AP440A - New substituted pyrazole derivatives, processes for their preparation and their use as herbicides. - Google Patents
New substituted pyrazole derivatives, processes for their preparation and their use as herbicides. Download PDFInfo
- Publication number
- AP440A AP440A APAP/P/1993/000579A AP9300579A AP440A AP 440 A AP440 A AP 440A AP 9300579 A AP9300579 A AP 9300579A AP 440 A AP440 A AP 440A
- Authority
- AP
- ARIPO
- Prior art keywords
- general formula
- compound
- alkyl
- meanings given
- hydrogen
- Prior art date
Links
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/56—1,2-Diazoles; Hydrogenated 1,2-diazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/90—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having two or more relevant hetero rings, condensed among themselves or with a common carbocyclic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having no bond to a nitrogen atom
- A01N47/06—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having no bond to a nitrogen atom containing —O—CO—O— groups; Thio analogues thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
- C07D231/52—Oxygen atom in position 3 and nitrogen atom in position 5, or vice versa
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
New substituted pyrazole derivatives of general formula
Description
Title: New substituted pyrazole derivatives, processes for their preparation and their use as herbicides
Field of the invention
This invention relates to new substituted pyrazole derivatives, their preparation, as well as intermediates, and their use as herbicides.
Prior Art
It is known that 1-phenylpyrazoles possess herbicidal activity (EP 154115).
However the herbicidal activity of these compounds in not high enough or selectivity problems can occur in important crops.
The object of the present invention is to make new compounds that have improved biological properties over the known compounds.
It has now been found that substituted pyrazole derivatives of general formula I
AiN/yn
N
(I) in which
R1 is Cj-^-alkyl;
BAD ORIGINAL β
AP Ο Ο Ο 4 4 Ο
R2 is C^C^alkyl, C1-C4-alkylthio, C^Ct-alkoxy, each of which is optionally substituted by one or more halogen atoms, or
R1 and R2 together form the group -(CH-,)m;
R3 is hydrogen or halogen,
R4 is hydrogen or CpC^alkyl,
R5 is hydrogen, nitro, cyano or the groups -COOR7, -C(=X)NR7R8 or -C(=X)R10,
R6 is hydrogen, halogen, cyano, Cj-C^alkyl, (optionally substituted by one or more halogen or hydroxy groups), Cl-C4-alkoxy, phenyl, (optionally substituted by one or more halogen, nitro, cyano, Cj-C^alkyl, C1-C4-alkoxy or halo-Cl-C4-alkyl groups) , pyrrolyl, or is a (^-Cg-alkyl, C3-C8-alkenyl, C3-C8-alkynyl or Cj-Cg-alkoxy group, each of which is interrupted by one or more oxygen atoms, or is the group;
-(CH2)a-A, -(CH2) a-O- (CH2)b-R22, -(CH2)a-O-Rn or -COR24,
BAD ORIGINAL ft
AP 0 00 4 4 0
R7, R8 and R9, which may be the same or different, are hydrogen or C1-C4-alkyl or
R8 and R9 together with the nitrogen to which they are attached form a 5 or 6 membered saturated carbocyclic ring;
R10 is hydrogen or Cj-C4-alkyl, optionally substituted by one or more halogen atoms,
R11 is hydrogen, C^C^alkyl, C2-C6-alkenyl, C3-C6-alkynyl or phenyl (each of which is optionally substituted by one or more halogen atoms), C3-C8-cycloalkyl, cyanomethyl or the group R21CO-;
R12 is C^-Cg-alkyl, C2-C6-alkenyl, C^-Cg-alkynyl or phenyl (each of which is optionally substituted by one or more halogen atoms), C3-C8-cycloalkyl, cyanomethyl, Cj-C^-alkoxy-C^-Cg-alkyl, di-Cj-C^-alkylaminoCj-C^alkyl, tetrahydrofurfurylmethyl, C3-C6-alkynyloxy-Cj-^-alkyl, benzyl, (optionally substituted by one or more halogen, nitro, cyano, Cj-c4-alkyl, Cj-^-alkoxy or halo-Cj-^-alkyl groups) , or is the group -C(=X)R21, - (CH2) a-(0) d-R28, - (CH2) a-O-(CH2) b R28 or - (CH2) a-X-R34, and when R5 is -C(=O)R10, and/or when R1 is Cj-^-alkyl, R2 is difluoromethoxy, R3 is bromo and R5 is nitro or cyano, R12 can also be hydrogen; or
R11 and R12 together with the nitrogen to which they are attached form a 3, 5 or 6 membered saturated carbocyclic or aromatic ring, in which a carbon atom is optionally substituted by an oxygen atom;
R13 is hydrogen, Cj-C^alkyl, C2-C6-alkenyl or C3-C6-alkynyl; or R13 and R14 together form the group -(CH2)p;
R14 and R15, which may be the same or different, are
Cj-^-alkyl, C2-C6-alkenyl, C3-C6-alkynyl or phenyl (each of which is optionally substituted by one or more halogen atoms), hydrogen, C3-C6-cycloalkyl or the
BAD ORIGINAL &
AP Ο Ο Ο 4 4 Ο groups -XR18 or -NR19R20;
R16 is hydrogen, Cj-C6-alkyl, C2-C6-alkenyl, Cj-C^-alkynyl, Cj-C^-alkylcarbonyl, cyano-Cj-^-alkyl, C1-C4-alkoxycarbonyl-Cl-C4-alky 1, di-C^-C^-alkoxy5 carbonyl-Cj-C^-alkyl, benzyl, C^-C^-alkoxyCj-C-alkynyl, or the group -(CH2)a-R33, -(CH2)a-X-R30,
- (CH2) a-X- (CH2) b-R30 or -(CH2)a-X-(CH2)b-X-(CH2)c-R30,
R17 is hydrogen, Cj-C4-alkyl, C2-C6-alkenyl, Cj-C^-alkynyl, cyano-Cl-C3-alky 1, Cj-C^-alkylcarbonyl-Cj-C^-alkyl or phenyl,
R18 is Cj-^-alkyl, optionally substituted by one or more halogens;
R19 and R20, which may be the same or different, are hydrogen or Cj-^-alkyl;
R21 is Cj-C4-alkyl, (optionally substituted by one or more halogens) , Cj-C^alkoxy-Cj-Cq-alkyl, Cj-C4-alkylthioCj-C4-alkyl, C-j-C^cycloalkyl, phenyl, (optionally substituted by one or more halogen, nitro, cyano, Cj-C4-alkyl, Cj-C^-alkoxy or halo-C^C^alkyl groups), or is the group -NR31R32 or - (CH2) a-(O) d-R33;
R22 is Cj-C^-alkoxycarbonyl or carboxy,
R23 is chloromethyl, cyanomethyl, Cj-C6-cycloalkyl (optionally interrupted by one or more oxygen atoms), or Cj-C4-alkoxycarbonyl-C|-C4-alkyl,
R24 is hydroxy or the group -NR25R26;
A is -NR25R26 or -S(O)n-R27;
R25 and R26, which may be the same or different, are hydrogen or Cj-C4-alkyl;
R27 is Cj-^-alkyl, C1-C4-alkoxycarbonyl-Cj-C^-alkyl or carboxy,
R28 is hydrogen, hydroxy, halogen, Cj-C^alkyl, (optionally substituted by one or more Cj-C4-alkoxy groups), C3-C6-cycloalkyl (optionally interrupted by one or
BAD ORIGINAL
AP Ο 00 4 4 Ο more oxygen atoms and optionally substituted by dimethyl), furyl, thienyl or -C(=O)R29;
R29 and R30, which may be the same or different, are CpC^alkyl or Cj-^-alkoxy;
R31 and R32, which may be the same or different, are
Cj-C4-alkyl or phenyl;
R33 is C3-C6-cycloalkyl (optionally interrupted by one or more oxygen atoms and optionally substituted by dimethyl), furyl, thienyl or -C(=O)R29;
C 10 R34 is Cj-C4-alkyl;
| a, | b | and c are 1, 2 or |
| d | is | 0 or 1; |
| m | is | 3 or 4; |
| P | is | 2 or 3; and |
| X | is | oxygen or sulfur, |
possess better herbicide properties than the known compounds of related structure.
Particularly active are those pyrazole derivatives as 20 defined above, in which
R1 is methyl;
R2 is methylthio or difluoromethoxy (and especially difluoromethoxy); or
R1 and R2 together form the group -(CH2)4;
R3 is hydrogen, chloro or bromo;
R4 is hydrogen;
R5 is hydrogen, nitro, cyano or -C(=X)R10.
In a particularly preferred group of compounds, R6 is 30 hydrogen, halogen, cyano, Cj-C^-alkyl, CM-a lkylthio or
-NRnR12, with R11 and R12 preferably being hydrogen, Cj^-alkyl or CM-alkoxycarbonyl.
The term halogen means fluorine, chlorine, bromine and
BAD ORIGINAL ft Ap 0 0 0 4 4 0 iodine.
It is to be understood that the term alkyl, alkenyl and alkynyl includes branched as well as straight chained hydrocarbon groups.
The invention also includes intermediates of general formula II
in which R1, R2 and R3 have the meanings given in general formula I, intermediates of general formula Ii
in which Rl and R2 have the meanings given in general formula I, intermediates of general formula Ij
APOOO 4 4 Ο
bj).
in which R1, R2 and R5 have the meanings given in general formula I, intermediates of general formula Ik
(ik ) .
in which Rl, R2 and R6 have the meanings given in general 20 formula I, intermediates of general formula II r’/Jn nh2cn (ij>_ in which R1, R2 and R3 have the meanings given in general formula I, and intermediates of general formula Im
BAD ORIGINAL ft
APOOOUO
ΝΑ \
\\ 'N !
R r6 C—NH? 2 (Ira ) in which Rl, R2, R3 and R6 have the meanings given in general formula I.
The compounds of the invention of general formula I can be prepared, by a process in which
A) a compound of general formula II
R2
NHNH2 in which R1, R2 and R3 have the meanings given in general formula I, is reacted with a compound of general formula III
Y CN in which R4 and R5 have the meanings given in general formula I and Y is C^-C^-alkoxy, hydroxy or halogen, or when Rs is hydrogen,
B) a compound of general formula II ,2
R'
RyVR' (ll).
NHNHN:
badoriginal
AP Ο Ο Ο 4 4 Ο in which R1, R2 and R3 have the meanings given in general 5 formula I, is reacted with a 2-haloacrylonitrile of formula Ilia
CN
CH2=C (Ilia),
Hal or with a 2,3-dihalopropionitrile of formula Illb
Hal—CH2—CH
CN (Nib),
Hal in which Hal is halogen, or when R3 is halogen,
C) a compound of general formula Ia
N:
,N
R1 R (la), in which Rl, R2, R5, R11 and R12 have the meanings given in 30 general formula I, is reacted first with a halogenating agent to give a compound of formula lb
R
R
N R5
(Ib),
BAD ORIGINAL
AP 0 0 0 4 4 0 in which Rl, R2, R^, R11 and R12 have the meanings given in general formula I, and Hal is halogen, and then further treated to give the desired compound, or when r5 is -C(=S)R10 and R6 is amino,
D) a compound of general formula Ic
(Ic), in which R1, R2, R3, R4 and R10 have the meanings given in general formula I, is treated with Lawesson's reagent, or when R3 is -OR16,
E) a compound of general formula Id
N— ,R
R, (Id),
Tr in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is first diazotised to give a compound of formula le
R;
N'
I
R' (le),
AP Ο Ο Ο 4 4 Ο ί
C in which R1, R2, RJ, R4 and R5 have the meanings given in general formula I, and then by heating to give a compound of formula If
in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, which is then reacted with a compound of general formula IV
QR16 (IV) in which R16 has the meaning given in general formula I, and Q is a leaving group, or when R5 is nitro and R6 is -SR17,
F) a compound of general formula Ig
Λ
Rr
in which R1, R2, R3 and R4 have the meanings given in general formula I and Hal is halogen is reacted with a nucleophile of general formula V eSR17 (V) in which R1' has the meaning given in general formula I, or when R5 is nitro and R6 is -S(O)nR17, in which n is 1 or 2,
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
G) a compound of general formula Ih 2
R‘ !
j=r
Ih),
NO, in which R1, R~, R3, R4 and R17 have the meanings given in general formula I, is subjected to a stepwise oxidation with m-chloroperbenzoic acid, or when R5 is cyano H) a compound of general formula Ila
R-
NHNH.
(Ha), in which R1 and R2 have the meanings given in general formula I, is reacted with a compound of general formula IIIc
CN \
CN (IIIc), in which Y is Cj-Cg-alkoxy, hydroxy or halogen, or when R5 is nitro,
I) a compound of general formula Ii
R
(Ii)
NH2 in which Rl and R2 have the meanings given in general
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο formula I, is nitrated in known manner, or
J) a compound of general formula Ij / NtY
N ι 1 R (ij) in which R1, R~ and R5 have the meanings given in general formula I, is brominated in known manner, or when when R5 is halogen,
K) a compound of general formula II
NHNH, (II) , in which R1, R2 and R3 have the meanings given in general formula I, is reacted with a compound of general formula IIIc /
CN
CN (H1C) in which Y' is C1-C6-alkoxy, dimethylamino or halogen, to first give compound of formula II
( II) ,
BAD ORIGINAL &
AP Ο Ο Ο 4 4 Ο in which R1, R2 and R3 have the meanings given in general formula I, and this compound is then diazotised in known manner with sodium nitrite and converted to the corresponding halide, or
L) a compound of general formula Ik 2
R CN in which Rl, R2 and R6 have the meanings given in general formula I, is treated with a halogenating agent, or
M) a compound of general formula Im
in which Rl, R2 and R3 have the meanings given in general formula I, and R6 is y-C^-alkyl, (optionally substituted by one or more halogens) or is a C2-Cg-alkyl, interrupted by one or more oxygens, is converted in known manner to the nitrile of general formula I, or when R6 is -NRnR12,
N) a compound of general formula In
APO 00 44 Ο in which R1, R2 and R3 have the meanings given in general formula I, is reacted with an amine in a solvent, or when R6 is -NRnR12, in which R11 is hydrogen and R12 is C^Cg-alkyl,
O) a compound of general formula II N—
R3 // l !
\\
NH2 cn (il) .
in which R1, R2 and R3 have the meanings given in general formula I, is reacted with a trialkyl ortho ester and then reduced, or
P) a compound of general formula Io <*· c
CN flo ) , in which R1, R2 and R3 have the meanings given in general formula I, and R12 is Cj-C^-alkyl is reacted with an base and an alkylating agent or an acid chloride, or when R6 is -NRnR12, in which R11 and R12 are Cj-Cg-alkyl,
Q) a compound of general formula II
R·
N:
N
NH2 cn // (il)
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο in which R1, R2 and R2 have the meanings given in general formula I, is reacted with approximately 2 mole of base and 2 mole of a suitable alkylating agent, or
R) a compound of general formula II Nz=r \\ ! \ NH2 CN (II), in which R1, R2 and R2 have the meanings given in general formula I, is reacted with or without a base and a suitable acid chloride, or
S) a compound of general formula Ip N— \ ( Ip ) ,
NH C = O
CN in which R1, R2, R2 and R21 have the meanings given in general formula I, is reacted with a base and a suitable alkylating agent, or
T) a compound of general formula In
( In ) ’
R m which R , R and RJ have the meanings given in general formula I and R5 is cyano or nitro, is reacted with
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο an oxygen, nitrogen, sulfur or carbon nucleophile, or when
R6 is substituted methyl
U) a compound of general formula Iq
(i q), in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is reacted with a Lewis acid, or
V) a compound of general formula Ir
I 1 in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is treated with a halogenating agent, or
W) a compound of general formula Is
(I s),
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is reacted with an oxygen, nitrogen, sulfur or carbon nucleophile, or when R6 is mercapto
X) a compound of general formula It
(I t); in which R1, R2, R3 and R4 have the meanings given in general formula I, is treated with sodium hydrogen sulfide, or
Y) a compound of general formula lu
(I U), in which R1, R2, R3 and R4 have the meanings given in general formula I, is treated with a suitable alkylating agent, or
Z) a compound of general formula Iv
(I v)
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο in which R1, R2, R3 and R4 have the meanings given in general formula I, and Rx is C^Cj-alkyl, is oxidised in stages.
The compounds of the invention of general formula I, in which R5 is nitro and R6 is halogen, can also be prepared according to the process described in DE 3501323.
The compounds of the invention of general formula I, in O 10 which R5 is the group -C(O)R10 and R6 is amino, can also be prepared according to the process described in Collect. Czech. Chem. Commun. 55., 1038-48 (1990).
The compounds of the invention of general formula I, in which R6 is the group -NRnR12, can also be prepared according to the known processes described in DE 3 707 686, DE 3 543 034, EP 224 831, DE 3 543 035, JP 57167972 and DE 2 747 531.
The compounds of the invention of general formula I, in which R14 is the group -OR18 or -NR19R20, can be prepared from compounds of general formula I, in which R6 is amino according to the known processes described in Chem. Soc. Rev. 4., 231-50 (1975) and J. March, Advanced Organic
Chemistry, 1985, p. 370.
The compounds of the invention of general formula I, in which R5 is cyano or nitro and R6 is C1-C4-alkyl, can be prepared according to known processes (J. Heterocyclic
Chem. 24, 1669 (1987), ibid. 24, 739 (1987).
The reactions are suitably carried out by reacting the compounds of formulae II, Ila or III in a suitable solvent at a temperature between -30 and 150°C, preferably at room temperature.
BAD ORIGINAL d
AP000440
As halogenating agent there can be used for example sulfuryl chloride, sodium hypochlorite, N-chlorosuccinimide, N-bromosuccinimide, bromine or chlorine.
Leaving groups in process variant E are chloro or bromo.
The nitration in process variant I) is suitably carried out in known manner with nitric acid in acetic anhydride. The reaction temperature lies in the region of -10 to 140°C.
The process variant J) is suitably carried out in a solvent at a temperature of -20°C up to the boiling point of the solvent.
As brominating agent in process variant J) there can be used, for example N-bromosuccinimide or bromine.
The reaction of compounds of general formula II is suitably carried by the method described in J. March, Advanced Organic Chemistry, 1985. p. 647.
The process variant L) is generally carried out in a suitable solvent, preferably acetonitrile or dichloromethane, at a temperature of between -10°C and 80°C.
