AT327185B - Verfahren zur herstellung neuer nitrofuranderivate - Google Patents
Verfahren zur herstellung neuer nitrofuranderivateInfo
- Publication number
- AT327185B AT327185B AT1041473*7A AT1041473A AT327185B AT 327185 B AT327185 B AT 327185B AT 1041473 A AT1041473 A AT 1041473A AT 327185 B AT327185 B AT 327185B
- Authority
- AT
- Austria
- Prior art keywords
- producing new
- nitrofuran derivatives
- new nitrofuran
- derivatives
- producing
- Prior art date
Links
- 229940027988 antiseptic and disinfectant nitrofuran derivative Drugs 0.000 title 1
- IAIWVQXQOWNYOU-FPYGCLRLSA-N nitrofural Chemical class NC(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 IAIWVQXQOWNYOU-FPYGCLRLSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722202744 DE2202744A1 (de) | 1972-01-21 | 1972-01-21 | Nitrofuryl-triazolo eckige klammer auf 4,3-b eckige klammer zu-pyridazin-amide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA1041473A ATA1041473A (de) | 1975-04-15 |
| AT327185B true AT327185B (de) | 1976-01-26 |
Family
ID=5833564
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1041373*7A AT327184B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT1041573*7A AT327186B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT45373A AT319224B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur Herstellung neuer Nitrofuranderivate |
| AT1041273*7A AT327183B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT1041473*7A AT327185B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
Family Applications Before (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1041373*7A AT327184B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT1041573*7A AT327186B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT45373A AT319224B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur Herstellung neuer Nitrofuranderivate |
| AT1041273*7A AT327183B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3903086A (de) |
| JP (1) | JPS4880596A (de) |
| AT (5) | AT327184B (de) |
| AU (1) | AU466339B2 (de) |
| CA (1) | CA1001628A (de) |
| CH (5) | CH577511A5 (de) |
| DE (1) | DE2202744A1 (de) |
| ES (1) | ES410659A1 (de) |
| FR (1) | FR2181673B1 (de) |
| GB (1) | GB1351921A (de) |
| HU (1) | HU164579B (de) |
| NL (1) | NL7300613A (de) |
| ZA (1) | ZA73419B (de) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU176972B (hu) * | 1977-06-13 | 1981-06-28 | Gyogyszerkutato Intezet | Sposob poluchenija novykh proizvodnykh piridazinil-gidrazona |
| EP2844660B1 (de) * | 2012-05-02 | 2017-11-01 | Southern Research Institute | Triazolopyridazinverbindungen, verwendung als hemmer von kinase-lrrk2 und verfahren zur herstellung davon |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE630438A (de) * | 1962-04-02 | |||
| NL128591C (de) * | 1965-07-02 | |||
| FR1527537A (fr) * | 1966-06-18 | 1968-05-31 | Boehringer & Soehne Gmbh | Procédé de préparation de nouveaux dérivés du 5-nitrofurane et du 5-nitrothiophène |
| NL128809C (de) * | 1966-06-18 | |||
| US3506656A (en) * | 1966-10-22 | 1970-04-14 | Boehringer Mannheim Gmbh | Triazolo-tetrazolo-pyridazine derivatives |
-
1972
- 1972-01-21 DE DE19722202744 patent/DE2202744A1/de active Pending
- 1972-12-18 US US316198A patent/US3903086A/en not_active Expired - Lifetime
-
1973
- 1973-01-15 HU HUB01410*AA patent/HU164579B/hu unknown
- 1973-01-16 GB GB228473A patent/GB1351921A/en not_active Expired
- 1973-01-16 NL NL7300613A patent/NL7300613A/xx unknown
- 1973-01-16 ES ES410659A patent/ES410659A1/es not_active Expired
- 1973-01-18 FR FR7301721A patent/FR2181673B1/fr not_active Expired
- 1973-01-18 CH CH244476A patent/CH577511A5/xx not_active IP Right Cessation
- 1973-01-18 CH CH71973A patent/CH577507A5/xx not_active IP Right Cessation
- 1973-01-18 CH CH244276A patent/CH577509A5/xx not_active IP Right Cessation
- 1973-01-18 CA CA162,102A patent/CA1001628A/en not_active Expired
- 1973-01-18 CH CH244576A patent/CH577512A5/xx not_active IP Right Cessation
- 1973-01-18 CH CH244376A patent/CH577510A5/xx not_active IP Right Cessation
- 1973-01-19 AT AT1041373*7A patent/AT327184B/de active
- 1973-01-19 AT AT1041573*7A patent/AT327186B/de active
- 1973-01-19 AT AT45373A patent/AT319224B/de not_active IP Right Cessation
- 1973-01-19 ZA ZA730419A patent/ZA73419B/xx unknown
- 1973-01-19 JP JP48008479A patent/JPS4880596A/ja active Pending
- 1973-01-19 AT AT1041273*7A patent/AT327183B/de not_active IP Right Cessation
- 1973-01-19 AT AT1041473*7A patent/AT327185B/de active
- 1973-01-22 AU AU51344/73A patent/AU466339B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT319224B (de) | 1974-12-10 |
| ZA73419B (en) | 1973-11-28 |
| DE2202744A1 (de) | 1973-07-26 |
| CA1001628A (en) | 1976-12-14 |
| ATA1041273A (de) | 1975-04-15 |
| ES410659A1 (es) | 1976-01-01 |
| JPS4880596A (de) | 1973-10-29 |
| AT327183B (de) | 1976-01-26 |
| ATA1041473A (de) | 1975-04-15 |
| AT327184B (de) | 1976-01-26 |
| ATA1041373A (de) | 1975-04-15 |
| US3903086A (en) | 1975-09-02 |
| CH577511A5 (de) | 1976-07-15 |
| FR2181673B1 (de) | 1976-12-03 |
| NL7300613A (de) | 1973-07-24 |
| AT327186B (de) | 1976-01-26 |
| GB1351921A (en) | 1974-05-15 |
| CH577509A5 (de) | 1976-07-15 |
| AU5134473A (en) | 1974-07-25 |
| HU164579B (de) | 1974-03-28 |
| AU466339B2 (en) | 1975-10-23 |
| CH577507A5 (de) | 1976-07-15 |
| CH577512A5 (de) | 1976-07-15 |
| FR2181673A1 (de) | 1973-12-07 |
| CH577510A5 (de) | 1976-07-15 |
| ATA1041573A (de) | 1975-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT333752B (de) | Verfahren zur herstellung neuer benzoxazol-derivate | |
| AT331970B (de) | Verfahren zur herstellung neuer alpha- aminobenzylpenicillinderivate | |
| AT333987B (de) | Verfahren zur herstellung neuer insulinderivate | |
| ATA588973A (de) | Verfahren zur herstellung neuer phenoxypropanolamine | |
| AT329570B (de) | Verfahren zur herstellung neuer chinazolinonderivate | |
| AT331255B (de) | Verfahren zur herstellung neuer hexahydrotriazinonderivate | |
| AT327414B (de) | Verfahren zur herstellung neuer bis-piperazino-androstan-derivate | |
| AT326653B (de) | Verfahren zur herstellung neuer 2-amino-4-h-pyrane | |
| AT327881B (de) | Verfahren zur herstellung neuer furanderivate | |
| ATA470873A (de) | Verfahren zur herstellung neuer anhydro- furanosederivate | |
| AT327184B (de) | Verfahren zur herstellung neuer nitrofuranderivate | |
| AT327189B (de) | Verfahren zur herstellung neuer nitrofuranderivate | |
| AT324323B (de) | Verfahren zur herstellung neuer benzimidazolderivate | |
| AT326120B (de) | Verfahren zur herstellung neuer isoxazolidinderivate | |
| AT335462B (de) | Verfahren zur herstellung neuer 1-nitrosoharnstoffderivate | |
| DD108067A5 (de) | Verfahren zur herstellung neuer bicycloalkan-derivate | |
| AT322542B (de) | Verfahren zur herstellung neuer nitrofuranverbindungen | |
| AT323730B (de) | Verfahren zur herstellung neuer indolderivate | |
| ATA1016673A (de) | Verfahren zur herstellung neuer sydnon-derivate | |
| ATA1030473A (de) | Verfahren zur herstellung neuer everninomicinderivate | |
| ATA2575A (de) | Verfahren zur herstellung neuer anhydro- furanosederivate | |
| ATA79175A (de) | Verfahren zur herstellung neuer sulfonamidodiphenylather | |
| ATA217775A (de) | Verfahren zur herstellung neuer phenoxypropanolamine |