CA1045739A - Fireproof polyester composition - Google Patents
Fireproof polyester compositionInfo
- Publication number
- CA1045739A CA1045739A CA216,012A CA216012A CA1045739A CA 1045739 A CA1045739 A CA 1045739A CA 216012 A CA216012 A CA 216012A CA 1045739 A CA1045739 A CA 1045739A
- Authority
- CA
- Canada
- Prior art keywords
- polyester
- denotes
- carbon atoms
- fireproof
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000728 polyester Polymers 0.000 title claims abstract description 70
- 239000000203 mixture Substances 0.000 title claims abstract description 34
- 150000002903 organophosphorus compounds Chemical class 0.000 claims abstract description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 18
- 229920001283 Polyalkylene terephthalate Polymers 0.000 claims abstract description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 9
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 9
- 125000001424 substituent group Chemical group 0.000 claims abstract description 9
- 125000004437 phosphorous atom Chemical group 0.000 claims abstract description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 11
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 239000000835 fiber Substances 0.000 claims description 10
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 238000007493 shaping process Methods 0.000 claims 1
- 238000002156 mixing Methods 0.000 abstract description 5
- -1 alkylidene radical Chemical class 0.000 description 31
- 238000000034 method Methods 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 21
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 18
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 18
- 229920000742 Cotton Polymers 0.000 description 12
- 229910052698 phosphorus Inorganic materials 0.000 description 10
- 239000011574 phosphorus Substances 0.000 description 10
- 238000006068 polycondensation reaction Methods 0.000 description 10
- 239000001294 propane Substances 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 8
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 230000000875 corresponding effect Effects 0.000 description 6
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000008188 pellet Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000009884 interesterification Methods 0.000 description 5
- 150000003018 phosphorus compounds Chemical class 0.000 description 5
- 229920001407 Modal (textile) Polymers 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 229920000297 Rayon Polymers 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 238000009987 spinning Methods 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002964 rayon Substances 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- MCONGYNHPPCHSD-UHFFFAOYSA-N 3-dimethoxyphosphoryl-n-(hydroxymethyl)propanamide Chemical compound COP(=O)(OC)CCC(=O)NCO MCONGYNHPPCHSD-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N anhydrous diethylene glycol Natural products OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000002788 crimping Methods 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000009940 knitting Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- LJCHLHGJWNCEGK-UHFFFAOYSA-N 1-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol Chemical compound C1=C(Br)C(OCC(O)C)=C(Br)C=C1C(C)(C)C1=CC(Br)=C(OCC(C)O)C(Br)=C1 LJCHLHGJWNCEGK-UHFFFAOYSA-N 0.000 description 1
- FZTVWBUZWAQIRX-UHFFFAOYSA-N 2-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]cyclohexyl]phenoxy]ethanol Chemical compound C1=C(Br)C(OCCO)=C(Br)C=C1C1(C=2C=C(Br)C(OCCO)=C(Br)C=2)CCCCC1 FZTVWBUZWAQIRX-UHFFFAOYSA-N 0.000 description 1
- RVHUMFJSCJBNGS-UHFFFAOYSA-N 2-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol Chemical compound C=1C(Br)=C(OCCO)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(OCCO)C(Br)=C1 RVHUMFJSCJBNGS-UHFFFAOYSA-N 0.000 description 1
- SBPCJHWDFWXUMF-UHFFFAOYSA-N 2-[2,6-dibromo-4-[3,5-dibromo-4-(2-hydroxyethoxy)phenoxy]phenoxy]ethanol Chemical compound C1=C(Br)C(OCCO)=C(Br)C=C1OC1=CC(Br)=C(OCCO)C(Br)=C1 SBPCJHWDFWXUMF-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BNCADMBVWNPPIZ-UHFFFAOYSA-N 2-n,2-n,4-n,4-n,6-n,6-n-hexakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine Chemical compound COCN(COC)C1=NC(N(COC)COC)=NC(N(COC)COC)=N1 BNCADMBVWNPPIZ-UHFFFAOYSA-N 0.000 description 1
- NJHMMAODWVTQLA-UHFFFAOYSA-N 3-[2,6-dibromo-4-[2-[3,5-dibromo-4-(3-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-1-ol Chemical compound C=1C(Br)=C(OCCCO)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(OCCCO)C(Br)=C1 NJHMMAODWVTQLA-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 101100127656 Caenorhabditis elegans lam-2 gene Proteins 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 1