Process variant M) is generally carried out according to the method described in Tetrahedron Letters, 1977 p. 1813.
Process variant O) is generally carried out according to the known methods (J. March, Advanced Organic Chemistry, 1985. p. 798-800 and literature cited there).
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
C 10
C 10 (
(
Suitable bases for process variants P), Q), R) and S) include for example alkali metal and alkaline earth metal hydroxides, sodium methanolate, alkali metal hydrides, alkali metal and alkaline earth metal carbonates, tertiary aliphatic and aromatic amines, such as triethylamine and pyridine as well as heterocyclic bases.
Process variant T) is generally carried out for example according to methods described in J. Heterocyclic Chem.
25, 555 (1988).
The preparation can be carried out with or without a solvent. Should need arise, such solvent or diluents can be used which are inert to the reactants. Examples of such solvents or diluents are aliphatic, alicyclic and aromatic hydrocarbons, each of which can be optionally chlorinated, such as for example hexane, cyclohexane, petroleum ether, naphtha, benzene, toluene, xylene, methylene chloride, chloroform, carbon tetrachloride, ethylene dichloride, trichloroethane and chlorobenzene, ethers, such as for example diethyl ether, methyl ethyl ether, methyl t-butyl ether, diisopropyl ether, dibutyl ether, dioxane and tetrahydrofuran, ketones, such as for example acetone, methyl ethyl ketone, methyl isopropyl ketone and methyl isobutyl ketone, nitriles, such as for example acetonitrile and propionitrile, alcohols, such as for example methanol, ethanol, isopropanol, butanol, tertbutanol, tert-amyl alcohol and ethylene glycol, esters, such as for example ethyl acetate and amyl acetate, amides, such as for example dimethylformamide and dimethylacetamide, sulfoxides, such as for example dimethyl sulfoxide and sulfones such as for example sulfolane, bases, such as for example pyridine and triethylamine, carboxylic acids such as for example acetic acid, and mineral acids such as for example sulfuric acid
BAD ORIGINAL i
AP Ο Ο Ο 4 4 Ο and hydrochloric acid.
The compounds of the invention can be worked up in conventional manner. Purification can be achieved by crystallisation or column chromatography.
The compounds of the invention are, as a rule, colourless or slightly yellow crystalline or liquids or substances that are highly soluble in halogenated hydrocarbons, such as methylene chloride or chloroform, Ethers, such as diethyl ether or tetrahydrofuran, alcohols, such as methanol or ethanol, ketones, such as acetone or butanone, amides, such as dimethylformamide, and also sulfoxides, such as dimethyl sulfoxide.
The intermediate compounds of general formula II
(H).
in which R1, R2 and R3 have the meanings given in general formula I can be prepared in known manner (e.g. JP 62158260) from compounds of general formula VI
R' N=\
NH.
(VI ) in which R1, R2 and R3 have the meanings given in general formula I.
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
The compounds of general formula II in which R1 and R2 together form the group -(CH2)m- and R3 is hydrogen, can be prepared by treating a compound of general formula Illc i| 0 5 HalCH3(Cr^)3 — C-C=( (IHc), a
with hydrazine with addition of a base. The compound of general formula IIIc can be prepared by reacting a compound of general formula Hid 0
HalCtyCH^-C/ (IIId), a
and a 1,1-dihaloethylene.
The compounds of general formula VI, in which R1 and R2 have the meanings given in general formula I and R3 is halogen, can be prepared by reacting a compound of general formula VI in which R3 is hydrogen, with a halogenating agent.
The compounds used as starting materials for compounds of general formula VI, are of general formula VII
R2
(VH), in which R1 has the meaning given in general formula I, and can be prepared for example, by a process in which, in the case when R2 is Ct-C4-alkyl, optionally substituted by
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
Γ ίο ( .
( halogen,
a) a compound of general formula VIII, Villa or IX
R2 y=\ (viii), NH2 CN (Villa), // \ CX),
O CN in which R2 is C|-C4-alkyl, optionally substituted by halogen, is reacted with a compound of general formula X
R1 - NHNH2 (X) in which R1 has the meaning given in general formula I, optionally in the presence of a solvent, or when R2 is Cj-C^-alkylthio, optionally substituted by one or more halogens,
b) a compound of general formula XI
in which R35 is cyano or the group -COOR36, in which R36 is Cj-C^-alkyl, is reacted with a compound of general formula X, optionally in the presence of a solvent, e.g. water, to give first a compound of general formula XII
SH
N=J nh2 (XII) ,
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο in which R1 has the meaning given in general formula I and R35 has the meaning given above, which is then reacted with a compound of general formula XIII
R37Q (XIII) in which R37 is CpCj-alkyl, optionally substituted by one or more halogens, and Q is a leaving group, and the resulting compound of general formula XIV
SR
-N
N· (XIV)
NH, is saponified and decarboxylated according to known literature methods (e.g. Zeitschrift fur Chemie 420, (1968)), or
c) a compound of general formula XV
C (XV).
SR CN 25 in which R35 is cyano or the group -COOR36, in which R36 is C1-C4-alkyl, and R37 is Cj-^-alkyl, optionally substituted by one or more halogens, is reacted with a compound of general formula X, optionally in the presence of a solvent, e.g. water, to give a compound of general formula XIV, or when R2 is Cj-C^-alkoxy, optionally substituted by one or more halogens
d) a compound of general formula XVI
BAD ORIGINAL ft
APOOO440
(XVI), in which R1 has the meaning given in general formula I, is 10 reacted with a compound of general formula XIII, in the presence of a base, or
h) a compound of general formula XVII ,CO2Z
HO
Ν' ii ,N (XVII), in which R1 has the meaning given in general formula I and Z is c^-C^-alkyl, is reacted, in the presence of a base, with a compound of general formula XIII
R37Q (XIII) in which R37 is Cj-C^-alkyl, optionally substituted by one or more halogens, and Q is a leaving group, and the resulting compound of general formula XVIII .CO,Z r3/o
ΊΝ' R 1 ,N (XVIII)y in which R1 has the meaning given in general formula I,
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο is Cj-C4-alkyl, optionally substituted by one or more halogens, and Z is Cj-^-alkyl, is reacted with ammonia and the resulting compound of general formula XIX
II .GNH.
N' t
R ,N (X IX), in which R has the meaning given in general formula I and R37 is Cj-C^-alkyl, optionally substituted by one or more halogens, is reacted with sodium hydroxide and a halogen, or when R3 in general formula I is halogen,
f) a compound of general formula XVIII or XIX r3'o
N'
Ϊ
R
II ,N
O
II ,C-NH.
CO2Z (X IX), (XIII) in which R1 has the meaning given in general formula I, R37 is Cj-Cj-alkyl, optionally substituted by one or more halogens, and Z is Cj-C4-alkyl, is reacted with a halogenating agent to give a compound of general formula XVIIIa and XlXb
Hal r'o
N'
I
R ,N .CO2Z
Ha
II
-C-NH(XVI Ila) und
N R 1 (X IXb)
BAD ORIGINAL ft
AP 0 0 0 4 4 0 in which Rl, R37 and Z have the meanings given in general formula XVIII and XIX, or
g) a compound of general formula XIXa
Hal /C-NH2 -s :i l| ii 0 (XIXa), f?7o in which R1 has the meaning given in general formula I, R37 is Cj-C4-alkyl, optionally substituted by one or more halogens, and Hal is halogen, is reacted with sodium hydroxide and bromine to give a compound of general formula XX
(XX).
in which R1, R37 and Hal have the meanings given in formula XIXa, or when R1 and R' together form a tri- or tetramethylene group
h) a compound of general formula XXI
BAD ORIGINAL ft
AP 0 0 0 4 4 0 in which n is 2 or 3, is reacted with hydrazine and the resulting 3(5)-amino-5(3)-hydroxyalkylpyrazole of general formula XXII
HO-(CH2)nCH
(XXII), in which n is 2 or 3, is reacted with hexane-2,5-dione, phthalic anhydride or tetrahydrophthalic anhydride, in a similar manner to known literature methods (Bull. Chem. Soc. Jp., 44 . 2856-8 (1971), or EP 305826), to give a compound of general formula XXIII
in which n is 2 or 3 and Q is an amino protecting group, such as e.g. Qlz Q2 or Q3
and this is cyclised using the Mitsunobu variant (Synthesis, 1 (1981)), to give a compound of general
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο formula XXIV
(XXIV), in which η is 2 or 3, and then in the case when Q is Q1( this is treated with hydroxylamine as described in J. Org.
Chem., 49, 1224-1227 (1984), and in the case when Q is Q, or Q3, this is treated with hydrazine, in a similar manner to known literature methods (Org. Synthesis, Coll. Vol.,
3., 148 (1955)).
The starting materials of general formula XXI can be prepared in known manner (Chem. Ber., 109(1), 253-60, 1976) .
(..
(
The compounds of general formula Ii, used as starting 20 materials, can be prepared by decarboxylating a compound of general formula XXV
in which R1 and R2 have the meanings given in general formula I.
The compounds of general formula XXV can be prepared by saponifying a compound of general formula XXVI
BAD ORIGINAL A
AP Ο Ο Ο 4 4 Ο
in which R1 and R2, have the meanings given under general formula I and R7 is Ct-C4-alkyl.
The compounds of general formula XXVI can be prepared by reacting a compound of general Ila, in which R1 and R2 have the meanings given under general formula I with a compound of general formula XXVII
CN
CO2FT (XXVII), in which R7 is Cj-C4-alkyl and Y is C^-Cg-alkoxy, hydroxy or halogen.
The intermediates of general formula Ij, can be prepared in an analogous way to process described above in which instead of the compounds of general formulae Ila and Ii the corresponding compounds of general formula XXVIII and/or XXIX
H NHNH2
R
N (XXVIII)
(XXIX),
R
AP Ο Ο Ο 4 4 Ο
Vi.·.
are used.
The intermediates of general formula Ik, can be prepared by reacting a compound of general formula lib
R•N
N: ./
NHNH, (Hb) in which R1 and R2 have the meanings given in general formula lib in an analogous way to processes described above.
The intermediates of general formula Im, in which R6 is Cj-Qj-alkyl, optionally substituted by one or more halogens or C2-Cg-alkyl, interrupted by one or more oxygen atoms, can be prepared converting a compound of general formula Iq
( Iq ) , in which R1, R2 and R3 have the meanings given in general formula I, R6 is Cj-C4-alkyl, optionally substituted by one or more halogens or C2-Cs-alkyl, interrupted by one or more oxygen atoms, and R7 is Cj-C^alkyl, in known manner to the amide.
The compounds of general formula Iq can be prepared in known manner (J. Heterocyclic Chem 24., 1669 (1987), ibid.
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
C 10 (
24, 739 (1987)).
The preparation of the intermediates can be carried out with or without a solvent. Should need arise, a solvent mentioned above can be used.
The named starting materials are either known in the or can be prepared in similar manner to known methods.
The compounds of the invention show a good herbicidal activity against broad leaved weeds and grasses. A selective use of the compounds of the invention in various crops is possible for example in rape, beet, soya beans, cotton, rice, barley, wheat and other cereals. Individual active substances are particularly suitable as selective herbicides in beet, cotton, soya, maize and cereals. However the compounds can be used for control of weeds in permanent crops, such as for example forestry, ornamental trees, fruit, vine, citrus, nut, banana, coffee, tea, rubber, oil palm, cocoa, berry fruit and hop plantations.
The compounds of the invention can used for example against the following plant species:
Dicotyledonous weeds of the species: Sinapis, Lepidium, Galium, Stellaria, Matricaria, Anthemis, Galinsoga, Chenopodium, Brassica, Urtica, Senecio, Amaranthus, Portulaca, Xanthium, Convolvulus, Iponoea, Polygonum, Sesbania, Ambrosia, Cirsium, Carduus, Sonchus, Solanum, Rorippa, Lamium, Veronica, Abutilon, Datura, Viola, Galeopsis, Papaver, Centaurea and Chrysanthemum.
Monocotyledonous weeds of the species: Avena, Alopecurus,
Echinochloa, Setaria, Panicum, Digitaria, Poa, Eleusine,
Brachiaria, Lolium, Bromus, Cyperus, Agropyron,
BAD ORIGINAL ft
AP ο Ο Ο 4 4 Ο
Sagittaria, Monocharia, Fimbristylis, Eleocharis,
Ischaemum and Apera.
The rates of use vary depending on the manner of pre- and 5 postemergent use between 0.001 and 5 kg/ha.
The compounds of the invention can also be used as defoliants, desiccants and total herbicides.
The compounds of the invention can be used either alone or in admixture with one another or with other active agents. Optionally, other plant-protective agents or pesticides can be added, depending on the purpose for the treatment. When it is desired to broaden the spectrum of activity, other herbicides can also be added. Herbicidally active mixing partners suitable in this connection include for example, the active agents listed in Weed Abstracts, vol. 40, No. 1, 1991, under the heading Lists of common names and abbreviations employed for currently used herbicides and plant growth regulators in Weed Abstracts.
An improvement in the intensity and speed of action can be obtained, for example, by addition of suitable adjuvants, such as organic solvents, wetting agents and oils. Such additives may allow a decrease in the dose.
The designated active ingredients or their mixtures can suitably be used, for example, as powders, dusts, granules, solutions, emulsions or suspensions, with the addition of liquid and/or solid carriers and/or diluents and, optionally, binding, wetting, emulsifying and/or dispersing adjuvants.
Suitable liquid carriers are, for example aliphatic and aromatic hydrocarbons, such as benzene, toluene, xylene,
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο cyclohexanone, isophorone, dimethyl sulfoxide, dimethylformamide and other mineral-oil fractions and plant oils.
Suitable solid carriers include mineral earths, e.g. bentonite, silica gel, talcum, kaolin, attapulgite, limestone, silicic acid and plant products, e.g. flours.
As surface-active agents there can be used for example 10 calcium lignosulfonate, polyoxyethylenealkylphenyl ethers, naphthalenesulfonic acids and their salts, phenolsulfonic acids and their salts, formaldehyde condensates, fatty alcohol sulfates, as well as substituted benzenesulfonic acids and their salts.
The percentage of the active ingredient(s) in the various preparations can vary within wide limits. For example, the compositions can contain about 10 to 90 percent by weight active ingredients, and about 90 to 10 percent by weight liquid or solid carriers, as well as, optionally up to 20 percent by weight of surfactant.
The agents can be applied in customary fashion, for example with water as the carrier in spray mixture volumes of approximately 100 to 1,000 1/ha. The agents can be applied using low-volume or ultra-low-volume techniques or in the form of so-called microgranules.
The preparation of these formulations can be carried out in known manner, for example by milling or mixing processes. Optionally, individual components can be mixed just before use for example by the so-called commonly used tank-mixing method.
Formulations can be prepared, for example, from the
BAD ORIGINAL £
AP Ο Ο Ο 4 4 Ο
C 10
C 10 (
( following ingredients.
A) Wettable Powder percent by weight active ingredient 35 percent by weight fuller7s earth percent by weight calcium lignosulfonate 2 percent by weight sodium salt of
N-methyl-N-oleyltaurine percent by weight silicic acid
B) Paste percent by weight active ingredient percent by weight sodium aluminium silicate 15 percent by weight cetyl polyglycol ether with 8 mole ethylene oxide percent by weight spindle oil percent by weight polyethylene glycol percent by weight water
C) Emulsifiable Concentrate percent by weight active ingredient percent by weight isophorone percent by weight of a mixture of the sodium salt of N-methyl-N-oleyltaurine and calcium lignosulfonate
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
The following examples illustrate the preparation of compounds according to the invention.
Example 1.0
4-Acetvl-5-amino-l-(3-chloro-4,5,6,7-tetrahvdropyrazolo(1,5-a1pyridin-2-yl)pyrazole
0.56 g (3 mmol) 3-Chloro-2-hydrazino-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine was dissolved in 5 ml ethanol and ¢- 10 treated with 0.42 g (3 mmol) 2-ethoxymethylen-3-oxobutyronitrile. After heating under reflux for 3 hours, the mixture was concentrated and the residue purified by silica gel chromatography (hexane/ethyl acetate 1:1).
Yield: 0.75 g = 89.4% of theory mp: 153-154°C
Example 1.1
5-Amino-l-(3-chloro-4,5,6,7-tetrahydropyrazolo20 r1,5-aΊpyridin-2-y1)-4-thioacetylpyrazole
0.28 g (1 mmol) 4-Acetyl-5-amino-l-(3-chloro( 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)pyrazole was dissolved in 5 ml dimethoxyethane and treated with 0.28 (0.6 mmol) Lawesson's reagent. After heating under reflux for 2 hours with stirring, the reaction solution was poured into water and extracted with ethyl acetate. The organic phase was washed with saturated aqueous sodium chloride, dried over magnesium sulfate and concentrated.
The residue was purified by silica gel column chromatography. (Hexane/ethyl acetate 1:1).
Yield: 0.21 g = 71% of theory
AP Ο Ο Ο 4 4 Ο
Example 1.2
N-f1-(3-Chloro-4,5,6,7-tetrahydropyrazolof1.5-alpyridin2- vl)-4-nitro-5-pyrazolvl1propionamide
8.72 g (29.7 mmol) N-[1-(3-Chloro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-5-pyrazolyl]propionamide was suspended in 33 ml acetic acid. Under ice cooling, at 0-5°C, 3.31 g (32.5 mmol) acetic anhydride was added.
1.93 g (31 mmol) Fuming nitric acid was added dropwise.
After stirring for 6 hours at room temperature, the mixture was concentrated. The residue was taken up in dichloromethane, neutralised with aqueous sodium hydrogen carbonate and washed with aqueous sodium chloride. The organic phase was dried over magnesium sulfate and concentrated. The residue was purified by silica gel chromatography (hexane/ethyl acetate 1:1).
Yield: 6.03 g = 60% of theory mp: 46-49°C
Example 2.0
Ν-Γ1-(4-Chloro-5-difluoromethoxy-1-methyl-3-pyrazolvl)4-nitro-5-pyrazolyl1-2,2,2-trifluoroacetamide
0.79 g (2.1 mmol) N-[1-(5-Difluoromethoxy-l-methyl3- pyrazolyl)-4-nitro-5-pyrazolyl]-2-2,2-trifluoroacetamide was suspended in 35 ml dichloromethane and treated with 0.17 ml sulfuryl chloride. The mixture was stirred for one hour at room temperature and concentrated.
Yield: 0.77 g = 89.5% of theory mp: 136-139°C
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
Example 2.1
Ν-Γ1-(4-Chloro-5-difluororaethoxy-l-methyl-3-pyrazolvl) 4-ηitro-5-pyrazolvnacetamide
1.3 g (5.0 mmol) 5-Amino-l-(4-chloro-5-difluoromethoxyl-methyl-3-pyrazolyl)pyrazole was dissolved in 20 ml acetic acid and treated with 0.55 g (5.4 mmol) acetic anhydride. After stirring for 2 hours at room temperature the reaction solution was cooled to 0°C and 0.4 g (6.4 mmol) concentrated nitric acid added. After stirring for 8 hours at room temperature, the reaction mixture was poured into ice water and extracted with ethyl acetate. The organic phase was dried over magnesium sulfate and concentrated. The residue was purified by silica gel column chromatography (hexane/ethyl acetate 1:1).
Yield: 1.4 g = 81.5% of theory mp: 132°C
Example 3.1
5-Amino-4-nitro-l-(4-bromo-5-difluoromethoxy-l-methyl3-pyrazolvl)pyrazole
8.3 g (0.052 mol) Bromine was added dropwise at room temperature to 13 g (0.047 mol) 5-amino-4-nitro25 1-(5-difluoromethoxy-l-methyl-3-pyrazolyl)pyrazole dissolved in 260 ml acetic acid and the mixture stirred for 30 minutes. It was then concentrated and the residue taken up in the ethyl acetate and shaken with 5% aqueous sodium hydrogen carbonate. The phases were separated and the organic phase dried over magnesium sulfate. This was concentrated and the residue purified by silica gel column chromatography (hexane/ethyl acetate 3:1).
Yield: 8.3 g = 49.6% of theory
5 mp: 14 8 °C
BAD ORIGINAL $
AP Ο Ο Ο 4 4 Ο ο
o
Preparation of the starting materials
1. 5-Amino-4-nitro-l-(5-difluoromethoxy-l-methyl3-pyrazolyl)-pyrazole g (0.065 mol) 5-Amino-l-(5-difluoromethoxy-l-methy13-pyrazolyl)pyrazole was dissolved in 60 ml acetic acid and treated with 7.35 g (0.072 mol) acetic anhydride.
After stirring at room temperature for 3 hours, the reaction mixture was cooled to 10°C. 4.95 g (0.078 mol) Fuming nitric acid was added dropwise and the mixture treated with 8.0 g (0.078 mol) acetic anhydride. After stirring for 18 hours at room temperature, the reaction mixture was added to 500 ml ice-water. It was extracted three times with ethyl acetate, the organic phases were washed with water and concentrated. The residue was treated with 80 ml ethanol and 40 ml concentrated hydrochloric acid. After heating for 8 hours under reflux, the ethanol was removed and the residue extracted with ethyl acetate. The concentrated ethyl acetate phases were washed with saturated aqueous sodium hydrogen carbonate, dried over magnesium sulfate and concentrated. The residue was recrystallised from diisopropyl ether and ethyl acetate .
Yield: 10 g = 56% of theory mp: 140°C
2. 5-Amino-l-(5-difluoromethoxy-l-methvl-3-pyrazolyl)pyrazole
16.5 (0.06 mol) 5-Amino-l-(5-difluoromethoxy-l-methyl3-pyrazolyl)-4-pyrazolecarboxylic acid was heated at 210°C for 5 minutes and then cooled. The congealed melt was recrystallised from diisopropyl ether.
AP 0 Ο Ο 4 4 Ο
Yield: 12.6 g = 92% of theory mp: 106-107°C
3. 5-Amino-l-(5-difluoromethoxy-l-methyl3-pyrazolyl)-4-pyrazolecarboxylic acid
18.9 g (0.06 mol) Ethyl 5-Araino-l-(5-difluoromethoxyl-methyl-3-pyrazolyl)-4-pyrazolyl-4-pyrazolecarboxylate was dissolved in 150 ml 50% ethanol and treated with 15 ml 45% caustic soda. The mixture was heated for 2 hours at 8O°C, the ethanol distilled, the residue treated with icewater and acidified with concentrated hydrochloric acid. The residue was removed by suction filtration, washed with water and dried in vacuo at 75°C.
Yield: 16.7 g = 97% of theory mp: 173°C (dec.)
4. Ethyl 5-Amino-l-(5-difluoromethoxv-l-methyl3-pyrazolvl)-4-pyrazolvl-4-pvrazolecarboxylate g (0.1 mol) 5-Difluoromethoxy-3-hydrazino-l-methylpyrazole was dissolved in 100 ml ethanol. 18.05 g (0.1 mol) Ethyl ethoxymethylenecyanoacetate was added and the mixture heated for 1.5 hours at boiling. After cooling, the precipitated product was removed by suction filtration, washed with some ethanol and dried.
Yield: 18.95 g = 59% of theory mp: 168-169°C
5. 5-Difluoromethoxy-3-hydrazino-l-methyIpyrazole
39.8 g (0.25 mol) 3-Amino-5-difluoromethoxy-l-methylpyrazole was dissolved in 224 ml water and 450 ml concentrated hydrochloric acid. At -10°C, 18.55 g (0.27
BAD ORIGINAL ft
ΑΡοοο44 ο c
c mol) sodium nitrite in 80 ml water was added dropwise. After stirring for 1 hour at -1O°C, 137.6 g tin(II)chloride, dissolved in 180 ml concentrated hydrochloric acid, was added, dropwise, at this temperature. After a further hour stirring at -10°C, 805 ml 32% caustic soda was added dropwise at this temperature. The reaction mixture was shaken 8 times with ethyl acetate, the combined organic phases washed with saturated aqueous sodium chloride, dried over magnesium sulfate and concentrated.
Yield: 42.24 g = 97.2% of theory
Example 3.2
5-Amino-l-(4-bromo-5-difluoromethoxy-l-methy13-pyrazolyl)-4-pyrazolecarbonitrile
5.0 g (20 mmol) 5-Amino-l-(5-difluoromethoxy-l-methyl3-pyrazolyl)-4-pyrazolecarbonitrile was dissolved in 80 ml acetic acid. At room temperature, 1.2 ml (23 mmol) bromine was added, dropwise. After stirring for 15 minutes, the mixture was concentrated and stirred with diisopropyl ether/propanol. The solid material was suction filtered and dried.
Yield: 5.7 g = 87% of theory mp: 160°C
Example 3.3
5-Amino-l-(3-bromo-4,5,6,7-tetrahydropvrazoloΓ1, 5-al-pyridin-2-yl)-4-nitropyrazole
3.6 g (12.7 mmol) 5-Amino-l-(3-bromo-4,5,6,7-tetrahydropyrazolof1,5-a]pyridin-2-yl)pyrazole was suspended in 15 ml acetic acid and treated with 1.23 ml (13.0 mmol) acetic anhydride. The mixture was stirred for 5 hours at room
AP 0 0 0 440 temperature. 1.5 ml (15.9 mmol) acetic anhydride was added and then, with ice-bath cooling, 0.66 ml (15.5 mmol) fuming nitric acid was added, dropwise. After stirring for 12 hours at room temperature, the mixture was concentrated. The residue was dissolved in 30 ml ethanol and treated with 11.2 ml concentrated hydrochloric acid. After heating for 3 hours under reflux, the mixture was concentrated and the residue taken up in water and ethyl acetate. It was made basic with 2N aqueous sodium hydroxide and the organic phase separated. The aqueous phase was extracted twice with ethyl acetate. The combined organic phases were washed once with water and once with saturated aqueous sodium chloride. The organic phase was dried and concentrated. The residue was recrystallised from ethyl acetate.
Example 4.1
1- f3-Chloro-4,5,6,7-tetrahvdropyrazolof1,5-alpyridin2- vl)-5-diethylamino-4-pvrazolecarbonitrile
10.45 g (0.35 mol) Sodium hydride (80%) was added to 100 ml tetrahydrofuran and cooled to O’C. In a nitrogen atmosphere, a suspension of 43.6 g (0.17 mol)
5-amino-l-(3-chloro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-4-pyrazolecarbonitrile in 500 ml tetrahydrofuran was added dropwise. The mixture was stirred for 1.5 hours. Then 31.4 ml (0.38 mol) iodoethane in 20 ml tetrahydrofuran was added dropwise at 15°C. After stirring for three hours at 15°C, the mixture was cooled. Water was then added dropwise and the mixture extracted with ethyl acetate. The organic phase was separated, dried and concentrated. The residue was recrystallised from ethyl acetate.
Yield: 47.3 g = 89.4% of theory mp: 68-70 °C
SAD
ORIGINAL
APO 00 4 4 Ο
Example 4.2
1- (3-Chloro-4,5,6,7-tetrahydropyrazolof1, 5-alpyridin2— yl)-5-(ethylmethvlamino)-4-pyrazolecarbonitrile
23.3 g (88.7 mmol) 5-Amino-l-(3-chloro-4,5,6,7-tetrahydropyrazolo[l,5-a]pyridin-2-yl)-4-pyrazolecarbonitrile, 202 ml (1,21 mmol) triethyl orthoformate and 10 drops trifluoroacetic acid was heated for 5 hours with removal of water in a water bath at a temperature of 150°C. The reaction solution was concentrated, the residue was suspended in 250 ml ethanol and treated, portionwise, with cooling with 4.2 g (106.4 mmol) sodium borohydride. The mixture was heated to reflux until no more gas evolution was observed. Then the mixture was concentrated and the residue carefully added to ice-water. The mixture was extracted 3 times with methylene chloride and the extracts dried. The organic phase was concentrated. 2.61 g (87.1 mmol) Sodium hydride (80%) was added to 150 ml tetrahydrofuran and at 0°C, 24.1 g (87.1 mmol) of the resulting 1-(3-chloro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-5-methylamino-4-pyrazolecarbonitrile in 500 ml tetrahydrofuran was added dropwise. After stirring for 1 hour at room temperature, 7.82 ml (95.8 mmol) iodoethane was added and the mixture heated at 70°C for 3 hours. Water was added dropwise and the mixture extracted 3 times with ethyl acetate. The organic phase was separated, dried and concentrated. The residue was recrystallised from ethyl acetate.
Yield: 18.97 g = 71% of theory
APOOO 44 Ο
Example 4.3
5-Bromo-1-(4-chloro-5-difluoromethoxy-l-methyl3-pyrazolyl)-4-pyrazolecarbonitrile
5.68 g (19.7 mmol) 5-Amino-l-(4-chloro-5-difluoromethoxyl-methyl-3-pyrazolyl)-4-pyrazolecarbonitrile was dissolved in 66.3 ml hydrobromic acid (47%) and the mixture cooled to -6°C. Under a nitrogen atmosphere, 2.36 g (34.2 mmol) sodium nitrite in 5.9 ml water was added dropwise. The mixture was stirred for 15 minutes at this temperature and heated to room temperature. 200 ml water was then added and the mixture extracted 4 times with methylene chloride. The organic phase was washed with saturated aqueous sodium hydrogen carbonate, dried over magnesium sulfate and concentrated.
Yield: 6.94 g = 99.5% of theory mp: 78 °C
Preparation of the starting materials
1. 5-Amino-1-(4-chloro-5-difluoromethoxv-l-methyl3-pyrazolyl)-4-pyrazolecarbonitrile
5.0 g (19.7 mnol) 5-Amino-l-(5-difluoromethoxy-l-methyl25 3-pyrazolyl)-4-pyrazolecarbonitrile was dissolved in 180 ml acetonitrile and 2.65 g (19.7 mmol) sulfuryl chloride added dropwise. The mixture was stirred for one hour at room temperature and concentrated.
Yield: 5.68 g = 99.5% of theory
AP Ο Ο Ο 4 4 Ο . 5-Amino-1- (5-difluoromethoxy-1-methyl-3-pyrazolvl) 4-pvrazolecarbonitrile
22.5 g (0.13 mol) 5-Difluoromethoxy-3-hydrazino-l-methyl5 pyrazole was dissolved in 310 ml ethanol and treated with
15.4 g (0.13 mol) ethoxymethylenemalononitrile. After the mixture had been heated under reflux for one hour it was cooled. The precipitate was suction filtered and washed with a small amount of ethanol.
ζ-, 10 Yield: 19.28 g = 60% of theory mp: 141-143°C
3. 5-Difluoromethoxy-3-hydrazino-l-methylpvrazole
39.8 g (0.25 mol) 3-Amino-5-difluoromethoxy-l-methylpyrazole was dissolved in 225 ml water and 450 ml concentrated hydrochloric acid. At -10°C, 18.55 g (0.27 mol) sodium nitrite in 80 ml water was added dropwise. After stirring for one hour at -10°C, 137.6 g tin(II)chloride, dissolved in 180 ml concentrated hydrochloric acid, was added dropwise at this temperature. After stirring for a further hour at -10°C, 805 ml 32% t caustic soda was added dropwise at this temperature to the reaction mixture. The mixture was shaken 8 times with ethyl acetate, the combined organic phases washed with aqueous saturated sodium chloride, dried over magnesium sulfate and concentrated.
Yield: 42.24 g = 97.2% of theory
4. 3-Amino-5-difluoromethoxy-1-methylpyrazole
71.7 g (1.79 mol) Sodium hydroxide was added to 600 ml water and the mixture cooled to -5°C. At this temperature, 57.3 g (0.36 mol) bromine was added dropwise at such a rate that the temperature did not rise above 0°C. Then bad original
AP Ο Ο Ο 4 4 Ο
57.1 g (0.3 mol) 3-carbamoyl-5-difluoromethoxy-l-methylpyrazole was added portionwise at 0°C. The reaction mixture was stirred for one hour at 80°C and then saturated with sodium chloride. The precipitate which formed was suction filtered off. The filtrate was shaken 6 times with the ethyl acetate. The organic phase was dried over magnesium sulfate and concentrated. The precipitate which had been removed was dissolved in 500 ml water and the solution heated to boiling point for one hour. The ¢- 10 reaction solution was saturated with sodium chloride and shaken 6 times with ethyl acetate. The organic phase was dried with magnesium sulfate and concentrated.
Yield: 34.2 g = 70.5% of theory 15 mp: 57 °C
5. 3-Carbamoyl-5-difluoromethoxy-l-methylpyrazole
80.6 g (0.39 mol) 3-Methoxycarbonyl-5-difluoromethoxy20 1-methylpyrazole and 300 ml aqueous ammonia (33%) was stirred for one hour under reflux. The reaction solution was cooled, the precipitate suction filtered off and
C washed with water and diisopropyl ether.
Yield: 58.9 g = 78.8% of theory mp: 154°C
6. 5-Difluoromethoxy-3-methoxycarbony1-1-methylpyrazole
67.6 g (0.43 mol) 5-Hydroxy-3-methoxycarbonyl-l-methylpyrazole and 299.2 g (2.17 mol) potassium carbonate was dissolved in 1500 ml dimethylformamide and heated to 70°C. At this temperature chlorodifluoromethane was introduced over 2 hours and the mixture stirred at 80°c for 1.5 hours. The reaction mixture was added to water and bad ORIGINAL
AP 0 0 0 4 4 0 extracted 6 times with ethyl acetate. The combined organic phases were washed with saturated aqueous sodium chloride and dried over magnesium sulfate. The reaction solution was concentrated.
Yield: 80.6 g = 90.3% of theory
7. 5-Hydroxy-3-methoxycarbony1-1-methvlpyrazole
102.3 g (0.72 mol) Dimethyl acetylenedicarboxylate was added to 1000 ml ether and the mixture cooled to -5°C in an ice-methanol bath. 33 g (0.72 mol) methylhydrazine in 100 ml ether was added dropwise at a rate that the inner temperature did not rise above 0°C. The mixture was stirred for one hour at 0°C, the precipitate suction filtered off, washed with ether and dried at 40°C in vacuo. The intermediate was immersed in an oil-bath heated to 120°C. The reaction product was recrystallised from methanol.
Yield: 67.6 g = 60.1% of theory mp: 197 °C
8. 4-Chloro-5-difluoromethoxy-3-methoxycarbony11-methvl-pyrazole
2.1 g (10 mmol) 5-Difluoromethoxy-3-methoxycarbonyl1-methylpyrazole, dissolved in 30 ml methylene chloride, was treated with 1.35 g (10 mmol) sulfuryl chloride and the mixture stirred at room temperature for 10 minutes. It was then concentrated and the residue recrystallised from diisopropyl ether/ethyl acetate.
Yield: 1.8 g = 74.8% of theory mp: 51 °C
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
Ο
C c
c
Example 4.4
1-(4-Chloro-5-difluoromethoxv-l-methvl-3-pvrazolvl)5-methvl-4-pyrazolecarbonitrile
0.57 g (2.25 mmol) 1-(5-Difluoromethoxy-l-methyl3-pyrazolyl)-5-methyl-4-pyrazolecarbonitrile was dissolved in 30 ml methylene chloride and at room temperature was treated with 0.30 g (2.25 mmol) sulfuryl chloride. The mixture was stirred for one hour and then concentrated.
Yield: 0.65 g = 99.8% of theory mp: 69-70°C
Preparation of the starting materials
1. 1-(5-Difluoromethoxv-l-methvl-3-pvrazolvl)-5-methvl4-pyrazolecarbonitrile
A mixture of 0.79 g (2.91 mmol) 1-(5-difluoromethoxyl-methyl-3-pyrazolyl)-5-methyl-4-pyrazolecarboxamide,
0.46 g (5.85 mmol) pyridine and 20 ml 1,4-dioxane was cooled to 5°C and 0.74 g (3.51 mmol) trifluoroacetic anhydride was added dropwise. The mixture was stirred for 3 hours at room temperature. It was then added to 100 ml water and extracted 4 times with ethyl acetate. The organic phase was dried over magnesium sulfate and concentrated.
Yield: 0.74 = 99.8% of theory mp: 106-107°C
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
2. 1-(5-Difluoromethoxv-l-methvl-3-pyrazolyl)-5-methyl4-pyrazolecarboxamide
0.98 g (3.38 mmol) 1-(5-Difluoromethoxy-l-methyl5 3-pyrazolyl)-5-methyl-4-pyrazolecarbonyl chloride was dissolved in 20 ml tetrahydrofuran and 50 ml aqueous ammonia (33%) was added with stirring. After stirring for 3 hours at room temperature, the mixture was concentrated to half and acidified with dilute hydrochloric acid. The precipitate was suction filtered off, washed with a small amount of water and dried.
