AU557306B2 - Trans-1-n-propyl-6-oxodecahydroquinoline - Google Patents
Trans-1-n-propyl-6-oxodecahydroquinolineInfo
- Publication number
- AU557306B2 AU557306B2 AU17340/83A AU1734083A AU557306B2 AU 557306 B2 AU557306 B2 AU 557306B2 AU 17340/83 A AU17340/83 A AU 17340/83A AU 1734083 A AU1734083 A AU 1734083A AU 557306 B2 AU557306 B2 AU 557306B2
- Authority
- AU
- Australia
- Prior art keywords
- oxodecahydroquinoline
- trans
- propyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- FWHLCAXBTREMQT-ZYHUDNBSSA-N (4ar,8ar)-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-6-one Chemical compound C1C(=O)CC[C@H]2N(CCC)CCC[C@@H]21 FWHLCAXBTREMQT-ZYHUDNBSSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US439107 | 1982-11-03 | ||
| US06/439,107 US4471121A (en) | 1982-11-03 | 1982-11-03 | Method of resolving trans-d alpha-1-n-propyl-6-oxodecahydroquinoline and di-p-toluoyltartaric acid salts thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU1734083A AU1734083A (en) | 1984-05-10 |
| AU557306B2 true AU557306B2 (en) | 1986-12-18 |
Family
ID=23743321
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU17340/83A Ceased AU557306B2 (en) | 1982-11-03 | 1983-07-27 | Trans-1-n-propyl-6-oxodecahydroquinoline |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4471121A (enFirst) |
| EP (1) | EP0112604A1 (enFirst) |
| JP (1) | JPS5982365A (enFirst) |
| KR (1) | KR860001506B1 (enFirst) |
| AU (1) | AU557306B2 (enFirst) |
| CA (1) | CA1198115A (enFirst) |
| CS (1) | CS234050B2 (enFirst) |
| DD (1) | DD210045A5 (enFirst) |
| DK (1) | DK343183A (enFirst) |
| ES (1) | ES8502092A1 (enFirst) |
| FI (1) | FI832720A7 (enFirst) |
| GB (1) | GB2129422B (enFirst) |
| GR (1) | GR79600B (enFirst) |
| HU (1) | HU189311B (enFirst) |
| IL (1) | IL69360A (enFirst) |
| NZ (1) | NZ205030A (enFirst) |
| PH (1) | PH20193A (enFirst) |
| PL (1) | PL243198A1 (enFirst) |
| PT (1) | PT77113B (enFirst) |
| RO (1) | RO86512B (enFirst) |
| SU (1) | SU1282815A3 (enFirst) |
| ZA (1) | ZA835502B (enFirst) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL73001A0 (en) * | 1983-09-26 | 1984-12-31 | Lilly Co Eli | Improvements in and relating to 6-oxodecahydroquinolines |
| US4778894A (en) * | 1983-09-26 | 1988-10-18 | Eli Lilly And Company | 6 oxo-decahydroquinolines |
| US4764609A (en) * | 1986-03-31 | 1988-08-16 | Eli Lilly And Company | Synthesis of 2-aminopyrimido[4,5-g]quinolines |
| US5134143A (en) * | 1986-06-16 | 1992-07-28 | Eli Lilly And Company | BCD tricyclic ergoline part-structure analogues |
| US4826986A (en) * | 1986-06-16 | 1989-05-02 | Eli Lilly And Company | 6-Oxo-trans-octa- and decahydroquinolines |
| US4977160A (en) * | 1986-06-16 | 1990-12-11 | Eli Lilly And Company | BCD tricyclic ergoline part-structure analogues |
| FR2600649B1 (fr) * | 1986-06-26 | 1989-02-24 | Rhone Poulenc Sante | Procede de preparation du maleate acide de levomepromazine |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4230861A (en) * | 1979-01-22 | 1980-10-28 | Eli Lilly And Company | 1-And/or 7-substituted-6-hydroxy (or oxo)-3-decahydroquinoline carboxylic acids |
| US4198415A (en) * | 1979-01-22 | 1980-04-15 | Eli Lilly And Company | Prolactin inhibiting octahydro pyrazolo[3,4-g]quinolines |
-
1982
- 1982-11-03 US US06/439,107 patent/US4471121A/en not_active Expired - Fee Related
-
1983
- 1983-07-26 ES ES524454A patent/ES8502092A1/es not_active Expired
- 1983-07-27 JP JP58138680A patent/JPS5982365A/ja active Pending
- 1983-07-27 GR GR72054A patent/GR79600B/el unknown
- 1983-07-27 DK DK343183A patent/DK343183A/da not_active Application Discontinuation
- 1983-07-27 ZA ZA835502A patent/ZA835502B/xx unknown
- 1983-07-27 HU HU832645A patent/HU189311B/hu unknown
- 1983-07-27 PH PH29306A patent/PH20193A/en unknown
- 1983-07-27 PT PT77113A patent/PT77113B/pt unknown
- 1983-07-27 RO RO111745A patent/RO86512B/ro unknown
- 1983-07-27 NZ NZ205030A patent/NZ205030A/en unknown
- 1983-07-27 IL IL69360A patent/IL69360A/xx unknown
- 1983-07-27 AU AU17340/83A patent/AU557306B2/en not_active Ceased
- 1983-07-27 CS CS835634A patent/CS234050B2/cs unknown
- 1983-07-27 FI FI832720A patent/FI832720A7/fi not_active Application Discontinuation
- 1983-07-27 CA CA000433400A patent/CA1198115A/en not_active Expired
- 1983-07-27 EP EP83304342A patent/EP0112604A1/en not_active Ceased
- 1983-07-27 KR KR1019830003504A patent/KR860001506B1/ko not_active Expired
- 1983-07-27 PL PL24319883A patent/PL243198A1/xx unknown
- 1983-07-27 DD DD83253426A patent/DD210045A5/de unknown
- 1983-07-27 GB GB08320249A patent/GB2129422B/en not_active Expired
- 1983-07-27 SU SU833622809A patent/SU1282815A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| PH20193A (en) | 1986-10-16 |
| FI832720A7 (fi) | 1984-05-04 |
| DK343183D0 (da) | 1983-07-27 |
| KR860001506B1 (ko) | 1986-09-30 |
| PT77113A (en) | 1983-08-01 |
| CS234050B2 (en) | 1985-03-14 |
| EP0112604A1 (en) | 1984-07-04 |
| GB2129422A (en) | 1984-05-16 |
| KR840006626A (ko) | 1984-12-01 |
| NZ205030A (en) | 1986-03-14 |
| HU189311B (en) | 1986-06-30 |
| US4471121A (en) | 1984-09-11 |
| PL243198A1 (en) | 1984-08-13 |
| PT77113B (en) | 1986-04-11 |
| RO86512B (ro) | 1985-03-31 |
| SU1282815A3 (ru) | 1987-01-07 |
| IL69360A (en) | 1986-10-31 |
| JPS5982365A (ja) | 1984-05-12 |
| RO86512A (ro) | 1985-03-15 |
| DK343183A (da) | 1984-05-04 |
| GR79600B (enFirst) | 1984-10-31 |
| DD210045A5 (de) | 1984-05-30 |
| CA1198115A (en) | 1985-12-17 |
| FI832720A0 (fi) | 1983-07-27 |
| GB8320249D0 (en) | 1983-09-01 |
| ES524454A0 (es) | 1984-12-16 |
| GB2129422B (en) | 1986-08-20 |
| ZA835502B (en) | 1985-03-27 |
| AU1734083A (en) | 1984-05-10 |
| ES8502092A1 (es) | 1984-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU1146383A (en) | Amidoximeguinolines | |
| AU1383083A (en) | Ligator-clip | |
| AU1761783A (en) | Photoradiator | |
| AU1115783A (en) | Quadricycle | |
| AU1491183A (en) | Curler-styler | |
| AU1659483A (en) | 14-fluoromorphinans | |
| AU1112583A (en) | Pyrazolo-quinolines, -thiazines and -oxazines | |
| AU1649683A (en) | 1-dethia-1-oxa-3-cephem-derivatives | |
| AU1315083A (en) | Massage-douche | |
| AU1557383A (en) | Hestesko | |
| AU1708883A (en) | Ratschenartiger maulschlussel | |
| AU1602483A (en) | Sectionaliser | |
| AU1475883A (en) | Dosierpumpe | |
| AU1395383A (en) | Benzoazacycloalkyl-spiro-imidazolidines | |
| AU1227483A (en) | Klaranlage | |
| AU1636583A (en) | 19-thio-androstanes | |
| AU1704883A (en) | Pferdehufschuh | |
| AU1476983A (en) | Bomanordning | |
| AU1471483A (en) | Tallerkenknuser | |
| AU1553583A (en) | Arbeitsmaschine | |
| AU1674883A (en) | Interferon-epsilon | |
| AU1824183A (en) | Schneckenpresse | |
| AU557306B2 (en) | Trans-1-n-propyl-6-oxodecahydroquinoline | |
| AU1089783A (en) | N-benzothienylalkyl-n-alkyl-allylamines | |
| AU1277283A (en) | N-substituted-tetrahydrothiazines |