AU2007252917C1 - Hydroxyphenyl derivatives and biological applications thereof - Google Patents
Hydroxyphenyl derivatives and biological applications thereof Download PDFInfo
- Publication number
- AU2007252917C1 AU2007252917C1 AU2007252917A AU2007252917A AU2007252917C1 AU 2007252917 C1 AU2007252917 C1 AU 2007252917C1 AU 2007252917 A AU2007252917 A AU 2007252917A AU 2007252917 A AU2007252917 A AU 2007252917A AU 2007252917 C1 AU2007252917 C1 AU 2007252917C1
- Authority
- AU
- Australia
- Prior art keywords
- mmol
- formula
- ethyl
- derivative
- fluoro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 125000004464 hydroxyphenyl group Chemical group 0.000 title claims abstract description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 29
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims description 250
- 238000000034 method Methods 0.000 claims description 170
- -1 20 Cl-C8alkyl Chemical group 0.000 claims description 100
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 87
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 66
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 230000008569 process Effects 0.000 claims description 18
- 229910003827 NRaRb Inorganic materials 0.000 claims description 17
- 125000001072 heteroaryl group Chemical group 0.000 claims description 17
- 241000588724 Escherichia coli Species 0.000 claims description 15
- 229910052731 fluorine Inorganic materials 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 15
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- 150000002367 halogens Chemical class 0.000 claims description 14
- 125000000623 heterocyclic group Chemical group 0.000 claims description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 13
- 208000015181 infectious disease Diseases 0.000 claims description 13
- 150000002989 phenols Chemical class 0.000 claims description 13
- 125000000304 alkynyl group Chemical group 0.000 claims description 12
- 125000001153 fluoro group Chemical group F* 0.000 claims description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims description 10
- 241000689227 Cora <basidiomycete fungus> Species 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 244000000010 microbial pathogen Species 0.000 claims description 9
- 229910052763 palladium Inorganic materials 0.000 claims description 9
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 claims description 8
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 7
- 241000223960 Plasmodium falciparum Species 0.000 claims description 7
- 239000003814 drug Substances 0.000 claims description 7
- 239000002841 Lewis acid Substances 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 150000007517 lewis acids Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 229940079593 drug Drugs 0.000 claims description 5
- 239000000376 reactant Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 201000008827 tuberculosis Diseases 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 150000002148 esters Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- VADKRMSMGWJZCF-UHFFFAOYSA-N 2-bromophenol Chemical compound OC1=CC=CC=C1Br VADKRMSMGWJZCF-UHFFFAOYSA-N 0.000 claims description 3
- 125000000815 N-oxide group Chemical group 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000002950 monocyclic group Chemical group 0.000 claims description 3
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 229910052702 rhenium Inorganic materials 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000004306 triazinyl group Chemical group 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 101100114697 Danio rerio cpeb1 gene Proteins 0.000 claims 1
- 125000002098 pyridazinyl group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 445
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 407
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 215
- 238000000746 purification Methods 0.000 description 179
- 235000019439 ethyl acetate Nutrition 0.000 description 148
- 229940093499 ethyl acetate Drugs 0.000 description 146
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 134
- 238000012746 preparative thin layer chromatography Methods 0.000 description 109
- 239000003921 oil Substances 0.000 description 104
- 235000019198 oils Nutrition 0.000 description 104
- 239000000243 solution Substances 0.000 description 96
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 91
- 238000006243 chemical reaction Methods 0.000 description 82
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 80
- 239000007787 solid Substances 0.000 description 78
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 77
- 239000000203 mixture Substances 0.000 description 75
- 238000005481 NMR spectroscopy Methods 0.000 description 73
- 229910052786 argon Inorganic materials 0.000 description 67
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 65
- 239000011541 reaction mixture Substances 0.000 description 64
- 239000011734 sodium Substances 0.000 description 61
- 239000000741 silica gel Substances 0.000 description 57
- 229910002027 silica gel Inorganic materials 0.000 description 57
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 56
- 239000012074 organic phase Substances 0.000 description 56
- PPXNHYNGMQBJPX-UHFFFAOYSA-N 6-chloro-2-(2-methoxy-4-propylphenoxy)pyridin-3-amine Chemical compound COC1=CC(CCC)=CC=C1OC1=NC(Cl)=CC=C1N PPXNHYNGMQBJPX-UHFFFAOYSA-N 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 38
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 37
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- CHWNEIVBYREQRF-UHFFFAOYSA-N 4-Ethyl-2-methoxyphenol Chemical compound CCC1=CC=C(O)C(OC)=C1 CHWNEIVBYREQRF-UHFFFAOYSA-N 0.000 description 28
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 27
- 229920006395 saturated elastomer Polymers 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 26
- 239000000047 product Substances 0.000 description 24
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 24
- XEFQLINVKFYRCS-UHFFFAOYSA-N Triclosan Chemical compound OC1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1Cl XEFQLINVKFYRCS-UHFFFAOYSA-N 0.000 description 22
- 238000003756 stirring Methods 0.000 description 22
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 19
- 229960003500 triclosan Drugs 0.000 description 19
- ODVLIMANKCZDOT-UHFFFAOYSA-N 2-fluoro-6-(2-methoxy-4-propylphenoxy)pyridine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=CC(F)=N1 ODVLIMANKCZDOT-UHFFFAOYSA-N 0.000 description 18
- NJIAKRXOOKQTSD-UHFFFAOYSA-N 4-ethyl-2-methoxy-1-[4-nitro-2-(trifluoromethyl)phenoxy]benzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1C(F)(F)F NJIAKRXOOKQTSD-UHFFFAOYSA-N 0.000 description 18
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 16
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- 238000010792 warming Methods 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000012267 brine Substances 0.000 description 12
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- 238000004809 thin layer chromatography Methods 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 125000003342 alkenyl group Chemical group 0.000 description 11
- 230000000844 anti-bacterial effect Effects 0.000 description 11
- 230000001580 bacterial effect Effects 0.000 description 11
- 238000004587 chromatography analysis Methods 0.000 description 11
- MHVSUDUCUYPKHY-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(N)C=C1F MHVSUDUCUYPKHY-UHFFFAOYSA-N 0.000 description 10
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 102000004190 Enzymes Human genes 0.000 description 10
- 108090000790 Enzymes Proteins 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- 229960004132 diethyl ether Drugs 0.000 description 9
- DNTHMWUMRGOJRY-UHFFFAOYSA-N 1-fluoro-4-nitro-2-(trifluoromethyl)benzene Chemical group [O-][N+](=O)C1=CC=C(F)C(C(F)(F)F)=C1 DNTHMWUMRGOJRY-UHFFFAOYSA-N 0.000 description 8
- MBTGBRYMJKYYOE-UHFFFAOYSA-N 2,6-difluoropyridine Chemical compound FC1=CC=CC(F)=N1 MBTGBRYMJKYYOE-UHFFFAOYSA-N 0.000 description 8
- IJVFHCSUEBAAOZ-UHFFFAOYSA-N 3-fluoro-2-nitropyridine Chemical compound [O-][N+](=O)C1=NC=CC=C1F IJVFHCSUEBAAOZ-UHFFFAOYSA-N 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- 241000894006 Bacteria Species 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- 235000009518 sodium iodide Nutrition 0.000 description 8
- XHUBSJRBOQIZNI-UHFFFAOYSA-N (4-Hydroxy-3-methoxyphenyl)ethanol Chemical compound COC1=CC(CCO)=CC=C1O XHUBSJRBOQIZNI-UHFFFAOYSA-N 0.000 description 7
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 7
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- 238000010791 quenching Methods 0.000 description 7
- 230000000171 quenching effect Effects 0.000 description 7
- 238000005406 washing Methods 0.000 description 7
- 238000005160 1H NMR spectroscopy Methods 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- PXIKRTCSSLJURC-UHFFFAOYSA-N Dihydroeugenol Chemical compound CCCC1=CC=C(O)C(OC)=C1 PXIKRTCSSLJURC-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 241000191967 Staphylococcus aureus Species 0.000 description 6
- 125000003368 amide group Chemical group 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000000338 in vitro Methods 0.000 description 6
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 6
- WVPGMYXWAYHCST-UHFFFAOYSA-N 4-ethyl-2-phenylmethoxyphenol Chemical compound CCC1=CC=C(O)C(OCC=2C=CC=CC=2)=C1 WVPGMYXWAYHCST-UHFFFAOYSA-N 0.000 description 5
- ZUNDLPMNAZXQES-UHFFFAOYSA-N 5-bromo-2-(2-methoxy-4-propylphenoxy)pyridine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=C(Br)C=N1 ZUNDLPMNAZXQES-UHFFFAOYSA-N 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 5
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 5
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 5
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 5
- 108040007096 enoyl-[acyl-carrier-protein] reductase activity proteins Proteins 0.000 description 5
- 125000003709 fluoroalkyl group Chemical group 0.000 description 5
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- RUBQQRMAWLSCCJ-UHFFFAOYSA-N 1,2-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1 RUBQQRMAWLSCCJ-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- TWNRQWPXZZBWJA-UHFFFAOYSA-N 2-(2,6-difluoropyridin-4-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC(F)=NC(F)=C1 TWNRQWPXZZBWJA-UHFFFAOYSA-N 0.000 description 4