Yield: 0.27 g = 73% of theory mp: 116-118 °C
3. 1-(5-Difluoromethoxy-1-methyl-3-pyrazolvl)-5-methvl4-pyrazolecarbonyl chloride
0.2 g (3.8 mmol) 1-(5-Difluoromethoxy-l-methyl20 3-pyrazolyl)-5-methyl-4-pyrazolecarboxylic acid was suspended in 30 ml 1,2-dichloroethane and 1.19 g (10.0 mmol) thionyl chloride was added at room temperature, dropwise. The mixture was heated for 1 hour under reflux and concentrated.
Yield: 0.98 g = 100% of theory
4. 1-(5-Difluoromethoxy-l-methyl-3-pyrazolyl)-5-methvl4-pyrazolecarboxylic acid 30
A mixture of 1.25 g (4.16 mmol) Ethyl 1-(5-difluoromethoxy-l-methyl-3-pyrazolyl)-5-methy1-4-pyrazolecarboxylate, 20 ml ethanol and 0.97 ml aqueous sodium hydroxide (45%) was stirred for 1 hour at 80°C. The reaction solution was concentrated to a half and acidified
AP Ο Ο Ο 4 4 Ο with hydrochloric acid (37%). The precipitate was suction filtered off, washed with water and dried.
Yield: 1.05 g = 93% of theory 5 mp: 205-207°C
5. Ethyl 1-(5-difluoromethoxy-l-methyl-3-pyrazolvl)5-methy1-4-pyrazolecarboxylate
3.0 g (16.8 mmol) 5-Difluoromethoxy-3-hydrazino-l-methylpyrazole was added to 25 ml ethanol and treated dropwise with 2.96 g (16.0 mmol) ethyl dimethylaminomethylenacetate dissolved in 25 ml ethanol. The mixture was heated under reflux for 2 hours. After cooling the precipitate was suction filtered off.
Yield: 2.52 g = 53% of theory mp: 100°C
Further starting materials were prepared as follows:
1. 1,1,7-Trichloro-l-hepten-3-one
100 g (0.62 mol) 5-Chlorovaleroyl chloride was added dropwise to 78.53 g (0.589 mmol) aluminium chloride in 150 ml methylene chloride at room temperature. After stirring for 1 hour, 45 ml (0.558 mol) 1,1-dichloroethylene in 25 ml methylene chloride was added dropwise. Under icecooling 100 ml water was added dropwise and solid material suction filtered on Celite.The filtrate was washed with water and the organic phase dried and concentrated. The residue was distilled in a rotary evaporator.
Yield: 112.76 g = 93.8% of theory.
b.p.: 125°C/0.4 mbar bad original
AP Ο Ο Ο 4 4 Ο
2. 2-Hydrazino-4,5,6,7-tetrahydropvrazolof1,5-aTpyridine
261.9 ml (5.4 mol) Hydrazine hydrate was added dropwise to 116.6 g (0.54 mol) 1,1,7-trichloro-l-hepten-3-one in 2000 ml 2-propanol at -2’ C (acetone/dry-ice). After stirring for 12 hours at room temperature 60.6 g (1,08 mmol) potassium hydroxide was added and the mixture heated for 5 hours under reflux. The reaction mixture was evaporated to dryness and the residue treated with 100 ml water and 100 ml brine. It was extracted 9 times with ethyl acetate and the and the organic phase washed with brine, dried over sodium sulfate and concentrated.
Yield: 29.29 g = 35.6% of theory.
Yellow oil
3. 5-Amino-4-cyano-l-(l-methvl-5-methylmercapto3-pyrazolyl)pyrazole
A mixture of 2.0 g (13.1 mmol) 3-Hydrazino-l-methyl5-methylmercaptopyrazole and 1.8 g (14.4 mmol) ethoxymethylenemalononitrile in 25 ml ethanol was stirred for 30 minutes at room temperature and heated at boiling point for 3 hours. The reaction mixture was concentrated and the residue purified by silica gel chromatography (hexane/ethyl acetate 1:1).
Yield 2.8 g = 91% of theory, mp: 165-166° C.
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
4. 3-Hydrazino-1-methyl-5-methylmercaptopyrazole
1.1 g (15.8 mmol) sodium nitrite in 4 ml water was added dropwise to 1.9 g (13.1 mmol) 3-amino-l-methyl-5-methyl5 mercaptopyrazole in 28 ml concentrated hydrochloric acid at 0° C and the mixture stirred for 2 hours at 0°C. Then, at —30°C, a solution of 7.4 g (32.8 mmol) SnCl2 . 2H2O in 5.5 ml concentrated hydrochloric acid was added dropwise and the mixture stirred for 3 hours at this temperature.
The reaction mixture was then made basic with 32% caustic soda and extracted with methylene chloride. The organic phase was dried over sodium sulfate and concentrated. 2.0 g of product was obtained which was used without further purification.
5. 3-Amino-l-methvl-5-methvlmercaptopyrazole
5.55 g (33.0 mmol) 3-amino-4-cyano-l-methyl-5-methylmercaptopyrazole heated with 50 ml 32% caustic soda at boiling for 24 hours. The reaction mixture was cooled, made slightly acidic with aqueous sodium hydrogen phosphate, heated for 8 hours at 50°C and extracted with ethyl acetate. The organic phase was dried over sodium sulfate, concentrated and the residue purified by silica gel chromatography (hexane/ethyl acetate 1:1).
Yield: 19 g = 398% of theory, mp: 164-166° C.
6. 3-Amino-4-cyano-1-methyl-5-methylmercaptopyrazole
9.63 g (56.6 mmol) [Bis(methylmercapto)methylene]malononitrile was suspended in 50 ml water and treated with 3.7 ml (67.9 mmol) methylhydrazine. The mixture was bad ORIGINAL $
AP 0 0 0 4 4 0 heated at boiling for 1 hour, the reaction solution cooled, the precipitate suction filtered and recrystallised from ethanol.
Yield: 6.5 g = 68.% of theory.
mp: 120-121° C.
7. 5-Amino-l-(4,5,6.7-tetrahydropyrazolon,5-alpyridin-2-yl)-4-pyrazolecarboxylic acid and
2-hydrazino-4,5.6,7-tetrahvdro-pyrazolor1,5-alpyridine
These were prepared according to known methods as follows:
a) 2-Amino-4,5,6,7-tetrahydropyrazoloΓ1.5-alpyridine
A solution of 8.19 g (146 mmol) potassium hydroxide in 122 ml water and 122 ml ethanol was added to 19.19 g (292 mmol) hydroxylamine hydrochloride in 200 ml ethanol. The mixture was stirred for 15 minutes, 12.5 g (58 mmol) 2-(2,5-dimethyl-l-pyrrolyl)-4,5,6-7-tetrahydropyrazolo[l,5-a]pyridine added and the mixture heated under reflux for 30 hours. After distilling the ethanol, the mixture was treated with ethyl acetate, solid material filtered off, the aqueous phase saturated with sodium chloride and extracted with ethyl acetate. The organic phase was washed with saturated aqueous sodium chloride, dried over sodium sulfate and concentrated. The crude product was purified by silica gel chromatography (ethyl acetate/methanol).
Yield: 6.12 g = 77% of theory lH NMR (CDCl-j, 300MHz): <5=1.75-1.85 (m,2H), 1.95-2,05 (m, 2H) 2.68(t,2H,J=7.5Hz) , 3.5(s(wide),2H) , 3.92(t,2H,J=7.5Hz) , 5.33(s,lH)
BAD ORIGINAL ft
AP000440
b) 2-(2,5-Dimethvl-l-pyrrolvl)-4.5,6,7-tetrahvdropyrazolof1,5-alpyridine g (92 mmol) diethyl azodicarboxylate was added dropwise to 19.7 g (84 mmol) 3(5)-(4-hydroxybutyl)-5(3)(2,5-dimethyl-l-pyrrolyl)pyrazole and 22.1 g (84 mmol) triphenylphosphine in 300 ml tetrahydrofuran under ice cooling. The mixture was stirred for 4 hours at room temperature. It was then concentrated and the residue purified by silica gel chromatography (hexane/ethyl acetate).
Yield: 14.27 g = 79% of theory n£°: 1.5630
c) 3(5)-(4-Hydroxvbutyl)-5(3)-(2,5-dimethyl1-pyrrolyl)pyrazole
A mixture of 18 g (116 mmol) 3(5)-amino-5(3)-(hydroxybutyl) pyrazole, 14.6 g (128 mmol) 2,5-hexanedione and 3.2 ml acetic acid in 100 ml toluene was heated under reflux with removal of water for 8 hours. The resulting precipitate was suction filtered, washed with toluene and dried.
Yield: 19.7 g = 72% of theory mp: 147-148°C
d) 3(5)-Amino-5(3)-(hydroxybutyl)pyrazole
4,8 ml Hydrazine monohydrate was added to a solution of 12.3 g (0.1 mol) tetrahydro-2H-pyran-2-ylidenacetonitrile in 100 ml toluene at room temperature and the mixture
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
C 10 c
c heated under reflux for 5 hours. A dark yellow oil separated. The reaction mixture was concentrated and the residue purified by silica gel chromatography (ethyl acetate/methanol).
Yield: 11 g = 71% of theory
In a similar manner to that described in the previous Examples, the following compounds were prepared.
General formula
AP 0 0 0 4 4 0
Compound Physical
| No. | R5 | R6 | mp [°C] |
| 1.3 | H | H | 80-82 |
| 1.4 | -CN | H | 120-121 |
| 1.5 | H | -NHCOC2H5 | 149-151 |
| 1.6 | -CN | -NHCH3 | 174-175 |
| 1.7 | -CN | -N(CH3)2 | 138-139 |
| 1.8 | -CN | •N(C2H5)2 | |
| 1.9 | -CN | -nhcoch2ci | 209-211 |
| 1.10 | -CN | -N(CH3)COCH2C1 | 109-110 |
| 1.11 | -CN | 131-132 | |
| 1.12 | -no2 | -N(C2H5)2 | 55-57 |
| 1.13 | -nc>2 | -NHCH3 | 184-185 |
| 1.14 | -CN | Cl | 176-177 |
| 1.15 | -CN | Br | 196-198 |
| 1.16 | -no2 | Cl | |
| 1.17 | -no2 | Br |
Constant nn
1,5432
bad original $
AP Ο Ο Ο 4 4 Ο
Compound
No
R5
R6
Physical mp[°C]
Constant
1.18
1.19
1.20 1.21 1.22
1.23
1.24
1.25
1.26
1.27
1.28
1.29
1.30
1.31
1.32
1.33
1.34
1.35
1.36
-CN
-CN
-CN
-NO2
-NO2
-NO2
-CN
-CN
-NO2
-NO2
-NO2
-NO2
-NO2
-NO2
-NO2
-NO2
-CN
-NO2
-CN
-CH3 168-171
-C2H5
-C3H7
-CH3
-c2h5
-C3H7
-OCH3
-OC2H5
-OCH3 •OC2H5
-OCH(CH3)CO2CH3
-OCH(CH3)CO2C2H5
-SCH3
-SOCH3
-SO2CH3
-sc2h5
-SCH2COOEt
-SCH2COOEt
-NHCO(CH2)2C1 149-150 c
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
General formula
Compound Physical Constant
| No. | Rl | R2 | R3 | R5 | , 20 R6 mpFC]nD | |
| 2.2 | ch3 | -och3 | a | -ΝΟ2 | -NHCOCH3 | 46-48 |
| 2.3 | ch3 | -ochf2 | H | H | -nhcocf3 | 67-70 |
| 2.4 | ch3 | -ochf2 | H | H | -N(CH3)COCH3 | 66 |
| 2.5 | ch3 | -ochf2 | H | -no2 | -nhcoch3 | 115-116 |
| 2.6 | ch3 | -ochf2 | Cl | H | -nhcoch3 | 106 |
| 2.7 | ch3 | -ochf2 | Cl | H | -nhcoc2h5 | 114-119 |
| 2.8 | ch3 | -ochf2 | Cl | H | -nhcoc3h7 | 80-84 |
| 2.9 | ch3 | -ochf2 | Cl | H | -nhcoch2ci | 111-115 |
| 2.10 | ch3 | -ochf2 | Cl | H | -NHCO_<g> | 152-156 |
| 2.11 | ch3 | -ochf2 | Cl | -NO2 | -nhcoc2h5 | 109-110 |
| 2.12 | ch3 | -ochf2 | Cl | -no2 | -nhcoc3h7 | 92-96 |
| 2.13 | ch3 | -ochf2 | Cl | -no2 | -nhcoch2ci | 118-120 |
| 2.14 | ch3 | -ochf2 | Cl | -no2 | NHCO-^ | 194-196 |
| 2.15 | ch3 | -ochf2 | Cl | -no2 | -nhch3 | 102-105 |
| 2.16 | ch3 | -ochf2 | a | -NO2 | -N(CH3)2 | |
| 2.17 | - (CH | 2)A- | Cl | -NO2 | -nhcoch3 | 162 ( dec.) |
| 2.18 | - (CH | Cl | -no2 | -nhcoc3h7 | 58-61 | |
| 2.19 | - (CH | z | Cl | -no2 | 168( dec) | |
| 2.20 | ch3 | -ochf2 | Cl | H | -NHCO2C2H5 | 144-146 |
| 2.21 | ch3 | -ochf2 | Cl | H | -NHCONH2 |
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
| Compund | R3 | Physical Constant | |||
| No. | R1 R2 | R5 R6 | 20 mp[°C]nD | ||
| 2.22 | ch3 -ochf2 | a | H | -nhconhch3 | |
| 2.23 | ch3 -ochf2 | a | H | -NHCON(CH3)2 | |
| 2.24 | ch3 -ochf2 | a | -no2 | -NHCO2C2H5 | 1 |
| 2.25 | ch3 -ochf2 | a | -no2 | -nhconh2 | |
| 2.26 | ch3 -ochf2 | a | -no2 | -nhconhch3 | |
| 2.27 | ch3 -ochf2 | a | -NC^ | -NHCON(CH3)2 | |
| 2.28 | -<ch2’v | a | -N02 | -nhco2c2h5 | |
| 2.29 | -<οη2>4- | a | -no2 | -nhconh2 | |
| 2.30 | -<ch2)4- | a | -no2 | -nhconhch3 | |
| 2.31 | -<ch2)c | a | -N02 | -NHCON(CH3)2 | |
| 2.32 | ch3 -ochf2 | a | -no2 | -och3 | |
| 2.33 | ch3 -ochf2 | a | -no2 | -oc2h5 | |
| 2.34 | ch3 -ochf2 | a | -N02 | -0CH(CH3)CO2C2H5 | |
| 2.35 | ch3 -ochf2 | a | -no2 | -sch3 | |
| 2.36 | ch3 -ochf2 | a | -N02 | -soch3 | |
| 2.37 | ch3 -ochf2 | a | -no2 | -SC>2CH3 | |
| 2.38 | a | -N02 | -nhcocf3 | 56-60 | |
| 2.39 | ch3 -ochf2 | a | -no2 | nh6—<(] | 44-48 |
| 2.40 | ch3 -ochf2 | a | -no2 | o N H JLo _^Q^_q | 1.: |
| 2.41 | ch3 -ochf2 | a | -no2 | 0 II NHCCHgCClj | 47-51 |
| 2.42 | ch3 -ochf2 | a | H | ΝΗ0—<ζ] | 122-124 |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
General formula
Physical Constant
| Example No. | R3 | R6 | mp [°C] | nD | |
| Ο | 2.43 | a | CH2OCH2CO2Me | 1.51438 | |
| 2.44 | a | OLOCHCCLMe I | 1.50800 | ||
| CH, | |||||
| 2.45 | a | CH.OCCH, II | 1.51254 | ||
| 0 | |||||
| 2.46 | Cl | ch2sch3 | 1.54268 | ||
| c | 2.47 | a | CH2SEt | 1.53566 | |
| c | 2.48 | a | 74 | ||
| 2.49 | a | CH2SCH2CO2Et | 1.52740 | ||
| 2.50 | a | CH2NH2 | 1.53932 | ||
| 2.51 | Cl | CH2NHMe | |||
| 2.52 | a | CH2NHEt | |||
| 2.53 | a | CH2NH- | 1.51362 | ||
| 2.54 | Cl y | CH2NMe2 | |||
| 2.55 | Cl | CH2NEt2 | |||
| 2.56 | Cl | CH2N prop2 |
AP Ο Ο Ο 4 4 Ο
| Example | Physical | Constant | |
| No. R3 | R6 | mp (° C] | nD |
| 2.57 | Cl | ch2och2ci |
| 2.58 | Cl | ch2och2cn |
| 2.59 | Cl | CH2 OCH2-C=CH |
| 2.60 | Cl | CH2O<^HG=CH ch3 |
| 2.61 | Cl | CH,O-^0 |
| 2.62 | Cl | CH2OCH2C02Et |
| 2.63 | Cl | CH2OCH2CO2— |
| 2.64 | Cl | CH2OCH2CO2- |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
| Example· | R3 | R6 | Physical Constant |
| No. | mp [°C] no |
| 4.6 | Cl | ch3 | 69-70 |
| 4.7 | Br | ch3 | 76-78 |
| 4.8 | Cl | cf3 | 90-93 |
| 4.9 | Br | cf3 | 83- 86 |
| 4.10 | Cl | C2H5 | 74- 76 |
| 4.11 | Cl | C(CH3)3 | 57- 60 |
| 4.12 | Cl | ch2och3 | 1.50852 (20 °C) |
| 4.13 | Br | ch2och3 | 1.52580 |
| 4.14 | Cl | 118-122 | |
| 4.15 | Cl | ch2oh | 64 |
| 4.16 | Cl | ch2ci | 54 |
| 4.17 | Cl | CH2Br | 52 |
| 4.18 | Cl | CH2OEt | 67 |
| 4.19 | Cl | CH2Oprop | 48 |
| 4.20 | a | CH.O— | 1.50778 (20 °C) |
| 4.21 | Cl | CH2O(CH2)3CH3 | 1.50450 (20 9C). |
General formula
AP ο Ο Ο 4 4 Ο
| Example No. | R1 | R2 | R3 | R6 | Physical Constant | |
| mp.: [°C] | nD | |||||
| 4.22 | -(CH2)4- | Br | Br | 204-205 | ||
| 4.23 | ch3 | ochf2 | a | Br | 71-74 | |
| 4.24 | ch3 | ochf2 | Cl | Cl | 1.54046 | |
| (20,2 °C) | ||||||
| 4.25 | ch3 | ochf2 | Br | Br | 96- 97 |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
General formula
| 4.26 | Cl | cf3 | 109 - | 110 |
| 4.27 | a | c2h5 | 130 - | 131 |
| 4.28 | Cl | c2f5 | 135.5 - | 136 |
| 4.29 | Cl | C3H7 | 62 - | 63 |
| 4.30 | Cl | CH(CH3)2 | 107 - | 108 |
| 4.31 | Cl | Ph | 153 - | 154 |
| 4.32 | Cl | ch2och3 | 84 - | 85 |
| 4.33 | Br | ch2och3 | 80 - | 83 |
| 4.34 | Cl | ch2oc2h5 | 73 - | 74 |
| 4.35 | Cl | ch2oc3h7 | 88 - | 89 |
| 4.36 | Cl | CH2OCH(CH3)2 | 1.5440 (20.1 °C) | |
| 4.37 | Cl | ch2oh | 106 - | 107 |
| 4-38 | Cl | CH2Br | 128 - | 129 |
| 4.39 | Cl | ch2och2och | 1.5591 (21.2 °C) | |
| 4.40 | Cl | ch2och2ch=ch2 | 100.5 - | 102 |
| 4.41 | Cl | CH2OCH2CH2OCH3 | 1.5492 (20,2 °C) | |
| 4.42 | Cl | ch2ococh3 | 102.5 - | 103 |
| 4.43 | Cl | ch2och2cooh | 108 - | 110 |
| 4.44 | Cl | ch2och2cooch3 | 1.5376 (20 °C) |
BAD ORIGINAL
APO 00 4 4 Ο
| Example No. | R3 | R* | Physical Constant | |
| mp: [°C] | nD | |||
| 4.45 | Cl | “'’γΥ. | 1.5462(20-1 °C) | |
| 4.46 | Cl | 1.5424 (21 °C) | ||
| 4.47 | Cl | 1.5500 (20 °C) | ||
| 4.48 | Cl | 1.5481(20,2 °C) | ||
| 4.49 | Cl | CH2N(C2H5)2 | 1.5377 (20 °C) | |
| 4.50 | Cl | ch2sch3 | 100 -101 | |
| 4.51 | Cl | ch2so2ch3 | 139.5-141 | |
| 4.52 | Cl | ch2soch3 | 1.5716 (20.4 °Q | |
| 4.53 | Cl | ch2scooh | 120 | |
| 4.54 | Cl | CH2SCH2COOC2H5 | 1.5641 (20 °C) | |
| 4.55 | Cl | COOH | 184 | |
| 4.56 | Cl | CON(C2H5)2 | 126.5-128 |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
General formula
Example
No.
