AU2012223232B2 - Heterocyclic compounds for the inhibition of PASK - Google Patents
Heterocyclic compounds for the inhibition of PASK Download PDFInfo
- Publication number
- AU2012223232B2 AU2012223232B2 AU2012223232A AU2012223232A AU2012223232B2 AU 2012223232 B2 AU2012223232 B2 AU 2012223232B2 AU 2012223232 A AU2012223232 A AU 2012223232A AU 2012223232 A AU2012223232 A AU 2012223232A AU 2012223232 B2 AU2012223232 B2 AU 2012223232B2
- Authority
- AU
- Australia
- Prior art keywords
- quinoxaline
- methyl
- carboxylic acid
- amino
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 230000005764 inhibitory process Effects 0.000 title claims description 10
- 150000002391 heterocyclic compounds Chemical class 0.000 title abstract description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 43
- 238000000034 method Methods 0.000 claims abstract description 43
- 201000010099 disease Diseases 0.000 claims abstract description 30
- 239000003814 drug Substances 0.000 claims abstract description 26
- 238000011282 treatment Methods 0.000 claims abstract description 24
- 230000000694 effects Effects 0.000 claims abstract description 15
- 206010012601 diabetes mellitus Diseases 0.000 claims abstract description 13
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 210
- JGQDBVXRYDEWGM-UHFFFAOYSA-N quinoxaline-6-carboxylic acid Chemical compound N1=CC=NC2=CC(C(=O)O)=CC=C21 JGQDBVXRYDEWGM-UHFFFAOYSA-N 0.000 claims description 127
- 150000001875 compounds Chemical class 0.000 claims description 110
- -1 3-[(2S)-2-methylpyrrolidin-1-yl]-2-[5-(trifluoromethyl)-1-benzofuran-2-yl]quinoxaline-6-carboxylic acid 3-[Benzyl(methyl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound 0.000 claims description 65
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 50
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims description 31
- 206010022489 Insulin Resistance Diseases 0.000 claims description 20
- 229940124597 therapeutic agent Drugs 0.000 claims description 14
- 208000030159 metabolic disease Diseases 0.000 claims description 13
- 150000003626 triacylglycerols Chemical class 0.000 claims description 12
- 208000016097 disease of metabolism Diseases 0.000 claims description 11
- 208000001145 Metabolic Syndrome Diseases 0.000 claims description 10
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 claims description 10
- CPKQNJVWDKEEIN-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(4-phenylfuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C(OC=1)=CC=1C1=CC=CC=C1 CPKQNJVWDKEEIN-UHFFFAOYSA-N 0.000 claims description 9
- 206010028980 Neoplasm Diseases 0.000 claims description 9
- 230000001404 mediated effect Effects 0.000 claims description 9
- 201000000690 abdominal obesity-metabolic syndrome Diseases 0.000 claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 208000008589 Obesity Diseases 0.000 claims description 7
- 235000020824 obesity Nutrition 0.000 claims description 7
- DMWNCWWWTSTMTC-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(5-phenylfuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C(O1)=CC=C1C1=CC=CC=C1 DMWNCWWWTSTMTC-UHFFFAOYSA-N 0.000 claims description 6
- 208000032928 Dyslipidaemia Diseases 0.000 claims description 6
- 101000613563 Homo sapiens PAS domain-containing serine/threonine-protein kinase Proteins 0.000 claims description 6
- 208000017170 Lipid metabolism disease Diseases 0.000 claims description 6
- 102100040902 PAS domain-containing serine/threonine-protein kinase Human genes 0.000 claims description 6
- 230000009467 reduction Effects 0.000 claims description 6
- ZYWQUHYHWUQXTN-UHFFFAOYSA-N 2-(1,3-benzothiazol-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=CC=C2SC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=NC2=C1 ZYWQUHYHWUQXTN-UHFFFAOYSA-N 0.000 claims description 5
- RXSKMQGRFMZOIO-UHFFFAOYSA-N 2-(1-benzofuran-2-yl)-3-(diethylamino)quinoxaline-6-carboxylic acid Chemical compound C1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(CC)CC)C(O)=O)=CC2=C1 RXSKMQGRFMZOIO-UHFFFAOYSA-N 0.000 claims description 5
- WKQMDQNONJBZHA-UHFFFAOYSA-N 2-(1-benzofuran-2-yl)-3-(propan-2-ylamino)quinoxaline-6-carboxylic acid Chemical compound C1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3NC(C)C)C(O)=O)=CC2=C1 WKQMDQNONJBZHA-UHFFFAOYSA-N 0.000 claims description 5
- FFHXHHNIDPSDBY-UHFFFAOYSA-N 2-(1-benzofuran-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=CC=C2C(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=COC2=C1 FFHXHHNIDPSDBY-UHFFFAOYSA-N 0.000 claims description 5
- PIQMRBMZZGIMJW-UHFFFAOYSA-N 2-(1-benzofuran-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2OC=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 PIQMRBMZZGIMJW-UHFFFAOYSA-N 0.000 claims description 5
- QMOOVJMVTNKTMT-UHFFFAOYSA-N 2-(3,4-dihydro-2h-chromen-6-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound O1CCCC2=CC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC=C21 QMOOVJMVTNKTMT-UHFFFAOYSA-N 0.000 claims description 5
- CQZZHWXGJVDZEC-UHFFFAOYSA-N 2-(5-fluoro-1-benzofuran-2-yl)-3-pyrrolidin-1-ylquinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2OC3=CC=C(F)C=C3C=2)C=1N1CCCC1 CQZZHWXGJVDZEC-UHFFFAOYSA-N 0.000 claims description 5
- SGLKFZXVMCCJCK-UHFFFAOYSA-N 2-(6-fluoro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C(F)C=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 SGLKFZXVMCCJCK-UHFFFAOYSA-N 0.000 claims description 5
- UANZJUBUUPZHHZ-UHFFFAOYSA-N 3-(azepan-1-yl)-2-(6-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2OC3=CC(F)=CC=C3C=2)C=1N1CCCCCC1 UANZJUBUUPZHHZ-UHFFFAOYSA-N 0.000 claims description 5
- LJRGPOSGNRRDNU-UHFFFAOYSA-N 3-[cyclopropyl(methyl)amino]-2-(5-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2OC3=CC=C(F)C=C3C=2)C=1N(C)C1CC1 LJRGPOSGNRRDNU-UHFFFAOYSA-N 0.000 claims description 5
- DBJBGGXNRSDTNA-UHFFFAOYSA-N 3-[cyclopropyl(methyl)amino]-2-(6-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2OC3=CC(F)=CC=C3C=2)C=1N(C)C1CC1 DBJBGGXNRSDTNA-UHFFFAOYSA-N 0.000 claims description 5
- OJJFMHJYKUPPEF-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-quinoxalin-6-ylquinoxaline-6-carboxylic acid Chemical compound N1=CC=NC2=CC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC=C21 OJJFMHJYKUPPEF-UHFFFAOYSA-N 0.000 claims description 5
- 235000012000 cholesterol Nutrition 0.000 claims description 5
- 210000004185 liver Anatomy 0.000 claims description 5
- BIHUZIWQHCHYBI-LBPRGKRZSA-N 2-(1,3-benzothiazol-5-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(SC=N2)C2=C1 BIHUZIWQHCHYBI-LBPRGKRZSA-N 0.000 claims description 4
- SOOFJAKEDDEPQZ-ZDUSSCGKSA-N 2-(1-benzofuran-3-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=COC2=CC=CC=C12 SOOFJAKEDDEPQZ-ZDUSSCGKSA-N 0.000 claims description 4
- BQRJPDMXWWSWNB-UHFFFAOYSA-N 2-(2-fluoropyridin-4-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=NC(F)=C1 BQRJPDMXWWSWNB-UHFFFAOYSA-N 0.000 claims description 4
- CYLFJMZLGGCHAU-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2N=C(N(C)C(C)C)C(C=3OC4=CC=C(C=C4C=3)OC)=NC2=C1 CYLFJMZLGGCHAU-UHFFFAOYSA-N 0.000 claims description 4
- QBMJPGVLCJDRET-UHFFFAOYSA-N 2-(6-aminopyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(N)N=C1 QBMJPGVLCJDRET-UHFFFAOYSA-N 0.000 claims description 4
- LWPMWLKFTFMDSS-UHFFFAOYSA-N 2-(6-chloro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C(Cl)C=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 LWPMWLKFTFMDSS-UHFFFAOYSA-N 0.000 claims description 4
- GETLYZBHMGDHME-ZDUSSCGKSA-N 2-(6-fluoro-1-benzofuran-2-yl)-3-[(2s)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC=C(F)C=C2O1 GETLYZBHMGDHME-ZDUSSCGKSA-N 0.000 claims description 4
- HATAMFMJUBVBNF-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(3-phenylfuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C=1OC=CC=1C1=CC=CC=C1 HATAMFMJUBVBNF-UHFFFAOYSA-N 0.000 claims description 4
- 102000001554 Hemoglobins Human genes 0.000 claims description 4
- 108010054147 Hemoglobins Proteins 0.000 claims description 4
- 230000001668 ameliorated effect Effects 0.000 claims description 4
- 201000011510 cancer Diseases 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- MWZLPHYVHKHONG-LBPRGKRZSA-N 2-(1,3-benzothiazol-2-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=NC2=CC=CC=C2S1 MWZLPHYVHKHONG-LBPRGKRZSA-N 0.000 claims description 3
- YGDXDNYHCIZQJZ-UHFFFAOYSA-N 2-(1,3-benzothiazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2SC=NC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 YGDXDNYHCIZQJZ-UHFFFAOYSA-N 0.000 claims description 3
- GFTKHQLRFVCWRX-LBPRGKRZSA-N 2-(1h-indazol-5-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NN=C2)C2=C1 GFTKHQLRFVCWRX-LBPRGKRZSA-N 0.000 claims description 3
- KGIUOJYLXCAKHY-UHFFFAOYSA-N 2-(5,6-difluoro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound FC1=C(F)C=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 KGIUOJYLXCAKHY-UHFFFAOYSA-N 0.000 claims description 3
- ZXNMEEGSADJYDY-MRXNPFEDSA-N 2-(5-fluoro-1-benzofuran-2-yl)-3-[(2r)-2-(methoxymethyl)pyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound COC[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC(F)=CC=C2O1 ZXNMEEGSADJYDY-MRXNPFEDSA-N 0.000 claims description 3
- GDDDPORBETZDLU-LBPRGKRZSA-N 2-(6-fluoro-1-benzofuran-2-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC=C(F)C=C2O1 GDDDPORBETZDLU-LBPRGKRZSA-N 0.000 claims description 3
- RFGTWQYPVQBVOL-NSHDSACASA-N 2-(furan-3-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=COC=C1 RFGTWQYPVQBVOL-NSHDSACASA-N 0.000 claims description 3
- MHAKUCBRFOGKFE-UHFFFAOYSA-N 3-(azepan-1-yl)-2-(5-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2OC3=CC=C(F)C=C3C=2)C=1N1CCCCCC1 MHAKUCBRFOGKFE-UHFFFAOYSA-N 0.000 claims description 3
- GXICKBKQHWLVKZ-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-quinolin-6-ylquinoxaline-6-carboxylic acid Chemical compound N1=CC=CC2=CC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC=C21 GXICKBKQHWLVKZ-UHFFFAOYSA-N 0.000 claims description 3
- 108010069201 VLDL Cholesterol Proteins 0.000 claims description 3
- 208000010706 fatty liver disease Diseases 0.000 claims description 3
- 208000008338 non-alcoholic fatty liver disease Diseases 0.000 claims description 3
- 206010053219 non-alcoholic steatohepatitis Diseases 0.000 claims description 3
- 230000002265 prevention Effects 0.000 claims description 3
- WXHUDJCHSWBJBK-UHFFFAOYSA-N 2-(1,3-benzoxazol-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=NC2=C1 WXHUDJCHSWBJBK-UHFFFAOYSA-N 0.000 claims description 2
- MTLHELADYAJSKK-UHFFFAOYSA-N 2-(1-benzothiophen-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=CC=C2SC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 MTLHELADYAJSKK-UHFFFAOYSA-N 0.000 claims description 2
- AMPOKVPBVDAJRO-UHFFFAOYSA-N 2-(1-benzothiophen-2-yl)-3-piperidin-1-ylquinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2SC3=CC=CC=C3C=2)C=1N1CCCCC1 AMPOKVPBVDAJRO-UHFFFAOYSA-N 0.000 claims description 2
- KHNRLWXEMUFQHA-UHFFFAOYSA-N 2-(1-ethylindazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2N=C(N(C)C(C)C)C(C=3C=C4C=NN(C4=CC=3)CC)=NC2=C1 KHNRLWXEMUFQHA-UHFFFAOYSA-N 0.000 claims description 2
- BSLPFJZUSHEYDR-UHFFFAOYSA-N 2-(1-methylindazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2N(C)N=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 BSLPFJZUSHEYDR-UHFFFAOYSA-N 0.000 claims description 2
- KVWYGRCUHYDUPM-INIZCTEOSA-N 2-(1h-indazol-5-yl)-3-[(2s)-2-methyl-4-pyridin-2-ylpiperazin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C([C@@H](N(CC1)C=2C(=NC3=CC=C(C=C3N=2)C(O)=O)C=2C=C3C=NNC3=CC=2)C)N1C1=CC=CC=N1 KVWYGRCUHYDUPM-INIZCTEOSA-N 0.000 claims description 2
- ODUZRQZHHTZAHO-UHFFFAOYSA-N 2-(1h-indazol-5-yl)-3-piperidin-1-ylquinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2C=C3C=NNC3=CC=2)C=1N1CCCCC1 ODUZRQZHHTZAHO-UHFFFAOYSA-N 0.000 claims description 2
- YOVIPOGPVUTULK-AWEZNQCLSA-N 2-(1h-indol-5-yl)-3-[(2s)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC=C2)C2=C1 YOVIPOGPVUTULK-AWEZNQCLSA-N 0.000 claims description 2
- MWGREAUBIXKKTG-ZDUSSCGKSA-N 2-(1h-indol-5-yl)-3-[(3s)-3-methylmorpholin-4-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1COCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC=C2)C2=C1 MWGREAUBIXKKTG-ZDUSSCGKSA-N 0.000 claims description 2
- LZMMMXBIYIERPJ-LBPRGKRZSA-N 2-(2,4-difluorophenyl)-3-[(2s)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1F LZMMMXBIYIERPJ-LBPRGKRZSA-N 0.000 claims description 2
- UMGQJNFJZYZIPD-NSHDSACASA-N 2-(2,4-difluorophenyl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1F UMGQJNFJZYZIPD-NSHDSACASA-N 0.000 claims description 2
- GGGZMRUTRIRCSV-UHFFFAOYSA-N 2-(2,4-difluorophenyl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1F GGGZMRUTRIRCSV-UHFFFAOYSA-N 0.000 claims description 2
- HPPMXSBQQANRQW-SFHVURJKSA-N 2-(2-methyl-1h-indol-5-yl)-3-[(2s)-2-methyl-4-pyridin-2-ylpiperazin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C([C@@H](N(CC1)C=2C(=NC3=CC=C(C=C3N=2)C(O)=O)C=2C=C3C=C(C)NC3=CC=2)C)N1C1=CC=CC=N1 HPPMXSBQQANRQW-SFHVURJKSA-N 0.000 claims description 2
- ZYEKSELKTXPICM-HNNXBMFYSA-N 2-(2-methyl-1h-indol-5-yl)-3-[(2s)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC(C)=C2)C2=C1 ZYEKSELKTXPICM-HNNXBMFYSA-N 0.000 claims description 2
- CQGCVTTTZQCQSM-AWEZNQCLSA-N 2-(2-methyl-1h-indol-5-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC(C)=C2)C2=C1 CQGCVTTTZQCQSM-AWEZNQCLSA-N 0.000 claims description 2
- QGGBKOZHYLWKJJ-UHFFFAOYSA-N 2-(2-methyl-1h-indol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2NC(C)=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 QGGBKOZHYLWKJJ-UHFFFAOYSA-N 0.000 claims description 2
- YWGBYDRUISHZSH-NSHDSACASA-N 2-(3,4-difluorophenyl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C(F)=C1 YWGBYDRUISHZSH-NSHDSACASA-N 0.000 claims description 2
- CHAQZNLBANSVJR-UHFFFAOYSA-N 2-(3-methyl-1-benzofuran-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2OC=C(C)C2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 CHAQZNLBANSVJR-UHFFFAOYSA-N 0.000 claims description 2
- KVXWDHUOLVPLHD-UHFFFAOYSA-N 2-(3-methyl-1h-indol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2NC=C(C)C2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 KVXWDHUOLVPLHD-UHFFFAOYSA-N 0.000 claims description 2
- KFXZLYOKRQMVBM-UHFFFAOYSA-N 2-(3-methyl-2h-indazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2NN=C(C)C2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 KFXZLYOKRQMVBM-UHFFFAOYSA-N 0.000 claims description 2
