AU1855676A - Clavulanic acid derivatives - Google Patents
Clavulanic acid derivativesInfo
- Publication number
- AU1855676A AU1855676A AU18556/76A AU1855676A AU1855676A AU 1855676 A AU1855676 A AU 1855676A AU 18556/76 A AU18556/76 A AU 18556/76A AU 1855676 A AU1855676 A AU 1855676A AU 1855676 A AU1855676 A AU 1855676A
- Authority
- AU
- Australia
- Prior art keywords
- acid derivatives
- clavulanic acid
- clavulanic
- derivatives
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical class OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D503/00—Heterocyclic compounds containing 4-oxa-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxapenicillins, clavulanic acid derivatives; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB41889/75A GB1504426A (en) | 1975-10-13 | 1975-10-13 | Clavulanic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU1855676A true AU1855676A (en) | 1978-04-20 |
Family
ID=10421824
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU18556/76A Expired AU1855676A (en) | 1975-10-13 | 1976-10-11 | Clavulanic acid derivatives |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4132712A (enExample) |
| JP (1) | JPS5248685A (enExample) |
| AU (1) | AU1855676A (enExample) |
| BE (1) | BE846678A (enExample) |
| CH (1) | CH602743A5 (enExample) |
| DE (1) | DE2645999A1 (enExample) |
| DK (1) | DK142990C (enExample) |
| FR (1) | FR2327774A1 (enExample) |
| GB (1) | GB1504426A (enExample) |
| IE (1) | IE43529B1 (enExample) |
| NL (1) | NL7611205A (enExample) |
| SE (1) | SE7611044L (enExample) |
| ZA (1) | ZA765221B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES463484A1 (es) * | 1976-10-25 | 1978-11-16 | Glaxo Lab Ltd | Un procedimiento de preparacion de derivados del acido aci- lamino-clavulanico. |
| US4407751A (en) * | 1979-02-13 | 1983-10-04 | Leo Pharmaceutical Products Ltd. A/S (Lovens Kemiske Fabrik Produktionsaktieselskab) | Processes for preparing β-lactams |
| JPS55125997U (enExample) * | 1979-02-28 | 1980-09-06 | ||
| JPS5927194U (ja) * | 1982-08-11 | 1984-02-20 | 三洋電機株式会社 | 送風装置 |
| US20030219867A1 (en) * | 1993-07-24 | 2003-11-27 | Smithkline Beecham Plc | Clavulanic acid dehydrogenase, preparation and use for the production of clavulanic acid |
| GB9315393D0 (en) * | 1993-07-24 | 1993-09-08 | Smithkline Beecham Plc | Novel product |
-
1975
- 1975-10-13 GB GB41889/75A patent/GB1504426A/en not_active Expired
-
1976
- 1976-08-23 IE IE1877/76A patent/IE43529B1/en unknown
- 1976-08-26 US US05/717,900 patent/US4132712A/en not_active Expired - Lifetime
- 1976-08-31 ZA ZA765221A patent/ZA765221B/xx unknown
- 1976-09-24 FR FR7628774A patent/FR2327774A1/fr active Granted
- 1976-09-28 BE BE171020A patent/BE846678A/xx unknown
- 1976-10-05 SE SE7611044A patent/SE7611044L/xx unknown
- 1976-10-11 NL NL7611205A patent/NL7611205A/xx not_active Application Discontinuation
- 1976-10-11 AU AU18556/76A patent/AU1855676A/en not_active Expired
- 1976-10-12 DK DK457376A patent/DK142990C/da active
- 1976-10-12 DE DE19762645999 patent/DE2645999A1/de not_active Withdrawn
- 1976-10-12 JP JP51122724A patent/JPS5248685A/ja active Pending
- 1976-10-12 CH CH1290076A patent/CH602743A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH602743A5 (enExample) | 1978-07-31 |
| BE846678A (fr) | 1977-03-28 |
| ZA765221B (en) | 1977-08-31 |
| US4132712A (en) | 1979-01-02 |
| DE2645999A1 (de) | 1977-04-21 |
| DK457376A (da) | 1977-04-14 |
| FR2327774B1 (enExample) | 1978-11-17 |
| DK142990B (da) | 1981-03-09 |
| FR2327774A1 (fr) | 1977-05-13 |
| IE43529B1 (en) | 1981-03-25 |
| JPS5248685A (en) | 1977-04-18 |
| SE7611044L (sv) | 1977-04-14 |
| NL7611205A (nl) | 1977-04-15 |
| IE43529L (en) | 1977-04-13 |
| DK142990C (da) | 1981-10-19 |
| GB1504426A (en) | 1978-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU1934876A (en) | Hydroxybenzylmalonic acid derivatives | |
| ZA762285B (en) | New phenyl-alkane-carboxylic acid derivatives | |
| AU511853B2 (en) | l-Phenyl-2-Oxo-Pyrroliaine-4-carboxylic acid derivatives | |
| NZ182908A (en) | 2-tertiaryaminoindol-3-ylcarboxylic acid derivatives | |
| AU503489B2 (en) | Substituted aminodeoxy clavulanic acid | |
| GB1518449A (en) | Hydroxybenzylmalonic acid derivatives | |
| AU503529B2 (en) | Clavulanic acid | |
| AU501066B2 (en) | Fudidic acid derivatives | |
| AU509313B2 (en) | Clavulanic acid | |
| AU506250B2 (en) | Clavulanic acid derivatives | |
| ZA765531B (en) | New phenoxyalkylcarboxylic acid derivatives | |
| ZA766183B (en) | New phenoxyalkylcarboxylic acid derivatives | |
| KE3292A (en) | Clavulanic acid derivatives | |
| ZA767496B (en) | Etherified clavulanic acid derivatives | |
| AU1855676A (en) | Clavulanic acid derivatives | |
| GB1547169A (en) | Clavulanic acid derivatives | |
| GB1542405A (en) | Clavulanic acid derivatives | |
| ZA764209B (en) | Azanaphthaleneacetic acid derivatives | |
| IE43457L (en) | 1-deoxyribofuranuronic acid derivatives | |
| AU500980B2 (en) | Oxanilic acid derivatives | |
| AU497577B2 (en) | Clavulanic acid derivatives | |
| GB1535373A (en) | Prostenoic acid derivatives | |
| GB1523813A (en) | Diocamic acid derivatives | |
| AU1337876A (en) | Novel 8-azaprostanoic acid derivatives | |
| MY8400298A (en) | Clavulanic acid derivatives |