R3 R6
Physical Constant mp: [°C] no
4.57
4.58
4.59
4.60
4.61
4.62
4.63
4.64
4.65
4.66
4.67
4.68
4.69
4.70
4.71
4.72
| Cl | NHC3H7 | 137 |
| Cl | NHCH(CH3)2 | 114 |
| Cl | NH(CH2-CH=CH2) | 125 |
| Cl | NHC4H9 | 118 |
| Cl | NH[CH(CH3)CH2CH3] | 106 |
| Cl | NH[CH(CH3)CH(CH3)2] | 89-92 |
| Cl | nhch2ch2och3 | 129 |
| Cl | nhch2ch2oc2h5 | 111-112 |
| Cl | NHCH(CH3)CH2OCH3 | 105-106 |
| Cl | NHCH2CH2N(CH3)2 | 131-132 |
| Cl | N(CH3)CH2CH2N(CH3)2 | 1 (: |
| Cl | NHCH2Ph NHCHj—< 5 0 | 116 |
| Cl | 122-123 | |
| Br | N(CH3)C2H5 | 74- 76 |
| Br | N(CH3)C3H7 | 93- 95 |
| Cl | N(CH3)CH(CH3)2 | 74 |
BAD ORIGINAL ft
AP Ο Ο θ * * Ο
| Example No. | R3 | R6 | Physical Constant | |
| mp: [°C] | nD | |||
| 4.73 | Cl | N(CH3)CH2-C=CH | 91 | |
| 4.74 | Br | N(CH3)CH2-ChCH | 112-114 | |
| 4.75 | a | N(C2H5)CH2-C=CH2 | 75 | |
| 4.76 | a | N(C2H5)CH2-C3CH | 1.5642 (21,5 | |
| 4.77 | Cl | N(C3H7)2 | 1.5468 (23.8 °i | |
| 4.78 | Cl | 156 | ||
| 4.79 | Cl | 84 | ||
| 4.80 | Cl | —N? \) | 107 | |
| 4.81 | a | CN | 123 | |
| 4.82 | a | N(C2H5)CH2CH2N(CH3)2 | 1.5559 (20 °C) | |
| 4.83 | Cl | N(CH2-CH=CH2)2 | 79 | |
| 4.84 | Cl | nhO | 145 | |
| 4.85 | a | nhch2-och | 145 | |
| 4.86 | Cl | NHCH(C2H5)2 | 96 | |
| 4.87 | Cl | nhO | 139-142 |
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
| Example No. | R3 | R6 | Physical Constant mp [°C] no |
| 4.88 | Cl | -O | 141 |
| 4.89 | Cl | NHCH2CH2N(C2H5)2 | 78-80 |
| 4.90 | Cl | nhch2ch2oh | 138 |
| 4.91 | Cl | NHCH2CH2OCOCH3 | 99 |
| 4.92 | Cl | nhch2ch2ci | 158 |
| 4.93 | Cl | NH(CH2)3OCH3 | 112 |
| 4.94 | Cl | NHCH2CH2OCH2CH2OH | 82-84 |
| 4.95 | Cl | NHCH2CH(OCH3)2 | 127-129 |
| 4.96 | Cl | NHCH(CH3)CH(OCH3)2 | 151 |
| 4.97 | Cl | NHCH2CH(OC2H5)2 | 111-113 |
| 4.98 | Cl | 115-117 | |
| 4.99 | Cl | 121-123 | |
| 4.100 | Cl | 149-151 | |
| 4.101 | Cl | 114.5-117 | |
| 4.102 | Cl | NHCH2CH2SC2H5 | 113-115 |
| 4.103 | Cl | 170 | |
| 4.104 | Cl | 129-131 | |
| 4.105 | Cl | NHCH2COOC2H5 | 162 |
BAD ORIGINAL
AP Ο Ο Ο 4 4 0
Example
No.
R3 R6
Physical Constant mp [°C] no
4.106
4.107
4.108
4.109
4.110
4.111
4.112 c, a
oV ci
Cl
Cl
BAD ORIGINAL ft
General formula
AP O 0 0 4 4 Ο
R3 R6
Physical Constant mp: [°C] no
Example
No.
| 4.113 | a | NHC3H7 | 80 | |
| 4.114 | a | NH- | 77 | |
| 4.115 | Cl | NH(CH2)2OCH3 | 78-79 | |
| 4.116 | Cl | N(CH3)C2H5 | 1.52076 (20 °C) | |
| 4.117 | Cl | N(C2H5)2 | 1.49924 (20 °C) | |
| 4.118 | Cl | N(CH3)CH(CH3)2 | 1.51528 (20 °C) | |
| 4.119 | Br | N(CH3)CH(CH3)2 | 1.51258 (20,3 °C) | |
| 4.120 | Cl | N(C2H5)CH(CH3)2 52 | ||
| 4.121 | Cl | N(C3H7)2 | 1.49338 |
(20 °C)
BAD ORIGINAL
AP Ο Ο 0 4 4 0
| 72 | ||
| Example No. | R3 R6 | Physical Constant mp: [°C] no |
V_/
-<
4.122
4.123
Ο
4.124
Br
100 -102
70- 72
1.53388 (21,6 °C)
BAD ORIGINAL A
AP Ο Ο Ο 4 4 Ο
Example R1 R2 R3 R6
No.
Physical Constant mp: [°C] no
4.125 -(CH2)44.126 CH3 OCHF2
4.127 CH3 OCHF2
4.128 CH3 OCHF2
| Cl | nhc2h5 | 136 |
| Cl | nhch3 | 147-148 |
| Br | nhch3 | 150-152 |
| Br | nhc2h5 | 96 |
| 4.129 | -(CH2)4- |
| 4.130 | -(CH2)4- |
| 4.131 | -(CH2)4- |
| 4.132 | -(CH2)4- |
| 4.133 | -(CH2)4- |
| 4.134 | -(CH2)4- |
Cl NHCH2CN 183 Cl NHCH2-C=C-CH3 171.5-173.5 Cl nhch2csc-ch3 Cl NHCH2-C=C-C2H5 ci nhch2-c^c-ch2-och3
General formula
APOOOMO
Example
No.
R1 R2 R3 R6
Physical Constant mp: [°C] no
4.135
4.136
4.137
4.138
4.139
4.140
4.141
4.142
4.143
4.144
4.145
4.146
4.147
4.148
| -(CH2)4- | Cl | N(CH3)C2H5 | 69 |
| -(CH2)4- | Cl | N(CH3)C3H7 | 89 |
| -(CH2)4- | Cl | N(CH3)C4H9 | 72 |
| -(CH2)4- | Cl | N(CH3)CH(CH3)C2H5 | 68 |
| -(CH2)4- | Cl | N(CH3)CH(CH3)CH(CH3)2 70 | |
| -(CH2)4- | Cl | N(CH3)CH2CH2OCH3 | 80 |
| -(CH2)4- | Cl | N(C2H5)C3H7 | 92 |
| -(CH2)4- | Cl | N(C2H5)C4H9 | 1.5471 (22.9 °C) |
| -(CH2)4- | Cl | N(C2H5)CH(CH3)C2H5 | 115 |
| -(CH2)4- | Cl | N(C2H5)CH(CH3)CH(CH3)2 | 130-133 |
| -(CH2)4- | CI | N(C2H5)CH2CH2OCH3 | 58 |
| -(CH2)4- | Cl | N(C2H5)CH2Ph | 110 |
| -(CH2)4- | Cl | N(CH3)CH2CH2OC2H5 | 1.5559 (20 °C) |
| -(CH2)4- | CI | N(C2H5)CH2CH2OC2H5 | 1.5484 (20 °C) |
BAD ORIGINAL
AP ο Ο Ο 4 4 Ο
| Example No. | R1 R2 | R3 | R^ Physical Constant | |
| mp: [°C] | nD | |||
| 4.149 | -(CH2)4- | a | N(C3H7)CH2CH2OC2H5 | 1.5452 (20 °C) |
| 4.150 | -(CH2)4- | a | N(CH2-C=CH)CH2CH2OC2H5 1.55688 (20 °C) | |
| 4.151 | -(CH2)4- | a | N(CH3)CH(CH3)CH2OCH3 | 1.55644 (20 °C) |
| 4.152 | -(CH2)4- | a | N(C2H5)CH(CH3)CH2OCH3 | 94-95 |
| 4.153 | -(CH2)4- | a | N(CH2-C=CH)CH(CH3)CH2OCH3 124-126 | |
| 4.154 | ch3 ochf2 a | N(C2H5)CH2CH2OCH3 | 1.51744 (19,9 °C) | |
| 4.155 | ch3 ochf2 a | N(CH2-C=CH)CH2CH2OCH3 | 1.51376 | |
| (20 °C) | ||||
| 4.156 | -(CH2)4- | a | NH(CH2-C^CH) | 145 |
| 4.157 | -(CH2)4- | a | N(CH(CH3)C2H5)CH2-C=CH | 142 |
| 4.158 | -(CH2)4- | Cl | N(CH3)CH2— | 108 |
| 4.159 | •(CH2)4- | Cl | N(C2H5)CH(CH3)CH3 | 106 |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
| Example No. | R1 R2 | R3 | R6 | Physical Constant mp: [°C] nD |
| 4.160 | -(CH2)4- | Cl | N(C2H5)CH(CH3)2 | 106 |
| 4.161 | -(CH2)4- | Cl | N(CH2-C^CH)CH(CH3)C2H5 142 | |
| 4.162 | -(CH2)4- | Cl | N(CH3)CH2Ph | 108 |
| 4.163 | -(CH2)4- | Cl | N(CH3)CH(C2H5)2 | 110 |
| 4.164 | -(CH2)4- | Cl | N(CH3)CH2CH(OCH3)2 | 71 |
| 4.165 | -(CH2)4- | Cl | N(C2H5)CH2CH(OCH3)2 | 1.5459 (20 °C) |
| 4.166 | -(CH2)4- | a | N(CH2-C=CH)CH2CH(OCH3)2 111-113 | |
| 4.167 | -(CH2)4- | Cl | CH, | 97-99 |
| 4.168 | -(CH2)4- | CI | A”, | 169-171 |
| 4.169 | -(CH2)4- | Cl | CH--OCH | 140-142 |
| 4.170 | -(CH2)4- | Cl | N(CH3)CH2CH2SC2H5 | 1.5855 (22.4 °C) |
| 4.171 | -(CH2)4- | Cl | N(CH3)CH2-C=C-CH3 | |
| 4.172 | -(CH2)4- | Cl | N(CH3)CH2-C^c-C2H5 | |
| 4.173 | -(CH2)4- | Cl | N(CH3)CH2-CHC-CH2-OCH3 |
BAD ORIGINAL &
| AP o 0 0 4 4 0 | |||
| Example No. | R1 R2 | 77 | |
| R3 | R^ Physical Constant mp: [°C] ηθ | ||
| 4.174 | -(CH2)4- | Cl | O0 |
| 4.175 | -(CH2)4· | a | oo |
| 4.176 | -(CH2)4- | a | OL-C3CH OO |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
V,.
General formula
Example
No.
CN
Physical Constant mp: [°C] no
| 4.177 | Br | N(C2H5)2 71-72 | |
| 4.178 | Cl | N(CH2-C=CH)2 | 1,5739 1 |
| 4.179 | Cl | N(CH2CO2C2H5)2 | 1.5427 (20 °C) |
| 4.180 | a | 108 | |
| 4.181 | Cl | N(CH2-CSC-CH3)2 | |
| 4.182 | Cl | N(CH2-OC-C2H5)2 | |
| 4.183 | Cl | N(CH2-C=C-CH2OCH3)2 |
BAD ORIGINAL ft
APO00 44 0
| 79 | |
| General formula |
Example
No.
CN
R3 R6
Physical Constant mp: [°C] nj)
| 4.184 | Cl | NHCOCH3 | 123 |
| 4.185 | Cl | NHCOCF3 | 178 |
| 4.186 | Cl | NHCOCCI3 | 224 |
| 4.187 | Cl | NHCOC2H5 | 162 |
| 4.188 | Cl | NHCOC3H7 | 152 |
| 4.189 | Br | NHCOC3H7 | 148-150 |
| NHCO—/ | |||
| 4.190 | Cl | 171 | |
| 4.191 | Cl | NHCOC4H9 | 103 |
| 4.192 | Cl | N H CO_ | 252 |
| 4.193 | Cl | NHCOCH2OCH3 | 201-203 |
bad original
AP000440
R3 R6
Example
No.
