BE764556A - Nouveaux derives d'azidophenyl-1,4-dihydro-pyridine - Google Patents
Nouveaux derives d'azidophenyl-1,4-dihydro-pyridineInfo
- Publication number
- BE764556A BE764556A BE764556A BE764556A BE764556A BE 764556 A BE764556 A BE 764556A BE 764556 A BE764556 A BE 764556A BE 764556 A BE764556 A BE 764556A BE 764556 A BE764556 A BE 764556A
- Authority
- BE
- Belgium
- Prior art keywords
- azidophenyl
- dihydro
- pyridine
- new derivatives
- derivatives
- Prior art date
Links
- HZTQFRWYSBECDB-UHFFFAOYSA-N N(=[N+]=[N-])C=1N(C=CCC1)C1=CC=CC=C1 Chemical class N(=[N+]=[N-])C=1N(C=CCC1)C1=CC=CC=C1 HZTQFRWYSBECDB-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2013431A DE2013431C3 (de) | 1970-03-20 | 1970-03-20 | 4-Azidophenyl-l,4-dihydropyridin-3,5-dicarbonsäureester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE764556A true BE764556A (fr) | 1971-09-20 |
Family
ID=5765765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE764556A BE764556A (fr) | 1970-03-20 | 1971-03-19 | Nouveaux derives d'azidophenyl-1,4-dihydro-pyridine |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3708489A (enExample) |
| JP (1) | JPS5521032B1 (enExample) |
| AT (1) | AT303040B (enExample) |
| BE (1) | BE764556A (enExample) |
| CH (1) | CH559179A5 (enExample) |
| CS (2) | CS160139B2 (enExample) |
| DE (1) | DE2013431C3 (enExample) |
| FI (1) | FI54295C (enExample) |
| FR (1) | FR2085727B1 (enExample) |
| GB (1) | GB1305795A (enExample) |
| IE (1) | IE35233B1 (enExample) |
| IL (1) | IL36320A (enExample) |
| NL (1) | NL169468C (enExample) |
| NO (1) | NO131986C (enExample) |
| SE (1) | SE364710B (enExample) |
| ZA (1) | ZA711597B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2005116C3 (de) * | 1970-02-05 | 1980-02-14 | Bayer Ag, 5090 Leverkusen | Symmetrische 1,4-Dihydropyridin-3,5-dicarbonsäureester |
| US4021434A (en) * | 1972-01-22 | 1977-05-03 | Yamanouchi Pharmaceutical Co., Ltd. | Sodium β-[2,6-dimethyl-3,5-bis(ethoxycarbonyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-1-yl]ethyl sulfate |
| GB1430961A (en) * | 1972-01-22 | 1976-04-07 | Yamanouchi Pharma Co Ltd | 1-substituted-1,4-dihyddrypyridine derivatives |
| US3939171A (en) * | 1972-03-06 | 1976-02-17 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| DE2210672C3 (de) * | 1972-03-06 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | N-substituierte unsymmetrische 1 ^-Dihydropyridin-S^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3917620A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| US3957998A (en) * | 1972-03-06 | 1976-05-18 | Bayer Aktiengesellschaft | Use of 2,6-diamino-4-substituted-1,4-dihydropyridine-3,5-dicarboxylic acid esters for effecting coronary vessel dilation and treating hypertension |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| DD106832A5 (enExample) * | 1972-03-06 | 1974-07-05 | ||
| US3985886A (en) * | 1972-03-06 | 1976-10-12 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives and process for their preparation |
| US3857849A (en) * | 1973-02-28 | 1974-12-31 | Bayer Ag | 2-amino-1,4-dihydropyridine derivatives |
| US3992545A (en) * | 1972-03-06 | 1976-11-16 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives in pharmaceutical compositions |
| US3860601A (en) * | 1972-03-06 | 1975-01-14 | Horst Meyer | 2,6-diamino-1,4-dihydropyridine derivatives |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| US3974275A (en) * | 1972-04-18 | 1976-08-10 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters useful as coronary vessel dilators and anti-hypertensives |
| US4136187A (en) * | 1972-08-12 | 1979-01-23 | Bayer Aktiengesellschaft | Antihypertensive 2-amino-4,5-dihydropyridine derivatives |
| DE2239815C2 (de) * | 1972-08-12 | 1983-02-10 | Bayer Ag, 5090 Leverkusen | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
| DE2242787C2 (de) * | 1972-08-31 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | 4-Phenyl-6-amino-3,4-dihydropyridon-(2)-3,5-dicarbonsäure-diäthylesterderivate, ein Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| US4002762A (en) * | 1973-03-03 | 1977-01-11 | Bayer Aktiengesellschaft | 2-Amino-3,4-dihydropyridines used to effect coronary vessel dilation and treat hypertension |
| US4020178A (en) * | 1973-07-12 | 1977-04-26 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine esters used as coronary dilators and anti-hypertensives |
| NO883326L (no) * | 1987-08-11 | 1989-02-13 | Bayer Ag | Dhp-retard-tilberedning. |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
-
1970
- 1970-03-20 DE DE2013431A patent/DE2013431C3/de not_active Expired
-
1971
- 1971-03-02 IL IL36320A patent/IL36320A/en unknown
- 1971-03-09 IE IE293/71A patent/IE35233B1/xx unknown
- 1971-03-10 FI FI694/71A patent/FI54295C/fi active
- 1971-03-11 CS CS1794A patent/CS160139B2/cs unknown
- 1971-03-11 CS CS3638*A patent/CS160140B2/cs unknown
- 1971-03-11 ZA ZA711597A patent/ZA711597B/xx unknown
- 1971-03-12 SE SE03213/71A patent/SE364710B/xx unknown
- 1971-03-17 US US00125427A patent/US3708489A/en not_active Expired - Lifetime
- 1971-03-18 NO NO1058/71A patent/NO131986C/no unknown
- 1971-03-18 NL NLAANVRAGE7103672,A patent/NL169468C/xx not_active IP Right Cessation
- 1971-03-19 CH CH405371A patent/CH559179A5/xx not_active IP Right Cessation
- 1971-03-19 JP JP1545571A patent/JPS5521032B1/ja active Pending
- 1971-03-19 FR FR7109866A patent/FR2085727B1/fr not_active Expired
- 1971-03-19 AT AT239271A patent/AT303040B/de not_active IP Right Cessation
- 1971-03-19 BE BE764556A patent/BE764556A/xx not_active IP Right Cessation
- 1971-04-19 GB GB2454071*A patent/GB1305795A/en not_active Expired
-
1972
- 1972-06-02 US US00259289A patent/US3773956A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL36320A0 (en) | 1971-05-26 |
| FI54295B (fi) | 1978-07-31 |
| FR2085727B1 (enExample) | 1974-09-27 |
| IL36320A (en) | 1974-10-22 |
| US3708489A (en) | 1973-01-02 |
| NO131986B (enExample) | 1975-05-26 |
| ZA711597B (en) | 1972-06-28 |
| CH559179A5 (enExample) | 1975-02-28 |
| CS160139B2 (enExample) | 1975-02-28 |
| DE2013431A1 (de) | 1971-10-07 |
| GB1305795A (enExample) | 1973-02-07 |
| JPS5521032B1 (enExample) | 1980-06-06 |
| IE35233L (en) | 1971-09-20 |
| NL169468C (nl) | 1982-07-16 |
| SE364710B (enExample) | 1974-03-04 |
| US3773956A (en) | 1973-11-20 |
| CS160140B2 (enExample) | 1975-02-28 |
| AT303040B (de) | 1972-11-10 |
| NL7103672A (enExample) | 1971-09-22 |
| IE35233B1 (en) | 1975-12-24 |
| NO131986C (enExample) | 1975-09-03 |
| SU365069A3 (enExample) | 1972-12-28 |
| FR2085727A1 (enExample) | 1971-12-31 |
| NL169468B (nl) | 1982-02-16 |
| FI54295C (fi) | 1978-11-10 |
| DE2013431C3 (de) | 1979-12-20 |
| DE2013431B2 (de) | 1979-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE762580A (fr) | Nouveaux derives de 1,4-dihydropyridine | |
| BE764556A (fr) | Nouveaux derives d'azidophenyl-1,4-dihydro-pyridine | |
| FI55333C (fi) | Foerfarande foer framstaellning av n-(1,1,1-trisubstituerade)-metylazoler | |
| BE765313A (fr) | Nouveaux derives du thiochromanne | |
| BE814790A (fr) | Nouveaux derives d'arylthioalcanols | |
| BE779128A (fr) | Nouveaux derives de benzazine | |
| BE791889A (fr) | Nouveaux derives de la pyridine | |
| BE748568A (fr) | Nouveaux derives de la piperidine | |
| BE745077A (fr) | Nouveaux derives de l'oxo-3 dihydro-2, 3 benzoxazine-1,4 | |
| BE761219A (fr) | Derives d'isoquinoleine | |
| BE760483A (fr) | Nouveaux derives de cyanophenyl-1,4-dyhydropyridine | |
| BE792374A (fr) | Nouveaux derives d'isoindoline | |
| BE770308A (fr) | Nouveaux derives de la 2-pyrrolidinone | |
| BE751440A (fr) | Nouveaux derives de la piperidine | |
| BE774677A (fr) | Derives d'indoline | |
| BE774680A (fr) | Derives d'indoline | |
| BE791907A (fr) | Nouveaux derives des imidazolines | |
| BE775145A (fr) | Derives d'ergolene | |
| BE784076A (fr) | Nouveaux derives d'acetophenonoxine | |
| BE780630A (fr) | Nouveaux derives d'imidazo-pyridine | |
| BE772101A (fr) | Nouveaux derives d'uree | |
| BE820240A (fr) | Nouveaux derives de la piperidine | |
| BE830394Q (fr) | Nouveaux derives benzodiazepiniques-1,4" | |
| BE819651A (fr) | Nouveaux derives d'isoquinoleine | |
| BE786970A (fr) | Nouveaux derives dihydrobenzopyraniques |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RE | Patent lapsed |
Owner name: BAYER A.G. Effective date: 19840319 |