- DTCGHNJHIKLFGT-UHFFFAOYSA-N 2-(4-acetamidophenyl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC(C)=O)C=C1 DTCGHNJHIKLFGT-UHFFFAOYSA-N 0.000 claims description 2
- NZAIREKENDLPID-UHFFFAOYSA-N 2-(4-carbamoylphenyl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(C(N)=O)C=C1 NZAIREKENDLPID-UHFFFAOYSA-N 0.000 claims description 2
- UGYZUYYXWJRWED-ZDUSSCGKSA-N 2-(4-fluoro-2-methylphenyl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1C UGYZUYYXWJRWED-ZDUSSCGKSA-N 0.000 claims description 2
- UJJBXNNNFVIICL-UHFFFAOYSA-N 2-(4-fluoro-2-methylphenyl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1C UJJBXNNNFVIICL-UHFFFAOYSA-N 0.000 claims description 2
- FCIRAYUAICUXRT-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-(4-methylsulfonylpiperazin-1-yl)quinoxaline-6-carboxylic acid Chemical compound C1CN(S(=O)(=O)C)CCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 FCIRAYUAICUXRT-UHFFFAOYSA-N 0.000 claims description 2
- CPSIGEVKWMSHHW-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-(4-pyridin-2-ylpiperidin-1-yl)quinoxaline-6-carboxylic acid Chemical compound C1CC(C=2N=CC=CC=2)CCN1C1=NC2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 CPSIGEVKWMSHHW-UHFFFAOYSA-N 0.000 claims description 2
- BXYWNNBCTFBNED-CYBMUJFWSA-N 2-(4-fluorophenyl)-3-[(2r)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@@H]1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 BXYWNNBCTFBNED-CYBMUJFWSA-N 0.000 claims description 2
- DZRUCRKWBXDZRX-GFCCVEGCSA-N 2-(4-fluorophenyl)-3-[(2r)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 DZRUCRKWBXDZRX-GFCCVEGCSA-N 0.000 claims description 2
- YSDCXPRESMDZSH-LBPRGKRZSA-N 2-(4-fluorophenyl)-3-[(2s)-2-methylpiperazin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CNCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 YSDCXPRESMDZSH-LBPRGKRZSA-N 0.000 claims description 2
- ZCTTYVIVEMZVFW-LBPRGKRZSA-N 2-(4-fluorophenyl)-3-[(3s)-3-methylmorpholin-4-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1COCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 ZCTTYVIVEMZVFW-LBPRGKRZSA-N 0.000 claims description 2
- IBHWONCSHWMJNW-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-[methyl(2,2,2-trifluoroethyl)amino]quinoxaline-6-carboxylic acid Chemical compound FC(F)(F)CN(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 IBHWONCSHWMJNW-UHFFFAOYSA-N 0.000 claims description 2
- YJEHFXNHOSETNO-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-[methyl(2-methylpropyl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)CN(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 YJEHFXNHOSETNO-UHFFFAOYSA-N 0.000 claims description 2
- ZONMABJWTYATPJ-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-[methyl(pyridin-2-ylmethyl)amino]quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=CC(F)=CC=2)C=1N(C)CC1=CC=CC=N1 ZONMABJWTYATPJ-UHFFFAOYSA-N 0.000 claims description 2
- BLUQKEFNVDZORH-HNNXBMFYSA-N 2-(4-fluorophenyl)-3-[methyl-[(1s)-1-phenylethyl]amino]quinoxaline-6-carboxylic acid Chemical compound CN([C@@H](C)C=1C=CC=CC=1)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 BLUQKEFNVDZORH-HNNXBMFYSA-N 0.000 claims description 2
- KSOSMBIHLIURIR-UHFFFAOYSA-N 2-(4-fluorophenyl)-3-pyrrolidin-1-ylquinoxaline-6-carboxylic acid Chemical compound C1CCCN1C1=NC2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 KSOSMBIHLIURIR-UHFFFAOYSA-N 0.000 claims description 2
- LFLQRZMEKFBWRL-UHFFFAOYSA-N 2-(4-fluorophenyl)-7-hydroxy-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=C(O)C=C2N=C1C1=CC=C(F)C=C1 LFLQRZMEKFBWRL-UHFFFAOYSA-N 0.000 claims description 2
- BSJHQXDLPNSMKF-UHFFFAOYSA-N 2-(4-fluorophenyl)-7-methoxy-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C=1N=C2C=C(C(O)=O)C(OC)=CC2=NC=1C1=CC=C(F)C=C1 BSJHQXDLPNSMKF-UHFFFAOYSA-N 0.000 claims description 2
- OZVSQJWMHMBDFU-LBPRGKRZSA-N 2-(5-fluoro-1-benzothiophen-2-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC(F)=CC=C2S1 OZVSQJWMHMBDFU-LBPRGKRZSA-N 0.000 claims description 2
- YGOVPKBEDBATEQ-UHFFFAOYSA-N 2-(5-fluoro-1-benzothiophen-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound FC1=CC=C2SC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 YGOVPKBEDBATEQ-UHFFFAOYSA-N 0.000 claims description 2
- JODANXPMAYSDGT-UHFFFAOYSA-N 2-(benzimidazol-1-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=NC2=CC=CC=C2N1C1=NC2=CC=C(C(O)=O)C=C2N=C1N(C)C(C)C JODANXPMAYSDGT-UHFFFAOYSA-N 0.000 claims description 2
- PKQBRVJKVBCSBD-UHFFFAOYSA-N 2-[5-(4-fluorophenyl)furan-2-yl]-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C(O1)=CC=C1C1=CC=C(F)C=C1 PKQBRVJKVBCSBD-UHFFFAOYSA-N 0.000 claims description 2
- ZOBHMCJHEBCIDO-UHFFFAOYSA-N 3-(2-ethylpiperidin-1-yl)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CCC1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 ZOBHMCJHEBCIDO-UHFFFAOYSA-N 0.000 claims description 2
- VQQQQIRMJJMAFZ-UHFFFAOYSA-N 3-(4-acetylpiperazin-1-yl)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound C1CN(C(=O)C)CCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 VQQQQIRMJJMAFZ-UHFFFAOYSA-N 0.000 claims description 2
- WHPDGYFASRTPCX-UHFFFAOYSA-N 3-(4-benzoylpiperazin-1-yl)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound C1CN(C(=O)C=2C=CC=CC=2)CCN1C1=NC2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 WHPDGYFASRTPCX-UHFFFAOYSA-N 0.000 claims description 2
- GXQFYXYVMFMIDV-UHFFFAOYSA-N 3-(azepan-1-yl)-2-(1-benzothiophen-2-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2SC3=CC=CC=C3C=2)C=1N1CCCCCC1 GXQFYXYVMFMIDV-UHFFFAOYSA-N 0.000 claims description 2
- DSTLVSDHXCRLDK-UHFFFAOYSA-N 3-(azepan-1-yl)-2-(1h-indazol-5-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2C=C3C=NNC3=CC=2)C=1N1CCCCCC1 DSTLVSDHXCRLDK-UHFFFAOYSA-N 0.000 claims description 2
- BEABJFQFDAQKGJ-UHFFFAOYSA-N 3-(azepan-1-yl)-2-(1h-indol-5-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2C=C3C=CNC3=CC=2)C=1N1CCCCCC1 BEABJFQFDAQKGJ-UHFFFAOYSA-N 0.000 claims description 2
- WQONUXIVTVVECW-UHFFFAOYSA-N 3-(azetidin-1-yl)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound C1CCN1C1=NC2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 WQONUXIVTVVECW-UHFFFAOYSA-N 0.000 claims description 2
- DDUXHCSLCIVKQU-UHFFFAOYSA-N 3-(diethylamino)-2-(1h-indol-5-yl)quinoxaline-6-carboxylic acid Chemical compound C1=C2NC=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(CC)CC)C(O)=O)=C1 DDUXHCSLCIVKQU-UHFFFAOYSA-N 0.000 claims description 2
- CZPMTQKYMJNOID-UHFFFAOYSA-N 3-(diethylamino)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CCN(CC)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 CZPMTQKYMJNOID-UHFFFAOYSA-N 0.000 claims description 2
- OZBRLBINZJTDPM-UHFFFAOYSA-N 3-(dipropylamino)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CCCN(CCC)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 OZBRLBINZJTDPM-UHFFFAOYSA-N 0.000 claims description 2
- RRVPWSFFMYWNHX-UHFFFAOYSA-N 3-(n,2-dimethylanilino)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=CC(F)=CC=2)C=1N(C)C1=CC=CC=C1C RRVPWSFFMYWNHX-UHFFFAOYSA-N 0.000 claims description 2
- QFJNYGFQEHEWTC-UHFFFAOYSA-N 3-(tert-butylamino)-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CC(C)(C)NC1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 QFJNYGFQEHEWTC-UHFFFAOYSA-N 0.000 claims description 2
- WGMPSBONQCGIOX-UHFFFAOYSA-N 3-[(1-ethylpiperidin-4-yl)-methylamino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound C1CN(CC)CCC1N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 WGMPSBONQCGIOX-UHFFFAOYSA-N 0.000 claims description 2
- YRWDDGDRRAYHTF-NSHDSACASA-N 3-[(2s)-2-methylpyrrolidin-1-yl]-2-(1h-pyrrol-3-yl)quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CNC=C1 YRWDDGDRRAYHTF-NSHDSACASA-N 0.000 claims description 2
- WTGQLFGBDNYKMO-AWEZNQCLSA-N 3-[(2s)-4-ethyl-2-methylpiperazin-1-yl]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CN(CC)CCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 WTGQLFGBDNYKMO-AWEZNQCLSA-N 0.000 claims description 2
- SPJIAKWTNRHZMZ-GFCCVEGCSA-N 3-[[(2r)-butan-2-yl]-methylamino]-2-(5-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound FC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)[C@H](C)CC)C(O)=O)=CC2=C1 SPJIAKWTNRHZMZ-GFCCVEGCSA-N 0.000 claims description 2
- SPJIAKWTNRHZMZ-LBPRGKRZSA-N 3-[[(2s)-butan-2-yl]-methylamino]-2-(5-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylic acid Chemical compound FC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)[C@@H](C)CC)C(O)=O)=CC2=C1 SPJIAKWTNRHZMZ-LBPRGKRZSA-N 0.000 claims description 2
- XGUYTFZQPPQDRB-UHFFFAOYSA-N 3-[benzyl(methyl)amino]-2-(1h-indazol-5-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=C3C=NNC3=CC=2)C=1N(C)CC1=CC=CC=C1 XGUYTFZQPPQDRB-UHFFFAOYSA-N 0.000 claims description 2
- PIGGCTHZBRMRJA-UHFFFAOYSA-N 3-[cyclobutyl(methyl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=CC(F)=CC=2)C=1N(C)C1CCC1 PIGGCTHZBRMRJA-UHFFFAOYSA-N 0.000 claims description 2
- LMHHESMIXQKNEC-UHFFFAOYSA-N 3-[cyclohexyl(ethyl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=CC(F)=CC=2)C=1N(CC)C1CCCCC1 LMHHESMIXQKNEC-UHFFFAOYSA-N 0.000 claims description 2
- KOCTTWWLWSUHNQ-UHFFFAOYSA-N 3-[cyclohexyl(methyl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=CC(F)=CC=2)C=1N(C)C1CCCCC1 KOCTTWWLWSUHNQ-UHFFFAOYSA-N 0.000 claims description 2
- RTEJNBNUDIERIL-UHFFFAOYSA-N 3-[cyclopropyl(methyl)amino]-2-(1h-indazol-5-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=C3C=NNC3=CC=2)C=1N(C)C1CC1 RTEJNBNUDIERIL-UHFFFAOYSA-N 0.000 claims description 2
- VPXQOCGZRDUCFL-UHFFFAOYSA-N 3-[cyclopropyl(methyl)amino]-2-(1h-indol-5-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=C3C=CNC3=CC=2)C=1N(C)C1CC1 VPXQOCGZRDUCFL-UHFFFAOYSA-N 0.000 claims description 2
- AJBJYEBLRRYFOC-UHFFFAOYSA-N 3-[cyclopropyl(methyl)amino]-2-(2-methyl-1h-indol-5-yl)quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2C=C3C=C(C)NC3=CC=2)C=1N(C)C1CC1 AJBJYEBLRRYFOC-UHFFFAOYSA-N 0.000 claims description 2
- PARBWTIWFTYNDO-UHFFFAOYSA-N 3-[ethyl(propan-2-yl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CCN(C(C)C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 PARBWTIWFTYNDO-UHFFFAOYSA-N 0.000 claims description 2
- IZRAZUZULRPRLN-UHFFFAOYSA-N 3-[ethyl(propyl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CCCN(CC)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 IZRAZUZULRPRLN-UHFFFAOYSA-N 0.000 claims description 2
- WBKXSDADWYREDG-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(1-methylpyrazol-4-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C=1C=NN(C)C=1 WBKXSDADWYREDG-UHFFFAOYSA-N 0.000 claims description 2
- WHNRCQHDAMFUGE-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(1-phenylpyrazol-4-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C(=C1)C=NN1C1=CC=CC=C1 WHNRCQHDAMFUGE-UHFFFAOYSA-N 0.000 claims description 2
- KEGHRVHPKHEBNY-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(1h-pyrazol-5-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=NN1 KEGHRVHPKHEBNY-UHFFFAOYSA-N 0.000 claims description 2
- ZCVMKLHFUPBOIS-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(1h-pyrrol-3-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C=1C=CNC=1 ZCVMKLHFUPBOIS-UHFFFAOYSA-N 0.000 claims description 2
- WOHSBNVPMJNUCU-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-[4-(trifluoromethyl)phenyl]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(C(F)(F)F)C=C1 WOHSBNVPMJNUCU-UHFFFAOYSA-N 0.000 claims description 2
- CFORRWSIPRDYIG-UHFFFAOYSA-N 3-[tert-butyl(methyl)amino]-2-(4-fluorophenyl)quinoxaline-6-carboxylic acid Chemical compound CC(C)(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)C=C1 CFORRWSIPRDYIG-UHFFFAOYSA-N 0.000 claims description 2
- LHBDXCMNGSETQR-UHFFFAOYSA-N 7-fluoro-2-(4-fluorophenyl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=C(F)C=C2N=C1C1=CC=C(F)C=C1 LHBDXCMNGSETQR-UHFFFAOYSA-N 0.000 claims description 2
- TXIFVEJVMDXVNX-NSHDSACASA-N 7-hydroxy-2-(1H-indazol-5-yl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=C(O)C=C2N=C1C1=CC=C(NN=C2)C2=C1 TXIFVEJVMDXVNX-NSHDSACASA-N 0.000 claims description 2
- 208000031226 Hyperlipidaemia Diseases 0.000 claims description 2
- VKLQVNOXLJTORI-HNNXBMFYSA-N 2-(1h-indazol-5-yl)-3-[methyl-[(1s)-1-phenylethyl]amino]quinoxaline-6-carboxylic acid Chemical compound C1([C@@H](N(C)C=2C(=NC3=CC=C(C=C3N=2)C(O)=O)C=2C=C3C=NNC3=CC=2)C)=CC=CC=C1 VKLQVNOXLJTORI-HNNXBMFYSA-N 0.000 claims 1
- PZFJVXSVUNLVFI-QGZVFWFLSA-N 2-(1h-indol-5-yl)-3-[(2r)-2-(methoxymethyl)pyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound COC[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC=C2)C2=C1 PZFJVXSVUNLVFI-QGZVFWFLSA-N 0.000 claims 1
- OJOLRQIPVKEKAK-ZDUSSCGKSA-N 2-(1h-indol-5-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC=C2)C2=C1 OJOLRQIPVKEKAK-ZDUSSCGKSA-N 0.000 claims 1
- VJBLVFBNENQLSC-MRXNPFEDSA-N 2-(4-fluorophenyl)-3-[(2r)-2-(trifluoromethyl)pyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound N1([C@H](CCC1)C(F)(F)F)C1=NC2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 VJBLVFBNENQLSC-MRXNPFEDSA-N 0.000 claims 1
- CSTJTUFMIXTJLT-ZDUSSCGKSA-N 2-(5-fluoro-1-benzofuran-2-yl)-3-[(2s)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC(F)=CC=C2O1 CSTJTUFMIXTJLT-ZDUSSCGKSA-N 0.000 claims 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 89
- 108010013866 PAS domain kinases Proteins 0.000 abstract description 19
- 241001465754 Metazoa Species 0.000 abstract description 9
- 241000282414 Homo sapiens Species 0.000 abstract description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 379
- 239000000243 solution Substances 0.000 description 335
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 309
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 269
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 266
- 229910001868 water Inorganic materials 0.000 description 264
- 239000007787 solid Substances 0.000 description 211
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 201
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 189
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 184
- 238000005160 1H NMR spectroscopy Methods 0.000 description 179
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 172
- 238000003756 stirring Methods 0.000 description 145