Physical Constant mp: [°C] no
4.194
185-187
4.195
165
4.196
Cl O
151
4.197
Cl vQ
| 4.198 | Cl | o | 185 |
| 4.199 | Cl | NHCON(CH3)2 | 168 |
| 4.200 | a | NHCSN(CH3)2 | 170 |
| 4.201 | Cl | NHCON(CH3)Ph | 62-64 |
BAD ORIGINAL
AP o 0 0 4 4 o
General formula
| Example No. | R3 | R* | Physical Constant | ||
| mp: [*C] | °D | ||||
| 4.202 | a | weoetywcH, 0 | 125 | ||
| 4.203 | Cl | NHCH2CO2Et | 107-109 | ||
| 4.204 | a | NHCXCC^El CH. | 111-113 | ||
| 4.205 | Cl | N(Et)C0CH3 | 78-80 | ||
| 4.206 | a | N(E0COCH2C1 | 1.53412 | ||
| 4.207 | a | 85-87 | |||
| 4.208 | a | N(Et)COEt | 1.51132 | ||
| 4.209 | a | 1.51214 | |||
| 4.210 | a | N(^\jcoe X* | 1.52582 | ||
| 4.211 | a | N(CH2CO2Me)COEt | 87-90 | ||
| 4.212 | Br | NHCOEt | 120-122 |
BAD ORIGINAL ft
APΟ 0 0 4 4 Ο 82
| Example No. | R? | R* | Physical Constant mp: [*CJ 00 |
| 4.213 | Br | NHCOnbutyl | 100*104 |
| 4.214 | Br | 103 | |
| 4.215 | Br | N(COEt)2 | 105-107 |
| 4.216 | a | NHCOCH3 | 116-118 |
| 4.217 | a | NHCOCH^Q | 135-137 |
| 4.218 | a | NHCOCF3 | 134-137 |
| 4.219 | a | NHCOC2H5 | 126-128 |
| 4.220 | Br | NHCOC3H7 | 141-144 |
| 4.221 | a | NHCOC3H7 | 140-143 |
| 4.222 | a | NHCO— | 96-100 |
| 4.223 | a | N(COCH3>2 | 117-119 |
| 4.224 | a | N(COC2H5)2 | 93- 95 |
| 4.225 | a | N(COC3H7)2 | 73- 76 |
BAD ORIGINAL
AP € Ο Ο 4 4 Ο
| Example No. | R3 | R6 | Physical Constant | |
| mp: [°C] | nD | |||
| 4.226 | Cl | N(CH3)COCH3 | 121 | |
| 4.227 | Cl | N(C2H5)COCH3 | 79 | |
| 4.228 | Cl | N(C3H7)COCH3 | 85 | |
| 4.229 | Cl | (CH2-C=CH)COCH3 | 06 | |
| 4.230 | Cl | N(CH2CH2OCH3)COCH3 | 128 | |
| 4.231 | Cl | N(CH2Ph)COCH3 | 111-113 | |
| 4.232 | Cl | N(C2H5)COCH2a | 98-101 | |
| 4.233 | Cl | N(C3H7)COCH2a | 168 | |
| 4.234 | Cl | N(CH2CH2OCH3)COCH2C1 107 | ||
| 4.235 | Cl | N(CH2CH2OC2H5)COCH2Cl | 1.54132 (20 °C) | |
| 4.236 | Cl | N(CH2Ph)COCH2Cl | 165-168 | |
| 4.237 | Cl | N(CH3)COCF3 | 98 | |
| 4.238 | Cl | N(C2H5)COCF3 | 102 | |
| 4.239 | Cl | N(CH2-C=CH)COCF3 | 137 | |
| 4.240 | Cl | N(CH3)COC2H5 | 125-128 | |
| 4.241 | Cl | N(C2H5)COC2H5 | 83 | |
| 4.242 | Cl | N(CH2CH2OC2H5)COC2H5 | 1.54132 (20 °C) |
BAD ORIGINAL ft
AP ο Ο Ο 4 4 Ο
| 84 | ||||
| Example No. | R3 | R6 | Physical Constant | |
| mp: [°C] | nD | |||
| 4.243 | Cl | N(CH3)COC3H7 | 90 | |
| 4.244 | Cl | N(C2H5)COC3H7 | 72 | |
| 4.245 | Br | N(C2H5)COC3H7 | 103-104 | |
| 4.246 | CI | N (CH t |CO_^ | 121 | |
| 4.247 | Cl | N (c,h,)co_^ | 122 | |
| 4.248 | Cl | N(CH( -CICH)CO_^ | 191 | |
| 4.249 | σ | n(ch3)coc4h9 | 1.5427 (23.2 °C | |
| 4.250 4.251 | a a | N(C2H5)COC4H9 N(COCH3)CH2OCH3 | 109 | 1.5386 (23.3 °C |
| 4.252 | a | N[CH(CH3)2]COCH3 | 112-114 | |
| 4.253 | Cl | N(CH2CH2OC2H5)COCH3 | 100-103 | |
| 4.254 | Cl | N[CH(CH3)CH(CH3)2JCOCH3 93 | ||
| 4.255 | CI | N[CH(CH3)2]COCH2C1 | 146-149 | |
| 4.256 | Cl | N[CH(CH3)C2H5]COCH2C1 | 109-111 | |
| 4.257 | CI | N[CH(CH3)CH2OCH3]COCH2C1 126 | ||
| 4.258 | , ci | N(CH2CH2SC2H5)COCH3 | 1.5655 |
(22,4 °C)
BAD ORIGINAL
APO00440
General formula
CN
| Example No. | R3 | R6 | Physical Constant | |
| mp: [°C] | nD | |||
| 4.259 | a | N(CH3)COCH3 | 108-109 | |
| 4.260 | Cl | N(CH3)COCH2C1 | 87- 90 | |
| 4.261 | Cl | N(CH3)COC2H5 | 63- 67 | |
| 4.262 | Cl | N(C2H5)COCH3 | 77 | |
| 4.263 | Br | N(C2H5)COC3H7 | 75- 77 | |
| 4.264 | Cl | N(C3H7)COCH3 | 78-80 | |
| 4.265 | Br | N(Et)COEt | 1.5168 | |
| 4.266 | Br | n (—<jcoet | 1.51532 | |
| N<\) COB | ||||
| 4.267 | Br | 1.53406 | ||
| 4.268 | Br | N(CH2CN)COEt | 95-98 | |
| 4.269 | Br | N(Me)COC3H7 | 1.55112 | |
| 4.270 | Br | N(CH2OCH3)COC3H7 | 1.53024 | |
| 4.271 | Br | N(CH2CO2Et)COC3H7 | 1.52918 |
BAD ORIGINAL 0)
ΑΡ 0 00 440
General formula
| Example No. | R3 | R6 | Physical Constant | |
| mp: [°C] | nD | |||
| 4.272 | a | och3 | 174-176 | |
| 4.273 | a | OC2H5 | 117-118 | |
| 4.274 | Br | OC2H5 | 120-122 | |
| 4.275 | CI | OC3H7 | 95- 96 | |
| 4.276 | Cl | OCH2CH2OCH3 | 1.55562 (20 °C) | |
| 4.277 | Cl | och2ch2och2ch2och3 | 1.54220 (20 °C) | |
| 4.278 | Cl | och2-c=ch | 123 | |
| 4.279 | Cl | OC4H9 | 74-76 | |
| 4.280 | Cl | %Xj° | 99.5-101.5 | |
| 4.281 | Cl | 102-104 |
BAD ORIGINAL
AP ο Ο Ο 4 4 Ο
ρ.
Met
| 87 | ||||
| Example No. | R3 | R6 | Physical Constant | |
| mp: [°C] | nD | |||
| 4.282 | CI | 1.5575 (21.8 °C) | ||
| 4.283 | Cl | 1.5520 (22 °C) | ||
| 4.284 | Cl | J? | 1.5524 (21.8 °C) | |
| 4.285 | Cl | 67-70 | ||
| 4.286 | Cl | OCH2CH2CH(OC2H5)2 | 1.5306 (20 °C) | |
| 4.287 | Cl | 91-93 | ||
| 4.288 | Cl | 1.5544 (22.7 °C) | ||
| 4.289 | Cl | SCH2COOCH(CH3)2 | 125 | |
| 4.290 | Cl | 1.6136 |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 Ο
Example R3
No.
4.291 Cl
4.292 Cl
4.293 Cl
4.294 Cl
4.295 Cl
4.296 a
4.297 Cl
4.298 Cl
4.299 Cl
4.300 Cl
4.301 Cl c
4.302 Cl
4.303 Cl
4.304 Cl
4.305 Cl
4.306 Cl
4.307 Cl
R6 Physical Constant mp: [°C) eg
| sch3 | 128 | |
| sch2ch3 | 62 | |
| SCH(CH3)2 | 1.5786 (21.8 °C) | |
| SCH2-CSCH | 94 | |
| sch2co2c2h5 | 1.5646 (22.5 °C) | |
| SCH(CH3)CO2C2H5 | 1.5602 (21.8 °C) | |
| soch3 | 163 | |
| SO2CH3 | 229 | |
| OCH2CH(CH3)2 | 84-87 | |
| OCH2CH(OC2H5)2 | 1.5283 (20 °C) | |
| O(CH2)3OCH3 | 1.5482 (20 °C) | |
| OCH2Ph | 120-122 | |
| OCH2CH2OCH(CH3)2 67-69 | ||
| 149-152 | ||
| OCH(CH3)CO2C2H5 | ||
| och2co2c2h5 | ||
BAD ORIGINAL
AP 0 0 0 4 4 0
R3 R6
Example
No.
Physical Constant mp: [°C] no
4.308
4.309
4.310
4.311
BAD ORIGINAL
AP 0 0 0 4 4 0
General formula
ExampleNo.
R6
Physical Constant mp: [°C] nD
4.312
4.313
4.314
4.315
4.316
4.317
SCH2CO2Et 1.53242 (20.2 °C)
SCH3
SEt
Sprop
S nbutyl
4.318
4.319
4.320
4.321
4.322 och3
OEt
O prop
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
Example
No.
R6 Physical Constant mp: [°C] no
4.323
4.324
4.325
4.326
4.327
4.328
4.329
4.330
4.331
4.332
4.333 nbutyl
A/o.
BAD ORIGINAL &
AP ο Ο Ο 4 4 Ο
| 92 | |
| Example No. | R<> Physical Constant mp: [°C] no |
| 4.334 |
4.335
| 4.336 | |
| 4.337 | |
| 4.338 | |
| 4.339 | OB |
| 4.340 | O^OO, Me |
| 4.341 | •-Ό |
| 4.342 | —0 |
| 4.343 | 98-100 |
| 4.344 | 103-105 |
BAD ORIGINAL Cl
AP 0 0 0 4 4 0
R6
Example
No.
Physical Constant mp: [°C] no
4.345
4.346
4.347
4.348
4.349
4.350
4.351
4.352
4.353
4.354 hnA o—
HN
HN
93-96
1.51180
101-103
105-108
96-98
BAD ORIGINAL ft
AP 0 0 0 4 4 0
General formula
CHa
Example R5 R6 Physical Constant
No. mp: [°C] no
| 4.355 | CN | N(C2H5)2 | 89-90 |
| 4.356 | CN | NHfiCH3 0 | 123-124 |
| 4.357 | CN | CH3 | |
| 4.358 | CN | ch2och3 | |
| 4.359 | CN | Br | |
| 4.360 | CN | Cl | |
| 4.361 | CN | OCH2CH2OCH3 | |
| 4.362 | no2 | NHCEt II 0 |
BAD ORIGINAL kA
AP 0 0 Ο 44 Ο
The following examples illustrate the possibilities for use of the compounds of the invention.
In these Examples, herbicidal activity is denoted on a score of 0 to 4 in which:
= no damage
1=1- 24% damage = 25 - 74% damage = 75 - 89% damage = 90 - 100% damage
The abbreviations used for the various plant species have the following meanings
ABUTH = Abutilon theophrasti VERPE = Veronica persica AGRRE = Elymus repens VIOSS = Viola sp
HJWH = Alopecurus myosuroides
AVEFA = Avena fatua
BROTE = Bromus tectorum
CYPDI = Cyperus difformis
CYPES = Cyperus esculentus
ECHGH = Echinochloa crus-galli
GALAP = Galium aparine
GOSHI = Gossypium hirsutum
IPOSS = Ipomea purpurea
MATCH = Matricaria chamomilla
MOOVA = Monochoria vaginalis
ORYSA = Oryza sativa
PANSS = Panicum maximum
PASDS = Paspalum distichum
POLSS = Polygonum sp.
SCPJU = Scirpus juncoides
SEBEX = Sesbania exaltata
SETVI = Setaria viridis
SORHA = Sorghum halepense
SOLSS = Solanum sp.
BAD ORIGINAL
AP ο Ο Ο 4 4 Ο
Te3t Example A
In a greenhouse, the noted plant species were treated pre-emergently with the noted compounds, at a rate of 0.1 kg active ingredient/ha. The compounds were sprayed evenly over the soil as emulsions in 500 litres water/ha. Three weeks after the treatment, the compounds of the invention showed excellent activity against the weeds. The comparison material did not show the same high activity.
BAD ORIGINAL
ΑΡ Ο Ο Ο Μ ο
| Compounds | A A | A B | S | F | S | C | A | I | M | P | S | S | V | V | |
| L G | V R | E | A | o | y | B | P | 4 | O | E | O | E | I | ||
| 0 R | E 0 | T | N | R | P | U | o | r | L | B | L | R | 0 | ||
| M R | F T | V | S | H | #111 | T | s | S | E | S | P | s | |||
| y e | A E | 'Lr | 'S' | A | S' — | R | S | Ks | X | s | E | s | |||
| & | :W-: | mill | III | :.« | |||||||||||
| Ex. | 1.1 | - | - - | 3 | 3 | 3 | - | 3 | - | 4 | 2 | 1 | 4 | 3 | 4 |
| Ex. | 1.2 | 3 - | 3 - | 4 | 4 | - | - | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 1.6 | 3 3 | 3 - | 4 | 4 | 3 | - | 4 | - | 4 | 4 | 3 | 4 | 4 | 4 |
| Ex, | 1.7 | - - | - - | 3 | 3 | 3 | - | 4 | - | 4 | 3 | 4 | 4 | 4 | 2 |
| Ex, | 1.8 | 2 - | - - | 2 | 2 | 3 | - | 4 | - | 4 | 4 | 3 | 4 | 3 | 2 |
| Ex. | 1.9 | 2 2 | 3 - | 4 | 3 | 3 | - | 4 | - | 4 | 3 | 3 | 4 | 4 | 4 |
| Ex, | 1.11 | 2 - | 3 - | 4 | 3 | 3 | - | 3 | - | 4 | 1 | 0 | 4 | 4 | 3 |
| Ex, | 1.13 | 3 - | 3 - | 4 | 3 | 4 | 2 | 4 | - | 4 | 4 | 3 | 4 | 4 | 2 |
| Ex. | 1.15 | 3 2 | 2 - | 4 | 4 | 2 | - | - | - | 4 | 2 | 2 | 4 | 3 | 4 |
| Ex, | 1.18 | 4 3 | 3 - | 4 | 4 | 4 | 3 | 4 | - | 4 | 4 | 2 | 4 | 4 | 4 |
| Ex, | 2.1 | 3 4 | 4 4 | 4 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 2.11 | 3 - | 3 - | - | 4 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 2.12 | 3 - | 3 - | 4 | 4 | 4 | - | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 2.13 | 3 - | - | 4 | 4 | 4 | - | 3 | 3 | 4 | 4 | 4 | 3 | 4 | 4 |
| Ex, | 2.17 | 3 3 | 3 - | 4 | 4 | 4 | - | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 2.18 | 3 - | 3 - | 4 | 4 | 3 | - | 4 | - | 4 | 4 | 2 | 4 | 4 | 4 |
| Ex. | 2.24 | 3 - | 3 - | 3 | 3 | 3 | 3 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 2.38 | 3 - | - - | 3 | 3 | - | - | 4 | 3 | 4 | 3 | 4 | 4 | 4 | 4 |
| Ex. | 4.12 | 4 4 | 4 3 | 4 4 | 4 | 3 | 4 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Untreated | 0 0 | 0 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Comparison | |||||||||||||||
| 5-tert-butyl-3- | 0 0 | 0 1 | 2 | 4 | 0 | 0 | 1 | 1 | 3 | 1 | 0 | 3 | 2 | 3 | |
| (2, | 4-dichloro-5- | ||||||||||||||
| isopropoxyphenyl)- | |||||||||||||||
| 1,3 | ,4-oxadiazol- | 2-one |
BAD ORIGINAL
AP Ο Ο Ο 4 4 Ο
Λ -Λ
Test Example Β
In a greenhouse, the noted plant species were treated post-emergently with the noted compounds, at a rate of 0.3 kg active ingredient/ha. The compounds were sprayed evenly over the plants as emulsions in 500 litres water/ha. Two weeks after the treatment, the compounds of the invention showed activity against the weeds. The comparison material did not show the same high activity.
BAD ORIGINAL &
AP Ο Ο Ο 4 4 0 — 99
| Compounds | A L O M Y | A G R R E | A V E F A | B R O T E | S E T V I | P A N S S | S Ο R H A | C Y P Sil | A B U T K | G A L A P | F P 0 S S | Μ P A o | S E B E X | S Ο L S S | V E R P E | V Ϊ 0 s s | ||
| C H | S S | |||||||||||||||||
| Ex. | 1.0 | 2 | 2 | 2 | • | 4 | 3 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 3 | |
| Ex. | 1.1 | 3 | 3 | 3 | - | 4 | 3 | 3 | - | 4 | 3 | 3 | 4 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 1.2 | 4 | - | 3 | - | 3 | - | 3 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 1.6 | 4 | 3 | 3 | 2 | 4 | 3 | 3 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 1.7 | 3 | 3 | 2 | - | 3 | 3 | 3 | - | 4 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 1.8 | 3 | 3 | 3 | - | 3 | 3 | 3 | 3 | 4 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 4 |
| Ex, | 1.10 | - | - | 3 | - | 3 | - | 3 | - | 4 | - | 3 | 3 | 4 | 3 | 4 | 4 | 3 |
| Ex. | 1.12 | - | - | - | - | 3 | 2 | 3 | - | 4 | - | 3 | 2 | 4 | 3 | 4 | 3 | 3 |
| Ex. | 1.13 | 3 | 2 | 3 | - | 3 | 3 | 3 | 3 | 4 | - | 4 | 4 | 4 | 3 | 4 | 4 | 3 |
| Ex. | 1.18 | 3 | Ή | 3 | 3 | 4 | 3 | 3 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 2.1 | 3 | 3 | 4 | 4 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 2.11 | 3 | 3 | 3 | - | 4 | 4 | 4 | - | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Ex. | 2.12 | 3 | - | 4 | - | 3 | 3 | 4 | 3 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 2.13 | 3 | - | 3 | - | 3 | - | 3 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 3 |
| Ex, | 2.17 | 3 | 3 | 3 | - | 4 | 3 | 3 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 2.18 | 3 | - | 3 | - | 3 | 3 | 3 | 3 | 4 | 3 | 3 | 4 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 2.24 | 3 | - | 3 | - | 3 | 3 | 3 | 3 | 4 | 3 | 4 | 3 | 4 | 4 | 4 | 4 | 3 |
| Ex. | 2.38 | - | 3 | - | - | 3 | 3 | - | - | 4 | 3 | 3 | 4 | 3 | 4 | 4 | 4 | 4 |
| Ex. | 4.12 | 4 | 3 | 4 | 4 | 4 | 4 | 3 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Untreated | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Comparison | 0 | 1 | 1 | 0 | 1 | 0 | 1 | 1 | 4 | 2 | 3 | 2 | 3 | 2 | 4 | 1 | 3 | |
| 5-tert-butyl-3 | - | |||||||||||||||||
| (2, | 4-dichloro- | 5- | ||||||||||||||||
| isopropoxyphenyl) | - | |||||||||||||||||
| 1,3 | ,4-oxadiazol-2 | -one |
BAD ORIGINAL
AP ο Ο Ο 44 Ο
100
Test Example C
In a greenhouse, the compounds noted in the table were applied at the rates mentioned. For this the formulated active ingredients were pipetted onto the water surface
The test plants were treated pre-emergently and in the 1 3 leaf stage.
BAD ORIGINAL
AP ο ο Ο 4 4 Ο
101
| Ex. | 1.0 | 0,04 | 0 | 2 | 4 | 1 | 4 |
| Ex. | 1.1 | 0,04 | 0 | 3 | 4 | 3 | 4 |
| Ex. | 1.17 | 0,1 | 0 | - | 4 | - | 4 |
| Ex. | 1.2 | 0,005 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 1.4 | 0,05 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 1.5 | 0,10 | 0 | 3 | 4 | 1 | 2 |
| Ex. | 1.6 | 0,04 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 1.7 | 0,04 | 0 | 4 | 4 | 3 | 2 |
| Ex. | 1.8 | 0,04 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 1.9 | 0,0125 | 0 | 3 | 4 | J | 4 |
| Ex. | 1.10 | 0,01 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 1.11 | 0,05 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 1.13 | 0,02 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 1.14 | 0,02 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 1.15 | 0,01 | 0 | 1 | 4 | 0 | 4 |
| Ex. | 1.18 | 0,01 | 2 | 4 | 4 | 3 | 4 |
| Ex. | 1.21 | 0,025 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 1.22 | 0,05 | 1 | 4 | 4 | 2 | 4 |
| Ex. | 1.29 | 0,2 | 0 | - | 4 | 3 | 4 |
| Ex. | 1.36 | 0,04 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 2.0 | 0,05 | 1 | 3 | 4 | J | 4 |
| Ex. | 2.1 | 0,01 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 2.17 | 0,01 | 0 | 3 | - | 1 | 4 |
| Ex. | 2.18 | 0,01 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 2.38 | 0,04 | 0 | 3 | - | 2 | 4 |
| Ex. | 3.3 | 0,08 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.100 | 0,05 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.101 | 0,05 | 1 | 4 | 3 | 3 | 4 |
| Ex. | 4.102 | 0,025 | 0 | - | 4 | - | 4 |
| Ex. | 4.103 | 0,01 | 0 | - | - | - | 4 |
| Ex. | 4.104 | 0,1 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 4.105 | 0,05 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.122 | 0,04 | 1 | - | - | - | 4 |
| Ex. | 4.125 | 0,025 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.129 | 0,1 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.130 | 0,025 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 4.135 | 0,025 | 1 | 3 | 4 | 3 | 4 |
| Ex. | 4.137 | 0,1 | 0 | 3 | - | - | 4 |
| Ex. | 4.138 | 0,04 | 0 | - | 4 | 2 | 3 |
BAD ORIGINAL ft
AP Ο Ο Ο Μ Ο
102
| [COEOpOUJ Wtsfajt&Mai ν/Α/ί'/ά'/ί | ' iifpl | MBS βρΒ | gjjail ϋϋ! | Hili sit jgg slgiEj wig | W :θ|μ '////,::' | ||
| Ex. | 4.140 | 0,04 | 4 | 4 | 3 | 4 | |
| Ex. | 4.141 | 0,08 | 0 | 3 | 4 | 3 | 4 |
| Ex. | 4.143 | 0,08 | 0 | 3 | 4 | 3 | 4 |
| Ex. | 4.144 | 0,04 | 0 | - | 4 | - | 4 |
| Ex. | 4.146 | 0,2 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.147 | 0,08 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.148 | 0,08 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.150 | 0,04 | 0 | 4 | 4 | - | 4 |
| Ex. | 4.151 | 0,04 | 0 | - | 4 | - | 3 |
| Ex. | 4.152 | 0,1 | 0 | 4 | 3 | 4 | 4 |
| Ex. | 4.153 | 0,1 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.154 | 0,04 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.155 | 0,04 | 1 | 4 | 4 | 2 | 4 |
| Ex. | 4.157 | 0,2 | 0 | 4 | 3 | 3 | 4 |
| Ex. | 4.158 | 0,1 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.159 | 0,1 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.164 | 0,05 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.165 | 0,05 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.166 | 0,05 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.167 | 0,05 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.168 | 0,05 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.169 | 0,05 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.177 | 0,08 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.178 | 0,025 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.179 | 0,1 | 1 | 3 | 4 | 3 | 4 |
| Ex. | 4.180 | 0,05 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 4.185 | 0,1 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 4.186 | 0,1 | 1 | 4 | - | 2 | 4 |
| Ex. | 4.187 | 0,005 | - | 3 | 3 | 2 | 3 |
| Ex. | 4.189 | 0,005 | 1 | 3 | 4 | 3 | 3 |
| Ex. | 4.191 | 0,02 | 1 | 4 | 4 | - | 4 |
| Ex. | 4.192 | 0,04 | 0 | - | 4 | - | 3 |
| Ex. | 4.194 | 0,05 | 1 | - | - | 3 | 4 |
| Ex. | 4.196 | 0,1 | 1 | 4 | 3 | 4 | 4 |
| Ex. | 4.197 | 0,1 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.198 | 0,1 | 0 | 3 | - | - | 4 |
| Ex. | 4.2 | 0,025 | 0 | 4 | - | 4 | 4 |
| Ex. | 4.200 | 0,01 | 1 | 3 | - | - | 4 |
| Ex. | 4.205 | 0,025 | 1 | 4 | - | 4 | 4 |
BAD ORIGINAL ft
AP Ο Ο Ο 4 4 ο
103
| ; Cbsapoyad; , ,'',,; ? ί; ί,ί : ί ί'ί,χι; ί,?; ., , ,6 , Λ//'. ΙίΑ ί.*-' ,,i} ',4 ,, ί 1 ,ii '.'; J ί HlJ3 :<'·, ‘-Λ'·/'. f$ ~· ' . '; fi Η ; Γ'/ ;' : I 'ffa \ίΑ'ί'·.ίί%ί ii ' ? ' ΐίΑ '''Άΐ} *'4/$$%^', | Γ'·;£&ί?ΜθΗ ίΑηί ί>ί.·^-^Λί;ί>?ί?5ί>ί j'i.'fi.'i'f η.ns,, /, ί-ϊ1'' | -'; mwi Hfi ;c«'? ImiSw A V ·%* , -U'<' ; ίΛΛΛ.ίΑ.ύ:άΑί | νν'ί/άΛΪ'^Ι'ϊ'', i H ' | ||||
| Εχ. | 4.206 | 0,04 | 0 | 3 | 4 | 2 4 | |
| Εχ. | 4.228 | 0,08 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.230 | 0,08 | 1 | 3 | 4 | 2 4 | |
| Εχ. | 4.234 | 0,04 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.26 | 0,025 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.27 | 0,01 | 1 | 4 | 4 | 2 4 | |
| Εχ. | 4.227 | 0,1 | 1 | 3 | 2 | 3 4 | |
| Εχ. | 4.229 | 0,05 | 1 | 4 | - | 4 4 | |
| Εχ. | 4.231 | 0,1 | 0 | 3 | - | 4 | |
| Εχ. | 4.233 | 0,08 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.235 | 0,02 | 1 | 3 | 4 | 4 | |
| Εχ. | 4.236 | 0,2 | 0 | 4 | 4 | 2 4 | |
| Εχ. | 4.237 | 0,04 | 0 | 3 | 4 | 3 4 | |
| Εχ. | 4.238 | 0,04 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.239 | 0,04 | 0 | 4 | 4 | 4 4 | |
| Εχ. | 4.240 | 0,08 | 1 | 3 | 4 | 2 4 | |
| Εχ. | 4.241 | 0,04 | 0 | 3 | 4 | 2 4 | |
| Εχ. | 4.242 | 0,04 | 0 | - | 4 | 3 | |
| Εχ. | 4.243 | 0,08 | 0 | 2 | 4 | 2 4 | |
| Εχ. | 4.244 | 0,08 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.245 | 0,08 | 0 | 3 | 4 | 2 4 | |
| Εχ. | 4.246 | 0,1 | 0 | 4 | 4 | 4 | |
| Εχ. | 4.247 | 0,1 | 0 | 4 | 4 | 3 4 | |
| Εχ. | 4.248 | 0,025 | 0 | 3 | 4 | 2 4 | |
| Εχ. | 4.25 | 0,05 | 1 | 4 | 4 | 3 4 | |
| Εχ. | 4.251 | 0,1 | 1 | 3 | - | 4 4 | |
| Εχ. | 4.252 | 0,05 | 0 | - | 3 | - | |
| Εχ. | 4.255 | 0,1 | 0 | - | - | 4 | |
| Εχ. | 4.257 | 0,1 | 0 | 3 | 3 | 4 | |
| Εχ. | 4.275 | 0,025 | 0 | 4 | - | 3 4 | |
| Εχ. | 4.276 | 0,005 | 1 | 4 | 4 | 3 4 | |
| Εχ. | 4.277 | 0,005 | 1 | - | 3 | 3 | |
| Εχ. | 4.280 | 0,1 | 1 | - | 3 | 4 | |
| Εχ. | 4.281 | 0,025 | 1 | 3 | - | 2 4 | |
| Εχ. | 4.288 | 0,2 | 0 | - | 4 | 4 | |
| Εχ. | 4.29 | 0,05 | 1 | 4 | 4 | 4 4 | |
| Εχ. | 4.290 | 0,1 | 0 | 3 | 4 | 2 4 | |
| Εχ. | 4.291 | 0,025 | 1 | 4 | 4 | 3 4 | |
| Εχ. | 4.292 | 0.1 | 0 | 4 | 4 | 3 4 |
BAD ORIGINAL
AP Ο Ο Ο Μ Ο
104
| Ex. | 4.295 | 0,2 | 0 | 3 | - | 4 | 4 |
| Ex. | 4.31 | 0,1 | 0 | 3 | 4 | 3 | 4 |
| Ex. | 4.32 | 0,005 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 4.33 | 0,005 | 1 | - | - | - | 4 |
| Ex. | 4.34 | 0,002 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 4.35 | 0,005 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.37 | 0,01 | 0 | 3 | 2 | 2 | 4 |
| Ex. | 4.38 | 0,025 | 1 | - | - | - | 4 |
| Ex. | 4.41 | 0,005 | 1 | 3 | 4 | - | 4 |
| Ex. | 4.42 | 0,02 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 4.43 | 0,02 | 1 | 4 | 3 | 2 | 4 |
| Ex. | 4.49 | 0,25 | 1 | - | 3 | - | 4 |
| Ex. | 4.50 | 0,02 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 4.56 | 0,1 | 1 | 3 | 4 | 2 | 4 |
| Ex. | 4.57 | 0,025 | 1 | 4 | - | 3 | 4 |
| Ex. | 4.58 | 0,05 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.59 | 0,04 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.60 | 0,1 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.61 | 0,02 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.62 | 0,04 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.64 | 0,04 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.65 | 0,005 | 0 | 3 | 4 | 3 | 4 |
| Ex. | 4.66 | 0,1 | 0 | - | - | - | 4 |
| Ex. | 4.67 | 0,1 | 0 | - | - | - | 4 |
| Ex. | 4.68 | 0,04 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.69 | 0,01 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.70 | 0,08 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.71 | 0,08 | 0 | 3 | 4 | 3 | 4 |
| Ex. | 4.73 | 0,05 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.74 | 0,08 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.75 | 0,05 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.76 | 0,04 | 0 | 3 | 4 | 2 | 4 |
| Ex. | 4.79 | 0,04 | 0 | 3 | - | - | 4 |
| Ex. | 4.80 | 0,04 | 1 | 4 | - | 3 | 4 |
| Ex. | 4.82 | 0,1 | 0 | - | - | - | 4 |
| Ex. | 4.83 | 0,1 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.84 | 0,02 | 1 | 3 | 4 | 3 | 4 |
| Ex. | 4.85 | 0,025 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.87 | 0,1 | 0 | 4 | 4 | 4 | 4 |
AP Ο Ο Ο Μ Ο
105
| Compound ; w#?% ι??'-. | M OBI | .¾¾¾¾¾¾¾¾¾ l^wlll ¢^4¾¾¾¾¾¾¾¾¾ 8¾¾¾^¾¾¾¾ il&flBvisil | ιβιι^ fliiS fBWlti IMSm β|® eMilw | sse WlWil' | |||
| Ex. | 4.88 | 0,1 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.89 | 0,1 | 0 | - | 3 | - | 4 |
| Ex. | 4.90 | 0,025 | 0 | 3 | - | - | 4 |
| Ex. | 4.91 | 0,1 | 0 | 4 | 4 | 3 | 4 |
| Ex. | 4.92 | 0,05 | 1 | 4 | 4 | 4 | 4 |
| Ex. | 4.93 | 0,025 | 0 | 4 | 4 | 2 | 4 |
| Ex. | 4.94 | 0,1 | 0 | - | - | 3 | 4 |
| Ex. | 4.95 | 0,025 | 1 | 4 | 3 | 3 | 4 |
| Ex. | 4.96 | 0,005 | 0 | 3 | 4 | 2 | 4 |
| Ex. | 4.97 | 0,1 | 0 | 4 | 4 | 4 | 4 |
| Ex. | 4.98 | 0,05 | 1 | 4 | 4 | 3 | 4 |
| Ex. | 4.99 | 0,025 | 1 | 4 | 4 | 3 | 4 |
| Untreated | 0 | 0 | 0 | 0 | 0 | ||
| As the table shows, | the compounds | of the invention | show | ||||
| good | activity against Echinochloa | crus | -galli | (ECHGH) | |||
| Cyperus difformis (CYPDI), Scirpus juncoides | (SCPJU) and | ||||||
| Monochoria vaginali | s (MOOVA). |
AP Ο Ο Ο 4 4 Ο
106
Example D
In a greenhouse, the noted plant species were treated with the noted compounds, at a rate of 0.03 kg active ingredient/ha. The compounds were sprayed evenly over the plants as emulsions in 500 litres water/ha. Two weeks after the treatment, the compounds of the invention showed excellent activity against the weeds. The comparison material did not show the same high activity.
| Compound | A | S | P | A | G | I | M | P | S | S | V | V |
| L | E | A | B | A | P | A | 0 | E | 0 | E | I | |
| O | T | N | U | L | o | T | L | B | L | R | 0 | |
| M | V | S | T | A | s | C | S | E | S | P | s | |
| Y | I | s | H | P | s | H | s | X | S | E | s | |
| Ex. 3.1 | 3 | 4 | 4 | 4 | 3 | 4 | 4 | 4 | 4 | 4 | 4 | 4 |
| Untreated | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Comparison | ||||||||||||
| 5-tert.-Butyl-3-(2,4-dichloro | 1 | 2 | 1 | 3 | 2 | 3 | 2 | 0 | 2 | 4 | 2 | 2 |
| isopropoxyphenyl)-!,3,4-oxadiazol-2- | ||||||||||||
| one |
BAD ORIGINAL
AP ο Ο Ο 4 4 Ο
107
Example Ε
In a greenhouse, the noted plant species were treated with the noted compounds, at a rate of 0.1 kg active ingredient/ha. The compounds were sprayed evenly over the plants as emulsions in 500 litres water/ha. Two weeks after the treatment, the compounds of the invention showed excellent activity against the weeds. The comparison material did not show the same high activity.
| Compound | A | A | A | B | s | P | S C | A | G | I | Μ P | S S | V | V |
| L | G | V | R | E | A | O Y | B | A | P | A O | Ε O | E | I | |
| O | R | E | 0 | T | N | R F | U | L | Ο T L | B L | R | o | ||
| M | R | E | T | V | S | Η E | T | A | s | c s | E S | P | s | |
| Y | E | A | E | I | S | A S | H | P | s | rt s | X s | E | s | |
| Ex. 4.2 | - | - | - | - | 3 | 3 | 3 - | 4 | 3 | 3 | 4 4 | - 4 | 4 | 4 ! |
| Ex. 4.3 | 3 | - | 3 | 3 | 4 | 4 | 3 - | 4 | 4 | 4 | 4 4 | 4 4 | 4 | J |
| Ex. 4.4 | 4 | 3 | 3 | 3 | 4 | 4 | 3 3 | 4 | 4 | 4 | 4 4 | 4 4 | 4 | 3 i |
| Untreated | 0 | 0 | 0 | 0 | 0 | 0 | 0 0 | 0 | 0 | 0 | 0 0 | 0 0 | 0 | 0 : |
| Comparison | ||||||||||||||
| 5-tert.-Butyl-3- | 1 | 1 | 0 | 0 | 2 | 2 | 1 0 | 4 | 2 | 3 | 2 3 | 4 3 | 2 | 2 |
| (2,4-dichloro- | 5- | |||||||||||||
| isopropoxyphenyl) | - | |||||||||||||
| 1,3,4-oxadiazol-2 | -one |
AP 0 0 0 4 4 0
Claims (11)
- Claims1. Substituted pyrazole derivatives of general formala I (I).in whichR1R2 is C-j-C4-alkyl, C-|-C4-alkylthio, C1-C4-alkoxy, each of which is optionally substituted by one or more halogen atoms, or R1 and R2 together form the group -(CH2)m-;R3 is hydrogen or halogen;R4 is hydrogen;R5 is hydrogen, nitro, cyano or the group -COOR7, -C(=X)NR7R8 or -C(=X)R10;R6 is hydrogen, halogen, cyano, C-|-C4-akyl, (optionally substituted by one or more halogen or hydroxy groups), phenyl (optionally substituted by one or more halogen, nitro, cyano, C-|-C4-alkyl, Ci-C4-alkoxy or halo-Ci-C4-alkyl groups), or is a C2-CQalkyl, C3-Cg-alkenyl, Cg-Cg-alkynyl or C3-Cg-alkoxy group, each of which is interrupted by one or more oxygen atoms, or is the group -NR11R12, rr.....-(CH2)a-A, -(CH2)a-O-(CH2)b-R22. -(CH2)a-O-R23 or-COR24, bad original &AP 0 0 0 4 4 0I-109r, r ' v„ ’R7, R8 and R9, which may be the same or different, are hydrogen or C-|-C4-aikyl or,R8 and R9 together with the nitrogen to which they are attached form a 5 or 6 membered saturated carbocydic ring;R10 is hydrogen or C-|-C4-alkyl, optionally substituted by one or more halogen atoms,R11 is hydrogen, C-|-C4-alkyl, C2-Cg-alkenyl, C3*Cg-alkynyl or C3-Cg-cycloalkyl, cyanomethyl or the group R21CO-;R12 is C-|-C$-alkyl, C2-Cg-alkenyl, Cg-Cg-alkynyl or phenyl (each of which is optionally substituted by one or more halogen atoms), C3-CQ-cycloalkyl, cyanomethyl, Ci-C4-alkoxy-C-|-Cg-alkyl, di-C-j-C4-alkylamino-C-j-C4-alkyl, tetrahydrofurfurylmethyl, C3-Cg-alkynyloxy-C-|-C4-alkyl, benzyl oris the group -C(=X)R21, 4CH2)a-(O)d-R28, -(CH2)a-O-(CH2)b-R28 or -(CH2)a-X-R34, and when R5 is -C(=O)R10, and /or when R1 is C-|-C4-alkyl, r2 is difluoromethoxy, r3 is bromo and R5 is nitro or cyano, R12 can also be hydrogen; orR11 and R12 together with the nitrogen to which they are attached form a 3, 5 or 6 membered saturated carbocydic or aromatic ring, in which a carbon atom is optionally substituted by an oxygen atom;r13 is hydrogen, C-j^-alkyl, C2-Cg-alkenyl or C3-Cg-alkynyl; orR13 and R14 together form the group -(CH2)p-;R-*4 and R^3, which may be the same or different, are C-|-C4-alkyl, C2-Cg-alkenyl, C3-Cgalkynyl or phenyl (each of which is optionally substituted by one or more halogen atoms), halogen, or the group -XR18;R16 is hydrogen, C-|-Cg-alkyl, C2-Cg-alkenyl, C3-Cg-alkynyl, C-|-C4-alkylcarbonyl, cyano-C -j -Cg-alkyl, C j -C4-alkoxycarbonyl-C 1 -Cg-alkyl, di-C-)-C4-alkoxycarbonyi-C-|-C4-alkyl, benzyl, C-|-C4-alkoxy-C2-Cg-alkynyl; or the group -(CH2)a-R33, -(CH2)a-X-R3°, -(CH2)a-X-(CH2)b-R30 or -(CH2)a-X-<CH2)b-X-(CH2)c-R30;R17 is hydrogen, Cj-C4-alkyl, C2-Cg-alkenyl, C3-Cg-alkynyl, cyano-Ci-C3*alkyl, C1-C4alkoxycarbonyi-Ci-C3-alkyl or phenyl, r18 is C-|-C4-alkyl, optionally substituted by one or more halogen atoms;R21 is C-|-C4-alkyl, (optionally substituted by one or more halogens), C-|-C4-alkoxyC<|-C4-alkyl, C-|-C4-alkylthio-C-|-C4-alkyl, C3-Cg-cycloalkyl or is the group -NR31R32 or 4CH2)a-(O)d-R33;R22 is C-]-C4-alkoxycarbonyl or carboxy;r23 is chloromethyl, cyanomethyl, C3-Cg-cycloalkyl, (optionally interrupted by one or more oxygen atoms);r24 is hydroxy or the group -NR23r26;A is-NR25R26or.S(O)nR27; r25 and r26 Which may be the same or different, are hydrogen or C-|-C4-alkyl;R27 is C<|-C4-alkyl, C1 -C4-alkoxycarbonyl-C-| -C4-alkyl or carboxy;BAD ORIGINALAP 0 0 0 4 4 0-11Or28 is hydrogen, hydroxy, halogen, C-]-C4-alkyl, (optionally substituted by one or moreC-|-C4-alkoxy groups), C3-Cg-cycloalkyl (optionally interrupted by one or more oxygen atoms and optionally substituted by dimethyl), furyl, thienyl or -C(=O)R29;R29and R30, which may be the same or different, are C-|-C4-alkyl or C-|-C4-alkoxy;R31 and R32, which may be the same or different, are C-|-C4-alkyl or phenyl;R33 is C3-C(5-cycloalkyl (optionally interrupted by one or more oxygen atoms and optionally substituted by dimethyl) or -C(=O)R29;R34 is C-)-C4-alkyl; a, b and c are 1, 2 or 3; d is 0 or 1;m is 3 or 4;n is 0, 1 or 2;p is 2 Oder 3; andX is oxygen or sulfur.tBAD ORIGINALV'·IllAP Ο Ο Ο 4 4 Ο
- 2. Substituted pyrazolyl derivatives according to claim 1 in whichR1 is methyl;R2 is methylthio or difluoromethoxy (and especially 5 difluoromethoxy); orR1 and R2 together form the group -(CH2)4;R3 is hydrogen, chloro or bromo;R4 is hydrogen;R5 is hydrogen, nitro, cyano or -C(=X)R10.
