BE607375A - - Google Patents
Info
- Publication number
- BE607375A BE607375A BE607375DA BE607375A BE 607375 A BE607375 A BE 607375A BE 607375D A BE607375D A BE 607375DA BE 607375 A BE607375 A BE 607375A
- Authority
- BE
- Belgium
- Prior art keywords
- onium
- compound
- compounds
- bromide
- sep
- Prior art date
Links
- 150000004010 onium ions Chemical class 0.000 claims description 68
- 238000000034 method Methods 0.000 claims description 56
- -1 heterocyclic ammonium compound Chemical class 0.000 claims description 44
- 230000008569 process Effects 0.000 claims description 31
- 229910052709 silver Inorganic materials 0.000 claims description 27
- 239000004332 silver Substances 0.000 claims description 27
- 238000012546 transfer Methods 0.000 claims description 27
- 239000000839 emulsion Substances 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 22
- 238000011161 development Methods 0.000 claims description 13
- 230000002209 hydrophobic effect Effects 0.000 claims description 13
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 238000012545 processing Methods 0.000 claims description 9
- 150000001768 cations Chemical class 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 150000003868 ammonium compounds Chemical class 0.000 claims description 3
- 239000003086 colorant Substances 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 125000005496 phosphonium group Chemical group 0.000 claims 2
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium group Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims 2
- 150000003222 pyridines Chemical class 0.000 claims 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 66
- 239000000243 solution Substances 0.000 description 46
- 235000011121 sodium hydroxide Nutrition 0.000 description 22
- 239000001768 carboxy methyl cellulose Substances 0.000 description 19
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 17
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 17
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 17
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 16
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 229920002301 cellulose acetate Polymers 0.000 description 11
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 10
- 230000006872 improvement Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 108010010803 Gelatin Proteins 0.000 description 8
- 229920000159 gelatin Polymers 0.000 description 8
- 239000008273 gelatin Substances 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- 235000011852 gelatine desserts Nutrition 0.000 description 8
- 238000000926 separation method Methods 0.000 description 8
- ABFDKXBSQCTIKH-UHFFFAOYSA-M 1-ethylpyridin-1-ium;bromide Chemical compound [Br-].CC[N+]1=CC=CC=C1 ABFDKXBSQCTIKH-UHFFFAOYSA-M 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 235000019345 sodium thiosulphate Nutrition 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 5
- 150000001450 anions Chemical class 0.000 description 5
- 238000009792 diffusion process Methods 0.000 description 5
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 5
- 239000004312 hexamethylene tetramine Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 241000255969 Pieris brassicae Species 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 150000004026 tertiary sulfonium compounds Chemical class 0.000 description 4
- RWXZXCZBMQPOBF-UHFFFAOYSA-N 5-methyl-1H-benzimidazole Chemical compound CC1=CC=C2N=CNC2=C1 RWXZXCZBMQPOBF-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000000712 assembly Effects 0.000 description 3
- 238000000429 assembly Methods 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 3
- HIJUNUKEBATFPF-UHFFFAOYSA-M 1-ethylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 HIJUNUKEBATFPF-UHFFFAOYSA-M 0.000 description 2
- LAQYHRQFABOIFD-UHFFFAOYSA-N 2-methoxyhydroquinone Chemical compound COC1=CC(O)=CC=C1O LAQYHRQFABOIFD-UHFFFAOYSA-N 0.000 description 2
- WPBVJSPUBDVPPZ-UHFFFAOYSA-N 2-methyl-1-(2-phenylethyl)pyridin-1-ium Chemical compound CC1=CC=CC=[N+]1CCC1=CC=CC=C1 WPBVJSPUBDVPPZ-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- XJWSAJYUBXQQDR-UHFFFAOYSA-M dodecyltrimethylammonium bromide Chemical compound [Br-].CCCCCCCCCCCC[N+](C)(C)C XJWSAJYUBXQQDR-UHFFFAOYSA-M 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000005213 imbibition Methods 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000007480 spreading Effects 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 2
- VXUNBHPUGJFXIT-UHFFFAOYSA-M 1,1-dimethylpyrrolidin-1-ium;bromide Chemical compound [Br-].C[N+]1(C)CCCC1 VXUNBHPUGJFXIT-UHFFFAOYSA-M 0.000 description 1
- ZBFDBUWSMWBSCI-UHFFFAOYSA-M 1,1-dimethylpyrrolidin-1-ium;hydroxide Chemical compound [OH-].C[N+]1(C)CCCC1 ZBFDBUWSMWBSCI-UHFFFAOYSA-M 0.000 description 1
- XPDWILURLOSUQD-UHFFFAOYSA-N 1,2,3-trimethylquinolin-1-ium Chemical compound C1=CC=C2[N+](C)=C(C)C(C)=CC2=C1 XPDWILURLOSUQD-UHFFFAOYSA-N 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DMEHMWWKTXHHMO-UHFFFAOYSA-L 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;dibromide Chemical compound [Br-].[Br-].C=1C=CC=C[N+]=1CC[N+]1=CC=CC=C1 DMEHMWWKTXHHMO-UHFFFAOYSA-L 0.000 description 1
- HOWGOXCXIUWXSG-UHFFFAOYSA-N 1-(diethylamino)propane-1,1-diol Chemical compound CCN(CC)C(O)(O)CC HOWGOXCXIUWXSG-UHFFFAOYSA-N 0.000 description 1
- IZJAMTZFWZTTBC-UHFFFAOYSA-M 1-benzyl-2-ethylpyridin-1-ium;bromide Chemical compound [Br-].CCC1=CC=CC=[N+]1CC1=CC=CC=C1 IZJAMTZFWZTTBC-UHFFFAOYSA-M 0.000 description 1
- LKGFNNSOZPTLSS-UHFFFAOYSA-M 1-benzyl-2-methylpyridin-1-ium;bromide Chemical compound [Br-].CC1=CC=CC=[N+]1CC1=CC=CC=C1 LKGFNNSOZPTLSS-UHFFFAOYSA-M 0.000 description 1
- GLWHCXRACKOPRO-UHFFFAOYSA-M 1-benzylpyridin-1-ium;bromide Chemical compound [Br-].C=1C=CC=C[N+]=1CC1=CC=CC=C1 GLWHCXRACKOPRO-UHFFFAOYSA-M 0.000 description 1
- QJHCDMFAULPLAO-UHFFFAOYSA-M 1-butylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CCCC[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 QJHCDMFAULPLAO-UHFFFAOYSA-M 0.000 description 1
- OEIMXYNKWKCFOE-UHFFFAOYSA-N 1-ethylpyridazin-1-ium Chemical compound CC[N+]1=CC=CC=N1 OEIMXYNKWKCFOE-UHFFFAOYSA-N 0.000 description 1
- OIDIRWZVUWCCCO-UHFFFAOYSA-N 1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=CC=C1 OIDIRWZVUWCCCO-UHFFFAOYSA-N 0.000 description 1
- WTDKNKIQGBNMKG-UHFFFAOYSA-M 1-methylpyridin-1-ium;bromide Chemical compound [Br-].C[N+]1=CC=CC=C1 WTDKNKIQGBNMKG-UHFFFAOYSA-M 0.000 description 1
- SAORNRFCWXEYSW-UHFFFAOYSA-M 1-propylpyridin-1-ium;bromide Chemical compound [Br-].CCC[N+]1=CC=CC=C1 SAORNRFCWXEYSW-UHFFFAOYSA-M 0.000 description 1
- AUFZRCJENRSRLY-UHFFFAOYSA-N 2,3,5-trimethylhydroquinone Chemical compound CC1=CC(O)=C(C)C(C)=C1O AUFZRCJENRSRLY-UHFFFAOYSA-N 0.000 description 1
- QBQDROYKEQDPRX-UHFFFAOYSA-N 2,3-dimethyl-1,3-benzothiazol-3-ium Chemical compound C1=CC=C2[N+](C)=C(C)SC2=C1 QBQDROYKEQDPRX-UHFFFAOYSA-N 0.000 description 1
- XPZMWTZEBALMMC-UHFFFAOYSA-N 2,5-bis(aziridin-1-yl)benzene-1,4-diol Chemical compound OC=1C=C(N2CC2)C(O)=CC=1N1CC1 XPZMWTZEBALMMC-UHFFFAOYSA-N 0.000 description 1
- IWFJNPRQSDPXDC-UHFFFAOYSA-M 2-(4-chloropyridin-1-ium-1-yl)-1-phenylethanone;bromide Chemical compound [Br-].C1=CC(Cl)=CC=[N+]1CC(=O)C1=CC=CC=C1 IWFJNPRQSDPXDC-UHFFFAOYSA-M 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- AYHBRSKXFVQPPX-UHFFFAOYSA-M 2-methyl-1-(2-phenylethyl)pyridin-1-ium;bromide Chemical compound [Br-].CC1=CC=CC=[N+]1CCC1=CC=CC=C1 AYHBRSKXFVQPPX-UHFFFAOYSA-M 0.000 description 1
- BKFNEOXRGFXAML-UHFFFAOYSA-N 2-methylpyridin-1-ium;bromide Chemical compound Br.CC1=CC=CC=N1 BKFNEOXRGFXAML-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- VFSADEQGQSFZHB-UHFFFAOYSA-M 4-methylbenzenesulfonate 1-propylpyridin-1-ium Chemical compound C1(=CC=C(C=C1)S(=O)(=O)[O-])C.C(CC)[N+]1=CC=CC=C1 VFSADEQGQSFZHB-UHFFFAOYSA-M 0.000 description 1
- FTAHLRGENXPOTQ-UHFFFAOYSA-M 4-methylbenzenesulfonate;triethylsulfanium Chemical compound CC[S+](CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 FTAHLRGENXPOTQ-UHFFFAOYSA-M 0.000 description 1
- GVTDRUXHMYZTFF-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-1,4-diol Chemical compound C1CCCC2=C1C(O)=CC=C2O GVTDRUXHMYZTFF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 1
- PLXMOAALOJOTIY-FPTXNFDTSA-N Aesculin Natural products OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1Oc2cc3C=CC(=O)Oc3cc2O PLXMOAALOJOTIY-FPTXNFDTSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- HIDNIWVSMVBKSM-UHFFFAOYSA-M C1(=CC=C(C=C1)S(=O)(=O)[O-])C.C(CCCCCCC)[N+]1=C(C=CC=C1)C Chemical compound C1(=CC=C(C=C1)S(=O)(=O)[O-])C.C(CCCCCCC)[N+]1=C(C=CC=C1)C HIDNIWVSMVBKSM-UHFFFAOYSA-M 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LYFLTDAQTQLANS-UHFFFAOYSA-L [OH-].C(C)[N+](CC)(CC)CC.[OH-].C(C)[N+](CC)(CC)CC Chemical compound [OH-].C(C)[N+](CC)(CC)CC.[OH-].C(C)[N+](CC)(CC)CC LYFLTDAQTQLANS-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N alpha-naphthol Natural products C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical class [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- HXYXDTAROKJMBO-UHFFFAOYSA-N benzimidazol-1-amine Chemical compound C1=CC=C2N(N)C=NC2=C1 HXYXDTAROKJMBO-UHFFFAOYSA-N 0.000 description 1
- DLNWMWYCSOQYSQ-UHFFFAOYSA-M benzyl-hexadecyl-dimethylazanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 DLNWMWYCSOQYSQ-UHFFFAOYSA-M 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- ADRVNXBAWSRFAJ-UHFFFAOYSA-N catechin Natural products OC1Cc2cc(O)cc(O)c2OC1c3ccc(O)c(O)c3 ADRVNXBAWSRFAJ-UHFFFAOYSA-N 0.000 description 1
- 235000005487 catechin Nutrition 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229950001002 cianidanol Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- FAIXMQSVNFOTHN-UHFFFAOYSA-M diethyl(dimethyl)azanium 4-methylbenzenesulfonate Chemical compound CC[N+](C)(C)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 FAIXMQSVNFOTHN-UHFFFAOYSA-M 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- FQRPXALREFKNJX-UHFFFAOYSA-M dimethyl(nonyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCC[S+](C)C FQRPXALREFKNJX-UHFFFAOYSA-M 0.000 description 1
- XPROKLGQTCGPDN-UHFFFAOYSA-M dodecyl(dimethyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[S+](C)C XPROKLGQTCGPDN-UHFFFAOYSA-M 0.000 description 1
- QXBMTZROPNBOAE-UHFFFAOYSA-M ethyl(dimethyl)sulfanium;bromide Chemical compound [Br-].CC[S+](C)C QXBMTZROPNBOAE-UHFFFAOYSA-M 0.000 description 1
- ZXFWRDUUBDVSMJ-UHFFFAOYSA-M ethyl(trimethyl)phosphanium;bromide Chemical compound [Br-].CC[P+](C)(C)C ZXFWRDUUBDVSMJ-UHFFFAOYSA-M 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical group 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XCOHAFVJQZPUKF-UHFFFAOYSA-M octyltrimethylammonium bromide Chemical compound [Br-].CCCCCCCC[N+](C)(C)C XCOHAFVJQZPUKF-UHFFFAOYSA-M 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- QNXIYXGRPXRGOB-UHFFFAOYSA-N oxolane;propan-2-one Chemical compound CC(C)=O.C1CCOC1 QNXIYXGRPXRGOB-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- OWTCGJRBQMOICX-UHFFFAOYSA-M phenacyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C(=O)C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 OWTCGJRBQMOICX-UHFFFAOYSA-M 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- WNEYXFDRCSFJCU-UHFFFAOYSA-N propan-1-amine;hydrate Chemical compound [OH-].CCC[NH3+] WNEYXFDRCSFJCU-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- SSTZGACKDAVIGZ-UHFFFAOYSA-N sulfanium;bromide Chemical compound [SH3+].[Br-] SSTZGACKDAVIGZ-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- WQPVLAGBTJWVLF-UHFFFAOYSA-L tetrabutylazanium bromide hydroxide Chemical compound [OH-].[Br-].CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC WQPVLAGBTJWVLF-UHFFFAOYSA-L 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- LIXPXSXEKKHIRR-UHFFFAOYSA-M tetraethylphosphanium;bromide Chemical compound [Br-].CC[P+](CC)(CC)CC LIXPXSXEKKHIRR-UHFFFAOYSA-M 0.000 description 1
- ZTXFOCMYRCGSMU-UHFFFAOYSA-M tetramethylphosphanium;bromide Chemical compound [Br-].C[P+](C)(C)C ZTXFOCMYRCGSMU-UHFFFAOYSA-M 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- ANUSMYJRISPAKG-UHFFFAOYSA-M triethylsulfanium;bromide Chemical compound [Br-].CC[S+](CC)CC ANUSMYJRISPAKG-UHFFFAOYSA-M 0.000 description 1
- HXZNGFAQIRDVGC-UHFFFAOYSA-M trimethyl(propyl)phosphanium;bromide Chemical compound [Br-].CCC[P+](C)(C)C HXZNGFAQIRDVGC-UHFFFAOYSA-M 0.000 description 1
- ZNEOHLHCKGUAEB-UHFFFAOYSA-N trimethylphenylammonium Chemical compound C[N+](C)(C)C1=CC=CC=C1 ZNEOHLHCKGUAEB-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Landscapes
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE607375T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE607375A true BE607375A (enExample) |
Family
ID=3875133
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE607375D BE607375A (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| BE (1) | BE607375A (enExample) |
-
0
- BE BE607375D patent/BE607375A/fr unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3300306A (en) | Process for the manufacture of printing plates | |
| JPS5818629A (ja) | 画像形成方法 | |
| DE2811025A1 (de) | Silbersalze von 3-amino-1,2,4-mercaptotriazolderivaten | |
| CH628924A5 (fr) | Composes formateurs d'image photographique. | |
| US4356256A (en) | Photographic compositions, elements and processes using light-activatable enzymes | |
| FR2505061A1 (fr) | Produit photographique comprenant des emulsions aux halogenures d'argent positives directes, formant des images par diffusion et contenant des quinones | |
| JPS587629A (ja) | ハロゲン化銀写真感光材料の製造方法 | |
| JPS602950A (ja) | 熱現像カラ−感光材料 | |
| BE607375A (enExample) | ||
| CH494977A (fr) | Couche photographique | |
| FR2505062A1 (fr) | Elements recepteurs d'image, et produits et procedes photographiques de diffusion-transfert les utilisant | |
| US3748129A (en) | Dye image providing materials within diffusion transfer barrier layers | |
| BE554212A (enExample) | ||
| FR2479496A1 (fr) | Nouveaux composes du xanthene, produits et procedes photographiques les mettant en oeuvre | |
| FR2479998A1 (fr) | Materiau photographique pour procede de diffusion-transfert a gradation stable | |
| JPS60143336A (ja) | 拡散転写写真製品 | |
| US4047954A (en) | Sulfinyl-sulfonyl alkane silver halide solvents | |
| US3749578A (en) | Image-receiving material for use in silver salt diffusion transfer photography | |
| FR2500179A1 (fr) | Procede de formation d'une image argentique avec stabilisation rapide et produit photographique pour la mise en oeuvre du procede | |
| DE2126686A1 (de) | Photographisches Farbdiffusions übertragungsverfahren | |
| BE592287A (enExample) | ||
| BE752586R (fr) | Nouveaux produits et procedes | |
| JPS6046419B2 (ja) | ハロゲン化銀写真感光材料 | |
| US3653897A (en) | Yellow dye developers and transfer systems employing same | |
| AT265861B (de) | Photographisches Material für ein Farbdiffusions-Übertragungsverfahren |