AU497266B2 - Eburnamenine derivatives - Google Patents
Eburnamenine derivativesInfo
- Publication number
- AU497266B2 AU497266B2 AU84443/75A AU8444375A AU497266B2 AU 497266 B2 AU497266 B2 AU 497266B2 AU 84443/75 A AU84443/75 A AU 84443/75A AU 8444375 A AU8444375 A AU 8444375A AU 497266 B2 AU497266 B2 AU 497266B2
- Authority
- AU
- Australia
- Prior art keywords
- eburnamenine derivatives
- eburnamenine
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VKTOXAGUZWAECL-RBUKOAKNSA-N eburnamenine Chemical class C1=CC=C2C(CCN3CCC4)=C5[C@H]3[C@@]4(CC)C=CN5C2=C1 VKTOXAGUZWAECL-RBUKOAKNSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU74RI00000546A HU170886B (hu) | 1974-09-27 | 1974-09-27 | Sposob poluchenija proizvodnykh eburnamenina |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU8444375A AU8444375A (en) | 1977-03-10 |
| AU497266B2 true AU497266B2 (en) | 1978-12-07 |
Family
ID=11000957
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU84443/75A Expired AU497266B2 (en) | 1974-09-27 | 1975-09-01 | Eburnamenine derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4054571A (OSRAM) |
| JP (1) | JPS5951551B2 (OSRAM) |
| AT (1) | AT347049B (OSRAM) |
| AU (1) | AU497266B2 (OSRAM) |
| BE (1) | BE833526A (OSRAM) |
| BG (1) | BG30775A3 (OSRAM) |
| CA (1) | CA1066705A (OSRAM) |
| CS (1) | CS189721B2 (OSRAM) |
| DD (1) | DD122822A5 (OSRAM) |
| DE (1) | DE2539866C2 (OSRAM) |
| DK (1) | DK139681B (OSRAM) |
| FR (1) | FR2285878A1 (OSRAM) |
| GB (1) | GB1514306A (OSRAM) |
| HU (1) | HU170886B (OSRAM) |
| IL (1) | IL48029A (OSRAM) |
| NL (1) | NL7511182A (OSRAM) |
| PL (1) | PL100318B1 (OSRAM) |
| SE (1) | SE424327B (OSRAM) |
| SU (1) | SU582765A3 (OSRAM) |
| YU (1) | YU241275A (OSRAM) |
-
1974
- 1974-09-27 HU HU74RI00000546A patent/HU170886B/hu unknown
-
1975
- 1975-09-01 AU AU84443/75A patent/AU497266B2/en not_active Expired
- 1975-09-02 IL IL48029A patent/IL48029A/xx unknown
- 1975-09-08 DE DE2539866A patent/DE2539866C2/de not_active Expired
- 1975-09-10 AT AT696675A patent/AT347049B/de not_active IP Right Cessation
- 1975-09-11 CA CA235,273A patent/CA1066705A/en not_active Expired
- 1975-09-17 BE BE160135A patent/BE833526A/xx not_active IP Right Cessation
- 1975-09-17 US US05/614,151 patent/US4054571A/en not_active Expired - Lifetime
- 1975-09-22 DD DD188476A patent/DD122822A5/xx unknown
- 1975-09-23 FR FR7529074A patent/FR2285878A1/fr active Granted
- 1975-09-23 NL NL7511182A patent/NL7511182A/xx not_active Application Discontinuation
- 1975-09-24 SU SU7502175252A patent/SU582765A3/ru active
- 1975-09-25 SE SE7510786A patent/SE424327B/xx not_active IP Right Cessation
- 1975-09-25 BG BG031069A patent/BG30775A3/xx unknown
- 1975-09-25 YU YU02412/75A patent/YU241275A/xx unknown
- 1975-09-26 JP JP50117086A patent/JPS5951551B2/ja not_active Expired
- 1975-09-26 DK DK432975AA patent/DK139681B/da unknown
- 1975-09-26 PL PL1975183607A patent/PL100318B1/pl unknown
- 1975-09-26 GB GB39506/75A patent/GB1514306A/en not_active Expired
- 1975-09-26 CS CS756525A patent/CS189721B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4054571A (en) | 1977-10-18 |
| AU8444375A (en) | 1977-03-10 |
| SE7510786L (sv) | 1976-03-29 |
| SU582765A3 (ru) | 1977-11-30 |
| DK139681B (da) | 1979-03-26 |
| BE833526A (fr) | 1976-01-16 |
| JPS5951551B2 (ja) | 1984-12-14 |
| HU170886B (hu) | 1977-09-28 |
| DD122822A5 (OSRAM) | 1976-11-05 |
| IL48029A (en) | 1980-09-16 |
| NL7511182A (nl) | 1976-03-30 |
| AT347049B (de) | 1978-12-11 |
| GB1514306A (en) | 1978-06-14 |
| JPS5159899A (OSRAM) | 1976-05-25 |
| CS189721B2 (en) | 1979-04-30 |
| ATA696675A (de) | 1978-04-15 |
| FR2285878A1 (fr) | 1976-04-23 |
| DE2539866A1 (de) | 1976-04-22 |
| CA1066705A (en) | 1979-11-20 |
| FR2285878B1 (OSRAM) | 1978-11-17 |
| DK139681C (OSRAM) | 1979-10-01 |
| DK432975A (OSRAM) | 1976-03-28 |
| IL48029A0 (en) | 1975-11-25 |
| DE2539866C2 (de) | 1983-07-14 |
| SE424327B (sv) | 1982-07-12 |
| BG30775A3 (en) | 1981-08-14 |
| YU241275A (en) | 1982-06-30 |
| PL100318B1 (pl) | 1978-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU500910B2 (en) | Benzimidazolinone derivatives | |
| AU498132B2 (en) | 5 - nitro - pyrimidine derivatives | |
| AU467292B2 (en) | Eye-bush | |
| AU470711B2 (en) | Oxacyclohexane derivatives | |
| AU501915B2 (en) | Phenyl-pyridylamine derivatives | |
| AU503060B2 (en) | Ergopeptine derivatives | |
| AU472498B2 (en) | Aminomethylarylmethlpenicillin derivatives | |
| AU496294B2 (en) | Phenoxyhydroxypropylamine derivatives | |
| AU493443B2 (en) | N-substituted-acetyl n-substituted-aniline derivatives | |
| AU493074B2 (en) | Thiepino- and oxepino - pyrrole derivatives | |
| AU491426B2 (en) | N-thiobenzoyl-n-halophenylalamine derivatives | |
| AU475893B2 (en) | Triazapentadiene derivatives | |
| AU480360B2 (en) | 2-aminomethyl-phenol derivatives | |
| AU479671B2 (en) | -aryl-4-substituted piperidinoalkanol derivatives | |
| AU485016B2 (en) | Mercaptomethylpyridine derivatives | |
| AU489669B2 (en) | 3-piperazino-isoquinoline derivatives | |
| AU491184B2 (en) | Benzenedisulphonamide derivatives | |
| AU488651B2 (en) | 2-cyclopropyl-4-phenylprrolidine derivatives | |
| AU488164B2 (en) | Pyrimidincl derivatives | |
| AU486830B2 (en) | Benzo-bicyclononene derivatives | |
| AU488080B2 (en) | Cyclopentate derivatives | |
| AU497266B2 (en) | Eburnamenine derivatives | |
| AU491725B2 (en) | Novel cyclopropylmethlamine derivatives | |
| AU8743575A (en) | Benzenedisulphonamide derivatives | |
| AU7969575A (en) | Benzo-bicyclononene derivatives |