- 241000193803 Therea Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- NLTSCOZQKALPGZ-UHFFFAOYSA-N acetic acid;dihydrate Chemical compound O.O.CC(O)=O NLTSCOZQKALPGZ-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000000853 cresyl group Chemical group C1(=CC=C(C=C1)C)* 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FNIATMYXUPOJRW-UHFFFAOYSA-N cyclohexylidene Chemical group [C]1CCCCC1 FNIATMYXUPOJRW-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000007033 dehydrochlorination reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004079 fireproofing Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical class [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- GQHMUCPBVCGGBX-UHFFFAOYSA-N methyl 2-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-methoxy-2-oxoethoxy)phenyl]propan-2-yl]phenoxy]acetate Chemical compound C1=C(Br)C(OCC(=O)OC)=C(Br)C=C1C(C)(C)C1=CC(Br)=C(OCC(=O)OC)C(Br)=C1 GQHMUCPBVCGGBX-UHFFFAOYSA-N 0.000 description 1
- TVDJFYSFQBJWIZ-UHFFFAOYSA-N methyl 3-[2,6-dibromo-4-[2-[3,5-dibromo-4-(3-methoxy-3-oxopropoxy)phenyl]propan-2-yl]phenoxy]propanoate Chemical compound C1=C(Br)C(OCCC(=O)OC)=C(Br)C=C1C(C)(C)C1=CC(Br)=C(OCCC(=O)OC)C(Br)=C1 TVDJFYSFQBJWIZ-UHFFFAOYSA-N 0.000 description 1
- RDAOZVYFQXOQMF-UHFFFAOYSA-N methyl 4-[2,6-dibromo-4-[2-[3,5-dibromo-4-(4-methoxy-4-oxobutoxy)phenyl]propan-2-yl]phenoxy]butanoate Chemical compound C1=C(Br)C(OCCCC(=O)OC)=C(Br)C=C1C(C)(C)C1=CC(Br)=C(OCCCC(=O)OC)C(Br)=C1 RDAOZVYFQXOQMF-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ABMFBCRYHDZLRD-UHFFFAOYSA-N naphthalene-1,4-dicarboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=C(C(O)=O)C2=C1 ABMFBCRYHDZLRD-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- YZYKBQUWMPUVEN-UHFFFAOYSA-N zafuleptine Chemical compound OC(=O)CCCCCC(C(C)C)NCC1=CC=C(F)C=C1 YZYKBQUWMPUVEN-UHFFFAOYSA-N 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G79/00—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule
- C08G79/02—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule a linkage containing phosphorus
- C08G79/04—Phosphorus linked to oxygen or to oxygen and carbon
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Artificial Filaments (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48141650A JPS5091651A (enExample) | 1973-12-17 | 1973-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1045739A true CA1045739A (en) | 1979-01-02 |
Family
ID=15296970
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA216,012A Expired CA1045739A (en) | 1973-12-17 | 1974-12-13 | Fireproof polyester composition |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4046724A (enExample) |
| JP (1) | JPS5091651A (enExample) |
| CA (1) | CA1045739A (enExample) |
| DE (1) | DE2458967A1 (enExample) |
| GB (1) | GB1461629A (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2379560A1 (fr) * | 1977-02-03 | 1978-09-01 | Rhone Poulenc Textile | Copolyesters conformables a inflammabilite reduite |
| US4381390A (en) * | 1981-10-15 | 1983-04-26 | Mobay Chemical Corporation | Thermoplastic polyphosphonatophenyl ester carbonate from aryloxycarbonyloxy-benzoic acid aryl ester and preparation thereof |
| CA1207487A (en) * | 1981-10-19 | 1986-07-08 | Manfred Schmidt | Polysulfone-polyphosphonate molding compositions |
| JPS596774U (ja) * | 1982-07-05 | 1984-01-17 | 第一精工株式会社 | 回転センサ− |
| DE3700208A1 (de) * | 1987-01-07 | 1988-07-21 | Bayer Ag | Phosphorhaltige oligomere und polymere mit polyphenylenetherbloecken sowie mischungen anderer kunststoffe mit ihnen |
| DE3800672A1 (de) * | 1988-01-13 | 1989-07-27 | Bayer Ag | Flammgeschuetzte polyethylenterephthalatformmassen |
| DE3833694A1 (de) * | 1988-10-04 | 1990-04-05 | Bayer Ag | Flammgeschuetzte, gut kristallisierende polyethylenterephthalatformmassen |
| US20040167283A1 (en) * | 2003-02-24 | 2004-08-26 | Michael Vinciguerra | Linear polyphosphonates that exhibit an advantageous combination of properties, and methods related thereto |
| US6861499B2 (en) * | 2003-02-24 | 2005-03-01 | Triton Systems, Inc. | Branched polyphosphonates that exhibit an advantageous combination of properties, and methods related thereto |
| US7645850B2 (en) * | 2005-08-11 | 2010-01-12 | Frx Polymers, Inc. | Poly(block-phosphonato-ester) and poly(block-phosphonato-carbonate) and methods of making same |
| CN101253184B (zh) * | 2005-09-14 | 2011-06-15 | 大八化学工业株式会社 | 磷化合物及其用途和阻燃聚酯纤维 |
| US20070254991A1 (en) * | 2006-04-28 | 2007-11-01 | Saadat Hussain | Phosphorus-containing tetrabromobisphenol A |
| US20110237695A1 (en) * | 2010-03-23 | 2011-09-29 | Clariant International Ltd. | Flame Retardant Combinations For Polyester Elastomers And Flame Retarded Extrusion Or Molding Compositions Therefrom |
| CN104379651B (zh) | 2012-05-24 | 2016-10-26 | 沙特基础全球技术有限公司 | 改善的阻燃剂聚合物组合物 |
| KR20140080360A (ko) * | 2012-12-20 | 2014-06-30 | 제일모직주식회사 | 인계 공중합체, 이의 제조방법 및 이를 포함하는 난연성 열가소성 수지 조성물 |
| TW201439222A (zh) | 2013-01-22 | 2014-10-16 | Frx Polymers Inc | 含磷環氧化合物及源自其之組成物 |
| US10711133B2 (en) * | 2014-12-12 | 2020-07-14 | Eastman Chemical Company | Flame retardant copolyester compositions |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2435252A (en) * | 1944-01-01 | 1948-02-03 | Victor Chemical Works | Aryl phosphorus containing resins and the method of preparing the same |
| US2572076A (en) * | 1947-11-01 | 1951-10-23 | Victor Chemical Works | Phosphorus-containing resins and the method of preparing the same |
| US2891915A (en) * | 1954-07-02 | 1959-06-23 | Du Pont | Organophosphorus polymers |
| GB1281937A (en) * | 1969-11-11 | 1972-07-19 | Ici Ltd | Esters of a brominated bis-phenol and their use in inhibition of flammability of polyesters |
| US3829405A (en) * | 1970-06-29 | 1974-08-13 | Fiber Industries Inc | Phosphorus-containing polyesters |
| US3830771A (en) * | 1970-06-29 | 1974-08-20 | Celanese Corp | Phosphorus-containing polyesters |
| JPS5534831B2 (enExample) * | 1971-12-25 | 1980-09-09 | ||
| JPS5139271B2 (enExample) * | 1972-03-09 | 1976-10-27 | ||
| US3794617A (en) * | 1972-03-15 | 1974-02-26 | Emery Industries Inc | Copolyester fiber compositions having improved flame retardant properties |
| US3883611A (en) * | 1972-06-15 | 1975-05-13 | Standard Oil Co | Copolyester(ethylene terephthalate/tetramethylene dibromoterephthalate) a new block polymer |
| US3874157A (en) * | 1973-01-30 | 1975-04-01 | Fmc Corp | Flame-retardant fiber blend |
| US3874155A (en) * | 1973-01-30 | 1975-04-01 | Fmc Corp | Flame-retardant fiber blend |
-
1973
- 1973-12-17 JP JP48141650A patent/JPS5091651A/ja active Pending
-
1974
- 1974-12-13 GB GB5397074A patent/GB1461629A/en not_active Expired
- 1974-12-13 CA CA216,012A patent/CA1045739A/en not_active Expired
- 1974-12-13 DE DE19742458967 patent/DE2458967A1/de active Pending
- 1974-12-16 US US05/533,067 patent/US4046724A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5091651A (enExample) | 1975-07-22 |
| GB1461629A (en) | 1977-01-13 |
| DE2458967A1 (de) | 1975-06-19 |
| US4046724A (en) | 1977-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1045739A (en) | Fireproof polyester composition | |
| US4035343A (en) | Flame resistant synthetic linear polyesters and shaped structures made thereof | |
| US3794617A (en) | Copolyester fiber compositions having improved flame retardant properties | |
| US3558557A (en) | Copolyesters,their production and uses | |
| JP3926328B2 (ja) | 人工毛髪 | |
| TWI363817B (en) | Dope dyed flame retardant polyester fibers, textile products therefrom and the method of manufacturing thereof | |
| CA2085541A1 (en) | Flame resistant, low pilling polyester fiber | |
| US5145941A (en) | Flame resistant, low pilling polyester fiber | |
| US4101528A (en) | Copolyesters of ethylene 2,6-naphthalene dicarboxylate and halogenated comonomers | |
| US4059546A (en) | Textile fiber blend comprising cellulosic fibers and ethylene 2,6-naphthalene dicarboxylate-halogenated comonomers copolyester fibers | |
| US3874157A (en) | Flame-retardant fiber blend | |
| KR100449383B1 (ko) | 난연성 폴리에스테르 섬유의 제조방법 | |
| US3875108A (en) | Deep dyeable, lusterous, and fire-retardant linear polyester composition | |
| US5464694A (en) | Spinnable polyester based on modified polyethylene terephthalate and aliphatic dicarboxylic acids | |
| US3966682A (en) | Poly(tetramethylene dibro moterephthalate) | |
| US4045513A (en) | Ethylene 2,6-naphthalene dicarboxylated-alkylene-2,5 dibromoterephthalate flame-retardant copolyesters | |
| US4028308A (en) | Poly(cyclohexanedimethylene dibromoterephthalate) | |
| JP4155903B2 (ja) | 撥水吸湿複合繊維 | |
| US3962185A (en) | Polyester compositions having a durable antistatic property | |
| US4025491A (en) | Poly(tetramethylene dibromoterephthalate) yarns | |
| US3705130A (en) | Fiber forming polyester composition and fiber produced therefrom | |
| KR0170068B1 (ko) | 난연성 폴리에스테르의 제조방법 | |
| JP3611677B2 (ja) | 耐アルカリ加水分解性ポリエステル繊維 | |
| JPS62297323A (ja) | 難燃性ポリエステルの製造法 | |
| KR810000207B1 (ko) | 개량된 폴리에스테르의 제조방법 |