- FQBXPJKQAGLNJO-UHFFFAOYSA-N 2-(4,6-difluoropyridin-2-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC(F)=CC(F)=N1 FQBXPJKQAGLNJO-UHFFFAOYSA-N 0.000 description 4
- WZNVXMTUSPSPNC-UHFFFAOYSA-N 2-(4-ethyl-2-methoxyphenoxy)-6-fluoropyridine Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CC(F)=N1 WZNVXMTUSPSPNC-UHFFFAOYSA-N 0.000 description 4
- QLPLEZZSWXRBSZ-UHFFFAOYSA-N 2-(6-aminopyridin-3-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(N)N=C1 QLPLEZZSWXRBSZ-UHFFFAOYSA-N 0.000 description 4
- BCIFAMVLBCSRLK-UHFFFAOYSA-N 2-[4-(chloromethyl)-2-methoxyphenoxy]-6-fluoropyridine Chemical compound COC1=CC(CCl)=CC=C1OC1=CC=CC(F)=N1 BCIFAMVLBCSRLK-UHFFFAOYSA-N 0.000 description 4
- USONFEVIKSYSEM-UHFFFAOYSA-N 3-(4-ethyl-2-methoxyphenoxy)-2-nitropyridine Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CN=C1[N+]([O-])=O USONFEVIKSYSEM-UHFFFAOYSA-N 0.000 description 4
- REMSKULEXXEXHB-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-fluorobenzenesulfonyl chloride Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(Cl)(=O)=O)C=C1F REMSKULEXXEXHB-UHFFFAOYSA-N 0.000 description 4
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 4
- RSSTZQXYNAGANY-UHFFFAOYSA-N 5-ethyl-2-(6-fluoropyridin-2-yl)oxyphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=CC(F)=N1 RSSTZQXYNAGANY-UHFFFAOYSA-N 0.000 description 4
- 101150005343 INHA gene Proteins 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- OTJZCIYGRUNXTP-UHFFFAOYSA-N but-3-yn-1-ol Chemical compound OCCC#C OTJZCIYGRUNXTP-UHFFFAOYSA-N 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- DAKZISABEDGGSV-UHFFFAOYSA-N n-(2-aminoethyl)acetamide Chemical compound CC(=O)NCCN DAKZISABEDGGSV-UHFFFAOYSA-N 0.000 description 4
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- WXLLODVSYDIWMG-UHFFFAOYSA-N 2-(4-amino-2-fluorophenoxy)-5-(2-thiophen-3-ylethyl)phenol Chemical compound FC1=CC(N)=CC=C1OC(C(=C1)O)=CC=C1CCC1=CSC=C1 WXLLODVSYDIWMG-UHFFFAOYSA-N 0.000 description 3
- RMKYADNPZYKHSG-UHFFFAOYSA-N 2-(4-aminophenoxy)-5-ethyl-4-fluorophenol Chemical compound C1=C(F)C(CC)=CC(O)=C1OC1=CC=C(N)C=C1 RMKYADNPZYKHSG-UHFFFAOYSA-N 0.000 description 3
- VBJXTQISHZIZAA-UHFFFAOYSA-N 2-(4-bromo-5-fluoro-2-methoxyphenoxy)-6-fluoropyridine Chemical compound COC1=CC(Br)=C(F)C=C1OC1=CC=CC(F)=N1 VBJXTQISHZIZAA-UHFFFAOYSA-N 0.000 description 3
- HVZPDTCKLCBJIQ-UHFFFAOYSA-N 2-(4-ethyl-2-methoxyphenoxy)aniline Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CC=C1N HVZPDTCKLCBJIQ-UHFFFAOYSA-N 0.000 description 3
- NMWXHOPAMOMVFD-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(hydroxymethyl)phenol Chemical compound OC1=CC(CO)=CC=C1OC1=CC=CC(F)=N1 NMWXHOPAMOMVFD-UHFFFAOYSA-N 0.000 description 3
- NKLGLROSPKRAOG-UHFFFAOYSA-N 2-phenylmethoxy-4-propylphenol Chemical compound CCCC1=CC=C(O)C(OCC=2C=CC=CC=2)=C1 NKLGLROSPKRAOG-UHFFFAOYSA-N 0.000 description 3
- VAFFBCPXJUYWID-UHFFFAOYSA-N 3-(4-ethyl-5-fluoro-2-methoxyphenoxy)pyridin-2-amine Chemical compound C1=C(F)C(CC)=CC(OC)=C1OC1=CC=CN=C1N VAFFBCPXJUYWID-UHFFFAOYSA-N 0.000 description 3
- BGKABGGFJSTLIL-UHFFFAOYSA-N 3-(hydroxymethyl)-1,3-oxazolidin-2-one Chemical compound OCN1CCOC1=O BGKABGGFJSTLIL-UHFFFAOYSA-N 0.000 description 3
- QZKVGBAURDVFFN-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-2-fluoroaniline Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(N)C(F)=C1 QZKVGBAURDVFFN-UHFFFAOYSA-N 0.000 description 3
- DYAGYHAGWHVKBO-UHFFFAOYSA-N 4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroaniline Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(N)C=C1F DYAGYHAGWHVKBO-UHFFFAOYSA-N 0.000 description 3
- IVNVIMUTQIKSIZ-UHFFFAOYSA-N 4-ethyl-1-(2-fluoro-4-nitrophenoxy)-2-methoxybenzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1F IVNVIMUTQIKSIZ-UHFFFAOYSA-N 0.000 description 3
- JXOSRSXQLARECA-UHFFFAOYSA-N 4-ethyl-2-methoxy-1-(4-methylsulfonylphenoxy)benzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(C)(=O)=O)C=C1 JXOSRSXQLARECA-UHFFFAOYSA-N 0.000 description 3
- JZQBYSQZZGJPGE-UHFFFAOYSA-N 5-(aminomethyl)-3-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]-1,3-oxazolidin-2-one Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(N2C(OC(CN)C2)=O)C=C1F JZQBYSQZZGJPGE-UHFFFAOYSA-N 0.000 description 3
- BJEMGBNLIALWCL-UHFFFAOYSA-N 5-ethyl-4-fluoro-2-(2-fluoropyridin-3-yl)oxyphenol Chemical compound C1=C(F)C(CC)=CC(O)=C1OC1=CC=CN=C1F BJEMGBNLIALWCL-UHFFFAOYSA-N 0.000 description 3
- 229910015845 BBr3 Inorganic materials 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- BAWFJGJZGIEFAR-NNYOXOHSSA-O NAD(+) Chemical compound NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-O 0.000 description 3
- 206010041925 Staphylococcal infections Diseases 0.000 description 3
- 108010059993 Vancomycin Proteins 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- 229940125773 compound 10 Drugs 0.000 description 3
- KFWWCMJSYSSPSK-PAXLJYGASA-N crotonoyl-CoA Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)/C=C/C)O[C@H]1N1C2=NC=NC(N)=C2N=C1 KFWWCMJSYSSPSK-PAXLJYGASA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000002037 dichloromethane fraction Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 125000004991 fluoroalkenyl group Chemical group 0.000 description 3
- 125000001207 fluorophenyl group Chemical group 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 208000015688 methicillin-resistant staphylococcus aureus infectious disease Diseases 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- CPLVBGSKLGNUPL-UHFFFAOYSA-N n-[5-(2-hydroxy-4-propylphenoxy)pyridin-2-yl]methanesulfonamide Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(NS(C)(=O)=O)N=C1 CPLVBGSKLGNUPL-UHFFFAOYSA-N 0.000 description 3
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 3
- BOPGDPNILDQYTO-NNYOXOHSSA-N nicotinamide-adenine dinucleotide Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NNYOXOHSSA-N 0.000 description 3
- 244000045947 parasite Species 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 238000002953 preparative HPLC Methods 0.000 description 3
- 229910052701 rubidium Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- GJJYYMXBCYYXPQ-UHFFFAOYSA-N tert-butyl 2-oxopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC1=O GJJYYMXBCYYXPQ-UHFFFAOYSA-N 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 3
- 229960003165 vancomycin Drugs 0.000 description 3
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 description 3
- MYPYJXKWCTUITO-LYRMYLQWSA-O vancomycin(1+) Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C([O-])=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)[NH2+]C)[C@H]1C[C@](C)([NH3+])[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-O 0.000 description 3
- FVMURRACHZYJKS-UHFFFAOYSA-N (2-methoxy-4-propylphenyl) 4-methylbenzenesulfonate Chemical compound COC1=CC(CCC)=CC=C1OS(=O)(=O)C1=CC=C(C)C=C1 FVMURRACHZYJKS-UHFFFAOYSA-N 0.000 description 2
- KNXHQETWZXVXKL-UHFFFAOYSA-N (2-phenylmethoxy-4-propylphenyl) 4-methylbenzenesulfonate Chemical compound C=1C=CC=CC=1COC1=CC(CCC)=CC=C1OS(=O)(=O)C1=CC=C(C)C=C1 KNXHQETWZXVXKL-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- VWJSSJFLXRMYNV-UHFFFAOYSA-N 1-(3,4-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(F)C(F)=C1 VWJSSJFLXRMYNV-UHFFFAOYSA-N 0.000 description 2
- QLOUFQYUQSBGGE-UHFFFAOYSA-N 1-(4-bromo-2-methoxyphenoxy)-2-fluoro-4-nitrobenzene Chemical compound COC1=CC(Br)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1F QLOUFQYUQSBGGE-UHFFFAOYSA-N 0.000 description 2
- UFOMQGHWQUNUIW-UHFFFAOYSA-N 1-[4-(4-ethyl-2-hydroxyphenoxy)phenyl]-4-hydroxybutan-1-one Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(C(=O)CCCO)C=C1 UFOMQGHWQUNUIW-UHFFFAOYSA-N 0.000 description 2
- OXVJACPXRPKGLO-UHFFFAOYSA-N 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]ethanone Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(C(C)=O)C=C1F OXVJACPXRPKGLO-UHFFFAOYSA-N 0.000 description 2
- MKRFLGVXWMVNLR-UHFFFAOYSA-N 1-ethyl-3-(5-fluoro-2-nitrophenoxy)-2-methoxybenzene Chemical compound C(C)C=1C(=C(C=CC1)OC1=C(C=CC(=C1)F)[N+](=O)[O-])OC MKRFLGVXWMVNLR-UHFFFAOYSA-N 0.000 description 2
- CULMPCHJVWRTIE-UHFFFAOYSA-N 2,3-difluoro-4-(2-methoxy-4-propylphenoxy)pyridine Chemical compound FC=1C(=NC=CC1OC1=C(C=C(C=C1)CCC)OC)F CULMPCHJVWRTIE-UHFFFAOYSA-N 0.000 description 2
- HJCOKLCBQPFJLZ-UHFFFAOYSA-N 2,4-difluoro-6-(2-methoxy-4-propylphenoxy)pyridine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC(F)=CC(F)=N1 HJCOKLCBQPFJLZ-UHFFFAOYSA-N 0.000 description 2
- GSLVEXPADWBUAC-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)ethanesulfonic acid Chemical compound C1=CC=C2C(=O)N(CCS(=O)(=O)O)C(=O)C2=C1 GSLVEXPADWBUAC-UHFFFAOYSA-N 0.000 description 2
- LAEISEHYGWIGTO-UHFFFAOYSA-N 2-(2-amino-5-fluorophenoxy)-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC(F)=CC=C1N LAEISEHYGWIGTO-UHFFFAOYSA-N 0.000 description 2
- XPTHLTINAHWVCE-UHFFFAOYSA-N 2-(2-amino-5-methylphenoxy)-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC(C)=CC=C1N XPTHLTINAHWVCE-UHFFFAOYSA-N 0.000 description 2
- ABEBAVNUESLUEV-UHFFFAOYSA-N 2-(2-aminophenoxy)-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=CC=C1N ABEBAVNUESLUEV-UHFFFAOYSA-N 0.000 description 2
- MRIHADBFHMLZBI-UHFFFAOYSA-N 2-(2-aminopyridin-3-yl)oxy-5-ethyl-4-fluorophenol Chemical compound C1=C(F)C(CC)=CC(O)=C1OC1=CC=CN=C1N MRIHADBFHMLZBI-UHFFFAOYSA-N 0.000 description 2
- BXHSTSGJOUBJBD-UHFFFAOYSA-N 2-(2-aminopyridin-3-yl)oxy-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=CN=C1N BXHSTSGJOUBJBD-UHFFFAOYSA-N 0.000 description 2
- VKJCJJYNVIYVQR-UHFFFAOYSA-N 2-(3-bromopropyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCBr)C(=O)C2=C1 VKJCJJYNVIYVQR-UHFFFAOYSA-N 0.000 description 2
- ASLCUUVPSSTCSF-UHFFFAOYSA-N 2-(4-amino-2-fluorophenoxy)-5-(2-pyridin-2-ylethyl)phenol Chemical compound FC1=CC(N)=CC=C1OC(C(=C1)O)=CC=C1CCC1=CC=CC=N1 ASLCUUVPSSTCSF-UHFFFAOYSA-N 0.000 description 2
- OWEKCWUGFMPYAZ-OWOJBTEDSA-N 2-(4-amino-2-fluorophenoxy)-5-[(e)-2-thiophen-3-ylethenyl]phenol Chemical compound FC1=CC(N)=CC=C1OC(C(=C1)O)=CC=C1\C=C\C1=CSC=C1 OWEKCWUGFMPYAZ-OWOJBTEDSA-N 0.000 description 2
- LFEMAULBXIVOMM-UHFFFAOYSA-N 2-(4-amino-2-fluorophenoxy)-5-bromophenol Chemical compound FC1=CC(N)=CC=C1OC1=CC=C(Br)C=C1O LFEMAULBXIVOMM-UHFFFAOYSA-N 0.000 description 2
- JJYLEWUHUDEFPP-UHFFFAOYSA-N 2-(4-bromo-2-methoxyphenoxy)-6-fluoropyridine Chemical compound COC1=CC(Br)=CC=C1OC1=CC=CC(F)=N1 JJYLEWUHUDEFPP-UHFFFAOYSA-N 0.000 description 2
