AU510261B2 - Smoke retardant vinyl chloride and vinylidene chloride polymer compositions - Google Patents
Smoke retardant vinyl chloride and vinylidene chloride polymer compositionsInfo
- Publication number
- AU510261B2 AU510261B2 AU28230/77A AU2823077A AU510261B2 AU 510261 B2 AU510261 B2 AU 510261B2 AU 28230/77 A AU28230/77 A AU 28230/77A AU 2823077 A AU2823077 A AU 2823077A AU 510261 B2 AU510261 B2 AU 510261B2
- Authority
- AU
- Australia
- Prior art keywords
- polymer compositions
- retardant vinyl
- smoke retardant
- vinyl chloride
- vinylidene chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 title 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 229920000642 polymer Polymers 0.000 title 1
- 239000000779 smoke Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0091—Complexes with metal-heteroatom-bonds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/10—Metal compounds
- C08K3/105—Compounds containing metals of Groups 1 to 3 or of Groups 11 to 13 of the Periodic Table
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
- C08K5/34928—Salts
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| USUS770169 | 1977-02-04 | ||
| US05/770,169 US4053451A (en) | 1977-02-14 | 1977-02-14 | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2823077A AU2823077A (en) | 1979-03-01 |
| AU510261B2 true AU510261B2 (en) | 1980-06-19 |
Family
ID=25087691
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU28230/77A Expired AU510261B2 (en) | 1977-02-04 | 1977-08-25 | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4053451A (esLanguage) |
| JP (1) | JPS6017304B2 (esLanguage) |
| AU (1) | AU510261B2 (esLanguage) |
| BE (1) | BE859206A (esLanguage) |
| CA (1) | CA1086442A (esLanguage) |
| CH (1) | CH622538A5 (esLanguage) |
| DE (1) | DE2739772A1 (esLanguage) |
| DK (1) | DK153162C (esLanguage) |
| FR (1) | FR2380319A1 (esLanguage) |
| GB (1) | GB1557634A (esLanguage) |
| IT (1) | IT1085978B (esLanguage) |
| MX (1) | MX145567A (esLanguage) |
| NL (1) | NL183407C (esLanguage) |
| NO (1) | NO148223C (esLanguage) |
| SE (1) | SE7710032L (esLanguage) |
| ZA (1) | ZA775265B (esLanguage) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4115353A (en) * | 1977-07-22 | 1978-09-19 | Monsanto Company | Nitrogenous polymer composition emitting reduced amounts of hydrogen cyanide on combustion |
| US4157329A (en) * | 1978-01-13 | 1979-06-05 | Pennwalt Corporation | Copper and cobalt carbonates as smoke suppressants for poly(vinyl halides) |
| DE3260446D1 (en) * | 1981-04-29 | 1984-08-30 | Huels Chemische Werke Ag | Polyvinyl chloride mixture containing a copper compound |
| IT1170103B (it) * | 1983-01-25 | 1987-06-03 | Umberto Crespi | Compound di pvc plastificato e/o non, atossico e/o non, senza emissione di fumi, corrosivi e non, durante le lavorazioni di trasformazione |
| JP2627629B2 (ja) * | 1987-12-07 | 1997-07-09 | チッソ株式会社 | 液晶組成物 |
| US4965309A (en) * | 1987-11-04 | 1990-10-23 | H. B. Fuller Company | Smoke suppressant compositions for halogen-containing plastics and methods of using |
| US5036121A (en) * | 1988-09-06 | 1991-07-30 | The B. F. Goodrich Company | Flame and smoke retardant cable insulation and jacketing compositions |
| US5130528A (en) * | 1991-03-01 | 1992-07-14 | International Business Machines Corporation | Opto-photo-electric switch |
| DE4301601A1 (de) * | 1993-01-22 | 1994-07-28 | Chemie Linz Deutschland | Flammfeste Kunststoffe mit einem Gehalt an Trihydrazinotriazin, Triguanidinotriazin oder deren Salzen |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3845001A (en) * | 1971-11-08 | 1974-10-29 | Ethyl Corp | Smoke retardant compositions |
| US3821151A (en) * | 1971-11-08 | 1974-06-28 | Ethyl Corp | Smoke retardant compositions |
| US3992480A (en) * | 1973-07-30 | 1976-11-16 | Hooker Chemicals & Plastics Corporation | Fire retardant unsaturated polyesters |
| US3819577A (en) * | 1973-10-19 | 1974-06-25 | Goodrich Co B F | Flame retardant polyvinylchloride compositions |
| US3956231A (en) * | 1974-09-03 | 1976-05-11 | Amax Inc. | Flame and smoke retardant styrene polymer composition |
| US3962163A (en) * | 1974-12-30 | 1976-06-08 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
| US3975356A (en) * | 1975-06-02 | 1976-08-17 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
-
1977
- 1977-02-14 US US05/770,169 patent/US4053451A/en not_active Expired - Lifetime
- 1977-08-24 CA CA285,425A patent/CA1086442A/en not_active Expired
- 1977-08-25 AU AU28230/77A patent/AU510261B2/en not_active Expired
- 1977-08-25 GB GB35636/77A patent/GB1557634A/en not_active Expired
- 1977-08-25 DK DK377877A patent/DK153162C/da not_active IP Right Cessation
- 1977-08-31 ZA ZA00775265A patent/ZA775265B/xx unknown
- 1977-09-03 DE DE19772739772 patent/DE2739772A1/de not_active Withdrawn
- 1977-09-07 SE SE7710032A patent/SE7710032L/xx unknown
- 1977-09-08 IT IT27397/77A patent/IT1085978B/it active
- 1977-09-09 NL NLAANVRAGE7709925,A patent/NL183407C/xx not_active IP Right Cessation
- 1977-09-16 CH CH1134677A patent/CH622538A5/fr not_active IP Right Cessation
- 1977-09-22 JP JP52113456A patent/JPS6017304B2/ja not_active Expired
- 1977-09-23 NO NO773264A patent/NO148223C/no unknown
- 1977-09-29 BE BE181315A patent/BE859206A/xx not_active IP Right Cessation
- 1977-10-13 MX MX170911A patent/MX145567A/es unknown
- 1977-10-13 FR FR7730915A patent/FR2380319A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ZA775265B (en) | 1978-07-26 |
| NO148223B (no) | 1983-05-24 |
| NL7709925A (nl) | 1978-08-16 |
| NO148223C (no) | 1983-08-31 |
| US4053451A (en) | 1977-10-11 |
| AU2823077A (en) | 1979-03-01 |
| JPS6017304B2 (ja) | 1985-05-02 |
| BE859206A (fr) | 1978-01-16 |
| DE2739772A1 (de) | 1978-08-17 |
| NO773264L (no) | 1978-08-15 |
| FR2380319A1 (fr) | 1978-09-08 |
| SE7710032L (sv) | 1978-08-15 |
| CA1086442A (en) | 1980-09-23 |
| FR2380319B1 (esLanguage) | 1982-10-15 |
| NL183407B (nl) | 1988-05-16 |
| DK153162B (da) | 1988-06-20 |
| CH622538A5 (esLanguage) | 1981-04-15 |
| NL183407C (nl) | 1988-10-17 |
| MX145567A (es) | 1982-03-08 |
| JPS53101043A (en) | 1978-09-04 |
| GB1557634A (en) | 1979-12-12 |
| DK377877A (da) | 1978-08-15 |
| DK153162C (da) | 1988-10-31 |
| IT1085978B (it) | 1985-05-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA775138B (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| JPS5341351A (en) | Plastilized polyvinyl chloride polymer composition having fire retardant and smoke retardant property | |
| JPS5345350A (en) | Plastilized polyvinyl chloride polymer composition having fire resistant and smoke resistant property | |
| AU509885B2 (en) | Vinyl halide polymers having improved resistance for fire and smoke formation | |
| AU510261B2 (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| ZA806842B (en) | Vinylidene chloride copolymer latex compositions | |
| AU565907B2 (en) | Smoke retardant vinyl halide polymer compositions | |
| AU565615B2 (en) | Smoke retardant vinyl halide polymer compositions | |
| DE2965910D1 (en) | Fire retardant blend of interpolymer composition, chlorinated vinyl chloride polymer and vinyl chloride polymer | |
| JPS5287447A (en) | Flame retardant vinyl chloride or vinylidene chloride composition | |
| AU520528B2 (en) | Vinyl chloride polymers and production thereof | |
| GB2010856B (en) | Flame and smoke retardant polyvinyl chloride resin compositions | |
| AU522054B2 (en) | Vinyl chloride polymer composition | |
| AU511018B2 (en) | Improved fire and smoke retardant vinyl and vinylidene chloride polymer compositions | |
| GB2003489B (en) | Vinylidene chloride polymer latex | |
| AU5014979A (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| AU512673B2 (en) | Internally plasticized vinyl chloride copolymer | |
| AU515788B2 (en) | Manufacture of vinyl chloride polymers | |
| AU1191576A (en) | Smoke retardant vinyl chloride and polyvinylidene chloride compositions | |
| NZ192612A (en) | Smoke retardant vinyl chloride or vinylidene composition | |
| JPS55161840A (en) | Under fire condition*low smoke low combustibility vinyl chloride polymer composition | |
| AU520003B2 (en) | Synthesis of smoke retardant and vinyl halide polymers containing same | |
| JPS5287448A (en) | Flame retardant vinyl chloride or vinylidene chloride composition |