methoxyphenyl)-2-phenoxyacetamide Chemical compound COC1=CC=CC(NC(=O)COC=2C=CC=CC=2)=C1 MFAQSPGSUAKCQT-UHFFFAOYSA-N 0.000 description 1
- PRBFKGJEVLPUJC-UHFFFAOYSA-N n-(4-amino-2,5-dimethoxyphenyl)-2,4-dichlorobenzamide Chemical compound C1=C(N)C(OC)=CC(NC(=O)C=2C(=CC(Cl)=CC=2)Cl)=C1OC PRBFKGJEVLPUJC-UHFFFAOYSA-N 0.000 description 1
- IQLUKBBPRYHPOJ-UHFFFAOYSA-N n-(4-amino-2,5-dimethoxyphenyl)-4-methylbenzamide Chemical compound C1=C(N)C(OC)=CC(NC(=O)C=2C=CC(C)=CC=2)=C1OC IQLUKBBPRYHPOJ-UHFFFAOYSA-N 0.000 description 1
- PNGIXYJZWQPSBA-UHFFFAOYSA-N n-(4-amino-2-chloro-5-nitrophenyl)benzamide Chemical compound C1=C([N+]([O-])=O)C(N)=CC(Cl)=C1NC(=O)C1=CC=CC=C1 PNGIXYJZWQPSBA-UHFFFAOYSA-N 0.000 description 1
- LWAYASXDHDEGAO-UHFFFAOYSA-N n-(4-amino-2-chlorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1Cl LWAYASXDHDEGAO-UHFFFAOYSA-N 0.000 description 1
- GWFPMSIIVJMYRZ-UHFFFAOYSA-N n-(4-amino-2-methylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1C GWFPMSIIVJMYRZ-UHFFFAOYSA-N 0.000 description 1
- CXJJCQWIROJMNQ-UHFFFAOYSA-N n-(4-amino-3-chlorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C(Cl)=C1 CXJJCQWIROJMNQ-UHFFFAOYSA-N 0.000 description 1
- YSZMMELVLLQVSN-UHFFFAOYSA-N n-(4-amino-3-methoxyphenyl)-2-chlorobenzamide Chemical compound C1=C(N)C(OC)=CC(NC(=O)C=2C(=CC=CC=2)Cl)=C1 YSZMMELVLLQVSN-UHFFFAOYSA-N 0.000 description 1
- MBRXWCIRLOEZCA-UHFFFAOYSA-N n-(4-amino-5-methoxy-2-methylphenyl)acetamide Chemical compound COC1=CC(NC(C)=O)=C(C)C=C1N MBRXWCIRLOEZCA-UHFFFAOYSA-N 0.000 description 1
- YOBHVPWWYDUPFT-UHFFFAOYSA-N n-(4-ethoxyphenyl)-2-methoxybenzamide Chemical compound C1=CC(OCC)=CC=C1NC(=O)C1=CC=CC=C1OC YOBHVPWWYDUPFT-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229950006098 orthocaine Drugs 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 230000000485 pigmenting effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000001054 red pigment Substances 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3665—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic ring with two nitrogen atoms
- C09B29/3669—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic ring with two nitrogen atoms from a pyrimidine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1257274A CH599294A5 (show.php) | 1974-09-16 | 1974-09-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1047487A true CA1047487A (en) | 1979-01-30 |
Family
ID=4384275
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA235,289A Expired CA1047487A (en) | 1974-09-16 | 1975-09-12 | Monoazo pigments and a process for their manufacture |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS5155322A (show.php) |
| CA (1) | CA1047487A (show.php) |
| CH (1) | CH599294A5 (show.php) |
| DE (1) | DE2540803A1 (show.php) |
| FR (1) | FR2284644A1 (show.php) |
| GB (1) | GB1467589A (show.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3735276A1 (de) * | 1987-10-17 | 1989-04-27 | Bayer Ag | Basische azofarbstoffe, ihre herstellung und verwendung |
-
1974
- 1974-09-16 CH CH1257274A patent/CH599294A5/xx not_active IP Right Cessation
-
1975
- 1975-09-12 DE DE19752540803 patent/DE2540803A1/de active Pending
- 1975-09-12 CA CA235,289A patent/CA1047487A/en not_active Expired
- 1975-09-15 GB GB3777375A patent/GB1467589A/en not_active Expired
- 1975-09-15 FR FR7528184A patent/FR2284644A1/fr active Granted
- 1975-09-16 JP JP11203375A patent/JPS5155322A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CH599294A5 (show.php) | 1978-05-31 |
| FR2284644B1 (show.php) | 1978-05-19 |
| JPS5155322A (en) | 1976-05-15 |
| DE2540803A1 (de) | 1976-04-01 |
| FR2284644A1 (fr) | 1976-04-09 |
| GB1467589A (en) | 1977-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5669967A (en) | Pigment compositions | |
| CA1083565A (en) | Monoazo pigments | |
| US4012371A (en) | Benzinaldazolyl-, quinolonyl-, or phenmorpholonylazo-3-cyano-4-methyl-1,2-[1',2']-benz-[4',5']-imidazolo-6-hydroxypyridine colorants | |
| USRE27575E (en) | Water-insoluble benzimidazolone containing monoazo dyestuffs | |
| CA1047487A (en) | Monoazo pigments and a process for their manufacture | |
| CA1045120A (en) | Disazo pigments and a process for their manufacture | |
| US3923774A (en) | Quinazolone containing phenyl-azo-pyridine compounds | |
| US3197457A (en) | Monoazo pigments | |
| US3555002A (en) | Water-insoluble benzimidazolone containing monoazo dyestuffs | |
| US4070353A (en) | Dicarboxylic acid ester diazo pigments | |
| US3963693A (en) | Quinolone azo barbituric acid pigments | |
| US4206114A (en) | Monoazo pigments from diazotized 5-acylaminoanthranilic acid derivatives and acetoacetylaminobenzimidazolones | |
| CA1041518A (en) | Iminolsoindolinone pigments and process for their manufacture | |
| JPH0790196A (ja) | 顔料塩 | |
| US4031073A (en) | Monoazo pigments containing barbituric acid or thio- or imino-derivatives thereof | |
| CA1052803A (en) | Water-insoluble disazo methine compounds, process for their preparation and their use | |
| US4100156A (en) | Chlorine-containing disaza pigments | |
| CA1054606A (en) | Iminoisoindolinone pigments | |
| CA1047488A (en) | Azo pigments and process for their manufacture | |
| US4062838A (en) | Disazo pigments containing acylamino groups | |
| US4088641A (en) | 4-Methyl-5-(benzimidazolonylazo)-6-hydroxypyridone-2 pigment | |
| US4081439A (en) | Aromatic disazo pigments | |
| US4055559A (en) | Disazo pigment containing at least 2 chlorine atoms and process for their manufacture | |
| JPH06220341A (ja) | 新規なビスアゾ、ビスアゾメチンおよびアゾ−アゾメチン化合物 | |
| US4847365A (en) | Metal complexes of substituted 4-(2-carboxy-phenylazo-5-pyrazolones |