AT382594B - Verfahren zur herstellung von natriumpercarbonat - Google Patents
Verfahren zur herstellung von natriumpercarbonatInfo
- Publication number
- AT382594B AT382594B AT0599274A AT599274A AT382594B AT 382594 B AT382594 B AT 382594B AT 0599274 A AT0599274 A AT 0599274A AT 599274 A AT599274 A AT 599274A AT 382594 B AT382594 B AT 382594B
- Authority
- AT
- Austria
- Prior art keywords
- sodium percarbonate
- producing sodium
- producing
- percarbonate
- sodium
- Prior art date
Links
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 229940045872 sodium percarbonate Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/10—Peroxyhydrates; Peroxyacids or salts thereof containing carbon
- C01B15/103—Peroxyhydrates; Peroxyacids or salts thereof containing carbon containing only alkali metals as metals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7326674A FR2237833B1 (Direct) | 1973-07-20 | 1973-07-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA599274A ATA599274A (de) | 1986-08-15 |
| AT382594B true AT382594B (de) | 1987-03-10 |
Family
ID=9122901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0599274A AT382594B (de) | 1973-07-20 | 1974-07-19 | Verfahren zur herstellung von natriumpercarbonat |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4022874A (Direct) |
| JP (1) | JPS5113760B2 (Direct) |
| AT (1) | AT382594B (Direct) |
| BE (1) | BE816418A (Direct) |
| BR (1) | BR7405967D0 (Direct) |
| CA (1) | CA1033533A (Direct) |
| CH (1) | CH597093A5 (Direct) |
| DE (1) | DE2434531B2 (Direct) |
| DK (1) | DK141994B (Direct) |
| ES (1) | ES428424A1 (Direct) |
| FR (1) | FR2237833B1 (Direct) |
| GB (1) | GB1479738A (Direct) |
| IE (1) | IE39579B1 (Direct) |
| IT (1) | IT1014466B (Direct) |
| LU (1) | LU70565A1 (Direct) |
| NL (1) | NL185659C (Direct) |
| NO (1) | NO138845C (Direct) |
| SE (1) | SE400540B (Direct) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2380221A1 (fr) * | 1977-02-11 | 1978-09-08 | Ugine Kuhlmann | Perfectionnement au procede de preparation du percarbonate de sodium |
| FR2410627A1 (fr) * | 1977-12-02 | 1979-06-29 | Ugine Kuhlmann | Persels mixtes stables en melange lixiviel |
| JPS5644863A (en) * | 1979-09-20 | 1981-04-24 | Toshiba Corp | Characteristic testing terminal device for electronic equipment |
| JPS5833164B2 (ja) * | 1980-07-04 | 1983-07-18 | 花王株式会社 | 中空顆粒状過炭酸塩及びその製造方法 |
| US5328721A (en) * | 1992-07-30 | 1994-07-12 | Fmc Corporation | Process for manufacturing sodium carbonate perhydrate particles and coating them with sodium borosilicate |
| US5756445A (en) * | 1993-11-11 | 1998-05-26 | The Proctor & Gamble Company | Granular detergent composition comprising a low bulk density component |
| IT1290477B1 (it) * | 1997-03-26 | 1998-12-04 | Solvay Interox | Processo per produrre un persale |
| CA2275390A1 (en) * | 1996-12-16 | 1998-06-25 | Solvay Interox Gmbh | Method to produce sodium percarbonate |
| KR100494814B1 (ko) * | 2003-02-17 | 2005-06-13 | 동양제철화학 주식회사 | 입상 과탄산나트륨의 제조방법 |
| CN105060497B (zh) * | 2015-07-16 | 2017-06-20 | 华南理工大学 | 一种去除养殖水体亚硝酸盐的复合增氧剂及制备方法 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE560460C (de) * | 1927-07-27 | 1932-10-03 | Fritz Schlotterbeck Dr | Herstellung technisch stabiler, aktiven Sauerstoff abgebender Praeparate |
| FR937028A (fr) * | 1942-01-15 | 1948-08-05 | Produits Peroxydes Soc D | Lessive alcaline contenant de l'oxygène actif |
| FR937033A (fr) * | 1943-07-09 | 1948-08-05 | Produits Peroxydes Soc D | Perfectionnements dans la fabrication de lessives contenant de l'oxygène actif |
| DE1957825A1 (de) * | 1968-11-20 | 1970-06-11 | Solvay | Verfahren zur Herstellung von Natriumpercarbonat von geringem scheinbaren spezifischen Gewicht |
| DE2133566A1 (de) * | 1970-07-06 | 1972-01-20 | Laporte Industries Ltd., London | Verfahren zur Herstellung von Percarbonaten |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR869104A (fr) * | 1940-09-13 | 1942-01-24 | Electrochimie Soc | Procédé de préparation des combinaisons oxygénees du carbonate de soude |
| US2986448A (en) * | 1958-12-18 | 1961-05-30 | Allied Chem | Preparation of sodium percarbonate |
| GB1165154A (en) * | 1965-12-10 | 1969-09-24 | Laporte Chemical | Peroxygen Compounds |
| IT986371B (it) * | 1972-06-02 | 1975-01-30 | Degussa | Procedimento per la produzione di percarbonato alcalino |
| US3860694A (en) * | 1972-08-31 | 1975-01-14 | Du Pont | Process for the preparation of perhydrates |
-
1973
- 1973-07-20 FR FR7326674A patent/FR2237833B1/fr not_active Expired
-
1974
- 1974-06-17 BE BE145494A patent/BE816418A/xx not_active IP Right Cessation
- 1974-07-01 IE IE1384/74A patent/IE39579B1/xx unknown
- 1974-07-04 IT IT69140/74A patent/IT1014466B/it active
- 1974-07-04 GB GB29734/74A patent/GB1479738A/en not_active Expired
- 1974-07-11 US US05/487,613 patent/US4022874A/en not_active Expired - Lifetime
- 1974-07-17 CA CA205,105A patent/CA1033533A/en not_active Expired
- 1974-07-18 DE DE2434531A patent/DE2434531B2/de active Granted
- 1974-07-18 LU LU70565A patent/LU70565A1/xx unknown
- 1974-07-19 SE SE7409467A patent/SE400540B/xx not_active IP Right Cessation
- 1974-07-19 DK DK390174AA patent/DK141994B/da not_active IP Right Cessation
- 1974-07-19 BR BR5967/74A patent/BR7405967D0/pt unknown
- 1974-07-19 AT AT0599274A patent/AT382594B/de not_active IP Right Cessation
- 1974-07-19 ES ES428424A patent/ES428424A1/es not_active Expired
- 1974-07-19 NL NLAANVRAGE7409804,A patent/NL185659C/xx not_active IP Right Cessation
- 1974-07-19 CH CH1001874A patent/CH597093A5/xx not_active IP Right Cessation
- 1974-07-19 NO NO74742630A patent/NO138845C/no unknown
- 1974-07-20 JP JP49082762A patent/JPS5113760B2/ja not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE560460C (de) * | 1927-07-27 | 1932-10-03 | Fritz Schlotterbeck Dr | Herstellung technisch stabiler, aktiven Sauerstoff abgebender Praeparate |
| FR937028A (fr) * | 1942-01-15 | 1948-08-05 | Produits Peroxydes Soc D | Lessive alcaline contenant de l'oxygène actif |
| FR937033A (fr) * | 1943-07-09 | 1948-08-05 | Produits Peroxydes Soc D | Perfectionnements dans la fabrication de lessives contenant de l'oxygène actif |
| DE1957825A1 (de) * | 1968-11-20 | 1970-06-11 | Solvay | Verfahren zur Herstellung von Natriumpercarbonat von geringem scheinbaren spezifischen Gewicht |
| DE2133566A1 (de) * | 1970-07-06 | 1972-01-20 | Laporte Industries Ltd., London | Verfahren zur Herstellung von Percarbonaten |
Also Published As
| Publication number | Publication date |
|---|---|
| US4022874A (en) | 1977-05-10 |
| NL185659C (nl) | 1990-06-18 |
| DK390174A (Direct) | 1975-03-24 |
| SE400540B (sv) | 1978-04-03 |
| FR2237833A1 (Direct) | 1975-02-14 |
| AU7252674A (en) | 1976-02-26 |
| CA1033533A (en) | 1978-06-27 |
| SE7409467L (Direct) | 1975-01-21 |
| CH597093A5 (Direct) | 1978-03-31 |
| NO138845B (no) | 1978-08-14 |
| FR2237833B1 (Direct) | 1976-04-30 |
| ATA599274A (de) | 1986-08-15 |
| BR7405967D0 (pt) | 1975-05-13 |
| IE39579B1 (en) | 1978-11-08 |
| GB1479738A (en) | 1977-07-13 |
| DE2434531B2 (de) | 1978-08-24 |
| NL185659B (nl) | 1990-01-16 |
| NL7409804A (nl) | 1975-01-22 |
| DK141994C (Direct) | 1980-12-22 |
| DE2434531C3 (Direct) | 1979-07-19 |
| JPS5044199A (Direct) | 1975-04-21 |
| IT1014466B (it) | 1977-04-20 |
| NO742630L (Direct) | 1975-02-17 |
| DE2434531A1 (de) | 1975-02-13 |
| NO138845C (no) | 1978-11-22 |
| BE816418A (fr) | 1974-10-16 |
| ES428424A1 (es) | 1977-05-16 |
| IE39579L (en) | 1975-01-20 |
| JPS5113760B2 (Direct) | 1976-05-01 |
| DK141994B (da) | 1980-08-04 |
| LU70565A1 (Direct) | 1974-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT341504B (de) | Verfahren zur herstellung von alfa-arylpropionsauren | |
| AT345250B (de) | Verfahren zur herstellung von natriumpercarbonat | |
| AT331773B (de) | Verfahren zur herstellung von 3-methylmercaptopropionaldehyd | |
| AT341783B (de) | Verfahren zur herstellung von polylactonen | |
| AT331259B (de) | Verfahren zur herstellung von 5-fluorcytosin | |
| AT382594B (de) | Verfahren zur herstellung von natriumpercarbonat | |
| AT349433B (de) | Verfahren zur herstellung von natriumpercarbonat | |
| AT336634B (de) | Verfahren zur herstellung von poly-n-alkyliminoalanen | |
| AT344136B (de) | Verfahren zur herstellung von neuem 2-deutero-3-fluor-dl-alanin | |
| AT351167B (de) | Verfahren zur herstellung von allopurinol- haltigen tabletten | |
| AT335456B (de) | Verfahren zur herstellung von cyanpyridinen | |
| AT343629B (de) | Verfahren zur herstellung von 2-arylpropionaldehyden | |
| AT329525B (de) | Verfahren zur herstellung von polyalkenen | |
| AT357509B (de) | Verfahren zur herstellung von alkali- percarbonaten | |
| AT335609B (de) | Verfahren zur herstellung von cephemverbindungen | |
| AT346275B (de) | Verfahren zur herstellung von briketts | |
| ATA652574A (de) | Verfahren zur herstellung von 6-methyl-5-hepten-2-onverfahren zur herstellung von 6-methyl-5-hepten-2-on | |
| DD131062A3 (de) | Verfahren zur herstellung von lagerfaehigen duengemitteln | |
| AT340884B (de) | Verfahren zur herstellung von substituierten alkinolen | |
| AT387375B (de) | Kontinuierliches verfahren zur herstellung von chlordioxid | |
| AT337708B (de) | Verfahren zur herstellung von phthalobis-guanaminen | |
| AT340887B (de) | Verfahren zur herstellung von n-halogenketiminen | |
| AT335588B (de) | Verfahren zur herstellung von waschmitteln | |
| DD129958A3 (de) | Verfahren zur herstellung von natriumgoldsulfit | |
| ATA318476A (de) | Verfahren zur herstellung von 2,6-dihydroxycineol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |