CA1030964A - Substituted pyridinyloxy(thio)phenyl -acetamides,-ureas and urea derivatives - Google Patents
Substituted pyridinyloxy(thio)phenyl -acetamides,-ureas and urea derivativesInfo
- Publication number
- CA1030964A CA1030964A CA218,110A CA218110A CA1030964A CA 1030964 A CA1030964 A CA 1030964A CA 218110 A CA218110 A CA 218110A CA 1030964 A CA1030964 A CA 1030964A
- Authority
- CA
- Canada
- Prior art keywords
- acetamides
- ureas
- thio
- phenyl
- urea derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- UYVSZOYMHHWUJC-UHFFFAOYSA-N 2-phenyl-2-pyridin-2-yloxysulfanylacetamide Chemical class C=1C=CC=CC=1C(C(=O)N)SOC1=CC=CC=N1 UYVSZOYMHHWUJC-UHFFFAOYSA-N 0.000 title 1
- 150000003672 ureas Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/435,615 US3931201A (en) | 1974-01-22 | 1974-01-22 | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1030964A true CA1030964A (en) | 1978-05-09 |
Family
ID=23729105
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA218,110A Expired CA1030964A (en) | 1974-01-22 | 1975-01-17 | Substituted pyridinyloxy(thio)phenyl -acetamides,-ureas and urea derivatives |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US3931201A (ref) |
| JP (1) | JPS50101534A (ref) |
| BR (1) | BR7500308A (ref) |
| CA (1) | CA1030964A (ref) |
| DE (1) | DE2501648A1 (ref) |
| ES (1) | ES433835A1 (ref) |
| FR (1) | FR2258382A1 (ref) |
| IT (1) | IT1051003B (ref) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083714A (en) * | 1974-10-17 | 1978-04-11 | Ishihara Sangyo Kaisha, Ltd. | Alkoxyalkyl esters of substituted pyridyloxyphenoxy-2-propanoic acids, herbicidal composition containing the same and method of use thereof |
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| EP0000176B1 (de) * | 1977-06-29 | 1981-09-16 | Ciba-Geigy Ag | Pyridyloxy-phenoxy-alkancarbonsäurederivate, Verfahren zu deren Herstellung, und deren Verwendung als Herbizide oder als pflanzenwachstumsregulierende Mittel |
| US4491468A (en) * | 1977-07-22 | 1985-01-01 | The Dow Chemical Company | Herbicidal trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanenitriles and derivatives thereof |
| US4479001A (en) * | 1977-07-22 | 1984-10-23 | The Dow Chemical Company | Trifluoromethyl pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof |
| US4628099A (en) * | 1977-07-22 | 1986-12-09 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy propanoic acid chlorides |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| NL189293C (nl) * | 1978-02-06 | 1993-03-01 | Ishihara Sangyo Kaisha | Insecticide n-benzoyl-n'-fenylureumverbindingen en insecticide samenstelling op basis van een dergelijke verbinding. |
| EP0021613B1 (en) * | 1979-06-20 | 1983-04-06 | Imperial Chemical Industries Plc | Pyridine derivatives, processes for preparing them, herbicidal compositions containing them and methods of killing plants therewith |
| AU532156B2 (en) * | 1979-09-07 | 1983-09-22 | Ishihara Sangyo Kaisha Ltd. | N-benzoyl-n'-pyridyloxy phenyl urea |
| US4738710A (en) * | 1979-11-19 | 1988-04-19 | Ici Australia Limited | Herbicidal alkane carboxylic acid derivatives |
| AU541697B2 (en) * | 1979-11-19 | 1985-01-17 | Ici Australia Limited | Quinoline derivatives |
| US4330321A (en) * | 1981-03-16 | 1982-05-18 | The Dow Chemical Company | Compounds and method for selectively controlling grassy weeds in broadleaved crops |
| US4371537A (en) * | 1981-08-13 | 1983-02-01 | The Dow Chemical Company | Sulfur-substituted phenoxypyridines having antiviral activity |
| CA1215067A (en) * | 1982-10-18 | 1986-12-09 | Sudarshan K. Malhotra | 2-(6-phenoxy-3-nitro-2-pyridinoxy)-propionate compounds |
| AU2818584A (en) * | 1983-03-29 | 1984-10-25 | Fmc Corporation | N-phenyl-n-(pyridinyl-n-oxide)urea plant regulators |
| US4787931A (en) * | 1984-03-06 | 1988-11-29 | Fmc Corporation | N-phenyl-N'-(pyridinyl-N-oxide)urea plant regulators |
| DE3422077A1 (de) * | 1984-06-14 | 1985-12-19 | Bayer Ag, 5090 Leverkusen | Substituierte carbonsaeureanilide |
| US4735650A (en) * | 1985-10-10 | 1988-04-05 | Fmc Corporation | Pyridazinylurea N-oxide plant regulators |
| US4808722A (en) * | 1985-10-31 | 1989-02-28 | Fmc Corporation | Pyridinylurea N-oxide compounds and agricultural uses |
| CA1289559C (en) * | 1985-10-31 | 1991-09-24 | Robert N. Ii Henrie | Pyridinylurea compounds and agricultural uses |
| US4818271A (en) * | 1985-10-31 | 1989-04-04 | Fmc Corporation | Pyridinylurea compounds and agricultural uses |
| DE3544208A1 (de) * | 1985-12-13 | 1987-06-19 | Bayer Ag | Pyrimidylmercapto-acylanilide |
| DE3545569A1 (de) * | 1985-12-21 | 1987-06-25 | Hoechst Ag | Neue pyridin-derivate, verfahren zu ihrer herstellung, sie enthaltene mittel und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4866079A (en) * | 1986-03-19 | 1989-09-12 | Ciba-Geigy Corporation | N-pyridyloxyphenylisothioureas and the use thereof in pest control |
| DE3614846A1 (de) * | 1986-05-02 | 1987-11-05 | Bayer Ag | Pyridylthio-acylanilide |
| IL83488A (en) * | 1986-08-15 | 1991-12-15 | Ciba Geigy Ag | Heterocyclic substituted thioureas,isothioureas and carbodiimides,process for their preparation and insecticidal and acaricidal compositions containing them |
| US4888348A (en) * | 1986-09-04 | 1989-12-19 | Ciba-Geigy Corporation | Substituted thioureas, isothioureas and carbodiimides |
| US4897424A (en) * | 1987-06-18 | 1990-01-30 | Ciba-Geigy Corporation | Aryloxyphenylthioureas, aryloxyphenylisothioureas and aryloxyphenylcarbodiimides and pesticidal compositions containing them |
| EP0298915B1 (de) * | 1987-07-07 | 1992-05-20 | Ciba-Geigy Ag | Pyridylthio-, Pyridylsulfinyl- und Pyridylsulfonyl-phenyl-thioharnstoffe, -isothioharnstoffe und -carbodiimide, ihre Herstellung und Verwendung bei der Kontrolle von Schädlingen |
| DE3824788A1 (de) * | 1988-07-21 | 1990-02-22 | Basf Ag | Cyclopropancarboxamide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| JP2930708B2 (ja) * | 1988-12-23 | 1999-08-03 | ザ ダウ ケミカル カンパニー | イソチオシアナト官能化金属錯体の製造方法 |
| US6963792B1 (en) * | 1992-01-21 | 2005-11-08 | Sri International | Surgical method |
| FR2735476B1 (fr) * | 1995-06-14 | 1997-07-18 | Rhone Poulenc Rorer Sa | Nouvelle application de derives du pyrrole |
| US7329670B1 (en) | 1997-12-22 | 2008-02-12 | Bayer Pharmaceuticals Corporation | Inhibition of RAF kinase using aryl and heteroaryl substituted heterocyclic ureas |
| US7517880B2 (en) * | 1997-12-22 | 2009-04-14 | Bayer Pharmaceuticals Corporation | Inhibition of p38 kinase using symmetrical and unsymmetrical diphenyl ureas |
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| WO2000041698A1 (en) | 1999-01-13 | 2000-07-20 | Bayer Corporation | φ-CARBOXY ARYL SUBSTITUTED DIPHENYL UREAS AS p38 KINASE INHIBITORS |
| EP1140840B1 (en) | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7928239B2 (en) | 1999-01-13 | 2011-04-19 | Bayer Healthcare Llc | Inhibition of RAF kinase using quinolyl, isoquinolyl or pyridyl ureas |
| RU2319693C9 (ru) | 1999-01-13 | 2008-08-20 | Байер Копэрейшн | Производные мочевины (варианты), фармацевтическая композиция (варианты) и способ лечения заболевания, связанного с ростом раковых клеток (варианты) |
| US7235576B1 (en) | 2001-01-12 | 2007-06-26 | Bayer Pharmaceuticals Corporation | Omega-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7371763B2 (en) | 2001-04-20 | 2008-05-13 | Bayer Pharmaceuticals Corporation | Inhibition of raf kinase using quinolyl, isoquinolyl or pyridyl ureas |
| CN1318404C (zh) | 2002-02-11 | 2007-05-30 | 拜耳制药公司 | 作为激酶抑制剂的芳基脲类化合物 |
| WO2003068228A1 (en) | 2002-02-11 | 2003-08-21 | Bayer Pharmaceuticals Corporation | Aryl ureas with angiogenesis inhibiting activity |
| AU2003209119A1 (en) | 2002-02-11 | 2003-09-04 | Bayer Pharmaceuticals Corporation | Pyridine, quinoline, and isoquinoline n-oxides as kinase inhibitors |
| US7557129B2 (en) | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| DE602004007382T2 (de) | 2003-05-20 | 2008-04-17 | Bayer Pharmaceuticals Corp., West Haven | Diaryl-harnstoffe für durch pdgfr vermittelte krankheiten |
| NZ544920A (en) | 2003-07-23 | 2009-11-27 | Bayer Healthcare Llc | 4{4-[3-(4-chloro-3-trifluoromethylphenyl)-ureido]-3-fluorophenoxy}-pyridine-2-carboxylic acid methylamide and metabolites for the treatment and prevention of diseases and conditions |
| AU2017316909B2 (en) * | 2016-08-26 | 2020-11-19 | Sumitomo Chemical Company, Limited | 1-acetyl-3-phenyl urea compound, and use thereof |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE593743A (ref) * | 1959-08-05 | |||
| CH434868A (de) * | 1964-02-10 | 1967-04-30 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| DE1289844B (de) * | 1964-11-06 | 1969-02-27 | Hoechst Ag | Thioharnstoffe sowie Verfahren zu ihrer Herstellung |
| GB1190268A (en) * | 1966-05-12 | 1970-04-29 | Nyegaard & Co As | Pyridine Derivatives |
| NL6808378A (ref) * | 1967-06-15 | 1968-12-16 | ||
| US3651072A (en) * | 1967-08-21 | 1972-03-21 | Monsanto Co | 3-(halophenoxy) pyridines |
| US3576616A (en) * | 1969-05-15 | 1971-04-27 | Monsanto Co | Herbicidal compositions and methods |
-
1974
- 1974-01-22 US US05/435,615 patent/US3931201A/en not_active Expired - Lifetime
-
1975
- 1975-01-15 ES ES433835A patent/ES433835A1/es not_active Expired
- 1975-01-16 FR FR7501297A patent/FR2258382A1/fr not_active Withdrawn
- 1975-01-16 DE DE19752501648 patent/DE2501648A1/de active Pending
- 1975-01-16 BR BR308/75A patent/BR7500308A/pt unknown
- 1975-01-17 CA CA218,110A patent/CA1030964A/en not_active Expired
- 1975-01-20 JP JP857875A patent/JPS50101534A/ja active Pending
- 1975-01-21 IT IT19434/75A patent/IT1051003B/it active
- 1975-10-16 US US05/623,177 patent/US4063928A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1051003B (it) | 1981-04-21 |
| DE2501648A1 (de) | 1975-07-24 |
| ES433835A1 (es) | 1976-11-16 |
| AU7598074A (en) | 1976-06-03 |
| FR2258382A1 (ref) | 1975-08-18 |
| US4063928A (en) | 1977-12-20 |
| BR7500308A (pt) | 1975-11-04 |
| US3931201A (en) | 1976-01-06 |
| JPS50101534A (ref) | 1975-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1030964A (en) | Substituted pyridinyloxy(thio)phenyl -acetamides,-ureas and urea derivatives | |
| AU500910B2 (en) | Benzimidazolinone derivatives | |
| AU498132B2 (en) | 5 - nitro - pyrimidine derivatives | |
| AU470711B2 (en) | Oxacyclohexane derivatives | |
| AU501915B2 (en) | Phenyl-pyridylamine derivatives | |
| AU503060B2 (en) | Ergopeptine derivatives | |
| AU1595676A (en) | Guanidine derivatives | |
| AU472498B2 (en) | Aminomethylarylmethlpenicillin derivatives | |
| AU480171B2 (en) | Substituted pyridinyloxy (thio) phenylalkanamides and -ureas | |
| AU485845B2 (en) | 4-hydroxy-5-azacoumarin and derivatives | |
| AU488539B2 (en) | 3, 4-dicarboxycephalosporins and derivatives | |
| AU492279B2 (en) | 3--alkylisoxazole derivatives and herbicides containing them | |
| GB1519353A (en) | Phenylsuphinyl and thio amidine derivatives | |
| AU492102B2 (en) | 5-(2-hydroxypropoxy)-4-oxo-8 propyl-4h-1-benzopyran and derivatives thereof | |
| AU492952B2 (en) | Thiadiazole derivatives | |
| AU487437B2 (en) | Thioxanthene derivatives | |
| AU489931B2 (en) | Nitroimidazole derivatives | |
| AU8030175A (en) | 3, 4-dicarboxycephalosporins and derivatives | |
| AU491977B2 (en) | N-acyl-n-substituted anilino derivatives | |
| AU496294B2 (en) | Phenoxyhydroxypropylamine derivatives | |
| AU497266B2 (en) | Eburnamenine derivatives | |
| AU479671B2 (en) | -aryl-4-substituted piperidinoalkanol derivatives | |
| AU480360B2 (en) | 2-aminomethyl-phenol derivatives | |
| AU485016B2 (en) | Mercaptomethylpyridine derivatives | |
| AU486830B2 (en) | Benzo-bicyclononene derivatives |