- JGQDBVXRYDEWGM-UHFFFAOYSA-M quinoxaline-6-carboxylate Chemical compound N1=CC=NC2=CC(C(=O)[O-])=CC=C21 JGQDBVXRYDEWGM-UHFFFAOYSA-M 0.000 description 144
- 235000019439 ethyl acetate Nutrition 0.000 description 127
- 239000011541 reaction mixture Substances 0.000 description 125
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 120
- 239000003208 petroleum Substances 0.000 description 100
- 239000003921 oil Substances 0.000 description 72
- 235000019198 oils Nutrition 0.000 description 71
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 67
- 229910052757 nitrogen Inorganic materials 0.000 description 67
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 description 66
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 62
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 60
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 58
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 56
- 238000001914 filtration Methods 0.000 description 56
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 54
- 239000000741 silica gel Substances 0.000 description 54
- 229910002027 silica gel Inorganic materials 0.000 description 54
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 54
- 235000019798 tripotassium phosphate Nutrition 0.000 description 54
- 230000002829 reductive effect Effects 0.000 description 52
- 238000010898 silica gel chromatography Methods 0.000 description 50
- 239000012298 atmosphere Substances 0.000 description 48
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 47
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 46
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 43
- 125000003118 aryl group Chemical group 0.000 description 39
- 239000012044 organic layer Substances 0.000 description 33
- 229910052739 hydrogen Inorganic materials 0.000 description 32
- 125000000217 alkyl group Chemical group 0.000 description 31
- 125000001072 heteroaryl group Chemical group 0.000 description 31
- 239000001257 hydrogen Substances 0.000 description 31
- NFRZQOGQWDEUST-UHFFFAOYSA-N methyl 2-chloro-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound N1=C(Cl)C(N(C)C(C)C)=NC2=CC(C(=O)OC)=CC=C21 NFRZQOGQWDEUST-UHFFFAOYSA-N 0.000 description 30
- 239000002253 acid Substances 0.000 description 29
- YFTHTJAPODJVSL-UHFFFAOYSA-N 2-(1-benzothiophen-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(SC=C2)C2=C1 YFTHTJAPODJVSL-UHFFFAOYSA-N 0.000 description 28
- 125000000753 cycloalkyl group Chemical group 0.000 description 27
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 26
- 101150041968 CDC13 gene Proteins 0.000 description 25
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 25
- 150000002431 hydrogen Chemical class 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 24
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 23
- 239000012299 nitrogen atmosphere Substances 0.000 description 23
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 23
- 150000003839 salts Chemical class 0.000 description 23
- 238000009472 formulation Methods 0.000 description 21
- 108010001483 Glycogen Synthase Proteins 0.000 description 20
- 239000000651 prodrug Substances 0.000 description 20
- 229940002612 prodrug Drugs 0.000 description 20
- 229920002527 Glycogen Polymers 0.000 description 19
- 229940096919 glycogen Drugs 0.000 description 19
- 125000000623 heterocyclic group Chemical group 0.000 description 19
- 125000003710 aryl alkyl group Chemical group 0.000 description 17
- 239000003112 inhibitor Substances 0.000 description 17
- 239000004480 active ingredient Substances 0.000 description 16
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 16
- 125000001424 substituent group Chemical group 0.000 description 16
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 15
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 15
- 125000003342 alkenyl group Chemical group 0.000 description 15
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- 239000008103 glucose Substances 0.000 description 15
- 125000005843 halogen group Chemical group 0.000 description 15
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 14
- 125000003545 alkoxy group Chemical group 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 13
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 13
- 125000000304 alkynyl group Chemical group 0.000 description 13
- 208000035475 disorder Diseases 0.000 description 13
- 239000005457 ice water Substances 0.000 description 13
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 13
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 12
- 125000001188 haloalkyl group Chemical group 0.000 description 12
- 239000007788 liquid Substances 0.000 description 12
- 125000005842 heteroatom Chemical group 0.000 description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 230000001225 therapeutic effect Effects 0.000 description 11
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 10
- 125000003282 alkyl amino group Chemical group 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- YNSUZXDSLZOFLE-UHFFFAOYSA-N methyl 3-[cyclopropyl(methyl)amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(OS(=O)(=O)C(F)(F)F)C=1N(C)C1CC1 YNSUZXDSLZOFLE-UHFFFAOYSA-N 0.000 description 10
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- 230000001105 regulatory effect Effects 0.000 description 10
- 229910052717 sulfur Inorganic materials 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- 230000008901 benefit Effects 0.000 description 9
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 230000026731 phosphorylation Effects 0.000 description 9
- 238000006366 phosphorylation reaction Methods 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 9
- 238000010792 warming Methods 0.000 description 9
- YGLIPSIVUHENTJ-UHFFFAOYSA-N (5-fluoro-1-benzofuran-2-yl)boronic acid Chemical compound FC1=CC=C2OC(B(O)O)=CC2=C1 YGLIPSIVUHENTJ-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 102000002254 Glycogen Synthase Kinase 3 Human genes 0.000 description 8
- 108010014905 Glycogen Synthase Kinase 3 Proteins 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 8
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 8
- 230000001965 increasing effect Effects 0.000 description 8
- 238000002347 injection Methods 0.000 description 8
- 239000007924 injection Substances 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 7
- 125000004663 dialkyl amino group Chemical group 0.000 description 7
- 125000004475 heteroaralkyl group Chemical group 0.000 description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 7
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 6
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 6
- BNANPEQZOWHZKY-UHFFFAOYSA-N 3-phenylfuran Chemical compound O1C=CC(C=2C=CC=CC=2)=C1 BNANPEQZOWHZKY-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 6
- 102000004877 Insulin Human genes 0.000 description 6
- 108090001061 Insulin Proteins 0.000 description 6
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000005605 benzo group Chemical group 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- 210000004027 cell Anatomy 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 6
- 125000004404 heteroalkyl group Chemical group 0.000 description 6
- 229940125396 insulin Drugs 0.000 description 6
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 6
- RUZLIIJDZBWWSA-INIZCTEOSA-N methyl 2-[[(1s)-1-(7-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)ethyl]amino]benzoate Chemical group COC(=O)C1=CC=CC=C1N[C@@H](C)C1=CC(C)=CN2C(=O)C=C(N3CCOCC3)N=C12 RUZLIIJDZBWWSA-INIZCTEOSA-N 0.000 description 6
- YZKACKDNVJCZML-UHFFFAOYSA-N methyl 3-piperidin-1-yl-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(OS(=O)(=O)C(F)(F)F)C=1N1CCCCC1 YZKACKDNVJCZML-UHFFFAOYSA-N 0.000 description 6
- 229920000137 polyphosphoric acid Polymers 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 6
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 102000002131 PAS domains Human genes 0.000 description 5
- 108050009469 PAS domains Proteins 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 238000009825 accumulation Methods 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- SQWCXWRNKYARHF-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-(4-phenylfuran-2-yl)quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C(OC=1)=CC=1C1=CC=CC=C1 SQWCXWRNKYARHF-UHFFFAOYSA-N 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- ARYHTUPFQTUBBG-UHFFFAOYSA-N thiophen-2-ylboronic acid Chemical compound OB(O)C1=CC=CS1 ARYHTUPFQTUBBG-UHFFFAOYSA-N 0.000 description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 5
- PKRRNTJIHGOMRC-UHFFFAOYSA-N 1-benzofuran-2-ylboronic acid Chemical compound C1=CC=C2OC(B(O)O)=CC2=C1 PKRRNTJIHGOMRC-UHFFFAOYSA-N 0.000 description 4
- XGOBMWIHRYAUKY-UHFFFAOYSA-N 2-(1,2-benzoxazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2ON=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 XGOBMWIHRYAUKY-UHFFFAOYSA-N 0.000 description 4
- JANPZECAFMRBBL-UHFFFAOYSA-N 2-(5-fluoro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound FC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 JANPZECAFMRBBL-UHFFFAOYSA-N 0.000 description 4
- AFQFKDHVGYDZQD-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-[5-(trifluoromethyl)-1-benzofuran-3-yl]quinoxaline-6-carboxylic acid Chemical compound C1=C(C(F)(F)F)C=C2C(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=COC2=C1 AFQFKDHVGYDZQD-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- DTHNMHAUYICORS-KTKZVXAJSA-N Glucagon-like peptide 1 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 description 4
- 108010007622 LDL Lipoproteins Proteins 0.000 description 4
- 102000007330 LDL Lipoproteins Human genes 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 125000004438 haloalkoxy group Chemical group 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 4
- 230000002503 metabolic effect Effects 0.000 description 4
- 230000004060 metabolic process Effects 0.000 description 4
- ORKSRAZGFGVXCI-UHFFFAOYSA-N methyl 3-(azepan-1-yl)-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(OS(=O)(=O)C(F)(F)F)C=1N1CCCCCC1 ORKSRAZGFGVXCI-UHFFFAOYSA-N 0.000 description 4
- RTIWJZDFDVUDBW-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-(5-phenylfuran-2-yl)quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C(O1)=CC=C1C1=CC=CC=C1 RTIWJZDFDVUDBW-UHFFFAOYSA-N 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 4
- DHHVAGZRUROJKS-UHFFFAOYSA-N phentermine Chemical compound CC(C)(N)CC1=CC=CC=C1 DHHVAGZRUROJKS-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- YSFZVADNQRTXDX-UHFFFAOYSA-N (4-methoxyphenyl)methyl 2-(1,2-benzoxazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=CC=C(N=C(C=2C=C3C=NOC3=CC=2)C(=N2)N(C)C(C)C)C2=C1 YSFZVADNQRTXDX-UHFFFAOYSA-N 0.000 description 3
- JUARZXKFQHQMMB-UHFFFAOYSA-N (4-methoxyphenyl)methyl 2-(3-formyl-4-hydroxyphenyl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=CC=C(N=C(C=2C=C(C=O)C(O)=CC=2)C(=N2)N(C)C(C)C)C2=C1 JUARZXKFQHQMMB-UHFFFAOYSA-N 0.000 description 3
- IBWYGTJALAQXKI-UHFFFAOYSA-N (4-methoxyphenyl)methyl 2-bromo-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=CC=C(N=C(Br)C(=N2)N(C)C(C)C)C2=C1 IBWYGTJALAQXKI-UHFFFAOYSA-N 0.000 description 3
- IODPQZJZPKMFKV-UHFFFAOYSA-N (5-chloro-1-benzofuran-2-yl)boronic acid Chemical compound ClC1=CC=C2OC(B(O)O)=CC2=C1 IODPQZJZPKMFKV-UHFFFAOYSA-N 0.000 description 3
- XLIQZZGLIJLKTF-UHFFFAOYSA-N (5-methoxy-1-benzofuran-2-yl)boronic acid Chemical compound COC1=CC=C2OC(B(O)O)=CC2=C1 XLIQZZGLIJLKTF-UHFFFAOYSA-N 0.000 description 3
- JPCIXYIWFQDYCL-UHFFFAOYSA-N (6-methyl-1-benzofuran-3-yl) acetate Chemical compound CC1=CC=C2C(OC(=O)C)=COC2=C1 JPCIXYIWFQDYCL-UHFFFAOYSA-N 0.000 description 3
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 3
- WYXQQAYIAJRORT-UHFFFAOYSA-N 1-benzofuran-5-ylboronic acid Chemical compound OB(O)C1=CC=C2OC=CC2=C1 WYXQQAYIAJRORT-UHFFFAOYSA-N 0.000 description 3
- FHNMMCLPYZSVDZ-UHFFFAOYSA-N 2-(1-benzofuran-2-yl)-3-[cyclopropyl(methyl)amino]quinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N=C(C=2OC3=CC=CC=C3C=2)C=1N(C)C1CC1 FHNMMCLPYZSVDZ-UHFFFAOYSA-N 0.000 description 3
- WDOZMHXBTBDMMI-UHFFFAOYSA-N 2-(2,2-dibromoethenyl)-5-fluorophenol Chemical compound OC1=CC(F)=CC=C1C=C(Br)Br WDOZMHXBTBDMMI-UHFFFAOYSA-N 0.000 description 3
- KRZULGJBWBRGEQ-UHFFFAOYSA-N 2-(5-bromopyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CN=CC(Br)=C1 KRZULGJBWBRGEQ-UHFFFAOYSA-N 0.000 description 3
- PCXIATWDOZIUHJ-UHFFFAOYSA-N 2-(5-chloro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound ClC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC2=C1 PCXIATWDOZIUHJ-UHFFFAOYSA-N 0.000 description 3
- YPQAIUIPIWEOLN-UHFFFAOYSA-N 2-(6-fluoropyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(F)N=C1 YPQAIUIPIWEOLN-UHFFFAOYSA-N 0.000 description 3
- ZVNLQQKGXZSVPV-UHFFFAOYSA-N 2-(6-methoxypyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=NC(OC)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2N=C1N(C)C(C)C ZVNLQQKGXZSVPV-UHFFFAOYSA-N 0.000 description 3
- GCXNJAXHHFZVIM-UHFFFAOYSA-N 2-phenylfuran Chemical compound C1=COC(C=2C=CC=CC=2)=C1 GCXNJAXHHFZVIM-UHFFFAOYSA-N 0.000 description 3
- RHPXGFFWAQKXLZ-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-(6-pyrrolidin-1-ylpyridin-3-yl)quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C(C=N1)=CC=C1N1CCCC1 RHPXGFFWAQKXLZ-UHFFFAOYSA-N 0.000 description 3
- JGYLFXJCBLBQIV-UHFFFAOYSA-N 4-bromo-2-phenylfuran Chemical compound BrC1=COC(C=2C=CC=CC=2)=C1 JGYLFXJCBLBQIV-UHFFFAOYSA-N 0.000 description 3
- NWLZAQXAJNDAIK-UHFFFAOYSA-N 4-hydroxy-1-phenylbut-2-yn-1-one Chemical compound OCC#CC(=O)C1=CC=CC=C1 NWLZAQXAJNDAIK-UHFFFAOYSA-N 0.000 description 3
- PZCIAKIDGUSIMF-UHFFFAOYSA-N 5-(trifluoromethyl)-1-benzofuran Chemical compound FC(F)(F)C1=CC=C2OC=CC2=C1 PZCIAKIDGUSIMF-UHFFFAOYSA-N 0.000 description 3
- CPJOPFBXUHIQQL-UHFFFAOYSA-N 5-chloro-1-benzofuran Chemical compound ClC1=CC=C2OC=CC2=C1 CPJOPFBXUHIQQL-UHFFFAOYSA-N 0.000 description 3
- FTVHMXRCGNWCOL-UHFFFAOYSA-N 5-fluoro-1-benzofuran Chemical compound FC1=CC=C2OC=CC2=C1 FTVHMXRCGNWCOL-UHFFFAOYSA-N 0.000 description 3
- BKBDOWJPNZYBSO-UHFFFAOYSA-N 6-chloro-1-benzofuran Chemical compound ClC1=CC=C2C=COC2=C1 BKBDOWJPNZYBSO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 101800000224 Glucagon-like peptide 1 Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 108010010234 HDL Lipoproteins Proteins 0.000 description 3
