CA1025872A - Dibenzofuran and dibenzothiophene derivatives - Google Patents
Dibenzofuran and dibenzothiophene derivativesInfo
- Publication number
- CA1025872A CA1025872A CA170,956A CA170956A CA1025872A CA 1025872 A CA1025872 A CA 1025872A CA 170956 A CA170956 A CA 170956A CA 1025872 A CA1025872 A CA 1025872A
- Authority
- CA
- Canada
- Prior art keywords
- dibenzofuran
- dibenzothiophene derivatives
- dibenzothiophene
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical compound C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 title 2
- IYYZUPMFVPLQIF-ALWQSETLSA-N dibenzothiophene Chemical class C1=CC=CC=2[34S]C3=C(C=21)C=CC=C3 IYYZUPMFVPLQIF-ALWQSETLSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/76—Dibenzothiophenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2223391A DE2223391C3 (de) | 1972-05-13 | 1972-05-13 | Dibenzofuranderivate, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen enthaltend diese Verbindungen |
| DE19722261745 DE2261745A1 (de) | 1972-12-16 | 1972-12-16 | Dibenzofuran- und dibenzothiophenderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1025872A true CA1025872A (en) | 1978-02-07 |
Family
ID=25763245
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA170,956A Expired CA1025872A (en) | 1972-05-13 | 1973-05-10 | Dibenzofuran and dibenzothiophene derivatives |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3897453A (enExample) |
| JP (1) | JPS4948656A (enExample) |
| AT (1) | AT337685B (enExample) |
| CA (1) | CA1025872A (enExample) |
| CH (9) | CH612961A5 (enExample) |
| CS (2) | CS188892B2 (enExample) |
| DD (1) | DD106169A5 (enExample) |
| DK (1) | DK135684C (enExample) |
| ES (1) | ES414711A1 (enExample) |
| FR (1) | FR2184754B1 (enExample) |
| GB (1) | GB1369579A (enExample) |
| HU (1) | HU167789B (enExample) |
| IL (1) | IL42072A (enExample) |
| NL (1) | NL7305520A (enExample) |
| SE (1) | SE401676B (enExample) |
| YU (3) | YU35764B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4022805A (en) * | 1974-03-07 | 1977-05-10 | Hoffmann-La Roche Inc. | 8-Halo-dibenzofuran-3-acetic acids and certain esters thereof |
| US4097497A (en) * | 1975-02-10 | 1978-06-27 | Hoffmann-La Roche Inc. | Amides of 2-(3-dibenzofuran) alkanoic acids |
| JPS5196829A (ja) * | 1975-02-22 | 1976-08-25 | Shinkitosozairyo | |
| US4035428A (en) * | 1975-08-08 | 1977-07-12 | Monsanto Company | Process for production of orthophenylphenol |
| US4334078A (en) * | 1976-03-24 | 1982-06-08 | Hoffmann-La Roche Inc. | Dibenzothiophenes |
| US4107322A (en) * | 1976-06-03 | 1978-08-15 | American Hoechst Corporation | Benzyl and related esters of 6,11-dihydrodibenz[b,e]oxepin-acetic acids |
| US4219657A (en) * | 1977-12-19 | 1980-08-26 | Hoffmann-La Roche Inc. | Dibenzothiophenes |
| US4222944A (en) * | 1978-07-31 | 1980-09-16 | Hoffmann-La Roche Inc. | Halo-3-dibenzofuran alkanonitriles |
| EP0068563A3 (en) * | 1981-06-23 | 1983-06-15 | THE PROCTER & GAMBLE COMPANY | Heterocyclic acetic acid compounds and compositions for treating bone diseases |
| US4743694A (en) * | 1986-04-11 | 1988-05-10 | Mercek & Co., Inc. | Diastereocontrolled synthesis of 2-amino alcohols |
| US5373009A (en) * | 1994-02-02 | 1994-12-13 | American Home Products Corporation | Dibenzofuranyl esters of N-heterocyclic carboxylic acids |
| US6022307A (en) * | 1998-07-14 | 2000-02-08 | American Cyanamid Company | Substituted dibenzothiophenes having antiangiogenic activity |
| MXPA05004432A (es) * | 2002-10-23 | 2005-11-23 | Glenmark Pharmaceuticals Ltd | Compuestos triciclicos novedosos utiles para el tratamiento de desordenes inflamatorios y alergicos, procedimiento para su preparacion y composiciones farmaceuticas que lo contienen. |
| US8236485B2 (en) | 2002-12-20 | 2012-08-07 | Advanced Technology Materials, Inc. | Photoresist removal |
| JP6252306B2 (ja) * | 2014-03-28 | 2017-12-27 | 東ソー株式会社 | ヘテロアセン誘導体の製造方法 |
| CN108623559A (zh) * | 2018-03-28 | 2018-10-09 | 同济大学 | 一种二苯并噻吩甲酰甲酸酯类光引发剂及其制备方法与应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1175996A (en) * | 1967-05-12 | 1970-01-01 | Lepetit Spa | Diethyl-alpha-(2-Dibenzofuranyl)malonate |
| US3506688A (en) * | 1968-01-05 | 1970-04-14 | Dow Chemical Co | Hydroxyaluminum salt of 2-benzofuranacetic acid |
| US3655697A (en) * | 1969-06-25 | 1972-04-11 | Merck & Co Inc | Ortho-hydroxydibenzofuran carboxylic acid and acid derivatives substituted by a halogen atom |
| US3657281A (en) * | 1969-12-31 | 1972-04-18 | Parke Davis & Co | 4-aryl-1-dibenzofuran-alkanoic acids and salts thereof |
-
1973
- 1973-04-19 NL NL7305520A patent/NL7305520A/xx not_active Application Discontinuation
- 1973-04-20 IL IL42072A patent/IL42072A/xx unknown
- 1973-04-26 CH CH1115077A patent/CH612961A5/xx not_active IP Right Cessation
- 1973-04-26 CH CH318076A patent/CH596200A5/xx not_active IP Right Cessation
- 1973-04-26 CH CH1061177A patent/CH602697A5/xx not_active IP Right Cessation
- 1973-04-26 CH CH317776A patent/CH598242A5/xx not_active IP Right Cessation
- 1973-04-26 CH CH318176A patent/CH596201A5/xx not_active IP Right Cessation
- 1973-04-26 CS CS73894A patent/CS188892B2/cs unknown
- 1973-04-26 CH CH317876A patent/CH602696A5/xx not_active IP Right Cessation
- 1973-04-26 CS CS733029A patent/CS188891B2/cs unknown
- 1973-04-26 CH CH601773A patent/CH593273A5/xx not_active IP Right Cessation
- 1973-04-26 CH CH1061077A patent/CH611613A5/xx not_active IP Right Cessation
- 1973-04-26 CH CH317976A patent/CH599950A5/xx not_active IP Right Cessation
- 1973-05-04 AT AT395073A patent/AT337685B/de not_active IP Right Cessation
- 1973-05-09 SE SE7306515A patent/SE401676B/xx unknown
- 1973-05-10 US US358872A patent/US3897453A/en not_active Expired - Lifetime
- 1973-05-10 CA CA170,956A patent/CA1025872A/en not_active Expired
- 1973-05-11 GB GB2263173A patent/GB1369579A/en not_active Expired
- 1973-05-11 DD DD170778A patent/DD106169A5/xx unknown
- 1973-05-11 HU HUME1628A patent/HU167789B/hu unknown
- 1973-05-11 DK DK262473A patent/DK135684C/da active
- 1973-05-11 FR FR7317190A patent/FR2184754B1/fr not_active Expired
- 1973-05-12 ES ES414711A patent/ES414711A1/es not_active Expired
- 1973-05-12 JP JP48053041A patent/JPS4948656A/ja active Pending
-
1979
- 1979-03-06 YU YU550/79A patent/YU35764B/xx unknown
- 1979-03-06 YU YU00548/79A patent/YU54879A/xx unknown
- 1979-03-06 YU YU547/79A patent/YU35763B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU55079A (en) | 1980-10-31 |
| DK135684C (da) | 1977-11-14 |
| YU54779A (en) | 1980-10-31 |
| US3897453A (en) | 1975-07-29 |
| FR2184754B1 (enExample) | 1976-05-14 |
| HU167789B (enExample) | 1975-12-25 |
| CS188892B2 (en) | 1979-03-30 |
| ATA395073A (de) | 1976-11-15 |
| CH593273A5 (enExample) | 1977-11-30 |
| CS188891B2 (en) | 1979-03-30 |
| AT337685B (de) | 1977-07-11 |
| CH602697A5 (enExample) | 1978-07-31 |
| SE401676B (sv) | 1978-05-22 |
| NL7305520A (enExample) | 1973-11-15 |
| CH611613A5 (enExample) | 1979-06-15 |
| CH596201A5 (enExample) | 1978-03-15 |
| IL42072A0 (en) | 1973-06-29 |
| CH602696A5 (enExample) | 1978-07-31 |
| GB1369579A (en) | 1974-10-09 |
| IL42072A (en) | 1979-05-31 |
| YU54879A (en) | 1981-02-28 |
| CH612961A5 (enExample) | 1979-08-31 |
| FR2184754A1 (enExample) | 1973-12-28 |
| CH596200A5 (enExample) | 1978-03-15 |
| CH599950A5 (enExample) | 1978-06-15 |
| YU35763B (en) | 1981-06-30 |
| ES414711A1 (es) | 1976-10-16 |
| JPS4948656A (enExample) | 1974-05-11 |
| YU35764B (en) | 1981-06-30 |
| CH598242A5 (enExample) | 1978-04-28 |
| DK135684B (da) | 1977-06-06 |
| DD106169A5 (enExample) | 1974-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1025872A (en) | Dibenzofuran and dibenzothiophene derivatives | |
| AU467361B2 (en) | Q-aryl-4-substituted piperidinoalkanol derivatives | |
| CA987329A (en) | Benzopyran derivatives | |
| CA1019738A (en) | Isothiocyanopyridine derivatives | |
| AU470719B2 (en) | Oxazinoindole-and thiazinoinindole derivatives | |
| AU467405B2 (en) | Diphenylalkyllactamimide derivatives | |
| CA1017744A (en) | Perhydrofluorenetetrol and perhydrophenanthrenetetrol derivatives | |
| AU471111B2 (en) | 1-cyclopropyl-1-phenyl--amino-1-alkanols and 1-lower-alklacyl derivatives | |
| CA1018161A (en) | Indan-1-carboxamide derivatives | |
| AU470763B2 (en) | Pyrano-and thiopyranoindole derivatives | |
| CA975785A (en) | Benzopyran derivatives | |
| AU479400B2 (en) | Dibenzofuran and dibenzothiophen derivatives | |
| CA962689A (en) | Benzopyran derivatives | |
| AU5533173A (en) | Dibenzofuran and dibenzothiophen derivatives | |
| CA915705A (en) | Derivatives of dipropylacetylanilide | |
| AU479417B2 (en) | Coumarin and coumarinimide derivatives | |
| CA910296A (en) | 17-acetylgonanes and derivatives therefor | |
| CA899346A (en) | Benzazocine and benzothiazocine derivatives | |
| CA900977A (en) | Benzazocine and benzothiazocine derivatives | |
| CA915689A (en) | 2-propargylamino-5-phenyl-2-oxazolin-4-one and derivatives | |
| CA892026A (en) | Derivatives of dibenzocycloheptenes | |
| CA1012557A (en) | 2-amino-1-phenyl-butane derivatives | |
| CA904852A (en) | Tetrahydrocyclopropadibenzazepine derivatives | |
| AU482792B2 (en) | Indan-1-carboxamide derivatives | |
| AU477427B2 (en) | 2-fluoro-substituted thiazanthene derivatives |