AU2022259710B2 - Method and system for joint transmission of various emergency power generation equipment - Google Patents
Method and system for joint transmission of various emergency power generation equipment Download PDFInfo
- Publication number
- AU2022259710B2 AU2022259710B2 AU2022259710A AU2022259710A AU2022259710B2 AU 2022259710 B2 AU2022259710 B2 AU 2022259710B2 AU 2022259710 A AU2022259710 A AU 2022259710A AU 2022259710 A AU2022259710 A AU 2022259710A AU 2022259710 B2 AU2022259710 B2 AU 2022259710B2
- Authority
- AU
- Australia
- Prior art keywords
- power generation
- generation equipment
- power supply
- converter
- emergency power
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000010248 power generation Methods 0.000 title claims abstract description 327
- 230000005540 biological transmission Effects 0.000 title claims abstract description 40
- 238000000034 method Methods 0.000 title claims abstract description 20
- 238000005457 optimization Methods 0.000 claims abstract description 93
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 238000004146 energy storage Methods 0.000 claims description 8
- 239000000446 fuel Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 230000002068 genetic effect Effects 0.000 claims description 7
- STEPQTYSZVCJPV-UHFFFAOYSA-N metazachlor Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)CN1N=CC=C1 STEPQTYSZVCJPV-UHFFFAOYSA-N 0.000 abstract description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000011217 control strategy Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02J—CIRCUIT ARRANGEMENTS OR SYSTEMS FOR SUPPLYING OR DISTRIBUTING ELECTRIC POWER; SYSTEMS FOR STORING ELECTRIC ENERGY
- H02J1/00—Circuit arrangements for dc mains or dc distribution networks
- H02J1/10—Parallel operation of dc sources
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02J—CIRCUIT ARRANGEMENTS OR SYSTEMS FOR SUPPLYING OR DISTRIBUTING ELECTRIC POWER; SYSTEMS FOR STORING ELECTRIC ENERGY
- H02J1/00—Circuit arrangements for dc mains or dc distribution networks
- H02J1/10—Parallel operation of dc sources
- H02J1/12—Parallel operation of dc generators with converters, e.g. with mercury-arc rectifier
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Supply And Distribution Of Alternating Current (AREA)
Abstract
A method, and a system for joint transmission of various emergency power generation
equipment. The method includes: determining a maximum power generation amount of
each emergency power generation equipment in a current control period, basing on
environment information and operating condition information of the corresponding emergency
power generation equipment in the current control period; determining an optimal power supply
proportion of each emergency power generation equipment by using a preset optimization
algorithm, basing on an energy efficiency of each converter, wherein the optimization
algorithm converges in a condition that overall energy efficiency of the various emergency
power generation equipment is maximized, the overall energy efficiency of the various
emergency power generation equipment is a ratio of, a sum of products of the maximum power
generation amount of each emergency power generation equipment in the current control period,
a power supply proportion to be optimized which is generated by the optimization algorithm,
and the energy efficiency of a corresponding connected converter of each emergency power
generation equipment, to a total of power generation amount of each emergency power
generation equipment in the current control period; and the optimization algorithm is
constrained by the fact that the sum is greater than or equal to a total power supply demand of
the load in the current control period; sending the optimal power supply proportion of each
emergency power generation equipment to corresponding emergency power generation
equipment, to control the corresponding emergency power generation equipment work.
1/2
detenming a nxMn power genation amount of each
emergency power generation equipment Lu a cmrmt
control penod, basing on avironmnt infonnation and
operatig ondition information of the corresponding
emergency power generation equipment In the aent S101
control period
detenining optimal power supply proportion of each
emergency power generation equipment by usMg a pree S102
optinzaion algonthm
sending the optimal power supply proportion of each S103
emergency power generation equipment to correspnding
emergency pawegeneration equipment, to controlthe
corresponding emergency power generation equipmmt
work
Figure 1
Description
1/2
detenming a nxMn power genation amount of each emergency power generation equipment Lu a cmrmt control penod, basing on avironmnt infonnation and operatig ondition information of the corresponding emergency power generation equipment In the aent S101 control period
detenining optimal power supply proportion of each emergency power generation equipment by usMg a pree S102 optinzaion algonthm
sending the optimal power supply proportion of each S103 emergency powergeneration equipment to correspnding emergency pawegeneration equipment, to controlthe corresponding emergency power generation equipmmt work
Figure 1
[0001] The present disclosure generally relates to the field of emergency power supply technology, particularly to a method, and a system for joint transmission of various emergency power generation equipment.
[0002] There are different types of distributed power sources in the emergency network. Such as the difference between the output characteristics of the emergency diesel generator car and the distributed inverter power source, and the difference of the control mode of the distributed inverter power source. The control mode can be divided into voltage source mode and current source mode distributed power supply. Generally, in order to realize the autonomous operation of emergency network, the real-time balance of active power and reactive power is needed to ensure the frequency requirement, voltage quality and system stability. The traditional hierarchical structure has clear control structure for load-bearing operation, but it is difficult to balance power regulation and system efficiency. For the integrated control of multi emergency power supply, it is necessary to put forward an improved optimal control strategy for the overall efficiency of the system.
[0003] Exemplary embodiments of the present disclosure are to provide a method, and a system for joint transmission of various emergency power generation equipment, which achieve the overall optimal efficiency of the various emergency power generation equipment.
[0004] According to an exemplary embodiment of the present disclosure, a method for joint transmission of various emergency power generation equipment is provided wherein each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load. The method includes: determining a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; determining an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; sending the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work.
[0005] According to another exemplary embodiment of the present disclosure, a system for joint transmission of various emergency power generation equipment is provided wherein the system comprises a plurality of converter, a DC bus and a joint transmission controller, each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load. The joint transmission controller is configured to determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; to determine optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; and to send the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work.
[0005a] According to an exemplary embodiment of the present disclosure, a method for joint transmission of various emergency power generation equipment is provided, wherein each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load. The method comprises: determining a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; determining an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; sending the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work,
wherein the various emergency power generation equipment comprises a DC power generation equipment and an AC power generation equipment; and the converter comprises a first DC-DC converter and an AC-DC converter; the determining of an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter step comprises: determining the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm, and a second energy efficiency of the AC-DC converter in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm; wherein the first energy efficiency of the first DC-DC converter varies with a change in the power supply ratio of the DC generation equipment; and the second energy efficiency of the AC-DC converter varies with a change in the power supply ratio of the AC power generation equipment, wherein the preset optimization algorithm is a genetic algorithm; the determining the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm, and a second energy efficiency of the AC-DC converter in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm step comprises: calculating a product of a maximum power generation amount of the DC generation equipment in the current control period, the first power supply ratio to be optimized, and the first energy efficiency as an actual power supply of the DC generation equipment; calculating a product of a maximum power generation amount of the AC generation equipment in the current control period, the second power supply ratio to be optimized, and the second energy efficiency as an actual power supply of the AC generation equipment; calculating a first sum of the actual power supply of the DC power generation equipment and the actual power supply of the AC power generation equipment; calculating a second sum of the maximum power generation amount of the DC generation equipment and the maximum power generation amount of the AC generation equipment in the current control period; taking a ratio of the first sum to the second sum as thefitness of each individual of the optimization algorithm, wherein each individual is a vector comprising the first power supply ratio to be optimized and the second power supply ratio to be optimized, and the dimension of each individual is equal to the number of various emergency power generation equipment; determining the optimal power supply proportion of each emergency power generation equipment basing on the optimal individual in the condition that the optimization algorithm converges, and the optimization algorithm converges in the condition that the ratio of the first sum and the second sum is maximum.
[0005b] According to an exemplary embodiment of the present disclosure, a system for joint transmission of various emergency power generation equipment is provided, wherein the system comprises a plurality of converter, a DC bus and a joint transmission controller, each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load, and the joint transmission controller is configured to determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; to determine an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; and to send the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work,
wherein the various emergency power generation equipment comprises a DC power generation equipment and an AC power generation equipment; and the converter comprises a first DC-DC converter and an AC-DC converter; the DC power generation equipment is connected to the DC bus through the first DC-DC converter, and the AC power generation equipment is connected to the DC bus through the AC-DC converter; the joint transmission controller is connected to the first DC-DC converter and the AC-DC converter respectively; the joint transmission controller is further configured to determine the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm, and a second energy efficiency of the AC-DC converter in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm; wherein the first energy efficiency of the first DC-DC converter varies with a change in the power supply ratio of the DC generation equipment; and the second energy efficiency of the AC-DC converter varies with a change in the power supply ratio of the AC power generation equipment, wherein the preset optimization algorithm is a genetic algorithm; the joint transmission controller is further configured to calculate a product of a maximum power generation amount of the DC generation equipment in the current control period, the first power supply ratio to be optimized, and the first energy efficiency as an actual power supply of the DC generation equipment; to calculate a product of a maximum power generation amount of the AC generation equipment in the current control period, the second power supply ratio to be optimized, and the second energy efficiency as an actual power supply of the AC generation equipment; to calculate a first sum of the actual power supply of the DC power generation equipment and the actual power supply of the AC power generation equipment; and to calculate a second sum of the maximum power generation amount of the DC generation equipment and the maximum power generation amount of the AC generation equipment in the current control period; and to take a ratio of the first sum to the second sum as thefitness of each individual of the optimization algorithm, wherein each individual is a vector comprising the first power supply ratio to be optimized and the second power supply ratio to be optimized, and the dimension of each individual is equal to the number of various emergency power generation equipment; and to determine the optimal power supply proportion of each emergency power generation equipment basing on the optimal individual in the condition that the optimization algorithm converges, and the optimization algorithm converges in the condition that the ratio of the first sum and the second sum is maximum.
[0006] The method, and system for joint transmission of various emergency power generation equipment according to exemplary embodiments of the present disclosure determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period. The optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized. Thus, it can determine the maximum power generation amount of each emergency power generation equipment in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, so as to achieve the overall energy efficiency of the various emergency power generation equipment varies with a change in the power supply ratio of the power generation equipment, and to achieve the overall energy efficiency of the various emergency power generation equipment is optimal.
[0007] To illustrate more clearly the technical scheme in the embodiment of the present disclosure or in the prior art, a brief description of the drawings required to be used in the embodiment or in the prior art description. The attached drawings described below are some embodiments of the present disclosure, and other attached drawings can be obtained for ordinary technical personnel in this field without creative labor.
[0008] Figure 1 shows a flowchart of a method for joint transmission of various emergency power generation equipment according to an exemplary embodiment of the present disclosure.
[0009] Figure 2 shows a structural block diagram of a system for joint transmission of various emergency power generation equipment according to an exemplary embodiment of the present disclosure.
[0010] Reference is made is detail to embodiments of the present disclosure. Examples of the embodiments are illustrated in the drawings, where same reference numerals represent same components. The embodiments are illustrated hereinafter with reference to the drawings to explain the present disclosure.
[0011] Figure 1 shows a flowchart of a method for joint transmission of various emergency power generation equipment according to an exemplary embodiment of the present disclosure.
[0012] In step Si01, determining a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period. The determination for the maximum power generation amount of each emergency power generation equipment is not the focus of this disclosure, and can refer to the existing technology.
[0013] Instep S102, determining an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period.
[0014] In step S103, sending the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work.
[0015] The method for joint transmission of various emergency power generation equipment according to exemplary embodiments of the present disclosure determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period. The optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized. Thus, it can determine the maximum power generation amount of each emergency power generation equipment in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, so as to achieve the overall energy efficiency of the various emergency power generation equipment varies with a change in the power supply ratio of the power generation equipment, and to achieve the overall energy efficiency of the various emergency power generation equipment is optimal.
[0016] The method for joint transmission of various emergency power generation equipment includes at least one of the following multi-preferred embodiments.
[0017] The first preferred embodiment, the various emergency power generation equipment comprises a DC power generation equipment and a AC power generation equipment; and the converter comprises a first DC-DC converter and a AC-DC converter. The step S102 includes: determining the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter and a second energy efficiency of the AC-DC converter. The first energy efficiency of the first DC-DC converter is determined in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm. The second energy efficiency of the AC-DC converter is determined in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm. The first energy efficiency of the first DC-DC converter varies with a change in the power supply ratio of the DC generation equipment. The second energy efficiency of the AC-DC converter varies with a change in the power supply ratio of the AC power generation equipment.
[0018] The second preferred embodiment, the various emergency power generation equipment includes wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment.
[0019] The third preferred embodiment, the preset optimization algorithm is a genetic algorithm. The determining the optimal power supply proportion of each emergency power generation equipment step in the first preferred embodiment further includes following steps.
[0020] Step 1: calculating a product of a maximum power generation amount of the DC generation equipment in the current control period, the first power supply ratio to be optimized, and the first energy efficiency as an actual power supply of the DC generation equipment.
[0021] Step 2: calculating a product of a maximum power generation amount of the AC generation equipment in the current control period, the second power supply ratio to be optimized, and the second energy efficiency as an actual power supply of the AC generation equipment.
[0022] Step 3: calculating a first sum of the actual power supply of the DC power generation equipment and the actual power supply of the AC power generation equipment.
[0023] Step 4: calculating a second sum of the maximum power generation amount of the DC generation equipment and the maximum power generation amount of the AC generation equipment in the current control period.
[0024] Step 5: taking a ratio of the first sum to the second sum as the fitness of each individual of the optimization algorithm, wherein each individual is a vector comprising the first power supply ratio to be optimized and the second power supply ratio to be optimized, and the dimension of each individual is equal to the number of various emergency power generation equipment. The dimension of each individual is six when the various emergency power generation equipment includes wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment. Each individual is denoted as (Gi , G2, G3, G4, G5, G6). Gi , G2, G3, G4, G5, G6 of the vector is the power supply ratio of wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment respectively. Power generation amount of wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment are denoted as Fi, F2, F3, F4 , F5, F6 respectively, and the total power supply demand of the load in the current control period is denoted as Q. And then the fitness of each individual of the optimization algorithm is can be determined by 1/((F1Gi+F2G2+F3G3+F4 G4+F5 G5+F6 G6)- Q).
[0025] Step 6: determining the optimal power supply proportion of each emergency power generation equipment basing on the optimal individual in the condition that the optimization algorithm converges, and the optimization algorithm converges in the condition that the ratio of the first sum and the second sum is maximum. Thus, the optimal individuals when the optimization algorithm converges are determined as the optimal power supply proportion of wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment.
[0026] The method for joint transmission of various emergency power generation equipment according to exemplary embodiments of the present disclosure determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period. The optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized. Thus, it can determine the maximum power generation amount of each emergency power generation equipment in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, so as to achieve the overall energy efficiency of the various emergency power generation equipment varies with a change in the power supply ratio of the power generation equipment, and to achieve the overall energy efficiency of the various emergency power generation equipment is optimal.
[0027] Figure 2 shows a structural block diagram of a system for joint transmission of various emergency power generation equipment according to an exemplary embodiment of the present disclosure. As shown in figure 2, the system for joint transmission of various emergency power generation equipment according to an exemplary embodiment of the present disclosure includes: a plurality of converter, a DC bus and a joint transmission controller, each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load.
[0028] The joint transmission controller is configured to determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; to determine optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; and to send the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work.
[0029] Specifically, the various emergency power generation equipment includes a DC power generation equipment and a AC power generation equipment. The converter includes a first DC DC converter and a AC-DC converter. The DC power generation equipment is connected to the DC bus through the first DC-DC converter, and the AC power generation equipment is connected to the DC bus through the AC-DC converter. The joint transmission controller is connected to the first DC-DC converter and the AC-DC converter respectively. The joint transmission controller is further configured to determine the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter and a second energy efficiency of the AC-DC converter. The first energy efficiency of the first DC-DC converter is determined in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm. The second energy efficiency of the AC-DC converter is determined in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm. The first energy efficiency of the first DC-DC converter varies with a change in the power supply ratio of the DC generation equipment; and the second energy efficiency of the AC-DC converter varies with a change in the power supply ratio of the AC power generation equipment.
[0030] The preset optimization algorithm is a genetic algorithm. The joint transmission controller is further configured to calculate a product of a maximum power generation amount of the DC generation equipment in the current control period, the first power supply ratio to be optimized, and the first energy efficiency as an actual power supply of the DC generation equipment; and, to calculate a product of a maximum power generation amount of the AC generation equipment in the current control period, the second power supply ratio to be optimized, and the second energy efficiency as an actual power supply of the AC generation equipment; and, to calculate a first sum of the actual power supply of the DC power generation equipment and the actual power supply of the AC power generation equipment; and to calculate a second sum of the maximum power generation amount of the DC generation equipment and the maximum power generation amount of the AC generation equipment in the current control period; and to take a ratio of the first sum to the second sum as thefitness of each individual of the optimization algorithm, wherein each individual is a vector comprising the first power supply ratio to be optimized and the second power supply ratio to be optimized, and the dimension of each individual is equal to the number of various emergency power generation equipment; and to determine the optimal power supply proportion of each emergency power generation equipment basing on the optimal individual in the condition that the optimization algorithm converges, and the optimization algorithm converges in the condition that the ratio of the first sum and the second sum is maximum.
[0031] The converter includes a DC-AC converter and a second DC-DC converter; the DC bus is connected to a AC load through the DC-AC converter, and the DC bus is connected to a DC load through the second DC-DC converter. The joint transmission controller is connected to the DC-AC converter and the second DC-DC converter respectively.
[0032] Specifically, the various emergency power generation equipment comprises wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment.
[0033] The system for joint transmission of various emergency power generation equipment according to exemplary embodiments of the present disclosure determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period. The optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized. Thus, it can determine the maximum power generation amount of each emergency power generation equipment in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, so as to achieve the overall energy efficiency of the various emergency power generation equipment varies with a change in the power supply ratio of the power generation equipment, and to achieve the overall energy efficiency of the various emergency power generation equipment is optimal.
[0034] Although the present disclosure has been illustrated and described with reference to some exemplary embodiments thereof, it should be understood by those skilled in the art that various modifications may be made to the embodiments without departing from the spirit and scope of the present disclosure as defined in the appended claims and equivalents thereof.
[0035] Throughout this specification and the claims that follow unless the context requires otherwise, the words 'comprise' and 'include' and variations such as 'comprising' and 'including' will be understood to imply the inclusion of a stated integer or group of integers but not the exclusion of any other integer or group of integers.
[0036] The reference to any prior art in this specification is not, and should not be taken as, an acknowledgment or any form of suggestion that such prior art forms part of the common general knowledge of the technical field.
Claims (6)
1. A method for joint transmission of various emergency power generation equipment, wherein each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load, and the method comprises: determining a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; determining an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; sending the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work,
wherein the various emergency power generation equipment comprises a DC power generation equipment and a AC power generation equipment; and the converter comprises a first DC-DC converter and a AC-DC converter; the determining an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter step comprises: determining the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm, and a second energy efficiency of the AC-DC converter in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm; wherein the first energy efficiency of the first DC-DC converter varies with a change in the power supply ratio of the DC generation equipment; and the second energy efficiency of the AC-DC converter varies with a change in the power supply ratio of the AC power generation equipment, wherein the preset optimization algorithm is a genetic algorithm; the determining the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm, and a second energy efficiency of the AC-DC converter in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm step comprises: calculating a product of a maximum power generation amount of the DC generation equipment in the current control period, the first power supply ratio to be optimized, and the first energy efficiency as an actual power supply of the DC generation equipment; calculating a product of a maximum power generation amount of the AC generation equipment in the current control period, the second power supply ratio to be optimized, and the second energy efficiency as an actual power supply of the AC generation equipment; calculating a first sum of the actual power supply of the DC power generation equipment and the actual power supply of the AC power generation equipment; calculating a second sum of the maximum power generation amount of the DC generation equipment and the maximum power generation amount of the AC generation equipment in the current control period; taking a ratio of the first sum to the second sum as thefitness of each individual of the optimization algorithm, wherein each individual is a vector comprising the first power supply ratio to be optimized and the second power supply ratio to be optimized, and the dimension of each individual is equal to the number of various emergency power generation equipment; determining the optimal power supply proportion of each emergency power generation equipment basing on the optimal individual in the condition that the optimization algorithm converges, and the optimization algorithm converges in the condition that the ratio of the first sum and the second sum is maximum.
2. The method according to claim 1, wherein the various emergency power generation equipment comprises wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment.
3. The method according to claim 2, wherein the preset optimization algorithm is a multi objective genetic algorithm.
4. A system for joint transmission of various emergency power generation equipment, wherein the system comprises a plurality of converter, a DC bus and a joint transmission controller, each emergency generation equipment is connected to a DC bus through a converter, and the DC bus is used for connecting a load, and the joint transmission controller is configured to determine a maximum power generation amount of each emergency power generation equipment in a current control period, basing on environment information and operating condition information of the corresponding emergency power generation equipment in the current control period; to determine an optimal power supply proportion of each emergency power generation equipment by using a preset optimization algorithm, basing on an energy efficiency of each converter, wherein the optimization algorithm converges in a condition that overall energy efficiency of the various emergency power generation equipment is maximized, the overall energy efficiency of the various emergency power generation equipment is a ratio of, a sum of products of the maximum power generation amount of each emergency power generation equipment in the current control period, a power supply proportion to be optimized which is generated by the optimization algorithm, and the energy efficiency of a corresponding connected converter of each emergency power generation equipment, to a total of power generation amount of each emergency power generation equipment in the current control period; and the optimization algorithm is constrained by the fact that the sum is greater than or equal to a total power supply demand of the load in the current control period; and to send the optimal power supply proportion of each emergency power generation equipment to corresponding emergency power generation equipment, to control the corresponding emergency power generation equipment work,
wherein the various emergency power generation equipment comprises a DC power generation equipment and a AC power generation equipment; and the converter comprises a first DC-DC converter and a AC-DC converter; the DC power generation equipment is connected to the DC bus through thefirst DC-DC converter, and the AC power generation equipment is connected to the DC bus through the AC-DC converter; the joint transmission controller is connected to the first DC-DC converter and the AC-DC converter respectively; the joint transmission controller is further configured to determine the optimal power supply proportion of each emergency power generation equipment by using the optimization algorithm, basing on a first energy efficiency of the first DC-DC converter in the condition that a power supply ratio of the DC generation equipment is a first power supply ratio to be optimized which is generated by the optimization algorithm, and a second energy efficiency of the AC-DC converter in the condition that a power supply ratio of the AC power generation equipment is a second power supply ratio to be optimized which is generated by the optimization algorithm; wherein the first energy efficiency of the first DC-DC converter varies with a change in the power supply ratio of the DC generation equipment; and the second energy efficiency of the AC-DC converter varies with a change in the power supply ratio of the AC power generation equipment, wherein the preset optimization algorithm is a genetic algorithm; the joint transmission controller is further configured to calculate a product of a maximum power generation amount of the DC generation equipment in the current control period, the first power supply ratio to be optimized, and the first energy efficiency as an actual power supply of the DC generation equipment; to calculate a product of a maximum power generation amount of the AC generation equipment in the current control period, the second power supply ratio to be optimized, and the second energy efficiency as an actual power supply of the AC generation equipment; to calculate a first sum of the actual power supply of the DC power generation equipment and the actual power supply of the AC power generation equipment; and to calculate a second sum of the maximum power generation amount of the DC generation equipment and the maximum power generation amount of the AC generation equipment in the current control period; and to take a ratio of the first sum to the second sum as the fitness of each individual of the optimization algorithm, wherein each individual is a vector comprising the first power supply ratio to be optimized and the second power supply ratio to be optimized, and the dimension of each individual is equal to the number of various emergency power generation equipment; and to determine the optimal power supply proportion of each emergency power generation equipment basing on the optimal individual in the condition that the optimization algorithm converges, and the optimization algorithm converges in the condition that the ratio of the first sum and the second sum is maximum.
5. The system according to claim 4, wherein the converter comprises a DC-AC converter and a second DC-DC converter; the DC bus is connected to a AC load through the DC-AC converter, and the DC bus is connected to a DC load through the second DC-DC converter; the joint transmission controller is connected to the DC-AC converter and the second DC-DC converter respectively.
6. The system according to claim 5, wherein the various emergency power generation equipment comprises wind power generation equipment, photovoltaic power generation equipment, energy storage equipment, emergency diesel power generation vehicle, hydrogen energy equipment and fuel cell equipment.
Figure 1 1/2
Figure 2 2/2
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202210906730.2 | 2022-07-29 | ||
| CN202210906730.2A CN115173391A (en) | 2022-07-29 | 2022-07-29 | Joint transmission method and system for multiple emergency power generation devices |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2022259710A1 AU2022259710A1 (en) | 2024-02-15 |
| AU2022259710B2 true AU2022259710B2 (en) | 2024-05-02 |
Family
ID=83477106
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2022259710A Active AU2022259710B2 (en) | 2022-07-29 | 2022-10-24 | Method and system for joint transmission of various emergency power generation equipment |
Country Status (2)
| Country | Link |
|---|---|
| CN (1) | CN115173391A (en) |
| AU (1) | AU2022259710B2 (en) |
-
2022
- 2022-07-29 CN CN202210906730.2A patent/CN115173391A/en active Pending
- 2022-10-24 AU AU2022259710A patent/AU2022259710B2/en active Active
Also Published As
| Publication number | Publication date |
|---|---|
| AU2022259710A1 (en) | 2024-02-15 |
| CN115173391A (en) | 2022-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN110190628B (en) | Complex line full-parallel AT traction power supply system and method based on comprehensive energy | |
| CN108988402B (en) | Optimization control method for alternating current-direct current power distribution network based on optimization scheduling | |
| CN112803505B (en) | Distributed voltage source converter cooperative control method and alternating current-direct current parallel-serial micro-grid | |
| CN107069791B (en) | A kind of integration requirement response method for considering industrial park and being interacted with factory | |
| CN107508277A (en) | A kind of light storage direct-current grid distributed collaboration control method based on uniformity | |
| CN107017615B (en) | A kind of direct current electrical spring distributed control method and system based on consistency | |
| CN110601248A (en) | Multi-mode coordination control method of annular alternating current-direct current hybrid micro-grid system | |
| CN110544961A (en) | dynamic economic dispatching method for isolated grid type alternating current-direct current hybrid micro-grid | |
| CN113472020B (en) | Novel AC/DC hybrid data center power supply control system and control method | |
| Yang et al. | A dual mode distributed economic control for a fuel cell–photovoltaic-battery hybrid power generation system based on marginal cost | |
| CN110212517A (en) | The distributing unified control method of mesolow direct-flow distribution system | |
| CN113541197A (en) | Energy control method and system for low-voltage transformer area flexible-direct interconnection energy-storage-free system | |
| CN110994697B (en) | Optimal operation control method and system for alternating current-direct current distribution network containing light storage combination | |
| CN111231713A (en) | Electric automobile charging and discharging system and control method | |
| CN114362288B (en) | Method, system and storage medium for regulating balance among battery clusters | |
| CN112803480B (en) | Optical storage system and control method thereof | |
| AU2022259710B2 (en) | Method and system for joint transmission of various emergency power generation equipment | |
| CN117335476A (en) | SOC balance method, device and system for network-structured energy storage | |
| CN110649590B (en) | Energy cooperative control method for networking type direct-current micro-grid | |
| CN110766238A (en) | Hierarchical planning method and system for alternating current-direct current hybrid power distribution system | |
| CN218124324U (en) | Energy router system suitable for zero-carbon building | |
| CN115224704B (en) | Time-sharing multiplexing peak regulation and frequency modulation power station constructed based on hybrid energy storage and control method | |
| CN114221366B (en) | Control method, controller and power station for multi-PCS time sequence response of energy storage power station | |
| CN110994695A (en) | Intraday optimal scheduling method and system for power distribution network | |
| CN114512978A (en) | Control method for series networking type wind power full-direct-current sending system |