- 102000015779 HDL Lipoproteins Human genes 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 3
- 102000003729 Neprilysin Human genes 0.000 description 3
- 108090000028 Neprilysin Proteins 0.000 description 3
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 3
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 3
- 108091000080 Phosphotransferase Proteins 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 102100040918 Pro-glucagon Human genes 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- FMNJDJWOEYUSTA-UHFFFAOYSA-N [5-(trifluoromethyl)-1-benzofuran-2-yl]boronic acid Chemical compound FC(F)(F)C1=CC=C2OC(B(O)O)=CC2=C1 FMNJDJWOEYUSTA-UHFFFAOYSA-N 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- VRXCEHZIZNDEDO-UHFFFAOYSA-N ethyl 2-chloro-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound N1=C(Cl)C(N(C)C(C)C)=NC2=CC(C(=O)OCC)=CC=C21 VRXCEHZIZNDEDO-UHFFFAOYSA-N 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 235000020938 metabolic status Nutrition 0.000 description 3
- URKAKCLWRKEEDJ-UHFFFAOYSA-N methyl 2-(1,3-benzothiazol-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=CC=C2SC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=NC2=C1 URKAKCLWRKEEDJ-UHFFFAOYSA-N 0.000 description 3
- ZAOJRTZVLHBPTE-ZDUSSCGKSA-N methyl 2-(1,3-benzothiazol-5-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2C=C3N=CSC3=CC=2)C=1N1CCC[C@@H]1C ZAOJRTZVLHBPTE-ZDUSSCGKSA-N 0.000 description 3
- RVLHXFLRECFISP-UHFFFAOYSA-N methyl 2-(1-benzofuran-2-yl)-3-(diethylamino)quinoxaline-6-carboxylate Chemical compound C1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(CC)CC)C(=O)OC)=CC2=C1 RVLHXFLRECFISP-UHFFFAOYSA-N 0.000 description 3
- WGIAIQCYYDWCLF-UHFFFAOYSA-N methyl 2-(1-benzofuran-2-yl)-3-(propan-2-ylamino)quinoxaline-6-carboxylate Chemical compound C1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3NC(C)C)C(=O)OC)=CC2=C1 WGIAIQCYYDWCLF-UHFFFAOYSA-N 0.000 description 3
- AAQYWNCCRXVSTB-UHFFFAOYSA-N methyl 2-(1-benzofuran-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=CC=C2C(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=COC2=C1 AAQYWNCCRXVSTB-UHFFFAOYSA-N 0.000 description 3
- JSUJMTQISXTSEF-UHFFFAOYSA-N methyl 2-(1-benzofuran-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=C2OC=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(=O)OC)=C1 JSUJMTQISXTSEF-UHFFFAOYSA-N 0.000 description 3
- KZFUZNLLFGBRDC-UHFFFAOYSA-N methyl 2-(2-fluoropyridin-4-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=NC(F)=C1 KZFUZNLLFGBRDC-UHFFFAOYSA-N 0.000 description 3
- OKXXQXNOXNKDRJ-UHFFFAOYSA-N methyl 2-(3,4-dihydro-2h-chromen-6-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound O1CCCC2=CC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC=C21 OKXXQXNOXNKDRJ-UHFFFAOYSA-N 0.000 description 3
- BIORPHDFHLNMCA-UHFFFAOYSA-N methyl 2-(5-bromopyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CN=CC(Br)=C1 BIORPHDFHLNMCA-UHFFFAOYSA-N 0.000 description 3
- WHAQQNQXIOBQDN-UHFFFAOYSA-N methyl 2-(5-chloro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound ClC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC2=C1 WHAQQNQXIOBQDN-UHFFFAOYSA-N 0.000 description 3
- XVCIMQAMLKCOLJ-UHFFFAOYSA-N methyl 2-(5-fluoro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound FC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC2=C1 XVCIMQAMLKCOLJ-UHFFFAOYSA-N 0.000 description 3
- BLWCTPGSUGLJME-UHFFFAOYSA-N methyl 2-(5-fluoro-1-benzofuran-2-yl)-3-pyrrolidin-1-ylquinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC=C(F)C=C3C=2)C=1N1CCCC1 BLWCTPGSUGLJME-UHFFFAOYSA-N 0.000 description 3
- NHRNWTSNMZLWLP-UHFFFAOYSA-N methyl 2-(6-chloro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=C(Cl)C=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC2=C1 NHRNWTSNMZLWLP-UHFFFAOYSA-N 0.000 description 3
- KBSOOQSIGPKTPV-UHFFFAOYSA-N methyl 2-(6-fluoro-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=C(F)C=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC2=C1 KBSOOQSIGPKTPV-UHFFFAOYSA-N 0.000 description 3
- XOAOXLJVJHMCAG-UHFFFAOYSA-N methyl 2-(6-methoxypyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=C(OC)N=C1 XOAOXLJVJHMCAG-UHFFFAOYSA-N 0.000 description 3
- MPBOIZPGDHIDIK-UHFFFAOYSA-N methyl 3-(azepan-1-yl)-2-(6-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC(F)=CC=C3C=2)C=1N1CCCCCC1 MPBOIZPGDHIDIK-UHFFFAOYSA-N 0.000 description 3
- NQZFINBSPIWMRG-UHFFFAOYSA-N methyl 3-(diethylamino)-2-oxo-1h-quinoxaline-6-carboxylate Chemical compound COC(=O)C1=CC=C2N=C(O)C(N(CC)CC)=NC2=C1 NQZFINBSPIWMRG-UHFFFAOYSA-N 0.000 description 3
- IBQUWMBQJGSEJM-UHFFFAOYSA-N methyl 3-[cyclopropyl(methyl)amino]-2-(5-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC=C(F)C=C3C=2)C=1N(C)C1CC1 IBQUWMBQJGSEJM-UHFFFAOYSA-N 0.000 description 3
- CTPBWHCQCDGRNO-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-(3-phenylfuran-2-yl)quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C=1OC=CC=1C1=CC=CC=C1 CTPBWHCQCDGRNO-UHFFFAOYSA-N 0.000 description 3
- GXTTUPPOPUTMEX-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-(6-pyrrolidin-1-ylpyridin-3-yl)quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C(C=N1)=CC=C1N1CCCC1 GXTTUPPOPUTMEX-UHFFFAOYSA-N 0.000 description 3
- RMDLDNSYLGHJQS-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-quinoxalin-6-ylquinoxaline-6-carboxylate Chemical compound N1=CC=NC2=CC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC=C21 RMDLDNSYLGHJQS-UHFFFAOYSA-N 0.000 description 3
- FMMPQOKCEGMIJY-UHFFFAOYSA-N methyl 3-chloro-2-oxo-1h-quinoxaline-6-carboxylate Chemical compound N1=C(O)C(Cl)=NC2=CC(C(=O)OC)=CC=C21 FMMPQOKCEGMIJY-UHFFFAOYSA-N 0.000 description 3
- XAJTVTJJMRFFTL-UHFFFAOYSA-N methyl 4-chloro-2-(2-ethoxy-2-oxoethoxy)benzoate Chemical compound CCOC(=O)COC1=CC(Cl)=CC=C1C(=O)OC XAJTVTJJMRFFTL-UHFFFAOYSA-N 0.000 description 3
- QXDWMJQRXWLSDP-UHFFFAOYSA-N methyl 4-chloro-2-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(Cl)C=C1O QXDWMJQRXWLSDP-UHFFFAOYSA-N 0.000 description 3
- CNJJSTPBUHAEFH-UHFFFAOYSA-N methyl 4-fluoro-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 CNJJSTPBUHAEFH-UHFFFAOYSA-N 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 102000020233 phosphotransferase Human genes 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 125000004149 thio group Chemical group *S* 0.000 description 3
- DBGIVFWFUFKIQN-VIFPVBQESA-N (+)-Fenfluramine Chemical compound CCN[C@@H](C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-VIFPVBQESA-N 0.000 description 2
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 2
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 2
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- ZSOUVTSEHWKLHY-UHFFFAOYSA-N 2-(carboxymethoxy)-4-chlorobenzoic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(O)=O ZSOUVTSEHWKLHY-UHFFFAOYSA-N 0.000 description 2
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 2
- APPHBFSBEVVHQU-UHFFFAOYSA-N 2-bromo-6-fluoro-1-benzofuran Chemical compound FC1=CC=C2C=C(Br)OC2=C1 APPHBFSBEVVHQU-UHFFFAOYSA-N 0.000 description 2
- APEKBSGYHGDFKW-UHFFFAOYSA-N 3-[methyl(propan-2-yl)amino]-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-3-yl]quinoxaline-6-carboxylic acid Chemical compound CC(C)N(C)C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC=C(NC(=O)OC(C)(C)C)N=C1 APEKBSGYHGDFKW-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- NKOHRVBBQISBSB-UHFFFAOYSA-N 5-[(4-hydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione Chemical compound C1=CC(O)=CC=C1CC1C(=O)NC(=O)S1 NKOHRVBBQISBSB-UHFFFAOYSA-N 0.000 description 2
- JJXPTUWJVQUHKN-UHFFFAOYSA-N 5-methoxy-1-benzofuran Chemical compound COC1=CC=C2OC=CC2=C1 JJXPTUWJVQUHKN-UHFFFAOYSA-N 0.000 description 2
- VHAUANQYMZUJPS-UHFFFAOYSA-N 6-methyl-1-benzofuran-3-one Chemical compound CC1=CC=C2C(=O)COC2=C1 VHAUANQYMZUJPS-UHFFFAOYSA-N 0.000 description 2
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 2
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 2
- 239000004072 C09CA03 - Valsartan Substances 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 208000024172 Cardiovascular disease Diseases 0.000 description 2
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- LTMHDMANZUZIPE-AMTYYWEZSA-N Digoxin Natural products O([C@H]1[C@H](C)O[C@H](O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4[C@H]([C@]5(O)[C@](C)([C@H](O)C4)[C@H](C4=CC(=O)OC4)CC5)CC3)CC2)C[C@@H]1O)[C@H]1O[C@H](C)[C@@H](O[C@H]2O[C@@H](C)[C@H](O)[C@@H](O)C2)[C@@H](O)C1 LTMHDMANZUZIPE-AMTYYWEZSA-N 0.000 description 2
- 102000016622 Dipeptidyl Peptidase 4 Human genes 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 101000930822 Giardia intestinalis Dipeptidyl-peptidase 4 Proteins 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 102100038494 Nuclear receptor subfamily 1 group I member 2 Human genes 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 206010036049 Polycystic ovaries Diseases 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 2
- 108010001511 Pregnane X Receptor Proteins 0.000 description 2
- 108010029485 Protein Isoforms Proteins 0.000 description 2
- 102000001708 Protein Isoforms Human genes 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- YASAKCUCGLMORW-UHFFFAOYSA-N Rosiglitazone Chemical compound C=1C=CC=NC=1N(C)CCOC(C=C1)=CC=C1CC1SC(=O)NC1=O YASAKCUCGLMORW-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 2
- 241000534944 Thia Species 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 108010062497 VLDL Lipoproteins Proteins 0.000 description 2
- 201000010390 abdominal obesity-metabolic syndrome 1 Diseases 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000004450 alkenylene group Chemical group 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 125000004419 alkynylene group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 125000003435 aroyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 210000004899 c-terminal region Anatomy 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 230000001906 cholesterol absorption Effects 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000012217 deletion Methods 0.000 description 2
- 230000037430 deletion Effects 0.000 description 2
- 229960004597 dexfenfluramine Drugs 0.000 description 2
- 229960004890 diethylpropion Drugs 0.000 description 2
- XXEPPPIWZFICOJ-UHFFFAOYSA-N diethylpropion Chemical compound CCN(CC)C(C)C(=O)C1=CC=CC=C1 XXEPPPIWZFICOJ-UHFFFAOYSA-N 0.000 description 2
- LTMHDMANZUZIPE-PUGKRICDSA-N digoxin Chemical compound C1[C@H](O)[C@H](O)[C@@H](C)O[C@H]1O[C@@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@@H]3C[C@@H]4[C@]([C@@H]5[C@H]([C@]6(CC[C@@H]([C@@]6(C)[C@H](O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)C[C@@H]2O)C)C[C@@H]1O LTMHDMANZUZIPE-PUGKRICDSA-N 0.000 description 2
- 229960005156 digoxin Drugs 0.000 description 2
- LTMHDMANZUZIPE-UHFFFAOYSA-N digoxine Natural products C1C(O)C(O)C(C)OC1OC1C(C)OC(OC2C(OC(OC3CC4C(C5C(C6(CCC(C6(C)C(O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)CC2O)C)CC1O LTMHDMANZUZIPE-UHFFFAOYSA-N 0.000 description 2
- 125000004982 dihaloalkyl group Chemical group 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000000890 drug combination Substances 0.000 description 2
- 230000002526 effect on cardiovascular system Effects 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 230000002068 genetic effect Effects 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 230000002489 hematologic effect Effects 0.000 description 2
- 230000002440 hepatic effect Effects 0.000 description 2
- 235000009200 high fat diet Nutrition 0.000 description 2
- 230000000910 hyperinsulinemic effect Effects 0.000 description 2
- 201000008980 hyperinsulinism Diseases 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 102000004311 liver X receptors Human genes 0.000 description 2
- 108090000865 liver X receptors Proteins 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 208000011661 metabolic syndrome X Diseases 0.000 description 2
- IIFYVPJSLRKAAG-UHFFFAOYSA-N methyl 2-(1-benzofuran-2-yl)-3-[cyclopropyl(methyl)amino]quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC=CC=C3C=2)C=1N(C)C1CC1 IIFYVPJSLRKAAG-UHFFFAOYSA-N 0.000 description 2
- LMXBGNIZZXCGLA-UHFFFAOYSA-N methyl 2-(5-methoxy-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]-4a,8a-dihydroquinoxaline-6-carboxylate Chemical compound COC1=CC=C2OC(C=3C(N(C)C(C)C)=NC4C=C(C=CC4N=3)C(=O)OC)=CC2=C1 LMXBGNIZZXCGLA-UHFFFAOYSA-N 0.000 description 2
- ONWZJGSXOKSYKS-UHFFFAOYSA-N methyl 2-(6-fluoropyridin-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=CC(F)=N1 ONWZJGSXOKSYKS-UHFFFAOYSA-N 0.000 description 2
- JIDIUAZERFCAHG-LBPRGKRZSA-N methyl 2-(furan-3-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate Chemical compound N1([C@H](CCC1)C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C=1C=COC=1 JIDIUAZERFCAHG-LBPRGKRZSA-N 0.000 description 2
- QEMLOSYLKOTREG-VIFPVBQESA-N methyl 2-chloro-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(Cl)C=1N1CCC[C@@H]1C QEMLOSYLKOTREG-VIFPVBQESA-N 0.000 description 2
- NICCMDICSZLZRA-VIFPVBQESA-N methyl 3-[(2s)-2-methylpyrrolidin-1-yl]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(OS(=O)(=O)C(F)(F)F)C=1N1CCC[C@@H]1C NICCMDICSZLZRA-VIFPVBQESA-N 0.000 description 2
- IMSQRDKIRHUDBI-MRVPVSSYSA-N methyl 3-[[(2r)-butan-2-yl]amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound COC(=O)C1=CC=C2N=C(OS(=O)(=O)C(F)(F)F)C(N[C@H](C)CC)=NC2=C1 IMSQRDKIRHUDBI-MRVPVSSYSA-N 0.000 description 2
- LDLCUMSYQODBQK-UHFFFAOYSA-N methyl 3-[cyclopropyl(methyl)amino]-2-(6-fluoro-1-benzofuran-2-yl)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC(F)=CC=C3C=2)C=1N(C)C1CC1 LDLCUMSYQODBQK-UHFFFAOYSA-N 0.000 description 2
- JBAFBVQNQGUNPZ-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-[5-(trifluoromethyl)-1-benzofuran-2-yl]quinoxaline-6-carboxylate Chemical compound FC(F)(F)C1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC2=C1 JBAFBVQNQGUNPZ-UHFFFAOYSA-N 0.000 description 2
- JPJDTFJJTMONOV-UHFFFAOYSA-N methyl 3-oxo-2-phenyl-4h-quinoxaline-6-carboxylate Chemical compound O=C1NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=CC=C1 JPJDTFJJTMONOV-UHFFFAOYSA-N 0.000 description 2
- BWYKQOPKDMJZOE-UHFFFAOYSA-N methyl 4-[(2-methoxy-2-oxo-1-phenylethyl)amino]-3-nitrobenzoate Chemical compound C=1C=CC=CC=1C(C(=O)OC)NC1=CC=C(C(=O)OC)C=C1[N+]([O-])=O BWYKQOPKDMJZOE-UHFFFAOYSA-N 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 210000003205 muscle Anatomy 0.000 description 2
- YCWKZLXTHMGYAO-UHFFFAOYSA-N n-methylcyclopropanamine;hydrochloride Chemical compound Cl.CNC1CC1 YCWKZLXTHMGYAO-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 2
- 229960003562 phentermine Drugs 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 201000010065 polycystic ovary syndrome Diseases 0.000 description 2
- 125000006684 polyhaloalkyl group Polymers 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- ABMYEXAYWZJVOV-UHFFFAOYSA-N pyridin-3-ylboronic acid Chemical compound OB(O)C1=CC=CN=C1 ABMYEXAYWZJVOV-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- RYMZZMVNJRMUDD-HGQWONQESA-N simvastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 RYMZZMVNJRMUDD-HGQWONQESA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000007910 systemic administration Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- IKBKZGMPCYNSLU-RGVLZGJSSA-N tegaserod Chemical compound C1=C(OC)C=C2C(/C=N/NC(=N)NCCCCC)=CNC2=C1 IKBKZGMPCYNSLU-RGVLZGJSSA-N 0.000 description 2
- 229960002876 tegaserod Drugs 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- 238000013519 translation Methods 0.000 description 2
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 229960004699 valsartan Drugs 0.000 description 2
- SJSNUMAYCRRIOM-QFIPXVFZSA-N valsartan Chemical compound C1=CC(CN(C(=O)CCCC)[C@@H](C(C)C)C(O)=O)=CC=C1C1=CC=CC=C1C1=NN=N[N]1 SJSNUMAYCRRIOM-QFIPXVFZSA-N 0.000 description 2
- SYOKIDBDQMKNDQ-XWTIBIIYSA-N vildagliptin Chemical compound C1C(O)(C2)CC(C3)CC1CC32NCC(=O)N1CCC[C@H]1C#N SYOKIDBDQMKNDQ-XWTIBIIYSA-N 0.000 description 2
- NNWUEBIEOFQMSS-UHFFFAOYSA-N (+)-(S)-2-methylpiperidine Natural products CC1CCCCN1 NNWUEBIEOFQMSS-UHFFFAOYSA-N 0.000 description 1
- DBGIVFWFUFKIQN-UHFFFAOYSA-N (+-)-Fenfluramine Chemical compound CCNC(C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-UHFFFAOYSA-N 0.000 description 1
- WXGBZJJAGLSBPR-UHFFFAOYSA-N (2-fluoropyridin-4-yl)boronic acid Chemical compound OB(O)C1=CC=NC(F)=C1 WXGBZJJAGLSBPR-UHFFFAOYSA-N 0.000 description 1
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 1
- BOOOLEGQBVUTKC-NVQSDHBMSA-N (2e,4e)-3-methyl-5-[(1s,2s)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]penta-2,4-dienoic acid Chemical compound OC(=O)\C=C(/C)\C=C\[C@@H]1C[C@]1(C)C1=CC=C2C(C)(C)CCC(C)(C)C2=C1 BOOOLEGQBVUTKC-NVQSDHBMSA-N 0.000 description 1
- CHPRFKYDQRKRRK-ZCFIWIBFSA-N (2r)-2-(methoxymethyl)pyrrolidine Chemical compound COC[C@H]1CCCN1 CHPRFKYDQRKRRK-ZCFIWIBFSA-N 0.000 description 1
- FONCZICQWCUXEB-RUZDIDTESA-N (2r)-2-[4-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2,6-dimethylphenoxy]-3-phenylpropanoic acid Chemical compound C([C@@H](OC1=C(C)C=C(C=C1C)C=1C2=CC=CC=C2C(Br)=C2SC(=C(C2=1)C)C)C(O)=O)C1=CC=CC=C1 FONCZICQWCUXEB-RUZDIDTESA-N 0.000 description 1
- BHRZNVHARXXAHW-SCSAIBSYSA-N (2r)-butan-2-amine Chemical compound CC[C@@H](C)N BHRZNVHARXXAHW-SCSAIBSYSA-N 0.000 description 1
- LPUDGHQMOAHMMF-JBACZVJFSA-N (2s)-2-[[[(2s)-6-amino-2-(methanesulfonamido)hexanoyl]amino]methyl]-3-[1-[[(1s)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]cyclopentyl]propanoic acid Chemical compound N([C@@H](CC=1C=CC(O)=CC=1)C(O)=O)C(=O)C1(C[C@@H](CNC(=O)[C@H](CCCCN)NS(=O)(=O)C)C(O)=O)CCCC1 LPUDGHQMOAHMMF-JBACZVJFSA-N 0.000 description 1
- NNWUEBIEOFQMSS-LURJTMIESA-N (2s)-2-methylpiperidine Chemical compound C[C@H]1CCCCN1 NNWUEBIEOFQMSS-LURJTMIESA-N 0.000 description 1
- BHRZNVHARXXAHW-BYPYZUCNSA-N (2s)-butan-2-amine Chemical compound CC[C@H](C)N BHRZNVHARXXAHW-BYPYZUCNSA-N 0.000 description 1
- BIDNLKIUORFRQP-XYGFDPSESA-N (2s,4s)-4-cyclohexyl-1-[2-[[(1s)-2-methyl-1-propanoyloxypropoxy]-(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid Chemical compound C([P@@](=O)(O[C@H](OC(=O)CC)C(C)C)CC(=O)N1[C@@H](C[C@H](C1)C1CCCCC1)C(O)=O)CCCC1=CC=CC=C1 BIDNLKIUORFRQP-XYGFDPSESA-N 0.000 description 1
- ZGGHKIMDNBDHJB-NRFPMOEYSA-M (3R,5S)-fluvastatin sodium Chemical compound [Na+].C12=CC=CC=C2N(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 ZGGHKIMDNBDHJB-NRFPMOEYSA-M 0.000 description 1
- SFWWGMKXCYLZEG-YFKPBYRVSA-N (3s)-3-methylmorpholine Chemical compound C[C@H]1COCCN1 SFWWGMKXCYLZEG-YFKPBYRVSA-N 0.000 description 1
- VDSBXXDKCUBMQC-HNGSOEQISA-N (4r,6s)-6-[(e)-2-[2-(4-fluoro-3-methylphenyl)-4,4,6,6-tetramethylcyclohexen-1-yl]ethenyl]-4-hydroxyoxan-2-one Chemical compound C1=C(F)C(C)=CC(C=2CC(C)(C)CC(C)(C)C=2\C=C\[C@H]2OC(=O)C[C@H](O)C2)=C1 VDSBXXDKCUBMQC-HNGSOEQISA-N 0.000 description 1
- ICCGFOKNFZWCTJ-UHFFFAOYSA-N (5-bromopyridin-3-yl)boronic acid Chemical compound OB(O)C1=CN=CC(Br)=C1 ICCGFOKNFZWCTJ-UHFFFAOYSA-N 0.000 description 1
- KUKRPJYXNBIBIT-UHFFFAOYSA-N (6-fluoropyridin-2-yl)boronic acid Chemical compound OB(O)C1=CC=CC(F)=N1 KUKRPJYXNBIBIT-UHFFFAOYSA-N 0.000 description 1
- DHADXDMPEUWEAS-UHFFFAOYSA-N (6-methoxypyridin-3-yl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=N1 DHADXDMPEUWEAS-UHFFFAOYSA-N 0.000 description 1
- DMJWENQHWZZWDF-PKOBYXMFSA-N (6aS,13bR)-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol Chemical compound CN1CCC2=CC(Cl)=C(O)C=C2[C@H]2C3=CC=CC=C3CC[C@H]12 DMJWENQHWZZWDF-PKOBYXMFSA-N 0.000 description 1
- 125000006727 (C1-C6) alkenyl group Chemical group 0.000 description 1
- 125000006728 (C1-C6) alkynyl group Chemical group 0.000 description 1
- METKIMKYRPQLGS-GFCCVEGCSA-N (R)-atenolol Chemical compound CC(C)NC[C@@H](O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-GFCCVEGCSA-N 0.000 description 1
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 1
- RTHCYVBBDHJXIQ-MRXNPFEDSA-N (R)-fluoxetine Chemical compound O([C@H](CCNC)C=1C=CC=CC=1)C1=CC=C(C(F)(F)F)C=C1 RTHCYVBBDHJXIQ-MRXNPFEDSA-N 0.000 description 1
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 description 1
- POPHMOPNVVKGRW-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7-octahydronaphthalene Chemical compound C1CCC2CCCCC2=C1 POPHMOPNVVKGRW-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- QGKODZVXSMOOBS-UHFFFAOYSA-N 1-(2,2-diethoxyethoxy)-4-(trifluoromethyl)benzene Chemical compound CCOC(OCC)COC1=CC=C(C(F)(F)F)C=C1 QGKODZVXSMOOBS-UHFFFAOYSA-N 0.000 description 1
- HISQDLGUCGVTTQ-UHFFFAOYSA-N 1-(2,2-diethoxyethoxy)-4-fluorobenzene Chemical compound CCOC(OCC)COC1=CC=C(F)C=C1 HISQDLGUCGVTTQ-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- CFNMSJUXFABTQT-ZDUSSCGKSA-N 2-(1-benzofuran-2-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC=CC=C2O1 CFNMSJUXFABTQT-ZDUSSCGKSA-N 0.000 description 1
- SJIVTQMUSLGHTI-UHFFFAOYSA-N 2-(1-methylbenzotriazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2N(C)N=NC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 SJIVTQMUSLGHTI-UHFFFAOYSA-N 0.000 description 1
- USZAZKRESYUUIE-UHFFFAOYSA-N 2-(1h-indazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound C1=C2NN=CC2=CC(C2=NC3=CC=C(C=C3N=C2N(C)C(C)C)C(O)=O)=C1 USZAZKRESYUUIE-UHFFFAOYSA-N 0.000 description 1
- SVJHJKJDYXZCKX-UHFFFAOYSA-N 2-(1h-indol-5-yl)-3-piperidin-1-ylquinoxaline-6-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2N=C(C=2C=C3C=CNC3=CC=2)C=1N1CCCCC1 SVJHJKJDYXZCKX-UHFFFAOYSA-N 0.000 description 1
- DZNBPOFPFTVACV-UHFFFAOYSA-N 2-(3,4-dihydro-2h-1,5-benzodioxepin-7-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound O1CCCOC2=CC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(O)=O)=CC=C21 DZNBPOFPFTVACV-UHFFFAOYSA-N 0.000 description 1
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 1
- ZETQOGVBIWRSET-QGZVFWFLSA-N 2-(4-fluorophenyl)-3-[(2r)-2-(trifluoromethyl)piperidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound N1([C@H](CCCC1)C(F)(F)F)C1=NC2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 ZETQOGVBIWRSET-QGZVFWFLSA-N 0.000 description 1
- TXBZLMDSTWZQFI-NSHDSACASA-N 2-(4-fluorophenyl)-7-hydroxy-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=C(O)C=C2N=C1C1=CC=C(F)C=C1 TXBZLMDSTWZQFI-NSHDSACASA-N 0.000 description 1
- BGIKDGQEXRBMBP-LBPRGKRZSA-N 2-(5-fluoro-1-benzofuran-2-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylic acid Chemical compound C[C@H]1CCCN1C1=NC2=CC(C(O)=O)=CC=C2N=C1C1=CC2=CC(F)=CC=C2O1 BGIKDGQEXRBMBP-LBPRGKRZSA-N 0.000 description 1
- BCHLGPUROLTAMY-UHFFFAOYSA-N 2-(6-chloro-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC2=CC=C(Cl)C=C2O1 BCHLGPUROLTAMY-UHFFFAOYSA-N 0.000 description 1
- OPKXSJLCXJBUPR-UHFFFAOYSA-N 2-(6-fluoro-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC2=CC=C(F)C=C2O1 OPKXSJLCXJBUPR-UHFFFAOYSA-N 0.000 description 1
- QYCIGMBXFJKYAS-UHFFFAOYSA-N 2-(6-fluoro-2,3,5,6-tetrahydro-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1OC2=CC(F)CC=C2C1 QYCIGMBXFJKYAS-UHFFFAOYSA-N 0.000 description 1
- XMQODGUTLZXUGZ-RPBOFIJWSA-N 2-[(3s)-3-[[1-[(2r)-2-ethoxycarbonyl-4-phenylbutyl]cyclopentanecarbonyl]amino]-2-oxo-4,5-dihydro-3h-1-benzazepin-1-yl]acetic acid Chemical compound C([C@@H](C(=O)OCC)CC1(CCCC1)C(=O)N[C@@H]1C(N(CC(O)=O)C2=CC=CC=C2CC1)=O)CC1=CC=CC=C1 XMQODGUTLZXUGZ-RPBOFIJWSA-N 0.000 description 1
- CUPLLONAMLCFKB-UHFFFAOYSA-N 2-chloro-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylic acid Chemical compound OC(=O)C1=CC=C2N=C(Cl)C(N(C)C(C)C)=NC2=C1 CUPLLONAMLCFKB-UHFFFAOYSA-N 0.000 description 1
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 1
- LXWLEQZDXOQZGW-UHFFFAOYSA-N 3-bromofuran Chemical compound BrC=1C=COC=1 LXWLEQZDXOQZGW-UHFFFAOYSA-N 0.000 description 1
- UIAGMCDKSXEBJQ-IBGZPJMESA-N 3-o-(2-methoxyethyl) 5-o-propan-2-yl (4s)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)[C@H]1C1=CC=CC([N+]([O-])=O)=C1 UIAGMCDKSXEBJQ-IBGZPJMESA-N 0.000 description 1
- WJPZWSRYOBJHOP-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-(5-phenylfuran-3-yl)-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=COC(C=2C=CC=CC=2)=C1 WJPZWSRYOBJHOP-UHFFFAOYSA-N 0.000 description 1
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 1
- SWLAMJPTOQZTAE-UHFFFAOYSA-N 4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]benzoic acid Chemical class COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(C(O)=O)C=C1 SWLAMJPTOQZTAE-UHFFFAOYSA-N 0.000 description 1
- LGOZNQPHTIGMQJ-UHFFFAOYSA-N 4-bromo-2-ethylaniline Chemical compound CCC1=CC(Br)=CC=C1N LGOZNQPHTIGMQJ-UHFFFAOYSA-N 0.000 description 1
- QSWYYVWMQBXKSL-UHFFFAOYSA-N 4-chloro-2-(2,3-dioxobutoxy)benzoic acid Chemical compound CC(=O)C(=O)COC1=CC(Cl)=CC=C1C(O)=O QSWYYVWMQBXKSL-UHFFFAOYSA-N 0.000 description 1
- LWXFCZXRFBUOOR-UHFFFAOYSA-N 4-chloro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1O LWXFCZXRFBUOOR-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- GBJJCODOZGPTBC-UHFFFAOYSA-N 4-fluoro-2-hydroxybenzaldehyde Chemical compound OC1=CC(F)=CC=C1C=O GBJJCODOZGPTBC-UHFFFAOYSA-N 0.000 description 1
- BOJWTAQWPVBIPG-UHFFFAOYSA-N 4-fluoro-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 BOJWTAQWPVBIPG-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 108091005477 5-HT3 receptors Proteins 0.000 description 1
- 102000035037 5-HT3 receptors Human genes 0.000 description 1
- 108091005482 5-HT4 receptors Proteins 0.000 description 1
- AYOVPQORFBWFNO-UHFFFAOYSA-N 5-bromo-1-benzofuran Chemical compound BrC1=CC=C2OC=CC2=C1 AYOVPQORFBWFNO-UHFFFAOYSA-N 0.000 description 1
- MKKSTJKBKNCMRV-UHFFFAOYSA-N 5-bromo-2-hydroxybenzaldehyde Chemical compound OC1=CC=C(Br)C=C1C=O MKKSTJKBKNCMRV-UHFFFAOYSA-N 0.000 description 1
- RZTAMFZIAATZDJ-HNNXBMFYSA-N 5-o-ethyl 3-o-methyl (4s)-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)[C@@H]1C1=CC=CC(Cl)=C1Cl RZTAMFZIAATZDJ-HNNXBMFYSA-N 0.000 description 1
- VNACOBVZDCLAEV-GXKRWWSZSA-N 6-[2-[[2-[(2s)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile;dihydrochloride Chemical compound Cl.Cl.N1([C@@H](CCC1)C#N)C(=O)CNCCNC1=CC=C(C#N)C=N1 VNACOBVZDCLAEV-GXKRWWSZSA-N 0.000 description 1
- HQULYFAKUZDRPB-UHFFFAOYSA-N 6-bromo-2-[4-(trifluoromethoxy)phenoxy]-1,3-benzothiazole Chemical compound BrC1=CC2=C(N=C(S2)OC2=CC=C(C=C2)OC(F)(F)F)C=C1 HQULYFAKUZDRPB-UHFFFAOYSA-N 0.000 description 1
- KPFDABVKWKOIME-UHFFFAOYSA-N 6-bromo-3,4-dihydro-2h-chromene Chemical compound O1CCCC2=CC(Br)=CC=C21 KPFDABVKWKOIME-UHFFFAOYSA-N 0.000 description 1
- QSYZLDHZMYWEKL-UHFFFAOYSA-N 6-chloro-1-benzofuran-3-one Chemical compound ClC1=CC=C2C(=O)COC2=C1 QSYZLDHZMYWEKL-UHFFFAOYSA-N 0.000 description 1
- MUNCFYFZUDHPAG-UHFFFAOYSA-N 6-fluoro-1-benzofuran Chemical compound FC1=CC=C2C=COC2=C1 MUNCFYFZUDHPAG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 206010000830 Acute leukaemia Diseases 0.000 description 1
- JBMKAUGHUNFTOL-UHFFFAOYSA-N Aldoclor Chemical class C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC=NS2(=O)=O JBMKAUGHUNFTOL-UHFFFAOYSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-ZVIOFETBSA-N Aldosterone Chemical compound C([C@@]1([C@@H](C(=O)CO)CC[C@H]1[C@@H]1CC2)C=O)[C@H](O)[C@@H]1[C@]1(C)C2=CC(=O)CC1 PQSUYGKTWSAVDQ-ZVIOFETBSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-UHFFFAOYSA-N Aldosterone Natural products C1CC2C3CCC(C(=O)CO)C3(C=O)CC(O)C2C2(C)C1=CC(=O)CC2 PQSUYGKTWSAVDQ-UHFFFAOYSA-N 0.000 description 1
- 229940123338 Aldosterone synthase inhibitor Drugs 0.000 description 1
- UXOWGYHJODZGMF-QORCZRPOSA-N Aliskiren Chemical compound COCCCOC1=CC(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C(C)C)C(=O)NCC(C)(C)C(N)=O)C(C)C)=CC=C1OC UXOWGYHJODZGMF-QORCZRPOSA-N 0.000 description 1
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- 229940123413 Angiotensin II antagonist Drugs 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- XUKUURHRXDUEBC-UHFFFAOYSA-N Atorvastatin Natural products C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CCC(O)CC(O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-UHFFFAOYSA-N 0.000 description 1
- 210000002237 B-cell of pancreatic islet Anatomy 0.000 description 1
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 1
- XPCFTKFZXHTYIP-PMACEKPBSA-N Benazepril Chemical compound C([C@@H](C(=O)OCC)N[C@@H]1C(N(CC(O)=O)C2=CC=CC=C2CC1)=O)CC1=CC=CC=C1 XPCFTKFZXHTYIP-PMACEKPBSA-N 0.000 description 1
- 229940123208 Biguanide Drugs 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000002083 C09CA01 - Losartan Substances 0.000 description 1
- 239000002080 C09CA02 - Eprosartan Substances 0.000 description 1
- 239000002947 C09CA04 - Irbesartan Substances 0.000 description 1
- 239000002053 C09CA06 - Candesartan Substances 0.000 description 1
- 101100168093 Caenorhabditis elegans cogc-2 gene Proteins 0.000 description 1
- 229940127291 Calcium channel antagonist Drugs 0.000 description 1
- 229940122820 Cannabinoid receptor antagonist Drugs 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 1
- 241000723346 Cinnamomum camphora Species 0.000 description 1
- RGJOEKWQDUBAIZ-IBOSZNHHSA-N CoASH Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCS)O[C@H]1N1C2=NC=NC(N)=C2N=C1 RGJOEKWQDUBAIZ-IBOSZNHHSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 241000612154 Coris monspeliensis Species 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical group CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- JRWZLRBJNMZMFE-UHFFFAOYSA-N Dobutamine Chemical compound C=1C=C(O)C(O)=CC=1CCNC(C)CCC1=CC=C(O)C=C1 JRWZLRBJNMZMFE-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108010061435 Enalapril Proteins 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 208000007530 Essential hypertension Diseases 0.000 description 1
- 108010011459 Exenatide Proteins 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FAEKWTJYAYMJKF-QHCPKHFHSA-N GlucoNorm Chemical compound C1=C(C(O)=O)C(OCC)=CC(CC(=O)N[C@@H](CC(C)C)C=2C(=CC=CC=2)N2CCCCC2)=C1 FAEKWTJYAYMJKF-QHCPKHFHSA-N 0.000 description 1
- 208000002705 Glucose Intolerance Diseases 0.000 description 1
- 206010018429 Glucose tolerance impaired Diseases 0.000 description 1
- 108010046163 Glycogen Phosphorylase Proteins 0.000 description 1
- 102000007390 Glycogen Phosphorylase Human genes 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 206010019708 Hepatic steatosis Diseases 0.000 description 1
- 102000006947 Histones Human genes 0.000 description 1
- 108010033040 Histones Proteins 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 101000838579 Homo sapiens Serine/threonine-protein kinase TAO1 Proteins 0.000 description 1
- 101000838578 Homo sapiens Serine/threonine-protein kinase TAO2 Proteins 0.000 description 1
- 208000035150 Hypercholesterolemia Diseases 0.000 description 1
- 206010060378 Hyperinsulinaemia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 229940122199 Insulin secretagogue Drugs 0.000 description 1
- 229940122355 Insulin sensitizer Drugs 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- 108010028554 LDL Cholesterol Proteins 0.000 description 1
- 238000008214 LDL Cholesterol Methods 0.000 description 1
- 102000016267 Leptin Human genes 0.000 description 1
- 108010092277 Leptin Proteins 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 108010007859 Lisinopril Proteins 0.000 description 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- ZPXSCAKFGYXMGA-UHFFFAOYSA-N Mazindol Chemical compound N12CCN=C2C2=CC=CC=C2C1(O)C1=CC=C(Cl)C=C1 ZPXSCAKFGYXMGA-UHFFFAOYSA-N 0.000 description 1
- 102000029749 Microtubule Human genes 0.000 description 1
- 108091022875 Microtubule Proteins 0.000 description 1
- 102000003979 Mineralocorticoid Receptors Human genes 0.000 description 1
- 108090000375 Mineralocorticoid Receptors Proteins 0.000 description 1
- UWWDHYUMIORJTA-HSQYWUDLSA-N Moexipril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC(OC)=C(OC)C=C2C1)C(O)=O)CC1=CC=CC=C1 UWWDHYUMIORJTA-HSQYWUDLSA-N 0.000 description 1
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 description 1
- 208000034578 Multiple myelomas Diseases 0.000 description 1
- 101100221487 Mus musculus Cog2 gene Proteins 0.000 description 1
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 208000012902 Nervous system disease Diseases 0.000 description 1
- 208000025966 Neurological disease Diseases 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- ZBBHBTPTTSWHBA-UHFFFAOYSA-N Nicardipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)CC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 ZBBHBTPTTSWHBA-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 208000012868 Overgrowth Diseases 0.000 description 1
- 108090000854 Oxidoreductases Proteins 0.000 description 1
- 102000004316 Oxidoreductases Human genes 0.000 description 1
- 108010055723 PDGF receptor tyrosine kinase Proteins 0.000 description 1
- 229910019201 POBr3 Inorganic materials 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- MFOCDFTXLCYLKU-CMPLNLGQSA-N Phendimetrazine Chemical compound O1CCN(C)[C@@H](C)[C@@H]1C1=CC=CC=C1 MFOCDFTXLCYLKU-CMPLNLGQSA-N 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 102000010752 Plasminogen Inactivators Human genes 0.000 description 1
- 108010077971 Plasminogen Inactivators Proteins 0.000 description 1
- TUZYXOIXSAXUGO-UHFFFAOYSA-N Pravastatin Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(O)C=C21 TUZYXOIXSAXUGO-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 125000005631 S-sulfonamido group Chemical group 0.000 description 1
- RYMZZMVNJRMUDD-UHFFFAOYSA-N SJ000286063 Natural products C12C(OC(=O)C(C)(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 RYMZZMVNJRMUDD-UHFFFAOYSA-N 0.000 description 1
- AJLFOPYRIVGYMJ-UHFFFAOYSA-N SJ000287055 Natural products C12C(OC(=O)C(C)CC)CCC=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 AJLFOPYRIVGYMJ-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 229940083324 Selective androgen receptor modulator Drugs 0.000 description 1
- 102100028948 Serine/threonine-protein kinase TAO1 Human genes 0.000 description 1
- 102100028949 Serine/threonine-protein kinase TAO2 Human genes 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- 102000018692 Sulfonylurea Receptors Human genes 0.000 description 1
- 108010091821 Sulfonylurea Receptors Proteins 0.000 description 1
- 102000003673 Symporters Human genes 0.000 description 1
- 108090000088 Symporters Proteins 0.000 description 1
- 108010036928 Thiorphan Proteins 0.000 description 1
- 229940122388 Thrombin inhibitor Drugs 0.000 description 1
- KJADKKWYZYXHBB-XBWDGYHZSA-N Topiramic acid Chemical compound C1O[C@@]2(COS(N)(=O)=O)OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 KJADKKWYZYXHBB-XBWDGYHZSA-N 0.000 description 1
- 101710183280 Topoisomerase Proteins 0.000 description 1
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
- NGBFQHCMQULJNZ-UHFFFAOYSA-N Torsemide Chemical compound CC(C)NC(=O)NS(=O)(=O)C1=CN=CC=C1NC1=CC=CC(C)=C1 NGBFQHCMQULJNZ-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- VXFJYXUZANRPDJ-WTNASJBWSA-N Trandopril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](C[C@H]2CCCC[C@@H]21)C(O)=O)CC1=CC=CC=C1 VXFJYXUZANRPDJ-WTNASJBWSA-N 0.000 description 1
- 102000003929 Transaminases Human genes 0.000 description 1
- 108090000340 Transaminases Proteins 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- 102100033001 Tyrosine-protein phosphatase non-receptor type 1 Human genes 0.000 description 1
- 101710128896 Tyrosine-protein phosphatase non-receptor type 1 Proteins 0.000 description 1
- SVWDNAZSWUEPJT-UHFFFAOYSA-N [6-(trifluoromethyl)-1-benzofuran-2-yl]boronic acid Chemical compound C1=C(C(F)(F)F)C=C2OC(B(O)O)=CC2=C1 SVWDNAZSWUEPJT-UHFFFAOYSA-N 0.000 description 1
- 210000000579 abdominal fat Anatomy 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229960002632 acarbose Drugs 0.000 description 1
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 1
- GOEMGAFJFRBGGG-UHFFFAOYSA-N acebutolol Chemical compound CCCC(=O)NC1=CC=C(OCC(O)CNC(C)C)C(C(C)=O)=C1 GOEMGAFJFRBGGG-UHFFFAOYSA-N 0.000 description 1
- 229960002122 acebutolol Drugs 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229960004601 aliskiren Drugs 0.000 description 1
- 125000005012 alkyl thioether group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 239000003888 alpha glucosidase inhibitor Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229940000806 amaryl Drugs 0.000 description 1
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 description 1
- 229960002576 amiloride Drugs 0.000 description 1
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 1
- HTIQEAQVCYTUBX-UHFFFAOYSA-N amlodipine Chemical compound CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1Cl HTIQEAQVCYTUBX-UHFFFAOYSA-N 0.000 description 1
- 229960000528 amlodipine Drugs 0.000 description 1
- 229940025084 amphetamine Drugs 0.000 description 1
- 229960002932 anastrozole Drugs 0.000 description 1
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 1
- 239000002333 angiotensin II receptor antagonist Substances 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 229940046836 anti-estrogen Drugs 0.000 description 1
- 230000001833 anti-estrogenic effect Effects 0.000 description 1
- 239000000883 anti-obesity agent Substances 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000003524 antilipemic agent Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000002814 antineoplastic antimetabolite Substances 0.000 description 1
- 229940125710 antiobesity agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003886 aromatase inhibitor Substances 0.000 description 1
- 229940046844 aromatase inhibitors Drugs 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005015 aryl alkynyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229960002274 atenolol Drugs 0.000 description 1
- 229960005370 atorvastatin Drugs 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 210000000227 basophil cell of anterior lobe of hypophysis Anatomy 0.000 description 1
- 229960004530 benazepril Drugs 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- YXKTVDFXDRQTKV-HNNXBMFYSA-N benzphetamine Chemical compound C([C@H](C)N(C)CC=1C=CC=CC=1)C1=CC=CC=C1 YXKTVDFXDRQTKV-HNNXBMFYSA-N 0.000 description 1
- 229960002837 benzphetamine Drugs 0.000 description 1
- KKBIUAUSZKGNOA-HNAYVOBHSA-N benzyl (2s)-2-[[(2s)-2-(acetylsulfanylmethyl)-3-(1,3-benzodioxol-5-yl)propanoyl]amino]propanoate Chemical compound O=C([C@@H](NC(=O)[C@@H](CSC(C)=O)CC=1C=C2OCOC2=CC=1)C)OCC1=CC=CC=C1 KKBIUAUSZKGNOA-HNAYVOBHSA-N 0.000 description 1
- UIEATEWHFDRYRU-UHFFFAOYSA-N bepridil Chemical compound C1CCCN1C(COCC(C)C)CN(C=1C=CC=CC=1)CC1=CC=CC=C1 UIEATEWHFDRYRU-UHFFFAOYSA-N 0.000 description 1
- 229960003665 bepridil Drugs 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- 229960004324 betaxolol Drugs 0.000 description 1
- CHDPSNLJFOQTRK-UHFFFAOYSA-N betaxolol hydrochloride Chemical compound [Cl-].C1=CC(OCC(O)C[NH2+]C(C)C)=CC=C1CCOCC1CC1 CHDPSNLJFOQTRK-UHFFFAOYSA-N 0.000 description 1
- LPCWKMYWISGVSK-UHFFFAOYSA-N bicyclo[3.2.1]octane Chemical compound C1C2CCC1CCC2 LPCWKMYWISGVSK-UHFFFAOYSA-N 0.000 description 1
- 150000004283 biguanides Chemical class 0.000 description 1
- 238000002306 biochemical method Methods 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 1
- 229960002781 bisoprolol Drugs 0.000 description 1
- VHYCDWMUTMEGQY-UHFFFAOYSA-N bisoprolol Chemical compound CC(C)NCC(O)COC1=CC=C(COCCOC(C)C)C=C1 VHYCDWMUTMEGQY-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- OZVBMTJYIDMWIL-AYFBDAFISA-N bromocriptine Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@]2(C(=O)N3[C@H](C(N4CCC[C@H]4[C@]3(O)O2)=O)CC(C)C)C(C)C)C2)=C3C2=C(Br)NC3=C1 OZVBMTJYIDMWIL-AYFBDAFISA-N 0.000 description 1
- 229960002802 bromocriptine Drugs 0.000 description 1
- SNPPWIUOZRMYNY-UHFFFAOYSA-N bupropion Chemical compound CC(C)(C)NC(C)C(=O)C1=CC=CC(Cl)=C1 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0.000 description 1
- 229960001058 bupropion Drugs 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000000480 calcium channel blocker Substances 0.000 description 1
- 229960000846 camphor Drugs 0.000 description 1
- 229930008380 camphor Natural products 0.000 description 1
- 229960000932 candesartan Drugs 0.000 description 1
- SGZAIDDFHDDFJU-UHFFFAOYSA-N candesartan Chemical compound CCOC1=NC2=CC=CC(C(O)=O)=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C1=NN=N[N]1 SGZAIDDFHDDFJU-UHFFFAOYSA-N 0.000 description 1
- 239000003536 cannabinoid receptor antagonist Substances 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000036755 cellular response Effects 0.000 description 1
- 230000009166 cellular response to nutrient Effects 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 229960005110 cerivastatin Drugs 0.000 description 1
- SEERZIQQUAZTOL-ANMDKAQQSA-N cerivastatin Chemical compound COCC1=C(C(C)C)N=C(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC(O)=O)=C1C1=CC=C(F)C=C1 SEERZIQQUAZTOL-ANMDKAQQSA-N 0.000 description 1
- GPUADMRJQVPIAS-QCVDVZFFSA-M cerivastatin sodium Chemical compound [Na+].COCC1=C(C(C)C)N=C(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 GPUADMRJQVPIAS-QCVDVZFFSA-M 0.000 description 1
- JUFFVKRROAPVBI-PVOYSMBESA-N chembl1210015 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)N[C@H]1[C@@H]([C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO[C@]3(O[C@@H](C[C@H](O)[C@H](O)CO)[C@H](NC(C)=O)[C@@H](O)C3)C(O)=O)O2)O)[C@@H](CO)O1)NC(C)=O)C(=O)NCC(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 JUFFVKRROAPVBI-PVOYSMBESA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229960002155 chlorothiazide Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004617 chromonyl group Chemical group O1C(=CC(C2=CC=CC=C12)=O)* 0.000 description 1
- 208000024207 chronic leukemia Diseases 0.000 description 1
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 1
- NCNFDKWULDWJDS-OAHLLOKOSA-N cilansetron Chemical compound CC1=NC=CN1C[C@@H]1C(=O)C(C=2C=3N4CCCC=3C=CC=2)=C4CC1 NCNFDKWULDWJDS-OAHLLOKOSA-N 0.000 description 1
- 229960002099 cilansetron Drugs 0.000 description 1
- DCSUBABJRXZOMT-IRLDBZIGSA-N cisapride Chemical compound C([C@@H]([C@@H](CC1)NC(=O)C=2C(=CC(N)=C(Cl)C=2)OC)OC)N1CCCOC1=CC=C(F)C=C1 DCSUBABJRXZOMT-IRLDBZIGSA-N 0.000 description 1
- 229960005132 cisapride Drugs 0.000 description 1
- DCSUBABJRXZOMT-UHFFFAOYSA-N cisapride Natural products C1CC(NC(=O)C=2C(=CC(N)=C(Cl)C=2)OC)C(OC)CN1CCCOC1=CC=C(F)C=C1 DCSUBABJRXZOMT-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- GKTWGGQPFAXNFI-HNNXBMFYSA-N clopidogrel Chemical compound C1([C@H](N2CC=3C=CSC=3CC2)C(=O)OC)=CC=CC=C1Cl GKTWGGQPFAXNFI-HNNXBMFYSA-N 0.000 description 1
- 229960003958 clopidogrel bisulfate Drugs 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- RGJOEKWQDUBAIZ-UHFFFAOYSA-N coenzime A Natural products OC1C(OP(O)(O)=O)C(COP(O)(=O)OP(O)(=O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCS)OC1N1C2=NC=NC(N)=C2N=C1 RGJOEKWQDUBAIZ-UHFFFAOYSA-N 0.000 description 1
- 239000005516 coenzyme A Substances 0.000 description 1
- 229940093530 coenzyme a Drugs 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 229950003040 dalvastatin Drugs 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- KDTSHFARGAKYJN-UHFFFAOYSA-N dephosphocoenzyme A Natural products OC1C(O)C(COP(O)(=O)OP(O)(=O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCS)OC1N1C2=NC=NC(N)=C2N=C1 KDTSHFARGAKYJN-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- LTVOKYUPTHZZQH-UHFFFAOYSA-N difluoromethane Chemical group F[C]F LTVOKYUPTHZZQH-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000005433 dihydrobenzodioxinyl group Chemical group O1C(COC2=C1C=CC=C2)* 0.000 description 1
- 125000001070 dihydroindolyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000004611 dihydroisoindolyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000005045 dihydroisoquinolinyl group Chemical group C1(NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 1
- 229960004166 diltiazem Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 108010083220 ditekiren Proteins 0.000 description 1
- 229950010513 ditekiren Drugs 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- DLNKOYKMWOXYQA-UHFFFAOYSA-N dl-pseudophenylpropanolamine Natural products CC(N)C(O)C1=CC=CC=C1 DLNKOYKMWOXYQA-UHFFFAOYSA-N 0.000 description 1
- 229960001089 dobutamine Drugs 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 230000008482 dysregulation Effects 0.000 description 1
- 229950009714 ecopipam Drugs 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 229960000873 enalapril Drugs 0.000 description 1
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- 230000019439 energy homeostasis Effects 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- JUKPWJGBANNWMW-VWBFHTRKSA-N eplerenone Chemical compound C([C@@H]1[C@]2(C)C[C@H]3O[C@]33[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)C(=O)OC)C[C@@]21CCC(=O)O1 JUKPWJGBANNWMW-VWBFHTRKSA-N 0.000 description 1
- 229960001208 eplerenone Drugs 0.000 description 1
- OROAFUQRIXKEMV-LDADJPATSA-N eprosartan Chemical compound C=1C=C(C(O)=O)C=CC=1CN1C(CCCC)=NC=C1\C=C(C(O)=O)/CC1=CC=CS1 OROAFUQRIXKEMV-LDADJPATSA-N 0.000 description 1
- 229960004563 eprosartan Drugs 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 239000000328 estrogen antagonist Substances 0.000 description 1
- AVOLMBLBETYQHX-UHFFFAOYSA-N etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 description 1
- 229960003199 etacrynic acid Drugs 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 229960001519 exenatide Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229950005203 fasidotril Drugs 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 229960003580 felodipine Drugs 0.000 description 1
- 229940087476 femara Drugs 0.000 description 1
- 229960001582 fenfluramine Drugs 0.000 description 1
- 229940125753 fibrate Drugs 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229960002464 fluoxetine Drugs 0.000 description 1
- 229960003765 fluvastatin Drugs 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 229960002490 fosinopril Drugs 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- PZJSZBJLOWMDRG-UHFFFAOYSA-N furan-2-ylboronic acid Chemical compound OB(O)C1=CC=CO1 PZJSZBJLOWMDRG-UHFFFAOYSA-N 0.000 description 1
- CYEFKCRAAGLNHW-UHFFFAOYSA-N furan-3-ylboronic acid Chemical compound OB(O)C=1C=COC=1 CYEFKCRAAGLNHW-UHFFFAOYSA-N 0.000 description 1
- 125000004612 furopyridinyl group Chemical group O1C(=CC2=C1C=CC=N2)* 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229960004580 glibenclamide Drugs 0.000 description 1
- WIGIZIANZCJQQY-RUCARUNLSA-N glimepiride Chemical group O=C1C(CC)=C(C)CN1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)N[C@@H]2CC[C@@H](C)CC2)C=C1 WIGIZIANZCJQQY-RUCARUNLSA-N 0.000 description 1
- ZJJXGWJIGJFDTL-UHFFFAOYSA-N glipizide Chemical compound C1=NC(C)=CN=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZJJXGWJIGJFDTL-UHFFFAOYSA-N 0.000 description 1
- 229960001381 glipizide Drugs 0.000 description 1
- 230000014101 glucose homeostasis Effects 0.000 description 1
- ZNNLBTZKUZBEKO-UHFFFAOYSA-N glyburide Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZNNLBTZKUZBEKO-UHFFFAOYSA-N 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000006343 heptafluoro propyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 229960002003 hydrochlorothiazide Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000003451 hyperinsulinaemic effect Effects 0.000 description 1
- 208000006575 hypertriglyceridemia Diseases 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004041 inotropic agent Substances 0.000 description 1
- 230000003914 insulin secretion Effects 0.000 description 1
- 230000002473 insulinotropic effect Effects 0.000 description 1
- 210000001596 intra-abdominal fat Anatomy 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229960002198 irbesartan Drugs 0.000 description 1
- YCPOHTHPUREGFM-UHFFFAOYSA-N irbesartan Chemical compound O=C1N(CC=2C=CC(=CC=2)C=2C(=CC=CC=2)C=2[N]N=NN=2)C(CCCC)=NC21CCCC2 YCPOHTHPUREGFM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 210000004153 islets of langerhan Anatomy 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- FZWBNHMXJMCXLU-BLAUPYHCSA-N isomaltotriose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)O1 FZWBNHMXJMCXLU-BLAUPYHCSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000001810 isothiocyanato group Chemical group *N=C=S 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 description 1
- 229940039781 leptin Drugs 0.000 description 1
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000000865 liniment Substances 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229960002394 lisinopril Drugs 0.000 description 1
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 description 1
- 239000002171 loop diuretic Substances 0.000 description 1
- 229960004773 losartan Drugs 0.000 description 1
- KJJZZJSZUJXYEA-UHFFFAOYSA-N losartan Chemical compound CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C=2[N]N=NN=2)C=C1 KJJZZJSZUJXYEA-UHFFFAOYSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229960004844 lovastatin Drugs 0.000 description 1
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 description 1
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 229960000299 mazindol Drugs 0.000 description 1
- 229950004994 meglitinide Drugs 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229960003105 metformin Drugs 0.000 description 1
- RIFHJAODNHLCBH-UHFFFAOYSA-N methanethione Chemical group S=[CH] RIFHJAODNHLCBH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- DEPJXHIHVSBDDJ-ZDUSSCGKSA-N methyl 2-(1,3-benzothiazol-2-yl)-3-[(2s)-2-methylpyrrolidin-1-yl]quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2SC3=CC=CC=C3N=2)C=1N1CCC[C@@H]1C DEPJXHIHVSBDDJ-ZDUSSCGKSA-N 0.000 description 1
- TWJIJLXTUJVVKO-UHFFFAOYSA-N methyl 2-(1-ethylindazol-5-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound C1=C(C(=O)OC)C=C2N=C(N(C)C(C)C)C(C=3C=C4C=NN(C4=CC=3)CC)=NC2=C1 TWJIJLXTUJVVKO-UHFFFAOYSA-N 0.000 description 1
- GUHIFGHWSIPGBZ-UHFFFAOYSA-N methyl 2-(1h-indol-5-yl)-3-piperidin-1-ylquinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2C=C3C=CNC3=CC=2)C=1N1CCCCC1 GUHIFGHWSIPGBZ-UHFFFAOYSA-N 0.000 description 1
- UJLPLJOJEIPQDV-UHFFFAOYSA-N methyl 2-(5-methoxy-1-benzofuran-2-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound COC1=CC=C2OC(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=CC2=C1 UJLPLJOJEIPQDV-UHFFFAOYSA-N 0.000 description 1
- QPMGLJKMBJDTGN-AWEZNQCLSA-N methyl 2-(6-fluoro-1-benzofuran-2-yl)-3-[(2s)-2-methylpiperidin-1-yl]quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC(F)=CC=C3C=2)C=1N1CCCC[C@@H]1C QPMGLJKMBJDTGN-AWEZNQCLSA-N 0.000 description 1
- MDGPADNIOCBEOC-UHFFFAOYSA-N methyl 2-(6-fluoropyridin-3-yl)-3-[methyl(propan-2-yl)amino]quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=C(F)N=C1 MDGPADNIOCBEOC-UHFFFAOYSA-N 0.000 description 1
- DTHMTBUWTGVEFG-UHFFFAOYSA-N methyl 2-amino-2-phenylacetate;hydrochloride Chemical compound [Cl-].COC(=O)C([NH3+])C1=CC=CC=C1 DTHMTBUWTGVEFG-UHFFFAOYSA-N 0.000 description 1
- VKQFCGNPDRICFG-UHFFFAOYSA-N methyl 2-methylpropyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC(C)C)C1C1=CC=CC=C1[N+]([O-])=O VKQFCGNPDRICFG-UHFFFAOYSA-N 0.000 description 1
- LSOMBEQQIOGHEN-JTQLQIEISA-N methyl 3-[(2s)-2-methylpiperidin-1-yl]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(OS(=O)(=O)C(F)(F)F)C=1N1CCCC[C@@H]1C LSOMBEQQIOGHEN-JTQLQIEISA-N 0.000 description 1
- JDOFRXCJRBCASN-ZDUSSCGKSA-N methyl 3-[(2s)-2-methylpyrrolidin-1-yl]-2-[6-(trifluoromethyl)-1-benzofuran-2-yl]quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2OC3=CC(=CC=C3C=2)C(F)(F)F)C=1N1CCC[C@@H]1C JDOFRXCJRBCASN-ZDUSSCGKSA-N 0.000 description 1
- CDLARFSZQAKSJS-UHFFFAOYSA-N methyl 3-[cyclopropyl(methyl)amino]-2-(6-fluoro-1-benzofuran-3-yl)quinoxaline-6-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N=C(C=2C3=CC=C(F)C=C3OC=2)C=1N(C)C1CC1 CDLARFSZQAKSJS-UHFFFAOYSA-N 0.000 description 1
- LGGJAMJZGSAQTP-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate Chemical compound N1=C(OS(=O)(=O)C(F)(F)F)C(N(C)C(C)C)=NC2=CC(C(=O)OC)=CC=C21 LGGJAMJZGSAQTP-UHFFFAOYSA-N 0.000 description 1
- CHYHXWOPJRMWGU-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-[5-(trifluoromethyl)-1-benzofuran-3-yl]quinoxaline-6-carboxylate Chemical compound C1=C(C(F)(F)F)C=C2C(C3=NC4=CC=C(C=C4N=C3N(C)C(C)C)C(=O)OC)=COC2=C1 CHYHXWOPJRMWGU-UHFFFAOYSA-N 0.000 description 1
- PRKUYCICRWVGAP-UHFFFAOYSA-N methyl 3-[methyl(propan-2-yl)amino]-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-3-yl]quinoxaline-6-carboxylate Chemical compound CC(C)N(C)C1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=C(NC(=O)OC(C)(C)C)N=C1 PRKUYCICRWVGAP-UHFFFAOYSA-N 0.000 description 1
- PYPDBDATSKTBPE-UHFFFAOYSA-N methyl 3-bromo-2-phenylquinoxaline-6-carboxylate Chemical compound BrC1=NC2=CC(C(=O)OC)=CC=C2N=C1C1=CC=CC=C1 PYPDBDATSKTBPE-UHFFFAOYSA-N 0.000 description 1
- VYNZIJAHXLKFCL-UHFFFAOYSA-N methyl 6-chloro-7-[methyl(propan-2-yl)amino]naphthalene-2-carboxylate Chemical compound C1=C(Cl)C(N(C)C(C)C)=CC2=CC(C(=O)OC)=CC=C21 VYNZIJAHXLKFCL-UHFFFAOYSA-N 0.000 description 1
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229960002237 metoprolol Drugs 0.000 description 1
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 description 1
- AJLFOPYRIVGYMJ-INTXDZFKSA-N mevastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=CCC[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 AJLFOPYRIVGYMJ-INTXDZFKSA-N 0.000 description 1
- 229950009116 mevastatin Drugs 0.000 description 1
- BOZILQFLQYBIIY-UHFFFAOYSA-N mevastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CCC=C21 BOZILQFLQYBIIY-UHFFFAOYSA-N 0.000 description 1
- 210000004688 microtubule Anatomy 0.000 description 1
- PZRHRDRVRGEVNW-UHFFFAOYSA-N milrinone Chemical compound N1C(=O)C(C#N)=CC(C=2C=CN=CC=2)=C1C PZRHRDRVRGEVNW-UHFFFAOYSA-N 0.000 description 1
- 229960003574 milrinone Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229960005170 moexipril Drugs 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- 125000006578 monocyclic heterocycloalkyl group Chemical group 0.000 description 1
- 125000006682 monohaloalkyl group Chemical group 0.000 description 1
- 230000004118 muscle contraction Effects 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960004255 nadolol Drugs 0.000 description 1
- VWPOSFSPZNDTMJ-UCWKZMIHSA-N nadolol Chemical compound C1[C@@H](O)[C@@H](O)CC2=C1C=CC=C2OCC(O)CNC(C)(C)C VWPOSFSPZNDTMJ-UCWKZMIHSA-N 0.000 description 1
- OELFLUMRDSZNSF-BRWVUGGUSA-N nateglinide Chemical compound C1C[C@@H](C(C)C)CC[C@@H]1C(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 OELFLUMRDSZNSF-BRWVUGGUSA-N 0.000 description 1
- 229960000698 nateglinide Drugs 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 229960001783 nicardipine Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 1
- 229960001597 nifedipine Drugs 0.000 description 1
- 229960000715 nimodipine Drugs 0.000 description 1
- 229960000227 nisoldipine Drugs 0.000 description 1
- 235000021232 nutrient availability Nutrition 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- LVRLSYPNFFBYCZ-VGWMRTNUSA-N omapatrilat Chemical compound C([C@H](S)C(=O)N[C@H]1CCS[C@H]2CCC[C@H](N2C1=O)C(=O)O)C1=CC=CC=C1 LVRLSYPNFFBYCZ-VGWMRTNUSA-N 0.000 description 1
- 229950000973 omapatrilat Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- AHLBNYSZXLDEJQ-FWEHEUNISA-N orlistat Chemical compound CCCCCCCCCCC[C@H](OC(=O)[C@H](CC(C)C)NC=O)C[C@@H]1OC(=O)[C@H]1CCCCCC AHLBNYSZXLDEJQ-FWEHEUNISA-N 0.000 description 1
- 229960001243 orlistat Drugs 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 235000010603 pastilles Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001151 peptidyl group Chemical group 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 229960000436 phendimetrazine Drugs 0.000 description 1
- DLNKOYKMWOXYQA-APPZFPTMSA-N phenylpropanolamine Chemical compound C[C@@H](N)[C@H](O)C1=CC=CC=C1 DLNKOYKMWOXYQA-APPZFPTMSA-N 0.000 description 1
- 229960000395 phenylpropanolamine Drugs 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229960005095 pioglitazone Drugs 0.000 description 1
- 229960002797 pitavastatin Drugs 0.000 description 1
- VGYFMXBACGZSIL-MCBHFWOFSA-N pitavastatin Chemical compound OC(=O)C[C@H](O)C[C@H](O)\C=C\C1=C(C2CC2)N=C2C=CC=CC2=C1C1=CC=C(F)C=C1 VGYFMXBACGZSIL-MCBHFWOFSA-N 0.000 description 1
- 239000002797 plasminogen activator inhibitor Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical class [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000001323 posttranslational effect Effects 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 229960002965 pravastatin Drugs 0.000 description 1
- TUZYXOIXSAXUGO-PZAWKZKUSA-N pravastatin Chemical compound C1=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(O)=O)[C@H]2[C@@H](OC(=O)[C@@H](C)CC)C[C@H](O)C=C21 TUZYXOIXSAXUGO-PZAWKZKUSA-N 0.000 description 1
- 108010066381 preproinsulin Proteins 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- NPUSXSOBPNHOPH-UHFFFAOYSA-N propan-2-yl 4-(2-chlorophenyl)-1-ethyl-2-methyl-5-oxo-4,7-dihydrofuro[3,4-b]pyridine-3-carboxylate Chemical compound CC(C)OC(=O)C1=C(C)N(CC)C(COC2=O)=C2C1C1=CC=CC=C1Cl NPUSXSOBPNHOPH-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 230000003331 prothrombotic effect Effects 0.000 description 1
- KWGRBVOPPLSCSI-WCBMZHEXSA-N pseudoephedrine Chemical compound CN[C@@H](C)[C@@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WCBMZHEXSA-N 0.000 description 1
- 229960003908 pseudoephedrine Drugs 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000012797 qualification Methods 0.000 description 1
- 229960001455 quinapril Drugs 0.000 description 1
- JSDRRTOADPPCHY-HSQYWUDLSA-N quinapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)CC1=CC=CC=C1 JSDRRTOADPPCHY-HSQYWUDLSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- MKWQJYNEKZKCSA-UHFFFAOYSA-N quinoxaline Chemical compound N1=C=C=NC2=CC=CC=C21 MKWQJYNEKZKCSA-UHFFFAOYSA-N 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 229960003401 ramipril Drugs 0.000 description 1
- HDACQVRGBOVJII-JBDAPHQKSA-N ramipril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](C[C@@H]2CCC[C@@H]21)C(O)=O)CC1=CC=CC=C1 HDACQVRGBOVJII-JBDAPHQKSA-N 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 229940124617 receptor tyrosine kinase inhibitor Drugs 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000026313 regulation of carbohydrate metabolic process Effects 0.000 description 1
- 230000026729 regulation of glycogen biosynthetic process Effects 0.000 description 1
- 230000015801 regulation of glycogen metabolic process Effects 0.000 description 1
- 230000009712 regulation of translation Effects 0.000 description 1
- 239000002461 renin inhibitor Substances 0.000 description 1
- 229940086526 renin-inhibitors Drugs 0.000 description 1
- 229960002354 repaglinide Drugs 0.000 description 1
- 210000005000 reproductive tract Anatomy 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000029054 response to nutrient Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229960004586 rosiglitazone Drugs 0.000 description 1
- 229960000672 rosuvastatin Drugs 0.000 description 1
- BPRHUIZQVSMCRT-VEUZHWNKSA-N rosuvastatin Chemical compound CC(C)C1=NC(N(C)S(C)(=O)=O)=NC(C=2C=CC(F)=CC=2)=C1\C=C\[C@@H](O)C[C@@H](O)CC(O)=O BPRHUIZQVSMCRT-VEUZHWNKSA-N 0.000 description 1
- 229950001780 sampatrilat Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- QGJUIPDUBHWZPV-SGTAVMJGSA-N saxagliptin Chemical compound C1C(C2)CC(C3)CC2(O)CC13[C@H](N)C(=O)N1[C@H](C#N)C[C@@H]2C[C@@H]21 QGJUIPDUBHWZPV-SGTAVMJGSA-N 0.000 description 1
- 108010033693 saxagliptin Proteins 0.000 description 1
- 229960004937 saxagliptin Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000849 selective androgen receptor modulator Substances 0.000 description 1
- 229940095743 selective estrogen receptor modulator Drugs 0.000 description 1
- 239000000333 selective estrogen receptor modulator Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 229960004425 sibutramine Drugs 0.000 description 1
- UNAANXDKBXWMLN-UHFFFAOYSA-N sibutramine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CC(C)C)CCC1 UNAANXDKBXWMLN-UHFFFAOYSA-N 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 229910000367 silver sulfate Inorganic materials 0.000 description 1
- 229960002855 simvastatin Drugs 0.000 description 1
- 210000002027 skeletal muscle Anatomy 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 229960002370 sotalol Drugs 0.000 description 1
- ZBMZVLHSJCTVON-UHFFFAOYSA-N sotalol Chemical compound CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 ZBMZVLHSJCTVON-UHFFFAOYSA-N 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000004059 squalene synthase inhibitor Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- UZQBKCWYZBHBOW-YIPNQBBMSA-N terlakiren Chemical compound C([C@@H](C(=O)N[C@@H](CSC)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)C(=O)OC(C)C)NC(=O)N1CCOCC1)C1=CC=CC=C1 UZQBKCWYZBHBOW-YIPNQBBMSA-N 0.000 description 1
- 108010069247 terlakiren Proteins 0.000 description 1
- 229950003204 terlakiren Drugs 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- SASWSEQJAITMKS-JJNNLWIXSA-N tert-butyl (2s)-2-[[(2s)-1-[[(2s)-1-[[(4s,5s,7s)-5-hydroxy-2,8-dimethyl-7-[[(2s,3s)-3-methyl-1-oxo-1-(pyridin-2-ylmethylamino)pentan-2-yl]carbamoyl]nonan-4-yl]amino]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]-methylamino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]p Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)C[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC=1N=CC=CC=1)C(C)C)N(C)C(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H]1N(CCC1)C(=O)OC(C)(C)C)C1=CN=CN1 SASWSEQJAITMKS-JJNNLWIXSA-N 0.000 description 1
- 229960003604 testosterone Drugs 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 238000011285 therapeutic regimen Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 229940083085 thiazide derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 150000001467 thiazolidinediones Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- 125000000858 thiocyanato group Chemical group *SC#N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- LJJKNPQAGWVLDQ-SNVBAGLBSA-N thiorphan Chemical compound OC(=O)CNC(=O)[C@@H](CS)CC1=CC=CC=C1 LJJKNPQAGWVLDQ-SNVBAGLBSA-N 0.000 description 1
- 239000003868 thrombin inhibitor Substances 0.000 description 1
- 229960004605 timolol Drugs 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 229960004394 topiramate Drugs 0.000 description 1
- 229960005461 torasemide Drugs 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 229960002051 trandolapril Drugs 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000004951 trihalomethoxy group Chemical group 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 230000004222 uncontrolled growth Effects 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 229960001722 verapamil Drugs 0.000 description 1
- 108010002139 very low density lipoprotein triglyceride Proteins 0.000 description 1
- 229960001254 vildagliptin Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- ZXIBCJHYVWYIKI-PZJWPPBQSA-N ximelagatran Chemical compound C1([C@@H](NCC(=O)OCC)C(=O)N2[C@@H](CC2)C(=O)NCC=2C=CC(=CC=2)C(\N)=N\O)CCCCC1 ZXIBCJHYVWYIKI-PZJWPPBQSA-N 0.000 description 1
- 229960001522 ximelagatran Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/16—Drugs for disorders of the alimentary tract or the digestive system for liver or gallbladder disorders, e.g. hepatoprotective agents, cholagogues, litholytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/48—Drugs for disorders of the endocrine system of the pancreatic hormones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Obesity (AREA)
- Hematology (AREA)
- Endocrinology (AREA)
- Emergency Medicine (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Child & Adolescent Psychology (AREA)
- Gastroenterology & Hepatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201161448533P | 2011-03-02 | 2011-03-02 | |
| US201161448527P | 2011-03-02 | 2011-03-02 | |
| US61/448,533 | 2011-03-02 | ||
| US61/448,527 | 2011-03-02 | ||
| US201161449009P | 2011-03-03 | 2011-03-03 | |
| US61/449,009 | 2011-03-03 | ||
| PCT/US2012/027423 WO2012119046A2 (en) | 2011-03-02 | 2012-03-02 | Heterocyclic compounds for the inhibition of pask |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2012223232A1 AU2012223232A1 (en) | 2013-09-12 |
| AU2012223232B2 true AU2012223232B2 (en) | 2017-05-25 |
Family
ID=46758511
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2012223232A Ceased AU2012223232B2 (en) | 2011-03-02 | 2012-03-02 | Heterocyclic compounds for the inhibition of PASK |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US8912188B2 (cg-RX-API-DMAC7.html) |
| EP (1) | EP2681207B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP6139415B2 (cg-RX-API-DMAC7.html) |
| CN (1) | CN103459382B (cg-RX-API-DMAC7.html) |
| AU (1) | AU2012223232B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR112013022147A2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2828349C (cg-RX-API-DMAC7.html) |
| WO (1) | WO2012119046A2 (cg-RX-API-DMAC7.html) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP5696856B2 (ja) | 2009-09-03 | 2015-04-08 | バイオエナジェニックス | Paskの阻害用複素環式化合物 |
| CA2900303A1 (en) * | 2013-02-07 | 2014-08-14 | Merck Patent Gmbh | Substituted quinoxaline derivatives and their use as positive allosteric modulators of mglur4 |
| US9936700B2 (en) | 2013-10-23 | 2018-04-10 | Bayer Cropscience Aktiengesellschaft | Substituted quinoxaline derivatives as pest control agent |
| EP3131881A4 (en) | 2014-04-18 | 2017-09-06 | Millennium Pharmaceuticals, Inc. | Quinoxaline compounds and uses thereof |
| US10323018B2 (en) | 2015-01-20 | 2019-06-18 | Millennium Pharmaceuticals, Inc. | Quinazoline and quinoline compounds and uses thereof |
| EP3395803A1 (en) | 2017-04-28 | 2018-10-31 | Institut Pasteur | Imidazopyrazine derivatives, process for preparation thereof, and their uses as luciferins |
| CN107652278A (zh) * | 2017-08-09 | 2018-02-02 | 江苏工程职业技术学院 | 一种依帕列净的合成工艺 |
| CN112062687B (zh) * | 2020-09-02 | 2023-11-21 | 上海信谊万象药业股份有限公司 | 一种盐酸阿扎司琼中间体3-氨基-5-氯-2-羟基苯甲酸甲酯的合成方法 |
| CN115197155B (zh) * | 2022-07-25 | 2023-10-24 | 宝鸡文理学院 | 一种2-喹喔啉磺酸酯类化合物及其合成方法 |
| CR20250419A (es) | 2023-04-06 | 2025-10-07 | Pfizer | Compuestos de derivados de ácido indazol propiónico sustituidos y usos de estos |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20090082356A1 (en) * | 2005-08-26 | 2009-03-26 | Pascale Gaillard | Pyrazine Derivatives and Use as P13k Inhibitors |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH419399A (de) | 1962-07-18 | 1966-08-31 | Ciba Geigy | Verfahren zur Herstellung neuer Küpenfarbstoffe |
| HUT64023A (en) | 1991-03-22 | 1993-11-29 | Sandoz Ag | Process for producing aminoguanidine derivatives and pharmaceutical compositions comprising such compounds |
| US6331555B1 (en) | 1995-06-01 | 2001-12-18 | University Of California | Treatment of platelet derived growth factor related disorders such as cancers |
| WO1999042461A1 (en) * | 1998-02-23 | 1999-08-26 | Warner-Lambert Company | Substituted quinoxaline derivatives as interleukin-8 receptor antagonists |
| CO5150173A1 (es) | 1998-12-10 | 2002-04-29 | Novartis Ag | Compuestos n-(glicilo sustituido)-2-cianopirrolidinas inhibidores de peptidasa de dipeptidilo-iv (dpp-iv) los cuales son efectivos en el tratamiento de condiciones mediadas por la inhibicion de dpp-iv |
| AU3033500A (en) * | 1999-01-15 | 2000-08-01 | Agouron Pharmaceuticals, Inc. | Non-peptide glp-1 agonists |
| DE10013318A1 (de) | 2000-03-17 | 2001-09-20 | Merck Patent Gmbh | Formulierung enthaltend Chinoxalinderivate |
| FR2816940A1 (fr) | 2000-11-23 | 2002-05-24 | Lipha | Derives de 4-(biphenylcarbonylamino)-piperidine, compositions les contenant et leur utilisation |
| US6319679B1 (en) * | 2001-01-26 | 2001-11-20 | Board Of Regents, The University Of Texas System | PAS kinase |
| US7189724B2 (en) | 2003-04-15 | 2007-03-13 | Valeant Research And Development | Quinoxaline derivatives having antiviral activity |
| WO2005007099A2 (en) * | 2003-07-10 | 2005-01-27 | Imclone Systems Incorporated | Pkb inhibitors as anti-tumor agents |
| US20060276393A1 (en) | 2005-01-13 | 2006-12-07 | Sirtris Pharmaceuticals, Inc. | Novel compositions for preventing and treating neurodegenerative and blood coagulation disorders |
| WO2006079021A2 (en) | 2005-01-20 | 2006-07-27 | Sirtris Pharmaceuticals, Inc. | Use of sirtuin-activating compounds for treating flushing and drug induced weight gain |
| JP2008530111A (ja) | 2005-02-14 | 2008-08-07 | メルク エンド カムパニー インコーポレーテッド | Akt活性の阻害剤 |
| WO2006138418A2 (en) | 2005-06-14 | 2006-12-28 | President And Fellows Of Harvard College | Improvement of cognitive performance with sirtuin activators |
| CA2654735A1 (en) | 2006-06-08 | 2007-12-21 | University Of Utah Research Foundation | Pas kinase regulates energy homeostasis |
| CA2752150A1 (en) | 2009-02-11 | 2010-08-19 | Reaction Biology Corp. | Selective kinase inhibitors |
| RU2011140333A (ru) * | 2009-03-05 | 2013-04-10 | Астеллас Фарма Инк. | Хиноксалиновое соединение |
| CA2764026C (en) | 2009-06-12 | 2019-10-29 | Splicos | Compounds useful for treating aids |
| JP5696856B2 (ja) * | 2009-09-03 | 2015-04-08 | バイオエナジェニックス | Paskの阻害用複素環式化合物 |
| US9469615B2 (en) * | 2010-12-23 | 2016-10-18 | Merck Sharp & Dohme Corp. | Quinoxalines and AZA-quinoxalines as CRTH2 receptor modulators |
| BR112013017164B1 (pt) * | 2011-01-05 | 2021-05-04 | Bioenergenix | composto e composição farmacêutica |
| US8916561B2 (en) * | 2011-03-02 | 2014-12-23 | Bioenergenix, Llc | Substituted quinoxaline compounds for the inhibition of PASK |
-
2012
- 2012-03-02 AU AU2012223232A patent/AU2012223232B2/en not_active Ceased
- 2012-03-02 CA CA2828349A patent/CA2828349C/en active Active
- 2012-03-02 JP JP2013556883A patent/JP6139415B2/ja not_active Expired - Fee Related
- 2012-03-02 BR BR112013022147A patent/BR112013022147A2/pt not_active Application Discontinuation
- 2012-03-02 EP EP12751925.4A patent/EP2681207B1/en not_active Not-in-force
- 2012-03-02 US US13/410,650 patent/US8912188B2/en active Active
- 2012-03-02 WO PCT/US2012/027423 patent/WO2012119046A2/en not_active Ceased
- 2012-03-02 CN CN201280016906.1A patent/CN103459382B/zh not_active Expired - Fee Related
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20090082356A1 (en) * | 2005-08-26 | 2009-03-26 | Pascale Gaillard | Pyrazine Derivatives and Use as P13k Inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| AU2012223232A1 (en) | 2013-09-12 |
| US20120232056A1 (en) | 2012-09-13 |
| EP2681207B1 (en) | 2016-12-28 |
| JP6139415B2 (ja) | 2017-05-31 |
| NZ614610A (en) | 2014-08-29 |
| WO2012119046A2 (en) | 2012-09-07 |
| JP2014506933A (ja) | 2014-03-20 |
| US8912188B2 (en) | 2014-12-16 |
| WO2012119046A3 (en) | 2012-10-26 |
| EP2681207A2 (en) | 2014-01-08 |
| CA2828349A1 (en) | 2012-09-07 |
| CN103459382A (zh) | 2013-12-18 |
| CA2828349C (en) | 2019-05-21 |
| CN103459382B (zh) | 2016-06-29 |
| EP2681207A4 (en) | 2014-07-23 |
| BR112013022147A2 (pt) | 2017-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2012223232B2 (en) | Heterocyclic compounds for the inhibition of PASK | |
| DK2473504T3 (en) | Heterocyclic Compounds for Inhibition of Passover | |
| US10953012B2 (en) | Heterocyclic compounds for the inhibition of pask | |
| US10392389B2 (en) | Heterocyclic compounds for the inhibition of PASK | |
| AU2012204353B2 (en) | Heterocyclic compounds for the inhibition of PASK | |
| US11191765B2 (en) | Heterocyclic compounds for the inhibition of PASK | |
| AU2012204353A1 (en) | Heterocyclic compounds for the inhibition of PASK | |
| US8916561B2 (en) | Substituted quinoxaline compounds for the inhibition of PASK | |
| NZ614610B2 (en) | Heterocyclic compounds for the inhibition of pask |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FGA | Letters patent sealed or granted (standard patent) | ||
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |