AT372804B - Lochmasken-farbkathodenstrahlroehre - Google Patents
Lochmasken-farbkathodenstrahlroehreInfo
- Publication number
- AT372804B AT372804B AT0367178A AT367178A AT372804B AT 372804 B AT372804 B AT 372804B AT 0367178 A AT0367178 A AT 0367178A AT 367178 A AT367178 A AT 367178A AT 372804 B AT372804 B AT 372804B
- Authority
- AT
- Austria
- Prior art keywords
- color cathode
- mask color
- punch mask
- cathode pipes
- pipes
- Prior art date
Links
- IHPYMWDTONKSCO-UHFFFAOYSA-N 2,2'-piperazine-1,4-diylbisethanesulfonic acid Chemical compound OS(=O)(=O)CCN1CCN(CCS(O)(=O)=O)CC1 IHPYMWDTONKSCO-UHFFFAOYSA-N 0.000 title 1
- 239000007990 PIPES buffer Substances 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/02—Electrodes; Screens; Mounting, supporting, spacing or insulating thereof
- H01J29/06—Screens for shielding; Masks interposed in the electron stream
- H01J29/07—Shadow masks for colour television tubes
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/799,078 US4131822A (en) | 1977-05-20 | 1977-05-20 | Cathode ray tube with stress-relieved slot-aperture shadow mask |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA367178A ATA367178A (de) | 1983-03-15 |
| AT372804B true AT372804B (de) | 1983-11-25 |
Family
ID=25174991
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0367178A AT372804B (de) | 1977-05-20 | 1978-05-19 | Lochmasken-farbkathodenstrahlroehre |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4131822A (de) |
| JP (1) | JPS53145469A (de) |
| AT (1) | AT372804B (de) |
| AU (1) | AU3582378A (de) |
| BR (1) | BR7803062A (de) |
| CA (1) | CA1111489A (de) |
| DE (1) | DE2822016C3 (de) |
| ES (1) | ES469770A1 (de) |
| FI (1) | FI781510A7 (de) |
| FR (1) | FR2391554A1 (de) |
| GB (1) | GB1597926A (de) |
| IT (1) | IT1096227B (de) |
| MX (1) | MX4198E (de) |
| NL (1) | NL7805462A (de) |
| PL (1) | PL117549B1 (de) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4300069A (en) * | 1979-12-18 | 1981-11-10 | Rca Corporation | Color picture tube having improved slit type shadow mask and method of making same |
| US5243253A (en) * | 1991-07-30 | 1993-09-07 | Thomson Consumer Electronics, Inc. | Color picture tube having shadow mask with improved tie bar grading |
| EP0841679B1 (de) * | 1996-11-11 | 2003-02-12 | Kabushiki Kaisha Toshiba | Schattenmaske und Verfahren zu deren Herstellung |
| JP2002110063A (ja) * | 2000-09-28 | 2002-04-12 | Dainippon Printing Co Ltd | シャドウマスク |
| US6674224B2 (en) * | 2001-03-06 | 2004-01-06 | Thomson Licensing S.A. | Tension focus mask for a cathode-ray tube (CRT) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3653900A (en) * | 1969-08-15 | 1972-04-04 | Zenith Radio Corp | Selective etching process for changing shadow-mask aperture size |
| US3916243A (en) * | 1974-09-20 | 1975-10-28 | Buckbee Mears Co | Channeled shadow mask |
| US4048536A (en) * | 1976-03-18 | 1977-09-13 | Buckbee-Mears Company | Shadow mask with plurality of recessed regions extending across mask in two directions |
-
1977
- 1977-05-20 US US05/799,078 patent/US4131822A/en not_active Expired - Lifetime
-
1978
- 1978-05-05 AU AU35823/78A patent/AU3582378A/en active Pending
- 1978-05-09 MX MX78100598U patent/MX4198E/es unknown
- 1978-05-12 GB GB19160/78A patent/GB1597926A/en not_active Expired
- 1978-05-12 FI FI781510A patent/FI781510A7/fi not_active Application Discontinuation
- 1978-05-12 ES ES469770A patent/ES469770A1/es not_active Expired
- 1978-05-16 BR BR7803062A patent/BR7803062A/pt unknown
- 1978-05-16 CA CA303,496A patent/CA1111489A/en not_active Expired
- 1978-05-17 IT IT23526/78A patent/IT1096227B/it active
- 1978-05-19 AT AT0367178A patent/AT372804B/de not_active IP Right Cessation
- 1978-05-19 NL NL7805462A patent/NL7805462A/xx not_active Application Discontinuation
- 1978-05-19 FR FR7814843A patent/FR2391554A1/fr active Granted
- 1978-05-19 DE DE2822016A patent/DE2822016C3/de not_active Expired
- 1978-05-19 JP JP6055578A patent/JPS53145469A/ja active Granted
- 1978-05-20 PL PL1978206969A patent/PL117549B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2822016A1 (de) | 1978-11-23 |
| DE2822016C3 (de) | 1980-07-24 |
| IT1096227B (it) | 1985-08-26 |
| PL117549B1 (en) | 1981-08-31 |
| CA1111489A (en) | 1981-10-27 |
| JPS5747539B2 (de) | 1982-10-09 |
| FR2391554B1 (de) | 1983-04-22 |
| MX4198E (es) | 1982-01-26 |
| AU3582378A (en) | 1979-11-08 |
| DE2822016B2 (de) | 1979-11-08 |
| ES469770A1 (es) | 1979-01-01 |
| BR7803062A (pt) | 1979-01-02 |
| US4131822A (en) | 1978-12-26 |
| JPS53145469A (en) | 1978-12-18 |
| GB1597926A (en) | 1981-09-16 |
| NL7805462A (nl) | 1978-11-22 |
| FR2391554A1 (fr) | 1978-12-15 |
| PL206969A1 (pl) | 1979-02-12 |
| IT7823526A0 (it) | 1978-05-17 |
| FI781510A7 (fi) | 1978-11-21 |
| ATA367178A (de) | 1983-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT361088B (de) | Drehanodenroentgenroehre | |
| FI772143A7 (fi) | Laongzonspress foer pappersmaskin | |
| FI772651A7 (fi) | Maskin foer fastpressning av kopplingsstycken foer slangar | |
| BR7804920A (pt) | Conjunto de gaxeta | |
| SE7810944L (sv) | Tornpackning | |
| ATA204976A (de) | Kathodenstrahlrohre mit lochmaske | |
| DK205178A (da) | Pilleteringspresse | |
| SE7808406L (sv) | Katod | |
| PL207769A1 (pl) | Kineskop maskowy | |
| PL208046A1 (pl) | Kineskop maskowy | |
| PL208047A1 (pl) | Kineskop maskowy | |
| IT1096922B (it) | Anodo | |
| AT372804B (de) | Lochmasken-farbkathodenstrahlroehre | |
| SE7801650L (sv) | Fartygskuggvexel | |
| FI781488A7 (fi) | Regleringsarrangemang foer kontunuerligt fungerande press | |
| AT355100B (de) | Lochmasken-kathodenstrahlroehre | |
| AT376061B (de) | Lochmasken-kathodenstrahlroehre | |
| BR7802759A (pt) | Prensa tipografica | |
| BR7807960A (pt) | Prensa | |
| BE866863A (fr) | Anodes | |
| JPS53134367A (en) | Xxray mask | |
| FI782652A7 (fi) | Stigortsmaskin | |
| FI782709A7 (fi) | Formningsmaskin foer pappersbana | |
| JPS5387598A (en) | Mask | |
| FI783302A7 (fi) | Klockspelsmaskin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| ELJ | Ceased due to non-payment of the annual fee |