- HBZDPJYJJKWHCL-UHFFFAOYSA-N 2-(4-chloro-2-methoxyphenoxy)-6-fluoropyridine Chemical compound COC1=CC(Cl)=CC=C1OC1=CC=CC(F)=N1 HBZDPJYJJKWHCL-UHFFFAOYSA-N 0.000 description 2
- OOAUFEFUYYMIJS-UHFFFAOYSA-N 2-(4-ethyl-2-hydroxyphenyl)-4-methylbenzenesulfonic acid Chemical compound OC1=CC(CC)=CC=C1C1=CC(C)=CC=C1S(O)(=O)=O OOAUFEFUYYMIJS-UHFFFAOYSA-N 0.000 description 2
- MXLGQEJYWNJSPI-UHFFFAOYSA-N 2-(4-ethyl-2-methoxyphenoxy)-4-fluoroaniline Chemical compound COC1=CC(CC)=CC=C1OC1=CC(F)=CC=C1N MXLGQEJYWNJSPI-UHFFFAOYSA-N 0.000 description 2
- RFHFKMXQXLZCBE-UHFFFAOYSA-N 2-(4-ethyl-2-methoxyphenoxy)-n-methylaniline Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CC=C1NC RFHFKMXQXLZCBE-UHFFFAOYSA-N 0.000 description 2
- HARVXWKSWATTKD-UHFFFAOYSA-N 2-(4-ethyl-2-phenylmethoxyphenoxy)-6-fluoropyridine Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=CC(F)=N1 HARVXWKSWATTKD-UHFFFAOYSA-N 0.000 description 2
- OYJXBTQQZHDDTG-UHFFFAOYSA-N 2-(4-methoxyphenoxy)-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(OC)C=C1 OYJXBTQQZHDDTG-UHFFFAOYSA-N 0.000 description 2
- DYPBADKSWZKSKV-UHFFFAOYSA-N 2-(6-aminopyridin-2-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=CC(N)=N1 DYPBADKSWZKSKV-UHFFFAOYSA-N 0.000 description 2
- LZRNEXKMXMEJNB-UHFFFAOYSA-N 2-(6-chloropyridin-2-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=CC(Cl)=N1 LZRNEXKMXMEJNB-UHFFFAOYSA-N 0.000 description 2
- UVOZXUYMVQUIQP-UHFFFAOYSA-N 2-(6-ethoxypyridin-2-yl)oxy-5-ethylphenol Chemical compound CCOC1=CC=CC(OC=2C(=CC(CC)=CC=2)O)=N1 UVOZXUYMVQUIQP-UHFFFAOYSA-N 0.000 description 2
- MKICFIVNGGQTBK-UHFFFAOYSA-N 2-(6-ethoxypyridin-3-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(OCC)N=C1 MKICFIVNGGQTBK-UHFFFAOYSA-N 0.000 description 2
- PKNAJACOEMUPCS-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(1,2,2-trifluoroethenyl)phenol Chemical compound OC1=CC(C(F)=C(F)F)=CC=C1OC1=CC=CC(F)=N1 PKNAJACOEMUPCS-UHFFFAOYSA-N 0.000 description 2
- PHBUBTHGFVZEOZ-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(2-methylpropyl)phenol Chemical compound OC1=CC(CC(C)C)=CC=C1OC1=CC=CC(F)=N1 PHBUBTHGFVZEOZ-UHFFFAOYSA-N 0.000 description 2
- LGOGZZGHLJYOKZ-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(4-methylphenyl)phenol Chemical compound C1=CC(C)=CC=C1C(C=C1O)=CC=C1OC1=CC=CC(F)=N1 LGOGZZGHLJYOKZ-UHFFFAOYSA-N 0.000 description 2
- UCPHRFVYJFZNLL-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-methylphenol Chemical compound OC1=CC(C)=CC=C1OC1=CC=CC(F)=N1 UCPHRFVYJFZNLL-UHFFFAOYSA-N 0.000 description 2
- AWZKYZSRHHWFEZ-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=CC(F)=N1 AWZKYZSRHHWFEZ-UHFFFAOYSA-N 0.000 description 2
- PETRWTHZSKVLRE-UHFFFAOYSA-N 2-Methoxy-4-methylphenol Chemical compound COC1=CC(C)=CC=C1O PETRWTHZSKVLRE-UHFFFAOYSA-N 0.000 description 2
- OPZNVUYGBCFXQS-UHFFFAOYSA-N 2-[2-[4-(2-fluoro-4-nitrophenoxy)-3-methoxyphenyl]ethynyl]pyridine Chemical compound COC1=CC(C#CC=2N=CC=CC=2)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1F OPZNVUYGBCFXQS-UHFFFAOYSA-N 0.000 description 2
- XYSGLNYQDHQLJP-UHFFFAOYSA-N 2-[2-[4-(4-ethyl-2-methoxyphenoxy)phenyl]sulfonylethyl]-1,3-dioxolane Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)CCC2OCCO2)C=C1 XYSGLNYQDHQLJP-UHFFFAOYSA-N 0.000 description 2
- LPCKZUBMCNSMAD-UHFFFAOYSA-N 2-[3-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenoxy]propyl]isoindole-1,3-dione Chemical compound COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1OCCCN1C(=O)C2=CC=CC=C2C1=O LPCKZUBMCNSMAD-UHFFFAOYSA-N 0.000 description 2
- RDXBSTMFXUAWQW-UHFFFAOYSA-N 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluorophenoxy]-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(N2S(CCC2)(=O)=O)C=C1F RDXBSTMFXUAWQW-UHFFFAOYSA-N 0.000 description 2
- QMKIXZJTFBAAIV-UHFFFAOYSA-N 2-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]-1,2-thiazolidine 1,1-dioxide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(N2S(CCC2)(=O)=O)C=C1F QMKIXZJTFBAAIV-UHFFFAOYSA-N 0.000 description 2
- IKMAUMZJODSBSK-UHFFFAOYSA-N 2-[4-amino-2-(trifluoromethyl)phenoxy]-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(N)C=C1C(F)(F)F IKMAUMZJODSBSK-UHFFFAOYSA-N 0.000 description 2
- QBXRUGDYARTZMX-UHFFFAOYSA-N 2-[6-(butylamino)pyridin-2-yl]oxy-5-ethylphenol Chemical compound CCCCNC1=CC=CC(OC=2C(=CC(CC)=CC=2)O)=N1 QBXRUGDYARTZMX-UHFFFAOYSA-N 0.000 description 2
- XIIWPEJXPBDQLN-UHFFFAOYSA-N 2-amino-n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]ethanesulfonamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(NS(=O)(=O)CCN)C=C1F XIIWPEJXPBDQLN-UHFFFAOYSA-N 0.000 description 2
- ZYJAKBGLJOQZGF-UHFFFAOYSA-N 2-chloro-6-(2-methoxy-4-propylphenoxy)pyridin-3-amine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=C(N)C(Cl)=N1 ZYJAKBGLJOQZGF-UHFFFAOYSA-N 0.000 description 2
- RWGFBIFSTUXNAT-UHFFFAOYSA-N 2-chloro-6-(2-methoxy-4-propylphenoxy)pyridine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=CC(Cl)=N1 RWGFBIFSTUXNAT-UHFFFAOYSA-N 0.000 description 2
- RLUVQFAWFVTRKT-UHFFFAOYSA-N 2-ethoxy-6-(4-ethyl-2-methoxyphenoxy)pyridine Chemical compound CCOC1=CC=CC(OC=2C(=CC(CC)=CC=2)OC)=N1 RLUVQFAWFVTRKT-UHFFFAOYSA-N 0.000 description 2
- RTVYQNFCJHPRDV-UHFFFAOYSA-N 2-fluoro-6-(2-methoxy-4-methylphenoxy)pyridine Chemical compound COC1=CC(C)=CC=C1OC1=CC=CC(F)=N1 RTVYQNFCJHPRDV-UHFFFAOYSA-N 0.000 description 2
- VPWMKYIAUAXVNO-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-(2,2,2-trifluoroethyl)phenoxy]pyridine Chemical compound COC1=CC(CC(F)(F)F)=CC=C1OC1=CC=CC(F)=N1 VPWMKYIAUAXVNO-UHFFFAOYSA-N 0.000 description 2
- WWEYIFHKWPDHMT-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-(2-methylpropyl)phenoxy]pyridine Chemical compound COC1=CC(CC(C)C)=CC=C1OC1=CC=CC(F)=N1 WWEYIFHKWPDHMT-UHFFFAOYSA-N 0.000 description 2
- NTGFQWWXLCHULU-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-(4-methylphenyl)phenoxy]pyridine Chemical compound COC1=CC(C=2C=CC(C)=CC=2)=CC=C1OC1=CC=CC(F)=N1 NTGFQWWXLCHULU-UHFFFAOYSA-N 0.000 description 2
- WOLFPZFNTWSFIF-UHFFFAOYSA-N 2-fluoro-6-[4-[(3-fluoropyridin-4-yl)methyl]-2-methoxyphenoxy]pyridine Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(OC)=CC=1CC1=CC=NC=C1F WOLFPZFNTWSFIF-UHFFFAOYSA-N 0.000 description 2
- WFLBWYLZCQOPCA-UHFFFAOYSA-N 2-fluorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1F WFLBWYLZCQOPCA-UHFFFAOYSA-N 0.000 description 2
- LCHYEKKJCUJAKN-UHFFFAOYSA-N 2-propylphenol Chemical compound CCCC1=CC=CC=C1O LCHYEKKJCUJAKN-UHFFFAOYSA-N 0.000 description 2
- MUFKOXUVQXHNHJ-UHFFFAOYSA-N 3-(1,3-dioxan-2-yl)-1-(4-fluorophenyl)propan-1-one Chemical compound C1=CC(F)=CC=C1C(=O)CCC1OCCCO1 MUFKOXUVQXHNHJ-UHFFFAOYSA-N 0.000 description 2
- CJZIHLGYCDVKIN-UHFFFAOYSA-N 3-(2-methoxy-4-propylphenoxy)-2-nitropyridine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=CN=C1[N+]([O-])=O CJZIHLGYCDVKIN-UHFFFAOYSA-N 0.000 description 2
- JSFCWWUQLORGHX-UHFFFAOYSA-N 3-(4-bromo-5-fluoro-2-methoxyphenoxy)-2-nitropyridine Chemical compound COC1=CC(Br)=C(F)C=C1OC1=CC=CN=C1[N+]([O-])=O JSFCWWUQLORGHX-UHFFFAOYSA-N 0.000 description 2
- MFVSBUFYUCADSG-UHFFFAOYSA-N 3-(4-ethenyl-5-fluoro-2-methoxyphenoxy)-2-nitropyridine Chemical compound COC1=CC(C=C)=C(F)C=C1OC1=CC=CN=C1[N+]([O-])=O MFVSBUFYUCADSG-UHFFFAOYSA-N 0.000 description 2
- ZFLMBQSKMXMSCC-UHFFFAOYSA-N 3-(4-ethyl-5-fluoro-2-methoxyphenoxy)-1h-pyridin-2-one Chemical compound C1=C(F)C(CC)=CC(OC)=C1OC1=CC=CN=C1O ZFLMBQSKMXMSCC-UHFFFAOYSA-N 0.000 description 2
- RNSVHYKUWXBUHV-UHFFFAOYSA-N 3-(4-ethyl-5-fluoro-2-methoxyphenoxy)-2-fluoropyridine Chemical compound C1=C(F)C(CC)=CC(OC)=C1OC1=CC=CN=C1F RNSVHYKUWXBUHV-UHFFFAOYSA-N 0.000 description 2
- LBABHUGBZAKOCV-UHFFFAOYSA-N 3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propan-1-ol Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(NCCCO)C=C1F LBABHUGBZAKOCV-UHFFFAOYSA-N 0.000 description 2
- CELKOWQJPVJKIL-UHFFFAOYSA-N 3-fluoropyridine Chemical compound FC1=CC=CN=C1 CELKOWQJPVJKIL-UHFFFAOYSA-N 0.000 description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- ZMKRHESYQHCTQD-UHFFFAOYSA-N 4-(4-bromo-2-methoxyphenoxy)-3-fluoroaniline Chemical compound COC1=CC(Br)=CC=C1OC1=CC=C(N)C=C1F ZMKRHESYQHCTQD-UHFFFAOYSA-N 0.000 description 2
- MPIFKQHADMZLTM-UHFFFAOYSA-N 4-(4-ethyl-2-hydroxyphenoxy)-3-fluoro-n-(2-hydroxyethyl)benzenesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)NCCO)C=C1F MPIFKQHADMZLTM-UHFFFAOYSA-N 0.000 description 2
- VHLDHRMEOAKVKF-UHFFFAOYSA-N 4-(4-ethyl-2-hydroxyphenoxy)-3-fluoro-n-(3-imidazol-1-ylpropyl)benzenesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)NCCCN2C=NC=C2)C=C1F VHLDHRMEOAKVKF-UHFFFAOYSA-N 0.000 description 2
- ONYTVOGOFXRFDT-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-fluoro-n-propylaniline Chemical compound FC1=CC(NCCC)=CC=C1OC1=CC=C(CC)C=C1OC ONYTVOGOFXRFDT-UHFFFAOYSA-N 0.000 description 2
- ODOYIMKTTVHFHZ-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenol Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(O)C=C1F ODOYIMKTTVHFHZ-UHFFFAOYSA-N 0.000 description 2
- OLRJIFWTGFGNJC-UHFFFAOYSA-N 4-(4-ethyl-5-fluoro-2-methoxyphenoxy)aniline Chemical compound C1=C(F)C(CC)=CC(OC)=C1OC1=CC=C(N)C=C1 OLRJIFWTGFGNJC-UHFFFAOYSA-N 0.000 description 2
- ODEPZHGWGGUZBI-UHFFFAOYSA-N 4-(6-fluoropyridin-2-yl)oxy-3-hydroxybenzaldehyde Chemical compound OC1=CC(C=O)=CC=C1OC1=CC=CC(F)=N1 ODEPZHGWGGUZBI-UHFFFAOYSA-N 0.000 description 2
- QJJDETZATYNYRP-UHFFFAOYSA-N 4-(6-fluoropyridin-2-yl)oxy-3-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1OC1=CC=CC(F)=N1 QJJDETZATYNYRP-UHFFFAOYSA-N 0.000 description 2
- NMPWZTZHCGECDO-UHFFFAOYSA-N 4-[4-(4-ethyl-2-hydroxyphenoxy)phenyl]-4-oxobutanal Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(C(=O)CCC=O)C=C1 NMPWZTZHCGECDO-UHFFFAOYSA-N 0.000 description 2
- LPNROGKTVLTWNV-UHFFFAOYSA-N 4-[6-(2-methoxy-4-propylphenoxy)pyridin-3-yl]but-3-yn-1-ol Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=C(C#CCCO)C=N1 LPNROGKTVLTWNV-UHFFFAOYSA-N 0.000 description 2
- BJNIUDHOXUKBCY-UHFFFAOYSA-N 4-bromo-5-fluoro-2-methoxyphenol Chemical compound COC1=CC(Br)=C(F)C=C1O BJNIUDHOXUKBCY-UHFFFAOYSA-N 0.000 description 2
- MYIJROLRNWAPEO-UHFFFAOYSA-N 4-ethyl-1-(2-fluoro-4-methylsulfonylphenoxy)-2-methoxybenzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(C)(=O)=O)C=C1F MYIJROLRNWAPEO-UHFFFAOYSA-N 0.000 description 2
- UOAUAKBMPXUQOX-UHFFFAOYSA-N 4-ethyl-1-(2-fluoro-4-nitrophenoxy)-2-phenylmethoxybenzene Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1F UOAUAKBMPXUQOX-UHFFFAOYSA-N 0.000 description 2
- QIHFYGIKDHTIAN-UHFFFAOYSA-N 4-ethyl-1-(3-fluoro-4-nitrophenoxy)-2-methoxybenzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C([N+]([O-])=O)C(F)=C1 QIHFYGIKDHTIAN-UHFFFAOYSA-N 0.000 description 2
- GILGMRMLUFSIQC-UHFFFAOYSA-N 4-ethyl-2-methoxy-1-(2-nitrophenoxy)benzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CC=C1[N+]([O-])=O GILGMRMLUFSIQC-UHFFFAOYSA-N 0.000 description 2
- AZRRZGIBBLWSSQ-UHFFFAOYSA-N 4-ethyl-7-phenyl-3,5-diazabicyclo[2.2.2]octane-2,6-dione Chemical compound N1C(=O)C2C(=O)NC1(CC)CC2C1=CC=CC=C1 AZRRZGIBBLWSSQ-UHFFFAOYSA-N 0.000 description 2
- DSUFRPVVBZLHPI-UHFFFAOYSA-N 4-fluoro-n-methoxy-n-methylbenzamide Chemical compound CON(C)C(=O)C1=CC=C(F)C=C1 DSUFRPVVBZLHPI-UHFFFAOYSA-N 0.000 description 2
- RIKKIFILODWUGB-UHFFFAOYSA-N 5-(2-hydroxy-4-propylphenoxy)-1h-pyridin-2-one Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(O)N=C1 RIKKIFILODWUGB-UHFFFAOYSA-N 0.000 description 2
- YINLKMHSWSSBQW-UHFFFAOYSA-N 5-(2-methoxy-4-propylphenoxy)-2-nitropyridine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=C([N+]([O-])=O)N=C1 YINLKMHSWSSBQW-UHFFFAOYSA-N 0.000 description 2
- OPCBDBAZBDIZIP-UHFFFAOYSA-N 5-(azidomethyl)-3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]-1,3-oxazolidin-2-one Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1N1CC(CN=[N+]=[N-])OC1=O OPCBDBAZBDIZIP-UHFFFAOYSA-N 0.000 description 2
- BPKBSDNGBAVKSK-UHFFFAOYSA-N 5-(chloromethyl)-2-(6-fluoropyridin-2-yl)oxyphenol Chemical compound OC1=CC(CCl)=CC=C1OC1=CC=CC(F)=N1 BPKBSDNGBAVKSK-UHFFFAOYSA-N 0.000 description 2
- LNGITDNRPLXSKF-UHFFFAOYSA-N 5-[(3-fluoropyridin-4-yl)methyl]-2-(6-fluoropyridin-2-yl)oxyphenol Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(O)=CC=1CC1=CC=NC=C1F LNGITDNRPLXSKF-UHFFFAOYSA-N 0.000 description 2
- XPHJCRSNVXJMRS-UHFFFAOYSA-N 5-ethyl-2-(2-fluoro-4-methylsulfonylphenoxy)phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(C)(=O)=O)C=C1F XPHJCRSNVXJMRS-UHFFFAOYSA-N 0.000 description 2
- YNYKFQPVFSHCGQ-UHFFFAOYSA-N 5-ethyl-2-(4-methylsulfonylphenoxy)phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(C)(=O)=O)C=C1 YNYKFQPVFSHCGQ-UHFFFAOYSA-N 0.000 description 2
- FBIMGMFKUXKUMK-UHFFFAOYSA-N 5-ethyl-2-[2-(methylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=CC=C1NC FBIMGMFKUXKUMK-UHFFFAOYSA-N 0.000 description 2
- LTVXPDDAVCQUTA-UHFFFAOYSA-N 5-ethyl-2-[2-fluoro-4-(2-hydroxyethylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(NCCO)C=C1F LTVXPDDAVCQUTA-UHFFFAOYSA-N 0.000 description 2
- NXVKQLQTRIXNRC-UHFFFAOYSA-N 5-ethyl-2-[2-fluoro-4-(3-hydroxypropylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(NCCCO)C=C1F NXVKQLQTRIXNRC-UHFFFAOYSA-N 0.000 description 2
- FLGZWTBJOMZWOO-UHFFFAOYSA-N 5-ethyl-2-[4-(3-hydroxybutylsulfonyl)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)CCC(C)O)C=C1 FLGZWTBJOMZWOO-UHFFFAOYSA-N 0.000 description 2
- YUCFDBKUYFDWPG-UHFFFAOYSA-N 5-ethyl-2-[4-(ethylamino)-2-fluorophenoxy]phenol Chemical compound FC1=CC(NCC)=CC=C1OC1=CC=C(CC)C=C1O YUCFDBKUYFDWPG-UHFFFAOYSA-N 0.000 description 2
- AANOQBMJDPROPS-UHFFFAOYSA-N 6-(2-methoxy-4-propylphenoxy)pyridin-2-amine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=CC(N)=N1 AANOQBMJDPROPS-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241000187479 Mycobacterium tuberculosis Species 0.000 description 2
- 241001274216 Naso Species 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- YLNSNVGRSIOCEU-ZCFIWIBFSA-N [(2r)-oxiran-2-yl]methyl butanoate Chemical compound CCCC(=O)OC[C@H]1CO1 YLNSNVGRSIOCEU-ZCFIWIBFSA-N 0.000 description 2
- VSGFCTLXMLQCRL-UHFFFAOYSA-N [2-(4-acetyl-2-fluorophenoxy)-5-ethylphenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate Chemical compound CC(C)(C)OC(=O)NCC(=O)OC1=CC(CC)=CC=C1OC1=CC=C(C(C)=O)C=C1F VSGFCTLXMLQCRL-UHFFFAOYSA-N 0.000 description 2
- PUFSCIWWJIUJAH-UHFFFAOYSA-N [4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl] acetate Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(OC(C)=O)C=C1F PUFSCIWWJIUJAH-UHFFFAOYSA-N 0.000 description 2
- DQGHNDXVQYVHQU-UHFFFAOYSA-N [4-(6-fluoropyridin-2-yl)oxy-3-methoxyphenyl]methanol Chemical compound COC1=CC(CO)=CC=C1OC1=CC=CC(F)=N1 DQGHNDXVQYVHQU-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 244000052616 bacterial pathogen Species 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 2
- NKHAMOKHJAOQLU-UHFFFAOYSA-N benzyl n-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]carbamate Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NC(=O)OCC1=CC=CC=C1 NKHAMOKHJAOQLU-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 210000002421 cell wall Anatomy 0.000 description 2
- 125000003636 chemical group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229940125810 compound 20 Drugs 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000006264 debenzylation reaction Methods 0.000 description 2
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 2
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000002038 ethyl acetate fraction Substances 0.000 description 2
- OBNCKNCVKJNDBV-UHFFFAOYSA-N ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- NUGCKJOMCGIYRZ-UHFFFAOYSA-N ethyl n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]carbamate Chemical compound FC1=CC(NC(=O)OCC)=CC=C1OC1=CC=C(CC)C=C1OC NUGCKJOMCGIYRZ-UHFFFAOYSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 239000002054 inoculum Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 230000001665 lethal effect Effects 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- SWTDOBDFYXFIPN-UHFFFAOYSA-M magnesium;2-ethyl-1,3-dioxane;bromide Chemical compound [Mg+2].[Br-].[CH2-]CC1OCCCO1 SWTDOBDFYXFIPN-UHFFFAOYSA-M 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- SPUACDWLOLSOQO-UHFFFAOYSA-M methoxyazanium;chloride Chemical compound [Cl-].CO[NH3+] SPUACDWLOLSOQO-UHFFFAOYSA-M 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 230000000813 microbial effect Effects 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- PLGGYGFALJLDPP-UHFFFAOYSA-N n'-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]propane-1,3-diamine Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(NCCCN)C=C1F PLGGYGFALJLDPP-UHFFFAOYSA-N 0.000 description 2
- WSJBTTPJUIYKQN-UHFFFAOYSA-N n-(3-aminopropyl)-n-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]acetamide Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(N(CCCN)C(C)=O)C=C1F WSJBTTPJUIYKQN-UHFFFAOYSA-N 0.000 description 2
- OOLSCWJZBCHEFI-UHFFFAOYSA-N n-[2-(4-ethyl-2-methoxyphenoxy)phenyl]formamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CC=C1NC=O OOLSCWJZBCHEFI-UHFFFAOYSA-N 0.000 description 2
- MMDRPNRCZUFGGM-UHFFFAOYSA-N n-[2-[[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]sulfonylamino]ethyl]acetamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)NCCNC(C)=O)C=C1F MMDRPNRCZUFGGM-UHFFFAOYSA-N 0.000 description 2
- LJIPLDIGRBDFFJ-UHFFFAOYSA-N n-[3-(2-methoxy-4-propylphenoxy)phenyl]acetamide Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=CC(NC(C)=O)=C1 LJIPLDIGRBDFFJ-UHFFFAOYSA-N 0.000 description 2
- BSDVMQAJWZMPSX-UHFFFAOYSA-N n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]-2,2,2-trifluoroethanesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(NS(=O)(=O)CC(F)(F)F)C=C1F BSDVMQAJWZMPSX-UHFFFAOYSA-N 0.000 description 2
- BKNYRFAGAHNDMM-UHFFFAOYSA-N n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]-3-morpholin-4-ylpropane-1-sulfonamide Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NS(=O)(=O)CCCN1CCOCC1 BKNYRFAGAHNDMM-UHFFFAOYSA-N 0.000 description 2
- XCTWCCGLLMWVBB-UHFFFAOYSA-N n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]-4-morpholin-4-yl-4-oxobutanamide Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NC(=O)CCC(=O)N1CCOCC1 XCTWCCGLLMWVBB-UHFFFAOYSA-N 0.000 description 2
- BRFQLYBIHOTXOS-UHFFFAOYSA-N n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]cyclopropanesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NS(=O)(=O)C1CC1 BRFQLYBIHOTXOS-UHFFFAOYSA-N 0.000 description 2
- IZDLVONRLMDZSQ-UHFFFAOYSA-N n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]-4-morpholin-4-yl-4-oxobutanamide Chemical compound COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NC(=O)CCC(=O)N1CCOCC1 IZDLVONRLMDZSQ-UHFFFAOYSA-N 0.000 description 2
- FRTKCFUWBLFYIT-UHFFFAOYSA-N n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]cyclopropanesulfonamide Chemical compound COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NS(=O)(=O)C1CC1 FRTKCFUWBLFYIT-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- JYXQLGWOVROMIX-UHFFFAOYSA-N n-ethyl-4-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline Chemical compound FC1=CC(NCC)=CC=C1OC1=CC=C(CC)C=C1OC JYXQLGWOVROMIX-UHFFFAOYSA-N 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- IXQGCWUGDFDQMF-UHFFFAOYSA-N o-Hydroxyethylbenzene Natural products CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical compound CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000005494 pyridonyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- CYDKKZPHQHSVOE-UHFFFAOYSA-N (2-hydroxy-4-propylphenyl) 4-methylbenzenesulfonate Chemical compound OC1=CC(CCC)=CC=C1OS(=O)(=O)C1=CC=C(C)C=C1 CYDKKZPHQHSVOE-UHFFFAOYSA-N 0.000 description 1
- IBTSWKLSEOGJGJ-UHFFFAOYSA-N (3-acetamidophenyl)boronic acid Chemical compound CC(=O)NC1=CC=CC(B(O)O)=C1 IBTSWKLSEOGJGJ-UHFFFAOYSA-N 0.000 description 1
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical group COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 1
- BIWQNIMLAISTBV-UHFFFAOYSA-N (4-methylphenyl)boronic acid Chemical compound CC1=CC=C(B(O)O)C=C1 BIWQNIMLAISTBV-UHFFFAOYSA-N 0.000 description 1
- VDUKDQTYMWUSAC-UHFFFAOYSA-N (4-methylsulfonylphenyl)boronic acid Chemical compound CS(=O)(=O)C1=CC=C(B(O)O)C=C1 VDUKDQTYMWUSAC-UHFFFAOYSA-N 0.000 description 1
- GETTZEONDQJALK-UHFFFAOYSA-N (trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1 GETTZEONDQJALK-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- GZKMLIPYWVKNSM-UHFFFAOYSA-N 1-(1,3-dioxoisoindol-2-yl)ethanesulfonic acid Chemical compound C1=CC=C2C(=O)N(C(C)S(O)(=O)=O)C(=O)C2=C1 GZKMLIPYWVKNSM-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- IWCDWGBUIGLXBG-UHFFFAOYSA-N 1-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]ethanone Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(C(C)=O)C=C1F IWCDWGBUIGLXBG-UHFFFAOYSA-N 0.000 description 1
- WQEQXTHBPPRIGR-UHFFFAOYSA-N 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluoroanilino]butan-1-ol Chemical compound C(C)C1=CC(=C(OC2=C(C=C(C=C2)NC(CCC)O)F)C=C1)OC WQEQXTHBPPRIGR-UHFFFAOYSA-N 0.000 description 1
- PYDZKAWNDGJMOL-UHFFFAOYSA-N 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]pyrrolidine-2,5-dione Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(N2C(CCC2=O)=O)C=C1F PYDZKAWNDGJMOL-UHFFFAOYSA-N 0.000 description 1
- QINCDZKDZCCRSA-UHFFFAOYSA-N 1-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]ethanone Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(C(C)=O)C=C1F QINCDZKDZCCRSA-UHFFFAOYSA-N 0.000 description 1
- BZXIPHLHQCLMKZ-UHFFFAOYSA-N 1-bromo-3-(2-fluoro-4-nitrophenoxy)-2-methoxybenzene Chemical compound BrC=1C(=C(C=CC=1)OC1=C(C=C(C=C1)[N+](=O)[O-])F)OC BZXIPHLHQCLMKZ-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical group [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- CXCHEKCRJQRVNG-UHFFFAOYSA-N 2,2,2-trifluoroethanesulfonyl chloride Chemical compound FC(F)(F)CS(Cl)(=O)=O CXCHEKCRJQRVNG-UHFFFAOYSA-N 0.000 description 1
- IPLRZPREFHIGIB-UHFFFAOYSA-N 2,2-dinitropropan-1-ol Chemical compound OCC(C)([N+]([O-])=O)[N+]([O-])=O IPLRZPREFHIGIB-UHFFFAOYSA-N 0.000 description 1
- NHBKXEKEPDILRR-UHFFFAOYSA-N 2,3-bis(butanoylsulfanyl)propyl butanoate Chemical compound CCCC(=O)OCC(SC(=O)CCC)CSC(=O)CCC NHBKXEKEPDILRR-UHFFFAOYSA-N 0.000 description 1
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical group OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 1
- UZDRWXKBKVVUTE-UHFFFAOYSA-N 2,4,6-trifluoropyridine Chemical compound FC1=CC(F)=NC(F)=C1 UZDRWXKBKVVUTE-UHFFFAOYSA-N 0.000 description 1
- RJXOVESYJFXCGI-UHFFFAOYSA-N 2,4-difluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1F RJXOVESYJFXCGI-UHFFFAOYSA-N 0.000 description 1
- SRAMOYPYRHZTLC-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)-n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]ethanesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NS(=O)(=O)CCN1C(=O)C2=CC=CC=C2C1=O SRAMOYPYRHZTLC-UHFFFAOYSA-N 0.000 description 1
- FNXSZNTVFQWKMR-UHFFFAOYSA-N 2-(2-aminopyridin-3-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=CN=C1N FNXSZNTVFQWKMR-UHFFFAOYSA-N 0.000 description 1
- YLPUYFPJFKTKHU-UHFFFAOYSA-N 2-(2-fluoropyridin-3-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=CN=C1F YLPUYFPJFKTKHU-UHFFFAOYSA-N 0.000 description 1
- OBHLVIJTPIUIHA-UHFFFAOYSA-N 2-(2-pyridin-2-ylethyl)benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1CCC1=CC=CC=N1 OBHLVIJTPIUIHA-UHFFFAOYSA-N 0.000 description 1
- VFKJXTGXRKUXNA-UHFFFAOYSA-N 2-(2-thiophen-3-ylethyl)phenol Chemical compound S1C=C(C=C1)CCC1=C(C=CC=C1)O VFKJXTGXRKUXNA-UHFFFAOYSA-N 0.000 description 1
- LNVSABZCRQOCMR-UHFFFAOYSA-N 2-(3-amino-6-chloropyridin-2-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=NC(Cl)=CC=C1N LNVSABZCRQOCMR-UHFFFAOYSA-N 0.000 description 1
- YXLYEZLDLWBQCM-UHFFFAOYSA-N 2-(4-amino-2-fluorophenoxy)-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(N)C=C1F YXLYEZLDLWBQCM-UHFFFAOYSA-N 0.000 description 1
- TXVVXJKHOULEGU-UHFFFAOYSA-N 2-(4-ethenyl-5-fluoro-2-methoxyphenoxy)-6-fluoropyridine Chemical compound COC1=CC(C=C)=C(F)C=C1OC1=CC=CC(F)=N1 TXVVXJKHOULEGU-UHFFFAOYSA-N 0.000 description 1
- CYALQSYGBLRJOL-UHFFFAOYSA-N 2-(4-ethyl-2-methoxyphenoxy)-4-methyl-1-nitrobenzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC(C)=CC=C1[N+]([O-])=O CYALQSYGBLRJOL-UHFFFAOYSA-N 0.000 description 1
- SJEIOBIWZHUZRH-UHFFFAOYSA-N 2-(4-ethyl-2-phenylmethoxyphenyl)-4-methylbenzenesulfonic acid Chemical compound C=1C(CC)=CC=C(C=2C(=CC=C(C)C=2)S(O)(=O)=O)C=1OCC1=CC=CC=C1 SJEIOBIWZHUZRH-UHFFFAOYSA-N 0.000 description 1
- POBCFJUAETUWOA-UHFFFAOYSA-N 2-(5-amino-6-chloropyridin-2-yl)oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(N)C(Cl)=N1 POBCFJUAETUWOA-UHFFFAOYSA-N 0.000 description 1
- VWOCAGURVPBTKX-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(1,2,4-triazol-1-ylmethyl)phenol Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(O)=CC=1CN1C=NC=N1 VWOCAGURVPBTKX-UHFFFAOYSA-N 0.000 description 1
- PHHYWTZCLMDQLC-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(2,2,2-trifluoro-1-hydroxyethyl)phenol Chemical compound OC1=CC(C(O)C(F)(F)F)=CC=C1OC1=CC=CC(F)=N1 PHHYWTZCLMDQLC-UHFFFAOYSA-N 0.000 description 1
- IVXBFUKPDAWSDW-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(2,2,2-trifluoroethyl)phenol Chemical compound OC1=CC(CC(F)(F)F)=CC=C1OC1=CC=CC(F)=N1 IVXBFUKPDAWSDW-UHFFFAOYSA-N 0.000 description 1
- QYSODJQOQSMKMY-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(imidazol-1-ylmethyl)phenol Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(O)=CC=1CN1C=CN=C1 QYSODJQOQSMKMY-UHFFFAOYSA-N 0.000 description 1
- OTPGEVOSCNPHJH-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-(methoxymethyl)phenol Chemical compound OC1=CC(COC)=CC=C1OC1=CC=CC(F)=N1 OTPGEVOSCNPHJH-UHFFFAOYSA-N 0.000 description 1
- AJUBKCJAFMNBAE-UHFFFAOYSA-N 2-(6-fluoropyridin-2-yl)oxy-5-[2-(6-fluoropyridin-2-yl)oxyethyl]phenol Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(O)=CC=1CCOC1=CC=CC(F)=N1 AJUBKCJAFMNBAE-UHFFFAOYSA-N 0.000 description 1
- CKIIJIDEWWXQEA-UHFFFAOYSA-N 2-(bromomethyl)-1,3-dioxolane Chemical compound BrCC1OCCO1 CKIIJIDEWWXQEA-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- VRPJIFMKZZEXLR-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NCC(O)=O VRPJIFMKZZEXLR-UHFFFAOYSA-N 0.000 description 1
- LUSGNPDJIQMKAQ-UHFFFAOYSA-N 2-[2-(4-acetyl-2-fluorophenoxy)-5-ethylanilino]acetic acid;hydrochloride Chemical compound Cl.OC(=O)CNC1=CC(CC)=CC=C1OC1=CC=C(C(C)=O)C=C1F LUSGNPDJIQMKAQ-UHFFFAOYSA-N 0.000 description 1
- ATKWNQJLHLQVRS-UHFFFAOYSA-N 2-[2-methoxy-4-(1,2,2-trifluoroethenyl)phenoxy]pyridine Chemical compound COC1=C(OC2=NC=CC=C2)C=CC(=C1)C(=C(F)F)F ATKWNQJLHLQVRS-UHFFFAOYSA-N 0.000 description 1
- KPIHDZYPSJKPBJ-UHFFFAOYSA-N 2-[3-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenoxy]propyl]isoindole-1,3-dione Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1OCCCN1C(=O)C2=CC=CC=C2C1=O KPIHDZYPSJKPBJ-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- BIMHHHWBTNBGLT-UHFFFAOYSA-N 2-[4-(3-aminopropoxy)-2-fluorophenoxy]-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(OCCCN)C=C1F BIMHHHWBTNBGLT-UHFFFAOYSA-N 0.000 description 1
- HZLWAKSEXJJKCI-UHFFFAOYSA-N 2-[4-(3-chloropropyl)-2-methoxyphenoxy]-6-fluoropyridine Chemical compound COC1=CC(CCCCl)=CC=C1OC1=CC=CC(F)=N1 HZLWAKSEXJJKCI-UHFFFAOYSA-N 0.000 description 1
- QPGBDKHOMSQAEV-UHFFFAOYSA-N 2-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]ethanol Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(NCCO)C=C1F QPGBDKHOMSQAEV-UHFFFAOYSA-N 0.000 description 1
- VYEZLAYKZZSADY-UHFFFAOYSA-N 2-[4-[2-(1,3-dioxolan-2-yl)ethylsulfonyl]phenoxy]-5-ethylphenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)CCC2OCCO2)C=C1 VYEZLAYKZZSADY-UHFFFAOYSA-N 0.000 description 1
- ZMAGXNVOKOMPIF-UHFFFAOYSA-N 2-[5-(4-bromobut-1-ynyl)pyridin-2-yl]oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(C#CCCBr)C=N1 ZMAGXNVOKOMPIF-UHFFFAOYSA-N 0.000 description 1
- QYZDSFXMQGECGK-UHFFFAOYSA-N 2-[5-(4-hydroxybut-1-ynyl)pyridin-2-yl]oxy-5-propylphenol Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=C(C#CCCO)C=N1 QYZDSFXMQGECGK-UHFFFAOYSA-N 0.000 description 1
- IXMIEQPWCAPGKV-UHFFFAOYSA-N 2-aminooxyacetic acid;hydrochloride Chemical compound Cl.NOCC(O)=O IXMIEQPWCAPGKV-UHFFFAOYSA-N 0.000 description 1
- NHUBNHMFXQNNMV-UHFFFAOYSA-N 2-ethynylpyridine Chemical compound C#CC1=CC=CC=N1 NHUBNHMFXQNNMV-UHFFFAOYSA-N 0.000 description 1
- WIQISTBTOQNVCE-UHFFFAOYSA-N 2-fluoro-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1F WIQISTBTOQNVCE-UHFFFAOYSA-N 0.000 description 1
- XSPKENATFNMAQH-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-(1,2,2,2-tetrafluoroethyl)phenoxy]pyridine Chemical compound COC1=CC(C(F)C(F)(F)F)=CC=C1OC1=CC=CC(F)=N1 XSPKENATFNMAQH-UHFFFAOYSA-N 0.000 description 1
- MZCMUAKIDLETQZ-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-(1,2,2-trifluoroethenyl)phenoxy]pyridine Chemical compound COC1=CC(C(F)=C(F)F)=CC=C1OC1=CC=CC(F)=N1 MZCMUAKIDLETQZ-UHFFFAOYSA-N 0.000 description 1
- NUGYGXADYKINRO-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-(1,2,4-triazol-1-ylmethyl)phenoxy]pyridine Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(OC)=CC=1CN1C=NC=N1 NUGYGXADYKINRO-UHFFFAOYSA-N 0.000 description 1
- SIFNUKKQUSQBLU-UHFFFAOYSA-N 2-fluoro-6-[2-methoxy-4-[3-(1,2,4-triazol-1-yl)propyl]phenoxy]pyridine Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(OC)=CC=1CCCN1C=NC=N1 SIFNUKKQUSQBLU-UHFFFAOYSA-N 0.000 description 1
- FHWPWDOSKLLUGV-UHFFFAOYSA-N 2-fluoro-6-[4-(imidazol-1-ylmethyl)-2-methoxyphenoxy]pyridine Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(OC)=CC=1CN1C=CN=C1 FHWPWDOSKLLUGV-UHFFFAOYSA-N 0.000 description 1
- ZLABYIRMJRONPE-UHFFFAOYSA-N 2-fluoro-6-[4-[2-(6-fluoropyridin-2-yl)oxyethyl]-2-methoxyphenoxy]pyridine Chemical compound C=1C=C(OC=2N=C(F)C=CC=2)C(OC)=CC=1CCOC1=CC=CC(F)=N1 ZLABYIRMJRONPE-UHFFFAOYSA-N 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 1
- UUXHICUVBOTXQS-UHFFFAOYSA-N 2-hydroxybutanamide Chemical compound CCC(O)C(N)=O UUXHICUVBOTXQS-UHFFFAOYSA-N 0.000 description 1
- FZMXKCMCYXQMLN-UHFFFAOYSA-N 2-methoxy-1-(4-methoxyphenoxy)-4-propylbenzene Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=C(OC)C=C1 FZMXKCMCYXQMLN-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- GZBKVUGZEAJYHH-UHFFFAOYSA-N 2-nitropyridin-3-amine Chemical compound NC1=CC=CN=C1[N+]([O-])=O GZBKVUGZEAJYHH-UHFFFAOYSA-N 0.000 description 1
- QZZZWEIWYVXIHQ-UHFFFAOYSA-N 2-propylbenzenesulfonamide Chemical compound CCCC1=CC=CC=C1S(N)(=O)=O QZZZWEIWYVXIHQ-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XPQIPUZPSLAZDV-UHFFFAOYSA-N 2-pyridylethylamine Chemical compound NCCC1=CC=CC=N1 XPQIPUZPSLAZDV-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- CQSNULMZVQQZSY-UHFFFAOYSA-N 3-(2-methoxy-4-propylphenoxy)pyridin-2-amine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=CN=C1N CQSNULMZVQQZSY-UHFFFAOYSA-N 0.000 description 1
- PLQYIZQBABNCIO-UHFFFAOYSA-N 3-(4-ethyl-2-methoxyphenoxy)pyridin-2-amine Chemical compound COC1=CC(CC)=CC=C1OC1=CC=CN=C1N PLQYIZQBABNCIO-UHFFFAOYSA-N 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- IOWMSNCKGWXNPL-SNAWJCMRSA-N 3-[(E)-2-thiophen-3-ylethenyl]phenol Chemical compound S1C=C(C=C1)/C=C/C=1C=CC=C(C=1)O IOWMSNCKGWXNPL-SNAWJCMRSA-N 0.000 description 1
- ZUHLQLJZKPKQFS-UHFFFAOYSA-N 3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]-1,3-oxazolidin-2-one Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1N1CCOC1=O ZUHLQLJZKPKQFS-UHFFFAOYSA-N 0.000 description 1
- ZRJWEWVAGYYFFX-UHFFFAOYSA-N 3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1N1CC(CO)OC1=O ZRJWEWVAGYYFFX-UHFFFAOYSA-N 0.000 description 1
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 1
- WFNISJZUJCKTLT-UHFFFAOYSA-N 3-bromo-2-nitropyridine Chemical compound [O-][N+](=O)C1=NC=CC=C1Br WFNISJZUJCKTLT-UHFFFAOYSA-N 0.000 description 1
- OXQUPTNDYOFJHS-UHFFFAOYSA-N 3-butyl-6-(4-ethyl-2-methoxyphenoxy)pyridin-2-amine Chemical compound N1=C(N)C(CCCC)=CC=C1OC1=CC=C(CC)C=C1OC OXQUPTNDYOFJHS-UHFFFAOYSA-N 0.000 description 1
- MQECTFKJOOWSKZ-UHFFFAOYSA-N 3-chloro-n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]propane-1-sulfonamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(NS(=O)(=O)CCCCl)C=C1F MQECTFKJOOWSKZ-UHFFFAOYSA-N 0.000 description 1
- MJHLPKWONJUCFK-UHFFFAOYSA-N 3-ethynylthiophene Chemical compound C#CC=1C=CSC=1 MJHLPKWONJUCFK-UHFFFAOYSA-N 0.000 description 1
- DMRDLMUIZAFLGP-UHFFFAOYSA-N 3-fluoro-4-[2-methoxy-4-(2-pyridin-2-ylethyl)phenoxy]aniline Chemical compound C=1C=C(OC=2C(=CC(N)=CC=2)F)C(OC)=CC=1CCC1=CC=CC=N1 DMRDLMUIZAFLGP-UHFFFAOYSA-N 0.000 description 1
- KDHWOCLBMVSZPG-UHFFFAOYSA-N 3-imidazol-1-ylpropan-1-amine Chemical compound NCCCN1C=CN=C1 KDHWOCLBMVSZPG-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- DPGSPRJLAZGUBQ-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-vinyl-1,3,2-dioxaborolane Substances CC1(C)OB(C=C)OC1(C)C DPGSPRJLAZGUBQ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MMBGDBGGCNVZRP-UHFFFAOYSA-N 4-(4-ethyl-2-hydroxyphenoxy)-3-fluoro-n-(2-pyridin-2-ylethyl)benzenesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)NCCC=2N=CC=CC=2)C=C1F MMBGDBGGCNVZRP-UHFFFAOYSA-N 0.000 description 1
- QHTPEKXRQPRPNU-UHFFFAOYSA-N 4-(4-ethyl-2-hydroxyphenoxy)-3-fluoro-n-propylbenzenesulfonamide Chemical compound FC1=CC(S(=O)(=O)NCCC)=CC=C1OC1=CC=C(CC)C=C1O QHTPEKXRQPRPNU-UHFFFAOYSA-N 0.000 description 1
- XUPBFWCIOWFXLP-UHFFFAOYSA-N 4-(4-ethyl-2-hydroxyphenoxy)-3-fluorobenzenesulfonamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(N)(=O)=O)C=C1F XUPBFWCIOWFXLP-UHFFFAOYSA-N 0.000 description 1
- QXPOBMWHEICSHV-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-(trifluoromethyl)aniline Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(N)C=C1C(F)(F)F QXPOBMWHEICSHV-UHFFFAOYSA-N 0.000 description 1
- YOXFGPBOFRNFMW-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-fluoro-n-(pyridin-3-ylmethyl)aniline Chemical compound COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NCC1=CC=CN=C1 YOXFGPBOFRNFMW-UHFFFAOYSA-N 0.000 description 1
- NYTAMNSGWSOJQK-UHFFFAOYSA-N 4-(4-ethyl-2-methoxyphenoxy)-3-fluorobenzenesulfonamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(N)(=O)=O)C=C1F NYTAMNSGWSOJQK-UHFFFAOYSA-N 0.000 description 1
- CNIZDDDAPUBOCF-UHFFFAOYSA-N 4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoro-n-(2-pyridin-2-ylethyl)benzenesulfonamide Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1S(=O)(=O)NCCC1=CC=CC=N1 CNIZDDDAPUBOCF-UHFFFAOYSA-N 0.000 description 1
- CXEXPXBUQAWJMY-UHFFFAOYSA-N 4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoro-n-(3-imidazol-1-ylpropyl)benzenesulfonamide Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1S(=O)(=O)NCCCN1C=CN=C1 CXEXPXBUQAWJMY-UHFFFAOYSA-N 0.000 description 1
- YPJTUNBJYWSRPX-UHFFFAOYSA-N 4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoro-n-propylbenzenesulfonamide Chemical compound FC1=CC(S(=O)(=O)NCCC)=CC=C1OC1=CC=C(CC)C=C1OCC1=CC=CC=C1 YPJTUNBJYWSRPX-UHFFFAOYSA-N 0.000 description 1
- MCAFYHHCWHPZJI-UHFFFAOYSA-N 4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorobenzenesulfonyl chloride Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(S(Cl)(=O)=O)C=C1F MCAFYHHCWHPZJI-UHFFFAOYSA-N 0.000 description 1
- WAVONJJZOMPMAZ-UHFFFAOYSA-N 4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenol Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(O)C=C1F WAVONJJZOMPMAZ-UHFFFAOYSA-N 0.000 description 1
- VOKIYVQTJKLURY-UHFFFAOYSA-N 4-[(3-fluoropyridin-4-yl)methyl]-2-methoxyphenol Chemical compound C1=C(O)C(OC)=CC(CC=2C(=CN=CC=2)F)=C1 VOKIYVQTJKLURY-UHFFFAOYSA-N 0.000 description 1
- JXRPRSCHKOSERB-UHFFFAOYSA-N 4-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenoxy]butanoic acid Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(OCCCC(O)=O)C=C1F JXRPRSCHKOSERB-UHFFFAOYSA-N 0.000 description 1
- AUCUNPRPKKSNMB-UHFFFAOYSA-N 4-[4-(4-ethyl-2-methoxyphenoxy)-3-fluoroanilino]butan-1-ol Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(NCCCCO)C=C1F AUCUNPRPKKSNMB-UHFFFAOYSA-N 0.000 description 1
- TXLQRGVJVZNPIK-UHFFFAOYSA-N 4-[4-(4-ethyl-2-methoxyphenoxy)phenyl]sulfonylbutan-2-ol Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)CCC(C)O)C=C1 TXLQRGVJVZNPIK-UHFFFAOYSA-N 0.000 description 1
- WHSIIJQOEGXWSN-UHFFFAOYSA-N 4-bromo-2-methoxyphenol Chemical compound COC1=CC(Br)=CC=C1O WHSIIJQOEGXWSN-UHFFFAOYSA-N 0.000 description 1
- FVZQMMMRFNURSH-UHFFFAOYSA-N 4-chloro-2-methoxyphenol Chemical compound COC1=CC(Cl)=CC=C1O FVZQMMMRFNURSH-UHFFFAOYSA-N 0.000 description 1
- NQCIDVBMEZNQAM-UHFFFAOYSA-N 4-ethyl-1-(5-fluoro-2-nitrophenoxy)-2-methoxybenzene Chemical compound COC1=CC(CC)=CC=C1OC1=CC(F)=CC=C1[N+]([O-])=O NQCIDVBMEZNQAM-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- LVQFHDAKZHGEAJ-UHFFFAOYSA-M 4-methylbenzenesulfonate Chemical compound [CH2]C1=CC=C(S([O-])(=O)=O)C=C1 LVQFHDAKZHGEAJ-UHFFFAOYSA-M 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- FWCFGLQTZKHXHM-UHFFFAOYSA-N 5-(2-ethoxy-4-propylphenoxy)-1-ethylpyridin-2-one Chemical compound CCOC1=CC(CCC)=CC=C1OC1=CN(CC)C(=O)C=C1 FWCFGLQTZKHXHM-UHFFFAOYSA-N 0.000 description 1
- GHONJHCWNWUFPE-UHFFFAOYSA-N 5-(2-methoxy-4-propylphenoxy)pyridin-2-amine Chemical compound COC1=CC(CCC)=CC=C1OC1=CC=C(N)N=C1 GHONJHCWNWUFPE-UHFFFAOYSA-N 0.000 description 1
- ATXXLNCPVSUCNK-UHFFFAOYSA-N 5-bromo-2-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Br)C=N1 ATXXLNCPVSUCNK-UHFFFAOYSA-N 0.000 description 1
- XPYZVTRGXVSFHO-UHFFFAOYSA-N 5-ethyl-2-(2-fluorophenoxy)phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=CC=C1F XPYZVTRGXVSFHO-UHFFFAOYSA-N 0.000 description 1
- PMQJUALBKFVYCO-UHFFFAOYSA-N 5-ethyl-2-[2-fluoro-4-(1h-imidazol-2-ylmethylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NCC1=NC=CN1 PMQJUALBKFVYCO-UHFFFAOYSA-N 0.000 description 1
- JQRPGVMDKWGZCH-UHFFFAOYSA-N 5-ethyl-2-[2-fluoro-4-(1h-imidazol-5-ylmethylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NCC1=CNC=N1 JQRPGVMDKWGZCH-UHFFFAOYSA-N 0.000 description 1
- OHVNOFRUJGJXET-UHFFFAOYSA-N 5-ethyl-2-[2-fluoro-4-(4-hydroxybutylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(NCCCCO)C=C1F OHVNOFRUJGJXET-UHFFFAOYSA-N 0.000 description 1
- PDLNACZIOCQHGM-UHFFFAOYSA-N 5-ethyl-2-[2-fluoro-4-(pyridin-3-ylmethylamino)phenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NCC1=CC=CN=C1 PDLNACZIOCQHGM-UHFFFAOYSA-N 0.000 description 1
- ZUCDPTUYUUJHRK-FYWRMAATSA-N 5-ethyl-2-[4-[(e)-pyrrolidin-2-ylidenemethyl]sulfonylphenoxy]phenol Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)\C=C/2NCCC\2)C=C1 ZUCDPTUYUUJHRK-FYWRMAATSA-N 0.000 description 1
- BKLJUYPLUWUEOQ-UHFFFAOYSA-N 6-bromopyridin-2-amine Chemical compound NC1=CC=CC(Br)=N1 BKLJUYPLUWUEOQ-UHFFFAOYSA-N 0.000 description 1
- 101710146995 Acyl carrier protein Proteins 0.000 description 1
- 108700037654 Acyl carrier protein (ACP) Proteins 0.000 description 1
- 102000048456 Acyl carrier protein (ACP) Human genes 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 238000009631 Broth culture Methods 0.000 description 1
- MVXILWJRAHFFIJ-UHFFFAOYSA-N C(C)C1=CC(=C(ON(C2=CC(=CC=C2)F)CC=2N=CNC2)C=C1)OC Chemical compound C(C)C1=CC(=C(ON(C2=CC(=CC=C2)F)CC=2N=CNC2)C=C1)OC MVXILWJRAHFFIJ-UHFFFAOYSA-N 0.000 description 1
- FGUUSXIOTUKUDN-IBGZPJMESA-N C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 Chemical compound C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 FGUUSXIOTUKUDN-IBGZPJMESA-N 0.000 description 1
- JJHBTFYNYRGIJJ-UHFFFAOYSA-N CCC1=CC(=C(C=C1)OC2=C(C=C(C=C2)N3CCCC3)F)OC Chemical compound CCC1=CC(=C(C=C1)OC2=C(C=C(C=C2)N3CCCC3)F)OC JJHBTFYNYRGIJJ-UHFFFAOYSA-N 0.000 description 1
- YXJYWALKDNCPEB-UHFFFAOYSA-N CCC1=CC(=C(C=C1)OC2=C(C=C(C=C2)N3CCOC3)F)OCC4=CC=CC=C4 Chemical compound CCC1=CC(=C(C=C1)OC2=C(C=C(C=C2)N3CCOC3)F)OCC4=CC=CC=C4 YXJYWALKDNCPEB-UHFFFAOYSA-N 0.000 description 1
- YAVCXVGYNKDCAD-UHFFFAOYSA-N CCC1=CC(=C(C=C1)OC2=C(C=CC=C2S(=O)(=O)NCCNC(=O)C)F)OC Chemical compound CCC1=CC(=C(C=C1)OC2=C(C=CC=C2S(=O)(=O)NCCNC(=O)C)F)OC YAVCXVGYNKDCAD-UHFFFAOYSA-N 0.000 description 1
- IVHCKLJUVKYJQQ-UHFFFAOYSA-N COS(=O)(=O)C1=CC=CC=C1.COS(=O)(=O)C1=CC=CC=C1 Chemical compound COS(=O)(=O)C1=CC=CC=C1.COS(=O)(=O)C1=CC=CC=C1 IVHCKLJUVKYJQQ-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 239000004128 Copper(II) sulphate Substances 0.000 description 1
- 101100081489 Drosophila melanogaster Obp83a gene Proteins 0.000 description 1
- 108700033863 EC 2.3.1.85 Proteins 0.000 description 1
- 101710198510 Enoyl-[acyl-carrier-protein] reductase [NADH] Proteins 0.000 description 1
- 240000001414 Eucalyptus viminalis Species 0.000 description 1
- 241000206602 Eukaryota Species 0.000 description 1
- 229940121963 FABI inhibitor Drugs 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 241000606768 Haemophilus influenzae Species 0.000 description 1
- 241000590002 Helicobacter pylori Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 101000989653 Homo sapiens Membrane frizzled-related protein Proteins 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 102100029357 Membrane frizzled-related protein Human genes 0.000 description 1
- RJQXTJLFIWVMTO-TYNCELHUSA-N Methicillin Chemical compound COC1=CC=CC(OC)=C1C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 RJQXTJLFIWVMTO-TYNCELHUSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- GIVSZEFOLCRNOC-UHFFFAOYSA-N N-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline Chemical compound C(C)C1=CC(=C(ONC2=CC(=CC=C2)F)C=C1)OC GIVSZEFOLCRNOC-UHFFFAOYSA-N 0.000 description 1
- 229910017849 NH2—NH2 Inorganic materials 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 102000008024 Type I Fatty Acid Synthase Human genes 0.000 description 1
- 108010089879 Type I Fatty Acid Synthase Proteins 0.000 description 1
- 229910003106 Zn-Br Inorganic materials 0.000 description 1
- BSAJMGCDEQWBJU-UHFFFAOYSA-N [2,2,2-trifluoro-1-[4-(6-fluoropyridin-2-yl)oxy-3-methoxyphenyl]ethyl] 4-methylbenzenesulfonate Chemical compound COC1=CC(C(OS(=O)(=O)C=2C=CC(C)=CC=2)C(F)(F)F)=CC=C1OC1=CC=CC(F)=N1 BSAJMGCDEQWBJU-UHFFFAOYSA-N 0.000 description 1
- OTBXBNJIEOUPRV-UHFFFAOYSA-N [2-[6-(methanesulfonamido)pyridin-3-yl]oxy-5-propylphenyl] methanesulfonate Chemical compound CS(=O)(=O)OC1=CC(CCC)=CC=C1OC1=CC=C(NS(C)(=O)=O)N=C1 OTBXBNJIEOUPRV-UHFFFAOYSA-N 0.000 description 1
- XRNKIRCSBSYUGD-UHFFFAOYSA-N [3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1N1CC(COS(C)(=O)=O)OC1=O XRNKIRCSBSYUGD-UHFFFAOYSA-N 0.000 description 1
- VIAFQRYUYFLLIZ-UHFFFAOYSA-N [4-(6-fluoropyridin-2-yl)oxy-3-hydroxyphenyl]methyl acetate Chemical compound OC1=CC(COC(=O)C)=CC=C1OC1=CC=CC(F)=N1 VIAFQRYUYFLLIZ-UHFFFAOYSA-N 0.000 description 1
- OBIGDJOKRILHJJ-UHFFFAOYSA-N [5-ethyl-2-(6-fluoropyridin-2-yl)oxyphenyl] acetate Chemical compound CC(=O)OC1=CC(CC)=CC=C1OC1=CC=CC(F)=N1 OBIGDJOKRILHJJ-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005213 alkyl heteroaryl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 230000002141 anti-parasite Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003096 antiparasitic agent Substances 0.000 description 1
- 229940125687 antiparasitic agent Drugs 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical group OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- CSWRCFBCKMPDFN-UHFFFAOYSA-N bromo(oxo)borane Chemical compound BrB=O CSWRCFBCKMPDFN-UHFFFAOYSA-N 0.000 description 1
- 238000002815 broth microdilution Methods 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- SNRCKKQHDUIRIY-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloromethane;dichloropalladium;iron(2+) Chemical compound [Fe+2].ClCCl.Cl[Pd]Cl.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 SNRCKKQHDUIRIY-UHFFFAOYSA-L 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- PFWWSGFPICCWGU-UHFFFAOYSA-N cyclopropanesulfonyl chloride Chemical compound ClS(=O)(=O)C1CC1 PFWWSGFPICCWGU-UHFFFAOYSA-N 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 1
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical class C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- ZMMJGEGLRURXTF-UHFFFAOYSA-N ethidium bromide Chemical compound [Br-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CC)=C1C1=CC=CC=C1 ZMMJGEGLRURXTF-UHFFFAOYSA-N 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- RPWULZZPHHMPHY-LPYMAVHISA-N ethyl 2-[(e)-1-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]ethylideneamino]oxyacetate Chemical compound FC1=CC(C(/C)=N/OCC(=O)OCC)=CC=C1OC1=CC=C(CC)C=C1O RPWULZZPHHMPHY-LPYMAVHISA-N 0.000 description 1
- XIMFCGSNSKXPBO-UHFFFAOYSA-N ethyl 2-bromobutanoate Chemical compound CCOC(=O)C(Br)CC XIMFCGSNSKXPBO-UHFFFAOYSA-N 0.000 description 1
- KMPWQQDRYUSDCF-UHFFFAOYSA-N ethyl 4-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenoxy]butanoate Chemical compound FC1=CC(OCCCC(=O)OCC)=CC=C1OC1=CC=C(CC)C=C1O KMPWQQDRYUSDCF-UHFFFAOYSA-N 0.000 description 1
- IHLIVMCUQRQZGN-UHFFFAOYSA-N ethyl 4-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenoxy]butanoate Chemical compound FC1=CC(OCCCC(=O)OCC)=CC=C1OC1=CC=C(CC)C=C1OCC1=CC=CC=C1 IHLIVMCUQRQZGN-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 101150100150 fabI gene Proteins 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 229940047650 haemophilus influenzae Drugs 0.000 description 1
- 229940037467 helicobacter pylori Drugs 0.000 description 1
- 238000005570 heteronuclear single quantum coherence Methods 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 239000012479 in-house spinning solution Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229960003907 linezolid Drugs 0.000 description 1
- TYZROVQLWOKYKF-ZDUSSCGKSA-N linezolid Chemical compound O=C1O[C@@H](CNC(=O)C)CN1C(C=C1F)=CC=C1N1CCOCC1 TYZROVQLWOKYKF-ZDUSSCGKSA-N 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229940087646 methanolamine Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- CZXGXYBOQYQXQD-UHFFFAOYSA-N methyl benzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC=C1 CZXGXYBOQYQXQD-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- KNPNGMXRGITFLE-UHFFFAOYSA-N methylperoxy(phenyl)borinic acid Chemical compound COOB(O)C1=CC=CC=C1 KNPNGMXRGITFLE-UHFFFAOYSA-N 0.000 description 1
- JCDWETOKTFWTHA-UHFFFAOYSA-N methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC=CC=C1 JCDWETOKTFWTHA-UHFFFAOYSA-N 0.000 description 1
- 229960003085 meticillin Drugs 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- KRKPYFLIYNGWTE-UHFFFAOYSA-N n,o-dimethylhydroxylamine Chemical compound CNOC KRKPYFLIYNGWTE-UHFFFAOYSA-N 0.000 description 1
- JGNJLLBEOSMYOG-UHFFFAOYSA-N n-(3-aminopropyl)-n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]acetamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(N(CCCN)C(C)=O)C=C1F JGNJLLBEOSMYOG-UHFFFAOYSA-N 0.000 description 1
- FGGWVPFWYQQCQB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluorophenyl]methanesulfonamide Chemical compound C=1C=CC=CC=1COC1=CC(CC)=CC=C1OC1=CC=C(N(CCCN)S(C)(=O)=O)C=C1F FGGWVPFWYQQCQB-UHFFFAOYSA-N 0.000 description 1
- YHEXVXOMZKYOND-UHFFFAOYSA-N n-[2-[[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]sulfonylamino]ethyl]acetamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)NCCNC(C)=O)C=C1F YHEXVXOMZKYOND-UHFFFAOYSA-N 0.000 description 1
- NXJUYXQYFUYZQU-UHFFFAOYSA-N n-[3-(2-hydroxy-4-propylphenoxy)phenyl]acetamide Chemical compound OC1=CC(CCC)=CC=C1OC1=CC=CC(NC(C)=O)=C1 NXJUYXQYFUYZQU-UHFFFAOYSA-N 0.000 description 1
- WNEUBMXMGFIBED-UHFFFAOYSA-N n-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]-4-hydroxybutanamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(NC(=O)CCCO)C=C1F WNEUBMXMGFIBED-UHFFFAOYSA-N 0.000 description 1
- GRRIFXRLWVYHHZ-UHFFFAOYSA-N n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]-2,2,2-trifluoroethanesulfonamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(NS(=O)(=O)CC(F)(F)F)C=C1F GRRIFXRLWVYHHZ-UHFFFAOYSA-N 0.000 description 1
- LENKGLPZITZVOK-UHFFFAOYSA-N n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]-3-morpholin-4-ylpropane-1-sulfonamide Chemical compound COC1=CC(CC)=CC=C1OC(C(=C1)F)=CC=C1NS(=O)(=O)CCCN1CCOCC1 LENKGLPZITZVOK-UHFFFAOYSA-N 0.000 description 1
- RSDHMYLKKFXGPL-UHFFFAOYSA-N n-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]sulfonylacetamide Chemical compound COC1=CC(CC)=CC=C1OC1=CC=C(S(=O)(=O)NC(C)=O)C=C1F RSDHMYLKKFXGPL-UHFFFAOYSA-N 0.000 description 1
- USKHQAPKGBXZOL-UHFFFAOYSA-N n-[[3-[4-(4-ethyl-2-hydroxyphenoxy)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide Chemical compound OC1=CC(CC)=CC=C1OC1=CC=C(N2C(OC(CNC(C)=O)C2)=O)C=C1F USKHQAPKGBXZOL-UHFFFAOYSA-N 0.000 description 1
- IUJBHIGAJWHJFI-UHFFFAOYSA-N n-butyl-6-(4-ethyl-2-methoxyphenoxy)pyridin-2-amine Chemical compound CCCCNC1=CC=CC(OC=2C(=CC(CC)=CC=2)OC)=N1 IUJBHIGAJWHJFI-UHFFFAOYSA-N 0.000 description 1
- XYTCBLSVAGLDPL-UHFFFAOYSA-N n-ethyl-4-(4-ethyl-2-hydroxyphenoxy)-3-fluorobenzenesulfonamide Chemical compound FC1=CC(S(=O)(=O)NCC)=CC=C1OC1=CC=C(CC)C=C1O XYTCBLSVAGLDPL-UHFFFAOYSA-N 0.000 description 1
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical compound C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000005016 nuclear Overhauser enhanced spectroscopy Methods 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- YLNSNVGRSIOCEU-UHFFFAOYSA-N oxiran-2-ylmethyl butanoate Chemical compound CCCC(=O)OCC1CO1 YLNSNVGRSIOCEU-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- WXVUCMFEGJUVTN-UHFFFAOYSA-N phenyl methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=CC=C1 WXVUCMFEGJUVTN-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000011533 pre-incubation Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000009465 prokaryotic expression Effects 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- DROIHSMGGKKIJT-UHFFFAOYSA-N propane-1-sulfonamide Chemical compound CCCS(N)(=O)=O DROIHSMGGKKIJT-UHFFFAOYSA-N 0.000 description 1
- 125000003186 propargylic group Chemical group 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 238000009790 rate-determining step (RDS) Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008221 sterile excipient Substances 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- 125000006337 tetrafluoro ethyl group Chemical group 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 125000005000 thioaryl group Chemical group 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- 239000000606 toothpaste Substances 0.000 description 1
- 229940034610 toothpaste Drugs 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- DKZBBWMURDFHNE-UHFFFAOYSA-N trans-coniferylaldehyde Natural products COC1=CC(C=CC=O)=CC=C1O DKZBBWMURDFHNE-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- MWKJTNBSKNUMFN-UHFFFAOYSA-N trifluoromethyltrimethylsilane Chemical compound C[Si](C)(C)C(F)(F)F MWKJTNBSKNUMFN-UHFFFAOYSA-N 0.000 description 1
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- ZENOXNGFMSCLLL-UHFFFAOYSA-N vanillyl alcohol Chemical compound COC1=CC(CO)=CC=C1O ZENOXNGFMSCLLL-UHFFFAOYSA-N 0.000 description 1
- DSDCDMKASWVZHI-UHFFFAOYSA-M zinc;2-methanidylpropane;bromide Chemical compound Br[Zn+].CC(C)[CH2-] DSDCDMKASWVZHI-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
- A61P31/06—Antibacterial agents for tuberculosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
- A61P33/06—Antimalarials
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/38—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to a carbon atom of a six-membered aromatic ring, e.g. nitrodiphenyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/06—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of halogen atoms
- C07C209/08—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of halogen atoms with formation of amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/14—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/78—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C217/80—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings
- C07C217/82—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings of the same non-condensed six-membered aromatic ring
- C07C217/90—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings of the same non-condensed six-membered aromatic ring the oxygen atom of at least one of the etherified hydroxy groups being further bound to a carbon atom of a six-membered aromatic ring, e.g. amino-diphenylethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/32—Oximes
- C07C251/50—Oximes having oxygen atoms of oxyimino groups bound to carbon atoms of substituted hydrocarbon radicals
- C07C251/54—Oximes having oxygen atoms of oxyimino groups bound to carbon atoms of substituted hydrocarbon radicals of hydrocarbon radicals substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/73—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/16—Preparation of ethers by reaction of esters of mineral or organic acids with hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/26—Preparation of ethers by reactions not forming ether-oxygen bonds by introduction of hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/275—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings having all ether-oxygen atoms bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/295—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/50—Iso-indoles; Hydrogenated iso-indoles with oxygen and nitrogen atoms in positions 1 and 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/76—Nitrogen atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/092—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings with aromatic radicals attached to the chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Tropical Medicine & Parasitology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pulmonology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Indole Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP06290611.0 | 2006-04-14 | ||
| EP20060290611 EP1845087A1 (en) | 2006-04-14 | 2006-04-14 | Hydroxyphenyl derivatives and biological applications thereof |
| PCT/IB2007/002127 WO2007135562A2 (en) | 2006-04-14 | 2007-04-16 | Hydroxyphenyl derivatives and biological applications thereof |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| AU2007252917A1 AU2007252917A1 (en) | 2007-11-29 |
| AU2007252917B2 AU2007252917B2 (en) | 2012-05-10 |
| AU2007252917C1 true AU2007252917C1 (en) | 2014-05-29 |
Family
ID=37007447
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2007252917A Ceased AU2007252917C1 (en) | 2006-04-14 | 2007-04-16 | Hydroxyphenyl derivatives and biological applications thereof |
Country Status (8)
| Country | Link |
|---|---|
| US (3) | US8722746B2 (https=) |
| EP (2) | EP1845087A1 (https=) |
| JP (1) | JP5579432B2 (https=) |
| CN (1) | CN101500999B (https=) |
| AU (1) | AU2007252917C1 (https=) |
| CA (1) | CA2649196C (https=) |
| IL (1) | IL194781A (https=) |
| WO (1) | WO2007135562A2 (https=) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1845087A1 (en) | 2006-04-14 | 2007-10-17 | Mutabilis SA | Hydroxyphenyl derivatives and biological applications thereof |
| DE102008053242A1 (de) * | 2008-10-25 | 2010-05-06 | Saltigo Gmbh | Heteroaryl-Arylether |
| DK2473480T3 (en) * | 2009-09-01 | 2016-09-05 | Fab Pharma Sas | Novel antibacterial hydroxyphenylforbindelse |
| PL2491021T3 (pl) | 2009-10-20 | 2014-10-31 | Fab Pharma Sas | Nowe acylopiperazynony i ich zastosowanie jako środki farmaceutyczne |
| WO2011061214A1 (en) | 2009-11-18 | 2011-05-26 | Fab Pharma Sas | Novel heterocyclic acrylamides and their use as pharmaceuticals |
| WO2011106630A2 (en) | 2010-02-27 | 2011-09-01 | The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Chrysophaentin antimicrobial compounds that inhibit ftsz protein |
| EP2474313A1 (en) * | 2011-01-11 | 2012-07-11 | ABRA Pharmaceuticals sàrl | Novel self-assembling polyphenol-quinonoid polymer derivatives and use thereof |
| GB201522179D0 (en) * | 2015-12-16 | 2016-01-27 | Autifony Therapeutics Ltd | Novel compounds |
| US11905286B2 (en) | 2018-08-09 | 2024-02-20 | Antabio Sas | Diazabicyclooctanones as inhibitors of serine beta-lactamases |
| SG11202101255UA (en) | 2018-08-09 | 2021-03-30 | Antabio Sas | Diazabicyclooctanones as inhibitors of serine beta-lactamases |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3391195A (en) * | 1963-12-04 | 1968-07-02 | Monsanto Res Corp | Fluorinated polyphenyl ethers |
| CH1085567A4 (de) * | 1967-08-01 | 1969-03-14 | Ciba Geigy Ag | Verfahren zum antimikrobiellen Ausrüsten bzw. zum Schützen von Textilien gegen den Befall durch Mikroorganismen und eine Flotte bzw. ein Bad zur Durchführung dieses Verfahrens |
| GB1390616A (en) * | 1971-07-27 | 1975-04-16 | Ciba Geigy Ag | Antibacterial compositions |
| US5578295A (en) * | 1995-04-28 | 1996-11-26 | The Procter & Gamble Company | Oral care compositions comprising certain substituted diphenyl ethers |
| EP1042265A2 (en) * | 1997-12-12 | 2000-10-11 | Ciba SC Holding AG | O-derivatives of halogenated diphenyl ether compounds |
| GB9827391D0 (en) | 1998-12-11 | 1999-02-03 | Fundation O N C F | Aldose reductase inhibitors and pharmaceutical compositions |
| DE10015525A1 (de) | 2000-03-30 | 2001-10-11 | Deutsches Krebsforsch | Synthetische Derivate von Lunularsäure, Arzneimittel enthaltend diese Verbindung, Verfahren zur Herstellung der Lunularsäurederivate sowie deren Verwendung |
| AU2003225047A1 (en) * | 2002-04-18 | 2003-11-03 | Celmed Oncology (Usa), Inc. | Peptide deformylase activated prodrugs |
| FR2839448A1 (fr) * | 2002-05-07 | 2003-11-14 | Oreal | Utilisation d'esters de triclosan, de piroctone et de tropolone dans une composition a liberation controlee |
| AU2003290779A1 (en) * | 2002-11-14 | 2004-06-03 | Celmed Oncology (Usa), Inc. | Peptide deformylase activated prodrugs |
| US20090105349A1 (en) * | 2004-08-18 | 2009-04-23 | Warner-Lambert Company Llc | Androgen modulators |
| US7687547B2 (en) | 2004-08-23 | 2010-03-30 | Research Foundation Of State University Of New York | Diphenyl ether antimicrobial compounds |
| US20060211697A1 (en) * | 2004-12-08 | 2006-09-21 | Liren Huang | 2-(2 Or 4-substituted aryloxy)-phenol derivatives as antibacterial agents |
| US20070054884A1 (en) | 2005-08-31 | 2007-03-08 | Emergent Product Development Gaithersburg Inc. | 4-substituted 2-aryloxyphenol derivatives as antibacterial agents |
| EP1845087A1 (en) | 2006-04-14 | 2007-10-17 | Mutabilis SA | Hydroxyphenyl derivatives and biological applications thereof |
| DK2473480T3 (en) | 2009-09-01 | 2016-09-05 | Fab Pharma Sas | Novel antibacterial hydroxyphenylforbindelse |
-
2006
- 2006-04-14 EP EP20060290611 patent/EP1845087A1/en not_active Withdrawn
-
2007
- 2007-04-16 US US12/226,281 patent/US8722746B2/en not_active Expired - Fee Related
- 2007-04-16 CA CA2649196A patent/CA2649196C/en not_active Expired - Fee Related
- 2007-04-16 AU AU2007252917A patent/AU2007252917C1/en not_active Ceased
- 2007-04-16 EP EP07789559A patent/EP2010495A2/en not_active Withdrawn
- 2007-04-16 CN CN200780022244.8A patent/CN101500999B/zh not_active Expired - Fee Related
- 2007-04-16 JP JP2009504857A patent/JP5579432B2/ja not_active Expired - Fee Related
- 2007-04-16 WO PCT/IB2007/002127 patent/WO2007135562A2/en not_active Ceased
-
2008
- 2008-10-22 IL IL194781A patent/IL194781A/en not_active IP Right Cessation
-
2014
- 2014-03-28 US US14/228,893 patent/US9309179B2/en not_active Expired - Fee Related
-
2016
- 2016-03-08 US US15/063,891 patent/US20160185724A1/en not_active Abandoned
Non-Patent Citations (1)
| Title |
|---|
| KIM Y-K., et al, "Cytotoxic Components from Stem Bark of Magnolia obovata" Planta Medica,1999, Vol. 65(3), pages 291-292 * |
Also Published As
| Publication number | Publication date |
|---|---|
| JP5579432B2 (ja) | 2014-08-27 |
| US20140213589A1 (en) | 2014-07-31 |
| CN101500999B (zh) | 2014-01-15 |
| IL194781A0 (en) | 2009-08-03 |
| WO2007135562A2 (en) | 2007-11-29 |
| CN101500999A (zh) | 2009-08-05 |
| CA2649196C (en) | 2016-06-07 |
| US8722746B2 (en) | 2014-05-13 |
| CA2649196A1 (en) | 2007-11-29 |
| US9309179B2 (en) | 2016-04-12 |
| EP2010495A2 (en) | 2009-01-07 |
| US20160185724A1 (en) | 2016-06-30 |
| JP2009533417A (ja) | 2009-09-17 |
| AU2007252917B2 (en) | 2012-05-10 |
| AU2007252917A1 (en) | 2007-11-29 |
| EP1845087A1 (en) | 2007-10-17 |
| WO2007135562A3 (en) | 2008-01-24 |
| IL194781A (en) | 2013-08-29 |
| US20100041658A1 (en) | 2010-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2007252917C1 (en) | Hydroxyphenyl derivatives and biological applications thereof | |
| JP5227304B2 (ja) | 新規なヒドロキサム酸誘導体 | |
| CN111138301B (zh) | 联苯类化合物、其中间体、制备方法、药物组合物及应用 | |
| JP6267729B2 (ja) | 大環状ピリダジノン誘導体 | |
| EP3022184B1 (en) | Substituted benzene compounds | |
| TW403748B (en) | An oxazolidinedione derivative, its production and a pharmaceutical composition for lowering blood sugar and lipid in blood comprising the same | |
| US11434246B2 (en) | EP4 antagonists | |
| US20180022731A1 (en) | 2-(pyridin-3-yl)-pyrimidine derivatives as ret inhibitors | |
| WO2015010078A2 (en) | Substituted 6,5-fused bicyclic heteroaryl compounds | |
| WO2007037534A1 (ja) | 2-へテロアリール置換インドール誘導体 | |
| AU2013361060A1 (en) | 1,4-pyridone compounds | |
| EP2935214A1 (en) | 1,4-pyridone compounds | |
| JP2018516250A (ja) | 四置換アルケン化合物及びその使用 | |
| AU2007337003A1 (en) | MAPK/ERK kinase inhibitors | |
| JPWO2010024356A1 (ja) | ナフチリジン−n−オキシドを有する新規ヒドロキサム酸誘導体 | |
| NL1031335C2 (nl) | Gesubstitueerde N-sulfonylaminofenylethyl-2-fenoxyaceetamideverbindingen. | |
| CN119421874A (zh) | 一种芳香酰胺类衍生物及其在抗肿瘤药物中的应用 | |
| JPS62164667A (ja) | 新規なピリジン−誘導体およびそれらのn−オキシド、それらの製造方法および植物保護剤製造用の中間生成物としてのそれらの用途 | |
| TWI361806B (en) | Arylsulfonylmethyl or arylsulfonamide substituted aromatic compounds suitable for treating disorders that respond to modulation of the dopamine d3 receptor | |
| CN104869997A (zh) | 作为二酰基甘油酰基转移酶抑制剂的新型化合物 | |
| US9988361B2 (en) | Anti-enterovirus 71 thiadiazolidine derivative | |
| AU2024266935A1 (en) | Phenoxy(hetero)aryl ethers of antiproliferative activity | |
| US20100120717A1 (en) | Kinase inhibitors | |
| BRPI0614039A2 (pt) | inibidores isotopicamente substituìdos da bomba de prótons | |
| TW202613090A (zh) | 乳酸脫氫酶抑制劑、包含該抑制劑的組合物及其使用方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC1 | Assignment before grant (sect. 113) |
Owner name: FAB PHARMA Free format text: FORMER APPLICANT(S): MUTABILIS S.A. |
|
| FGA | Letters patent sealed or granted (standard patent) | ||
| DA2 | Applications for amendment section 104 |
Free format text: THE NATURE OF THE AMENDMENT IS AS SHOWN IN THE STATEMENT(S) FILED 20 DEC 2013 . |
|
| DA3 | Amendments made section 104 |
Free format text: THE NATURE OF THE AMENDMENT IS AS SHOWN IN THE STATEMENT(S) FILED 20 DEC 2013 |
|
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |