AT332257B - Antriebsanordnung beim turbinenspinnen - Google Patents
Antriebsanordnung beim turbinenspinnenInfo
- Publication number
- AT332257B AT332257B AT633273A AT633273A AT332257B AT 332257 B AT332257 B AT 332257B AT 633273 A AT633273 A AT 633273A AT 633273 A AT633273 A AT 633273A AT 332257 B AT332257 B AT 332257B
- Authority
- AT
- Austria
- Prior art keywords
- drive arrangement
- turbine spinning
- spinning
- turbine
- arrangement
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
- 238000009987 spinning Methods 0.000 title 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H4/00—Open-end spinning machines or arrangements for imparting twist to independently moving fibres separated from slivers; Piecing arrangements therefor; Covering endless core threads with fibres by open-end spinning techniques
- D01H4/42—Control of driving or stopping
- D01H4/44—Control of driving or stopping in rotor spinning
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Spinning Or Twisting Of Yarns (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722235686 DE2235686A1 (de) | 1972-07-20 | 1972-07-20 | Antriebsanordnung beim turbinenspinnen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA633273A ATA633273A (de) | 1975-12-15 |
| AT332257B true AT332257B (de) | 1976-09-27 |
Family
ID=5851198
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT633273A AT332257B (de) | 1972-07-20 | 1973-07-18 | Antriebsanordnung beim turbinenspinnen |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS4942933A (cs) |
| AT (1) | AT332257B (cs) |
| BE (1) | BE802546A (cs) |
| CH (1) | CH559255A5 (cs) |
| CS (1) | CS177136B2 (cs) |
| DE (1) | DE2235686A1 (cs) |
| FR (1) | FR2193891B1 (cs) |
| GB (1) | GB1418155A (cs) |
| IT (1) | IT992640B (cs) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5512866A (en) * | 1978-07-11 | 1980-01-29 | Towa Kogyo Kk | Method of driving pneumatic clearer in spinning machine |
| DE2911378A1 (de) * | 1979-03-23 | 1980-10-02 | Zinser Textilmaschinen Gmbh | Ringspinn- oder ringzwirnmaschine |
| DE3113909A1 (de) * | 1981-03-20 | 1982-09-30 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Textilmaschine |
| DE3309789A1 (de) * | 1983-03-18 | 1984-09-20 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Spinnereimaschine zum aufwinden von faeden |
| DE3619647A1 (de) * | 1986-06-11 | 1987-12-17 | Zinser Textilmaschinen Gmbh | Verfahren und vorrichtung zum einzelmotorischen antrieb einer spindel bei einer spinnmaschine |
| DE3822420A1 (de) * | 1988-07-02 | 1990-01-04 | Skf Textilmasch Komponenten | Ringspinn-/oder ringzwirnmaschine |
| DE3838418A1 (de) * | 1988-11-12 | 1990-05-17 | Zinser Textilmaschinen Gmbh | Spinnereimaschine, mit mehreren ueber die laenge der maschine verteilten elektromotoren |
| DE4411293C2 (de) * | 1994-03-31 | 1996-05-30 | Palitex Project Co Gmbh | Antriebsvorrichtung für ein mit hoher Drehzahl rotierendes Bauteil |
| DE10062096B4 (de) * | 1999-12-29 | 2012-06-14 | Rieter Ingolstadt Gmbh | Spinnmaschine mit mehrere Einzelantriebe aufweisenden Spinnstellen |
| EP1422323B1 (de) * | 2002-11-20 | 2017-04-12 | Maschinenfabrik Rieter Ag | Modulare Luftspinnmaschine |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3780513A (en) * | 1970-04-08 | 1973-12-25 | Toyoda Automatic Loom Works | Method and apparatus for driving open-end spinning frame |
| JPS5034649B1 (cs) * | 1970-04-18 | 1975-11-10 |
-
1972
- 1972-07-20 DE DE19722235686 patent/DE2235686A1/de active Pending
-
1973
- 1973-07-16 CS CS508473A patent/CS177136B2/cs unknown
- 1973-07-18 AT AT633273A patent/AT332257B/de not_active IP Right Cessation
- 1973-07-18 CH CH1052973A patent/CH559255A5/xx not_active IP Right Cessation
- 1973-07-18 IT IT2670673A patent/IT992640B/it active
- 1973-07-19 JP JP8258873A patent/JPS4942933A/ja active Pending
- 1973-07-19 FR FR7326579A patent/FR2193891B1/fr not_active Expired
- 1973-07-19 BE BE133646A patent/BE802546A/xx unknown
- 1973-07-20 GB GB3485473A patent/GB1418155A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CS177136B2 (cs) | 1977-07-29 |
| IT992640B (it) | 1975-09-30 |
| FR2193891B1 (cs) | 1976-05-07 |
| JPS4942933A (cs) | 1974-04-23 |
| GB1418155A (en) | 1975-12-17 |
| DE2235686A1 (de) | 1974-01-31 |
| FR2193891A1 (cs) | 1974-02-22 |
| ATA633273A (de) | 1975-12-15 |
| CH559255A5 (cs) | 1975-02-28 |
| BE802546A (fr) | 1973-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AR195944A1 (es) | Mejoras en transmisiones | |
| SE389172B (sv) | Kompressorrotor | |
| BR7303545D0 (pt) | Aperfeicoamentos em compressor helicoidal rotativo | |
| AR197682A1 (es) | Mejoras en una construccion de cojinete | |
| AT326759B (de) | Rotierende gleichrichtbranordnung | |
| IT964163B (it) | Rotore saldato | |
| SE385138B (sv) | Fiberarmerat rotoraggregat | |
| FI56449B (fi) | Vingstabiliserad projektil | |
| BE799254A (fr) | Esters partiels | |
| AT332257B (de) | Antriebsanordnung beim turbinenspinnen | |
| DK146273C (da) | Maskindreven pladesaks | |
| IT979439B (it) | Azocoloranti reattivi | |
| AR194557A1 (es) | Mejoras en cajas de velocidades | |
| AT330824B (de) | Schienenschleifgerat | |
| SE393963B (sv) | I brevlador instoppbar ask | |
| ATA851373A (de) | Fungizide mittel | |
| FI54870C (fi) | Med krutkraft driven bultpistol | |
| SU498928A1 (ru) | Машина дл сортировани корнеплодов | |
| BE805665A (fr) | Rotors | |
| AT328222B (de) | Fungizide mittel | |
| AT324768B (de) | Fungizide mittel | |
| AT332100B (de) | Vermortelungsmaschine | |
| BE798188A (fr) | Diphenylmethanelactamimides substitues | |
| AT334753B (de) | Scheibenwischerantrieb | |
| SE394332B (sv) | Synkrondrivverk |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |