BE647142A - - Google Patents
Info
- Publication number
- BE647142A BE647142A BE647142DA BE647142A BE 647142 A BE647142 A BE 647142A BE 647142D A BE647142D A BE 647142DA BE 647142 A BE647142 A BE 647142A
- Authority
- BE
- Belgium
- Prior art keywords
- alkyl
- group
- halogen
- residue
- component
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 239000000975 dye Substances 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 230000008878 coupling Effects 0.000 claims description 5
- 238000010168 coupling process Methods 0.000 claims description 5
- 238000005859 coupling reaction Methods 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000000987 azo dye Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 229920000728 polyester Polymers 0.000 claims description 4
- -1 polyethylene terephthalates Polymers 0.000 claims description 4
- 238000004043 dyeing Methods 0.000 claims description 3
- 239000000835 fiber Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000004753 textile Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 2
- 229920002284 Cellulose triacetate Polymers 0.000 claims 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 claims 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 150000002500 ions Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000009998 heat setting Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0039607 | 1963-04-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE647142A true BE647142A (enExample) | 1964-08-17 |
Family
ID=7097850
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE647142D BE647142A (enExample) | 1963-04-27 | 1964-04-27 |
Country Status (1)
| Country | Link |
|---|---|
| BE (1) | BE647142A (enExample) |
-
1964
- 1964-04-27 BE BE647142D patent/BE647142A/fr unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE647142A (enExample) | ||
| US3057848A (en) | 2-amino-4, 6-dinitrobenzothiazole and azo dyestuffs therefrom | |
| BE708604A (enExample) | ||
| US3836549A (en) | Anthraquinone compounds | |
| US3098096A (en) | 3-and 4-(2-chlorethylsulfonyl)-benzoyl chloride | |
| US3047582A (en) | Phthalocyanine-sulfonamides and-carbonamides | |
| US2434150A (en) | Monoazo compounds | |
| US2194925A (en) | Primary arylamines and the manufacture thereof | |
| US3338659A (en) | Method and composition for dyeing certain textile fibers with beta-arylated naphthoxidines | |
| US2173053A (en) | Dye for cellulose esters and ethers | |
| US3822246A (en) | Azo compounds containing an imidoalkanoylamino group | |
| US563382A (en) | Friedrich krecke and ignaz rosenberg | |
| BE436330A (enExample) | ||
| BE657303A (enExample) | ||
| CH381344A (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| JPS5924755A (ja) | モノアゾ化合物及びそれを用いる染色法 | |
| US677239A (en) | Halogen-substituted indigo and process of making same. | |
| AT204146B (de) | Verfahren zur Herstellung von kupplungsfähigen Phthalocyaninderivaten | |
| US450037A (en) | Hermann reisenegger | |
| AT232622B (de) | Verfahren zur Herstellung von neuen Anthrachinonfarbstoffen | |
| US605921A (en) | Blue anthraquinone dye | |
| BE397338A (enExample) | ||
| BE569964A (enExample) | ||
| BE703200A (enExample) | ||
| BE566956A (enExample) |