CA1041824A - Electrographic toner and developer composition - Google Patents
Electrographic toner and developer compositionInfo
- Publication number
- CA1041824A CA1041824A CA224,337A CA224337A CA1041824A CA 1041824 A CA1041824 A CA 1041824A CA 224337 A CA224337 A CA 224337A CA 1041824 A CA1041824 A CA 1041824A
- Authority
- CA
- Canada
- Prior art keywords
- resin
- particles
- toner
- range
- amine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 85
- 150000001412 amines Chemical class 0.000 claims abstract description 44
- 239000002245 particle Substances 0.000 claims description 86
- 229920005989 resin Polymers 0.000 claims description 55
- 239000011347 resin Substances 0.000 claims description 55
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 239000000049 pigment Substances 0.000 claims description 8
- 239000000975 dye Substances 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 6
- 230000009477 glass transition Effects 0.000 claims description 5
- 239000004417 polycarbonate Substances 0.000 claims description 5
- 229920000515 polycarbonate Polymers 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 description 39
- 239000000463 material Substances 0.000 description 30
- 230000005291 magnetic effect Effects 0.000 description 25
- 238000011161 development Methods 0.000 description 20
- 230000018109 developmental process Effects 0.000 description 19
- 238000000034 method Methods 0.000 description 18
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 15
- 239000003086 colorant Substances 0.000 description 13
- 239000000843 powder Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 10
- 239000011230 binding agent Substances 0.000 description 9
- 239000004094 surface-active agent Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- 229910052742 iron Inorganic materials 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- -1 aliphatic amines Chemical class 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N divinylbenzene Substances C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 239000000976 ink Substances 0.000 description 3
- 239000006249 magnetic particle Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 238000004088 simulation Methods 0.000 description 3
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- YCUVUDODLRLVIC-UHFFFAOYSA-N Sudan black B Chemical compound C1=CC(=C23)NC(C)(C)NC2=CC=CC3=C1N=NC(C1=CC=CC=C11)=CC=C1N=NC1=CC=CC=C1 YCUVUDODLRLVIC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229920000180 alkyd Polymers 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 229940105289 carbon black Drugs 0.000 description 2
- 235000019241 carbon black Nutrition 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000000696 magnetic material Substances 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000012260 resinous material Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 2
- SXAWRMKQZKPHNJ-UHFFFAOYSA-M tetrapentylazanium;chloride Chemical compound [Cl-].CCCCC[N+](CCCCC)(CCCCC)CCCCC SXAWRMKQZKPHNJ-UHFFFAOYSA-M 0.000 description 2
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000008247 Echinochloa frumentacea Nutrition 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 240000004072 Panicum sumatrense Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 239000003302 ferromagnetic material Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000000088 plastic resin Substances 0.000 description 1
- 229920001603 poly (alkyl acrylates) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000012256 powdered iron Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Inorganic materials [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/097—Plasticisers; Charge controlling agents
- G03G9/09733—Organic compounds
- G03G9/09775—Organic compounds containing atoms other than carbon, hydrogen or oxygen
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/470,425 US3944493A (en) | 1974-05-16 | 1974-05-16 | Electrographic toner and developer composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1041824A true CA1041824A (en) | 1978-11-07 |
Family
ID=23867597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA224,337A Expired CA1041824A (en) | 1974-05-16 | 1975-04-10 | Electrographic toner and developer composition |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3944493A (enExample) |
| JP (1) | JPS5317903B2 (enExample) |
| BR (1) | BR7502978A (enExample) |
| CA (1) | CA1041824A (enExample) |
| FR (1) | FR2271605B1 (enExample) |
| GB (1) | GB1490584A (enExample) |
Families Citing this family (162)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5045342A (enExample) * | 1973-08-29 | 1975-04-23 | ||
| US4076893A (en) * | 1974-08-26 | 1978-02-28 | Xerox Corporation | Tribo modified carrier materials via acylation |
| JPS51124434A (en) * | 1975-04-22 | 1976-10-29 | Ricoh Co Ltd | Duplicating method for plural sheets |
| US4139483A (en) * | 1977-02-28 | 1979-02-13 | Xerox Corporation | Electrostatographic toner composition containing surfactant |
| US4291111A (en) * | 1977-11-25 | 1981-09-22 | Xerox Corporation | Nitrogen-containing additives for magnetic toners having hydrophobic and hydrophilic moiety |
| US4298672A (en) * | 1978-06-01 | 1981-11-03 | Xerox Corporation | Toners containing alkyl pyridinium compounds and their hydrates |
| US4312933A (en) * | 1979-02-09 | 1982-01-26 | Xerox Corporation | Method of imaging using nitrogen-containing additives for magnetic toners |
| US4286038A (en) * | 1979-03-12 | 1981-08-25 | Xerox Corporation | Positive toners containing alkyl picolinium compounds |
| US4269922A (en) * | 1979-03-12 | 1981-05-26 | Xerox Corporation | Positive toners containing long chain hydrazinium compounds |
| US4264702A (en) * | 1979-03-12 | 1981-04-28 | Xerox Corporation | Positive toners containing alkyl morpholinium compounds as charge control agents |
| US4293631A (en) * | 1979-03-12 | 1981-10-06 | Xerox Corporation | Electrographic toner compositions |
| US4264697A (en) * | 1979-07-02 | 1981-04-28 | Xerox Corporation | Imaging system |
| US4263389A (en) * | 1979-07-16 | 1981-04-21 | Xerox Corporation | Positively charged toners containing vinyl pyrrolidone polymers |
| US4294904A (en) * | 1979-11-21 | 1981-10-13 | Xerox Corporation | Inductive development materials for a magnetic development process |
| US4304830A (en) * | 1980-01-14 | 1981-12-08 | Xerox Corporation | Toner additives |
| US4338390A (en) * | 1980-12-04 | 1982-07-06 | Xerox Corporation | Quarternary ammonium sulfate or sulfonate charge control agents for electrophotographic developers compatible with viton fuser |
| USRE32883E (en) * | 1980-12-04 | 1989-03-07 | Xerox Corporation | Quarternary ammonium sulfate or sulfonate charge control agents for electrophotographic developers compatible with viton fuser |
| US4394430A (en) * | 1981-04-14 | 1983-07-19 | Eastman Kodak Company | Electrophotographic dry toner and developer compositions |
| US4378419A (en) * | 1981-05-01 | 1983-03-29 | Xerox Corporation | Developer compositions containing telomeric quaternary salts |
| US4371601A (en) * | 1981-05-01 | 1983-02-01 | Xerox Corporation | Positively charged developer compositions containing telomeric amines |
| US4355167A (en) * | 1981-05-01 | 1982-10-19 | Xerox Corporation | Telomeric quaternary salt compositions |
| US4426436A (en) | 1981-08-26 | 1984-01-17 | Xerox Corporation | Process for positive charge sharing toner compositions |
| US4391890A (en) * | 1981-12-03 | 1983-07-05 | Xerox Corporation | Developer compositions containing alkyl pyridinium toluene sulfonates |
| US4396697A (en) * | 1981-12-03 | 1983-08-02 | Xerox Corporation | Organic sulfonate charge enhancing additives |
| US4397934A (en) * | 1981-12-31 | 1983-08-09 | Xerox Corporation | Developer compositions containing quaternized vinylpyridine polymers, and copolymers |
| US4397935A (en) * | 1982-01-18 | 1983-08-09 | Xerox Corporation | Positively charged developer compositions containing quaternized vinyl pyridine polymers |
| US4415646A (en) * | 1982-03-03 | 1983-11-15 | Xerox Corporation | Nitrogen containing polymers as charge enhancing additive for electrophotographic toner |
| US4533617A (en) * | 1982-05-26 | 1985-08-06 | Canon Kabushiki Kaisha | Heat fixing developer of capsule structure |
| JPS59189348A (ja) * | 1983-04-12 | 1984-10-26 | Canon Inc | 圧力定着性トナ− |
| DE3585769D1 (de) * | 1984-10-19 | 1992-05-07 | Canon Kk | Toner, ladungskontrollierendes material und zusammensetzung die eine positiv aufladbare verbindung enthaelt. |
| US4621039A (en) * | 1984-12-18 | 1986-11-04 | Xerox Corporation | Developer compositions with fast admixing characteristics |
| US4886725A (en) * | 1984-12-19 | 1989-12-12 | Canon Kabushiki Kaisha | Toner composition containing organotin oxide |
| JP2750853B2 (ja) * | 1986-11-20 | 1998-05-13 | 株式会社リコー | 静電潜像現像用トナー |
| US4783389A (en) * | 1987-03-27 | 1988-11-08 | E. I. Du Pont De Nemours And Company | Process for preparation of liquid electrostatic developers |
| US5364725A (en) * | 1993-03-15 | 1994-11-15 | Eastman Kodak Company | Toner and developer containing acyloxy-t-alkylated benzoic acids as charge-control agent |
| JP3267379B2 (ja) * | 1993-03-31 | 2002-03-18 | オリヱント化学工業株式会社 | 荷電制御剤及び静電荷像現像用トナー |
| JP3005884B2 (ja) * | 1993-07-08 | 2000-02-07 | 花王株式会社 | 静電荷像現像剤組成物 |
| US5411829A (en) | 1994-05-31 | 1995-05-02 | Xerox Corporation | Polyimide toner compositions |
| US5698422A (en) | 1995-01-06 | 1997-12-16 | Xerox Corporation | Toner and developer compositions |
| DE19620476B4 (de) * | 1996-05-21 | 2006-01-12 | Detlef Dr. Schulze-Hagenest | Toner und Entwickler für Hochgeschwindigkeitslaserdrucker |
| US5962178A (en) * | 1998-01-09 | 1999-10-05 | Xerox Corporation | Sediment free toner processes |
| US5853943A (en) * | 1998-01-09 | 1998-12-29 | Xerox Corporation | Toner processes |
| US5948583A (en) * | 1998-04-13 | 1999-09-07 | Xerox Corp | Toner composition and processes thereof |
| US6214507B1 (en) | 1998-08-11 | 2001-04-10 | Xerox Corporation | Toner compositions |
| US6190815B1 (en) | 1998-08-11 | 2001-02-20 | Xerox Corporation | Toner compositions |
| US6004714A (en) * | 1998-08-11 | 1999-12-21 | Xerox Corporation | Toner compositions |
| US6017668A (en) * | 1999-05-26 | 2000-01-25 | Xerox Corporation | Toner compositions |
| USH1889H (en) * | 1999-10-12 | 2000-10-03 | Xerox Corporation | Toner compositions |
| US6210851B1 (en) | 1999-12-01 | 2001-04-03 | Eastman Kodak Company | Electrophotographic toner surface treated with silica mixtures |
| US6120967A (en) * | 2000-01-19 | 2000-09-19 | Xerox Corporation | Sequenced addition of coagulant in toner aggregation process |
| US6899455B2 (en) | 2000-12-27 | 2005-05-31 | Xerox Corporation | Blending tool with an adjustable collision profile and method of adjusting the collision profile |
| US6756173B2 (en) | 2000-12-27 | 2004-06-29 | Xerox Corporation | Toner with increased amount of surface additives and increased surface additive adhesion |
| US6523996B2 (en) | 2000-12-27 | 2003-02-25 | Xerox Corporation | Blending tool with an enlarged collision surface for increased blend intensity and method of blending toners |
| US6420078B1 (en) | 2000-12-28 | 2002-07-16 | Xerox Corporation | Toner compositions with surface additives |
| US6805481B2 (en) | 2001-08-31 | 2004-10-19 | Xerox Corporation | High intensity blending tool with optimized risers for increased intensity when blending toners |
| US6566025B1 (en) | 2002-01-16 | 2003-05-20 | Xerox Corporation | Polymeric particles as external toner additives |
| US7276254B2 (en) * | 2002-05-07 | 2007-10-02 | Xerox Corporation | Emulsion/aggregation polymeric microspheres for biomedical applications and methods of making same |
| US7501150B2 (en) * | 2004-01-28 | 2009-03-10 | Xerox Corporation | Emulsion aggregation process for forming powder coating compositions, powder coating compositions and method for using the same |
| US7985524B2 (en) * | 2004-01-28 | 2011-07-26 | Xerox Corporation | Emulsion aggregation process for forming curable powder coating compositions, curable powder coating compositions and method for using the same |
| US7112394B2 (en) * | 2004-03-01 | 2006-09-26 | Xerox Corporation | Thermosetting toner compositions, thermosetting developer compositions and methods for making and using the same |
| US7208257B2 (en) * | 2004-06-25 | 2007-04-24 | Xerox Corporation | Electron beam curable toners and processes thereof |
| US7410750B2 (en) * | 2004-06-30 | 2008-08-12 | Xerox Corporation | Multicolored photochromic display |
| US7229735B2 (en) * | 2004-07-26 | 2007-06-12 | Xerox Corporation | Toner compositions |
| US7247415B2 (en) * | 2004-08-31 | 2007-07-24 | Xerox Corporation | Process for preparing toner particles and toner particles |
| US7652128B2 (en) * | 2004-11-05 | 2010-01-26 | Xerox Corporation | Toner composition |
| US7615327B2 (en) * | 2004-11-17 | 2009-11-10 | Xerox Corporation | Toner process |
| US7320851B2 (en) * | 2005-01-13 | 2008-01-22 | Xerox Corporation | Toner particles and methods of preparing the same |
| US7279261B2 (en) * | 2005-01-13 | 2007-10-09 | Xerox Corporation | Emulsion aggregation toner compositions |
| US7799502B2 (en) * | 2005-03-31 | 2010-09-21 | Xerox Corporation | Toner processes |
| US7329476B2 (en) | 2005-03-31 | 2008-02-12 | Xerox Corporation | Toner compositions and process thereof |
| US7432324B2 (en) * | 2005-03-31 | 2008-10-07 | Xerox Corporation | Preparing aqueous dispersion of crystalline and amorphous polyesters |
| US7468232B2 (en) | 2005-04-27 | 2008-12-23 | Xerox Corporation | Processes for forming latexes and toners, and latexes and toner formed thereby |
| US7862970B2 (en) * | 2005-05-13 | 2011-01-04 | Xerox Corporation | Toner compositions with amino-containing polymers as surface additives |
| US7459258B2 (en) * | 2005-06-17 | 2008-12-02 | Xerox Corporation | Toner processes |
| US7413842B2 (en) * | 2005-08-22 | 2008-08-19 | Xerox Corporation | Toner processes |
| US7713674B2 (en) * | 2005-09-09 | 2010-05-11 | Xerox Corporation | Emulsion polymerization process |
| US7662531B2 (en) * | 2005-09-19 | 2010-02-16 | Xerox Corporation | Toner having bumpy surface morphology |
| US7507517B2 (en) * | 2005-10-11 | 2009-03-24 | Xerox Corporation | Toner processes |
| US7683142B2 (en) * | 2005-10-11 | 2010-03-23 | Xerox Corporation | Latex emulsion polymerizations in spinning disc reactors or rotating tubular reactors |
| US7553596B2 (en) | 2005-11-14 | 2009-06-30 | Xerox Corporation | Toner having crystalline wax |
| US7541126B2 (en) * | 2005-12-13 | 2009-06-02 | Xerox Corporation | Toner composition |
| US7507513B2 (en) * | 2005-12-13 | 2009-03-24 | Xerox Corporation | Toner composition |
| US7498112B2 (en) * | 2005-12-20 | 2009-03-03 | Xerox Corporation | Emulsion/aggregation toners having novel dye complexes |
| US20070207397A1 (en) * | 2006-03-03 | 2007-09-06 | Xerox Corporation | Toner compositions |
| US20070207400A1 (en) | 2006-03-06 | 2007-09-06 | Xerox Corporation | Toner composition and methods |
| US7507515B2 (en) * | 2006-03-15 | 2009-03-24 | Xerox Corporation | Toner compositions |
| US7531334B2 (en) * | 2006-04-14 | 2009-05-12 | Xerox Corporation | Polymeric microcarriers for cell culture functions |
| US7691552B2 (en) * | 2006-08-15 | 2010-04-06 | Xerox Corporation | Toner composition |
| US20080044755A1 (en) * | 2006-08-15 | 2008-02-21 | Xerox Corporation | Toner composition |
| US7794911B2 (en) * | 2006-09-05 | 2010-09-14 | Xerox Corporation | Toner compositions |
| US7569321B2 (en) * | 2006-09-07 | 2009-08-04 | Xerox Corporation | Toner compositions |
| US7700252B2 (en) * | 2006-11-21 | 2010-04-20 | Xerox Corporation | Dual pigment toner compositions |
| EP1930780B1 (en) * | 2006-12-07 | 2010-02-17 | Punch Graphix International N.V. | Rounded radiation curable toner and method for fusing and curing the same |
| US7553601B2 (en) * | 2006-12-08 | 2009-06-30 | Xerox Corporation | Toner compositions |
| US7727696B2 (en) * | 2006-12-08 | 2010-06-01 | Xerox Corporation | Toner compositions |
| US7943283B2 (en) * | 2006-12-20 | 2011-05-17 | Xerox Corporation | Toner compositions |
| US20080210124A1 (en) * | 2007-03-01 | 2008-09-04 | Xerox Corporation | Core-shell polymer particles |
| US8278018B2 (en) * | 2007-03-14 | 2012-10-02 | Xerox Corporation | Process for producing dry ink colorants that will reduce metamerism |
| US20080241723A1 (en) | 2007-03-26 | 2008-10-02 | Xerox Corporation | Emulsion aggregation toner compositions having ceramic pigments |
| US8455171B2 (en) * | 2007-05-31 | 2013-06-04 | Xerox Corporation | Toner compositions |
| US20080299479A1 (en) * | 2007-05-31 | 2008-12-04 | Xerox Corporation | Toner compositions |
| US8088544B2 (en) * | 2007-07-30 | 2012-01-03 | Xerox Corporation | Core-shell polymer nanoparticles and method of making emulsion aggregation particles using same |
| US8034527B2 (en) | 2007-08-23 | 2011-10-11 | Xerox Corporation | Core-shell polymer nanoparticles and method for making emulsion aggregation particles using same |
| US8080353B2 (en) | 2007-09-04 | 2011-12-20 | Xerox Corporation | Toner compositions |
| US20090061342A1 (en) * | 2007-09-05 | 2009-03-05 | Xerox Corporation | Toner compositions |
| US20090081576A1 (en) * | 2007-09-25 | 2009-03-26 | Xerox Corporation | Toner compositions |
| US7833684B2 (en) * | 2007-11-14 | 2010-11-16 | Xerox Corporation | Toner compositions |
| US8101328B2 (en) | 2008-02-08 | 2012-01-24 | Xerox Corporation | Charge control agents for toner compositions |
| US8492065B2 (en) * | 2008-03-27 | 2013-07-23 | Xerox Corporation | Latex processes |
| US8092973B2 (en) | 2008-04-21 | 2012-01-10 | Xerox Corporation | Toner compositions |
| US8147714B2 (en) * | 2008-10-06 | 2012-04-03 | Xerox Corporation | Fluorescent organic nanoparticles and a process for producing fluorescent organic nanoparticles |
| US8236198B2 (en) | 2008-10-06 | 2012-08-07 | Xerox Corporation | Fluorescent nanoscale particles |
| US8586141B2 (en) * | 2008-10-06 | 2013-11-19 | Xerox Corporation | Fluorescent solid ink made with fluorescent nanoparticles |
| US8222313B2 (en) * | 2008-10-06 | 2012-07-17 | Xerox Corporation | Radiation curable ink containing fluorescent nanoparticles |
| US8541154B2 (en) * | 2008-10-06 | 2013-09-24 | Xerox Corporation | Toner containing fluorescent nanoparticles |
| US20100092886A1 (en) * | 2008-10-10 | 2010-04-15 | Xerox Corporation | Toner compositions |
| US8073376B2 (en) * | 2009-05-08 | 2011-12-06 | Xerox Corporation | Curable toner compositions and processes |
| US8192912B2 (en) | 2009-05-08 | 2012-06-05 | Xerox Corporation | Curable toner compositions and processes |
| US8394562B2 (en) * | 2009-06-29 | 2013-03-12 | Xerox Corporation | Toner compositions |
| US8394561B2 (en) * | 2009-07-20 | 2013-03-12 | Xerox Corporation | Colored toners |
| US8586272B2 (en) * | 2009-07-28 | 2013-11-19 | Xerox Corporation | Toner compositions |
| US8323865B2 (en) * | 2009-08-04 | 2012-12-04 | Xerox Corporation | Toner processes |
| US8257899B2 (en) | 2009-08-27 | 2012-09-04 | Xerox Corporation | Polyester process |
| US8722299B2 (en) | 2009-09-15 | 2014-05-13 | Xerox Corporation | Curable toner compositions and processes |
| US8092963B2 (en) | 2010-01-19 | 2012-01-10 | Xerox Corporation | Toner compositions |
| US8354213B2 (en) | 2010-01-19 | 2013-01-15 | Xerox Corporation | Toner compositions |
| US8137880B2 (en) * | 2010-01-20 | 2012-03-20 | Xerox Corporation | Colored toners |
| US8618192B2 (en) * | 2010-02-05 | 2013-12-31 | Xerox Corporation | Processes for producing polyester latexes via solvent-free emulsification |
| US9012118B2 (en) | 2010-03-04 | 2015-04-21 | Xerox Corporation | Toner compositions and processes |
| US8383310B2 (en) | 2010-04-27 | 2013-02-26 | Xerox Corporation | Toner compositions |
| US8608367B2 (en) | 2010-05-19 | 2013-12-17 | Xerox Corporation | Screw extruder for continuous and solvent-free resin emulsification |
| US8338069B2 (en) | 2010-07-19 | 2012-12-25 | Xerox Corporation | Toner compositions |
| US8574804B2 (en) | 2010-08-26 | 2013-11-05 | Xerox Corporation | Toner compositions and processes |
| US9239529B2 (en) | 2010-12-20 | 2016-01-19 | Xerox Corporation | Toner compositions and processes |
| US8663565B2 (en) | 2011-02-11 | 2014-03-04 | Xerox Corporation | Continuous emulsification—aggregation process for the production of particles |
| US8916098B2 (en) | 2011-02-11 | 2014-12-23 | Xerox Corporation | Continuous emulsification-aggregation process for the production of particles |
| US8492066B2 (en) | 2011-03-21 | 2013-07-23 | Xerox Corporation | Toner compositions and processes |
| US8980520B2 (en) | 2011-04-11 | 2015-03-17 | Xerox Corporation | Toner compositions and processes |
| US9134640B2 (en) | 2011-05-13 | 2015-09-15 | Xerox Corporation | Clear styrene emulsion/aggregation toner |
| US9354530B2 (en) | 2011-12-12 | 2016-05-31 | Xerox Corporation | Carboxylic acid or acid salt functionalized polyester polymers |
| US8703374B2 (en) | 2012-03-09 | 2014-04-22 | Xerox Corporation | Toner composition with charge control agent-treated spacer particles |
| US8673532B2 (en) | 2012-06-26 | 2014-03-18 | Xerox Corporation | Method of producing dry toner particles having high circularity |
| US9069275B2 (en) | 2013-04-03 | 2015-06-30 | Xerox Corporation | Carrier resins with improved relative humidity sensitivity |
| US9181389B2 (en) | 2013-05-20 | 2015-11-10 | Xerox Corporation | Alizarin-based polymer colorants |
| US9122179B2 (en) | 2013-08-21 | 2015-09-01 | Xerox Corporation | Toner process comprising reduced coalescence temperature |
| US9372422B2 (en) | 2014-01-22 | 2016-06-21 | Xerox Corporation | Optimized latex particle size for improved hot offset temperature for sustainable toners |
| US9372421B2 (en) | 2014-11-05 | 2016-06-21 | Xerox Corporation | System and method for conventional particle rounding utilizing continuous emulsion-aggregation (EA) technology |
| US9581924B2 (en) | 2014-11-14 | 2017-02-28 | Xerox Corporation | Bio-based acrylate and (meth)acrylate resins |
| US9400440B2 (en) | 2014-12-05 | 2016-07-26 | Xerox Corporation | Styrene/acrylate and polyester hybrid toner |
| US9383666B1 (en) | 2015-04-01 | 2016-07-05 | Xerox Corporation | Toner particles comprising both polyester and styrene acrylate polymers having a polyester shell |
| US9341968B1 (en) | 2015-04-01 | 2016-05-17 | Xerox Corporation | Toner particles comprising both polyester and styrene acrylate polymers having a polyester shell |
| US9335667B1 (en) | 2015-04-02 | 2016-05-10 | Xerox Corporation | Carrier for two component development system |
| US10007200B2 (en) | 2015-05-07 | 2018-06-26 | Xerox Corporation | Antimicrobial toner |
| US10216111B2 (en) | 2015-05-07 | 2019-02-26 | Xerox Corporation | Antimicrobial sulfonated polyester resin |
| US9740124B2 (en) | 2015-05-25 | 2017-08-22 | Xerox Corporation | Toner compositions and processes |
| US9791795B2 (en) | 2015-06-01 | 2017-10-17 | Xerox Corporation | Low fixing temperature sustainable toner |
| US10095140B2 (en) | 2015-11-10 | 2018-10-09 | Xerox Corporation | Styrene/acrylate and polyester resin particles |
| US9971265B1 (en) | 2017-02-23 | 2018-05-15 | Xerox Corporation | Toner compositions and processes |
| US10409185B2 (en) | 2018-02-08 | 2019-09-10 | Xerox Corporation | Toners exhibiting reduced machine ultrafine particle (UFP) emissions and related methods |
| US10539896B1 (en) | 2019-01-14 | 2020-01-21 | Xerox Corporation | Non-bisphenol-A emulsion aggregation toner and process |
| US11714361B2 (en) | 2021-07-27 | 2023-08-01 | Xerox Corporation | Toner |
| US12379677B2 (en) | 2021-07-27 | 2025-08-05 | Xerox Corporation | Latexes and related compositions |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3417019A (en) * | 1962-12-27 | 1968-12-17 | Eastman Kodak Co | Xerographic development |
| US3565654A (en) * | 1966-08-29 | 1971-02-23 | Owens Illinois Inc | Process for treating polyamide-based resin particles for use in electro-photography |
| US3669922A (en) * | 1970-05-21 | 1972-06-13 | Nat Distillers Chem Corp | Process for the preparation of colored polymer powders of controlled charge and printing characteristics |
-
1974
- 1974-05-16 US US05/470,425 patent/US3944493A/en not_active Expired - Lifetime
-
1975
- 1975-04-10 CA CA224,337A patent/CA1041824A/en not_active Expired
- 1975-05-14 BR BR3798/75A patent/BR7502978A/pt unknown
- 1975-05-14 FR FR7515010A patent/FR2271605B1/fr not_active Expired
- 1975-05-15 GB GB20596/75A patent/GB1490584A/en not_active Expired
- 1975-05-16 JP JP5848875A patent/JPS5317903B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5317903B2 (enExample) | 1978-06-12 |
| FR2271605B1 (enExample) | 1977-04-15 |
| FR2271605A1 (enExample) | 1975-12-12 |
| JPS51345A (enExample) | 1976-01-06 |
| GB1490584A (en) | 1977-11-02 |
| DE2520759A1 (de) | 1976-02-12 |
| BR7502978A (pt) | 1976-03-23 |
| DE2520759B2 (de) | 1977-06-30 |
| US3944493A (en) | 1976-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1041824A (en) | Electrographic toner and developer composition | |
| CA1060696A (en) | Electrographic toner and developer composition | |
| US4323634A (en) | Electrographic toner and developer composition containing quaternary ammonium salt charge control agent | |
| US3893935A (en) | Electrographic toner and developer composition | |
| CA1098751A (en) | Electrographic toner and developer composition containing a 4-aza-1-azoniabicyclo-(2.2.2.)-octane salt as a charge control agent | |
| CA1064304A (en) | Method for producing improved electrographic developer | |
| US4264697A (en) | Imaging system | |
| US4684596A (en) | Electrographic toner and developer composition containing quaternary ammonium salt charge-control agent | |
| CA1148403A (en) | Toners containing alkyl pyridinium compounds and their hydrates | |
| US4221856A (en) | Electrographic toner containing resin-compatible quaternary ammonium compound | |
| US4814250A (en) | Electrophotographic toner and developer compositions containing dioctylsulfosuccinate and sodium benzoate charge control agents | |
| US3647696A (en) | Uniform polarity resin electrostatic toners | |
| US3809554A (en) | Dry electrostatic toner composition and process of developing | |
| US4269922A (en) | Positive toners containing long chain hydrazinium compounds | |
| JPH0154694B2 (enExample) | ||
| US4304830A (en) | Toner additives | |
| US4254205A (en) | Positive toners containing alkyl picolinium compounds as charge control agents | |
| US4286038A (en) | Positive toners containing alkyl picolinium compounds | |
| JPS61128256A (ja) | 静電荷像現像用現像剤 | |
| US4264702A (en) | Positive toners containing alkyl morpholinium compounds as charge control agents | |
| US5013628A (en) | Particulate toner material with charge control agent | |
| US4293631A (en) | Electrographic toner compositions | |
| GB2034912A (en) | Electrostatographic toner | |
| JPS6037471B2 (ja) | 電気的潜像用トナ− | |
| JPS61162054A (ja) | 静電荷像現像用トナ− |