- 3. Substituted pyrazolyl derivatives according to claim 1 or 2 in which R6 is hydrogen, halogen, cyano, Cj-C4-alkyl, Cj^-alkylthio or -NRnR12,15
- 4. Substituted pyrazolyl derivatives according to claim 3 in which R11 and R12, which may be the same or different are hydrogen, Cj^-alkyl or C^-alkoxycarbonyl.
- 5. Compounds of general formula Ila ( 23 0 in which R1, R2 and R3 have the meanings given in general formula I in claim 1, as intermediates for preparation of compounds claimed in claim 1.BAD ORIGINAL ftAP Ο Ο Ο 4 4 Ο-112(Ί> €
- 6. Compounds of general formula Ii (Ii), in which R1 and R2 have the meanings given in general formula I in claim 1, as intermediates for preparation of compounds claimed in claim 1.
- 7. Compounds of general formula IjN— in which R1, R2 and R5 have the meanings given in general formula I in claim 1, as intermediates for preparation of compounds claimed in claim 1.bad ORIGINALAP Ο Ο Ο 4 4 Ο-1138. Compounds cf general formula Ik in which R1, R2 and R6 have the meanings given in general formula I in claim l, as intermediates for preparation of compounds claimed in claim 1.
- 9. Compounds of general formula IIN —R (II) , in which R1, R2 and R3 have the meanings given in general formula I in claim l, as intermediates for preparation of compounds claimed in claim 1.BAD ORIGINAL ftAP Ο Ο Ο 4 4 Ο (ΐ'-11410. Compounds of general formula Im ( Im ) in which R1, R2, R3 and R6 have the meanings given in general formula I in claim 1, as intermediates for preparation of compounds claimed in claim 1.11. A herbicidal composition which comprises a compound according to any one of claim 1 to 4, in admixture with agriculturally acceptable carriers and diluents.20 12. A method of combating weeds which comprises applying to the weeds or their locus a compound according to any one of claims 1 to 4.13. A process for the preparation of a compound of general 25 formula I as claimed in claim 1, in whichA) a compound of general formula IIF.(II), nhnh2 in which R1, R2 and R3 have the meanings given in formula I, is reacted with a compound of general general formulaIIIBAD ORIGINALAP Ο Ο Ο 4 4 Ο-115/ \Υ CN (ΝΙ), in which R4 and R5 have the meanings given in general formula I and Y is Cj-Cg-alkoxy, hydroxy or halogen, or when R5 is hydrogen,
- 10 B) a compound of general formula II •NN: // /\ (II)NHNHin which Rl, R2 and R3 have the meanings given in general formula I, is reacted with a 2-haloacrylonitrile of20 formula Ilia-CN-r'' »2(Ilia),Hai or with a 2,3-dihalopropionitrile of formula IHbHai^H2 — CHCN (I I I b );HaJ in which Hal is halogen, or when R3 is halogen,35 C) a compound of general formula laBAD ORIGINAL ftί.. jVAP 0 Ο Ο 4 4 Ο116ΝRPa), in which R1, R2, general formula agent to give aHe!\_ 5, R11 and R12 haveI, is reacted first compound of formula N— > I /N !the meanings given in with a halogenating lb (lb), in which R1, R2, R5, R11 and R12 have the meanings given in general formula I, and Hal is halogen, and then further treated to give the desired compound, or when R5 is -C(=S)R10 and R6 is amino,D) a compound of general formula Ic (Ic) .O in which R1, R2, R3, R4 and R10 have the meanings given in general formula I, is Created with Lawesson's reagent, that is 2,4-bis(4-methoxyphenyl)-I,2,3,4-dithiadiphosphetan—2,4-dithion, or when R3 is -ORBAD ORIGINAL ftAP Ο Ο Ο 4 4 Ο-117Ε) a compound of general formula Id in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is first diazotised to give a compound of formula leR4R ' (I e) in which R1, R2, general formula of formula IfR3, R4 and R5 have the meanings given in I, and then by heating to give a compound in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, which is then reacted with a compound of general formula IVQR16 (IV) in which R16 has the meaning given in general formula I, and Q is a leaving group, or when R5 is nitro and R6 is -SR17,BAD ORIGINAL ΆAP Ο Ο Ο 4 4 Ο-118F) a compound of general formula Ig R2 c 1 IN~ZVNy-R 4Hal (ig)NO,10 in which R1, R2, R3 and R4 have the meanings given in general formula I and Hal is halogen is reacted with a nucleophile of general formula V eSR17 (V) m which R1' has the meaning given in general formula I, or
- 15 when R5 is nitro and R6 is -S(O) R17, in which n is l or 2,G) a compound of general formula Ih (lh), in which R1, R2, R3, R4 and R17 have the meanings given in general formula I, is subjected to a stepwise oxidation with £i-chloroperbenzoic acid, or when Rs is cyanoH) a compound of general formula IlaR (Ha);N: nhnh2 in which Rl and R2 have the meanings given in generalBAD ORIGINALAP Ο Ο Ο 4 4 Ο-119formula I, is reacted with a compound of general formula IIIc CN /~=\ (Me),Y CN in which Y is Cj-Cg-alkoxy, hydroxy or halogen, or when R5 is nitro,I) a compound of .general formula IiR in which R1 and R2 have the meanings given in general formula I, is nitrated in known manner, orJ) a compound of general formula Ij in which R1, R2 and R5 have the meanings given in general formula I, is brominated in known manner, or when when R5 is halogen,K) a compound of general formula IINHNH, (II) ,BAD ORIGINALAP 0 0 0 4 4 0-120CN ’ \CN in which Rl, R2 and R3 have the meanings given in general formula I, is reacted with a compound of general formula IIIc (me),Y in which Y' is C^-c6-alkoxy, dimethylamino or halogen, to first give compound of formula IIII) in which Rl, R2 and R3 have the meanings given in general formula I, and this compound is then diazotised in known
- 20 manner with sodium nitrite and converted to the corresponding halide, or L) a compound of general formula Ik (Ik), in which R1, R2 and R6 have the meanings given in general formula I, is treated with a halogenating agent, orBAD ORIGINAL ftAP Ο Ο Ο 4 4 Ο-121Μ) a compound of general formula ImN— (Im;,Π 1 in which Rl, R2 and R3 have the meanings given in general formula I, and R6 is Cj-C^-alkyl, (optionally substituted by one or more halogens) or is a C^-Cg-alkyl, interrupted by one or more oxygens, is converted in known manner to the nitrile of general formula I, or when R6 is -NRUR12, N) a compound of general formula In (In ) ,CN in which R1, R2 and R3 have the meanings given in general formula I, is reacted with an amine in a solvent, or whenR6 is-NR^R12, in which R11 is hydrogen and R1· is ,11Cj-Cg-alkyl,0) a compound of general formula IIN— (II) , in which R1, R2 and R3 have the meanings given in general formula I, is reacted with a trialkyl ortho ester and then reduced, or bad original 8AP Ο Ο Ο 4 4 Ο-122Ρ) a compound of general formula Io (io ) in which R1, R2 and R3 have the meanings given in general 10 formula I, and R12 is Cj-C6-alkyl is reacted with an base and an alkylating agent or an acid chloride, or when R6 is -NRnR12, in which R11 and R12 are CpC^-alkyl,Q) a compound of general formula 11 in which R1, R2 and R3 have the meanings given in general formula I, is reacted with approximately 2 mole of base and 2 mole of a suitable alkylating agent, orR) a compound of general formula IIN/ in which R1, R2 and R3 have the meanings given in general formula I, is reacted with or without a base and a suitable acid chloride, orBAD ORIGINAL ftAP Ο Ο Ο 4 4 Ο-123S) a compound of general formula Ip N— : /RCNNHC = 0 1 01 a2 in which R1, R2, R3 and R21 have the meanings given in general formula I, is reacted with a base and a suitable alkylating agent, orT) a compound of general formula InN— in which R1, R2 and R3 have the meanings given in general formula I and R5 is cyano or nitro, is reacted with an oxygen, nitrogen, sulfur or carbon nucleophile, or when R6 is substituted methylU) a compound of general formula IqΛ in which Rl, R2, R3, R4 and R5 have the meanings given in general formula I, is reacted with a Lewis acid, or bad ORIGINALAP Ο Ο Ο 4 4 Ο-124V) a compound .of general formula Ir \V //'-R r·CH,OK (I Ό, in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is treated with a halogenating agent, orW) a compound of general formula Is 4R in which R1, R2, R3, R4 and R5 have the meanings given in general formula I, is reacted with an oxygen, nitrogen, sulfur or carbon nucleophile, or when R6 is mercapto X) a compound of general formula ItR (- t)I i •«sΛ in which Rl, R2, R3 and R4 have the meanings given inBAD ORIG'NAL QAP Ο Ο Ο 4 4 Ο —125— general formula I, is treated with sodium hydrogen sulfide, orY) a compound of general formula Iu 4Λ in which R1, R2, R3 and R4 have the meanings given in general formula I, is treated with a suitable alkylating agent, orZ) a compound of general formula Iv in which R1, R2, R3 and R4 have the meanings given in general formula I, and Rx is Cj-C4-alkyl, is oxidised in stages.
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4234709A DE4234709A1 (en) | 1992-10-12 | 1992-10-12 | New herbicidal substd. pyrazole derivs. |
| DE19934310091 DE4310091A1 (en) | 1993-03-24 | 1993-03-24 | Novel 1-(4-bromo-3-pyrazolyl)pyrazoles, their preparation, intermediates for their preparation, and their use as herbicides |
| DE19934315330 DE4315330A1 (en) | 1993-05-03 | 1993-05-03 | Novel 4-cyano-1-(3-pyrazolyl)pyrazoles, their preparation, and intermediates for their preparation and their use as agents having herbicidal action |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AP9300579A0 AP9300579A0 (en) | 1993-10-31 |
| AP440A true AP440A (en) | 1995-12-14 |
Family
ID=27204328
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| APAP/P/1993/000579A AP440A (en) | 1992-10-12 | 1993-10-12 | New substituted pyrazole derivatives, processes for their preparation and their use as herbicides. |
Country Status (27)
| Country | Link |
|---|---|
| US (3) | US5756424A (en) |
| EP (1) | EP0663913B1 (en) |
| JP (1) | JP3770403B2 (en) |
| KR (1) | KR100296062B1 (en) |
| CN (2) | CN1036397C (en) |
| AP (1) | AP440A (en) |
| AT (1) | ATE169017T1 (en) |
| AU (1) | AU676213B2 (en) |
| BG (1) | BG62772B1 (en) |
| BR (1) | BR9307226A (en) |
| CA (1) | CA2146852C (en) |
| CZ (1) | CZ282691B6 (en) |
| DE (1) | DE69320050T2 (en) |
| DK (1) | DK0663913T3 (en) |
| DZ (1) | DZ1720A1 (en) |
| ES (1) | ES2122043T3 (en) |
| FI (1) | FI951722L (en) |
| HU (1) | HU219150B (en) |
| IL (1) | IL107231A (en) |
| NZ (1) | NZ256693A (en) |
| PL (1) | PL174304B1 (en) |
| RO (1) | RO113244B1 (en) |
| RU (1) | RU2137771C1 (en) |
| SK (1) | SK281874B6 (en) |
| TW (1) | TW285634B (en) |
| WO (1) | WO1994008999A1 (en) |
| YU (1) | YU64793A (en) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL103678A (en) * | 1991-11-13 | 1996-09-12 | Schering Ag | Pyrazolylpyrazole derivatives processes for the preparation thereof and herbicidal compositions containing the same |
| DE4435373A1 (en) * | 1994-09-22 | 1996-03-28 | Hoechst Schering Agrevo Gmbh | Substituted pyrazolyl-pyrazole derivatives, process for their preparation and their use as agents with herbicidal activity |
| DE19532347A1 (en) * | 1995-09-04 | 1997-03-06 | Bayer Ag | 4-thiocarbamoyl-1- (3-pyrazolyl) pyrazole |
| DE19544393A1 (en) * | 1995-11-15 | 1997-05-22 | Hoechst Schering Agrevo Gmbh | Synergistic herbicidal mixtures |
| DE19623892A1 (en) * | 1996-06-06 | 1997-12-11 | Hoechst Schering Agrevo Gmbh | Substituted pyrazolyl-pyrazole derivatives |
| DE19630555A1 (en) * | 1996-07-18 | 1998-01-22 | Hoechst Schering Agrevo Gmbh | Substituted pyrazolyl-pyrazole derivatives |
| DE19631865A1 (en) * | 1996-08-08 | 1998-02-12 | Bayer Ag | Substituted 1- (3-pyrazolyl) pyrazoles |
| DE19751943A1 (en) | 1997-11-24 | 1999-05-27 | Hoechst Schering Agrevo Gmbh | New pyrazolyl-pyrazole derivatives are pre- and post-emergent herbicides |
| WO2000063356A2 (en) | 1999-04-19 | 2000-10-26 | Syngenta Participations Ag | Herbicidal seed treatment |
| EP1304325A4 (en) * | 2000-07-25 | 2004-04-07 | Sankyo Co | DERIVATIVES OF 5- (M-CYANOBENZYLAMINO) PYRAZOLE |
| DE10142336A1 (en) * | 2001-08-30 | 2003-03-20 | Bayer Cropscience Ag | Selective herbicides containing a tetrazolinone derivative |
| DE10219435A1 (en) * | 2002-05-02 | 2003-11-13 | Bayer Cropscience Ag | Substituted pyrazolo-pyrimidin-4-ones |
| WO2005030128A2 (en) * | 2003-09-23 | 2005-04-07 | Merck & Co., Inc. | Pyrazole modulators of metabotropic glutamate receptors |
| EA011812B1 (en) | 2004-03-27 | 2009-06-30 | Байер Кропсайенс Аг | Herbicide combination |
| TW200621152A (en) * | 2004-09-06 | 2006-07-01 | Basf Ag | (Hetero)cyclylcarboxamides for controlling harmful fungi |
| KR101387815B1 (en) * | 2005-02-21 | 2014-04-21 | 고유 아그리 가부시키가이샤 | Herbicide composition |
| EP1728430A1 (en) | 2005-06-04 | 2006-12-06 | Bayer CropScience GmbH | Herbicidal agents |
| US7842856B2 (en) | 2005-08-25 | 2010-11-30 | The Board Of Trustees Of The University Of Illinois | Herbicide resistance gene, compositions and methods |
| US7671254B2 (en) | 2005-08-25 | 2010-03-02 | The Board Of Trustees Of The University Of Illinois | Herbicide resistance gene, compositions and methods |
| EP2052614A1 (en) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbicide combination |
| DE102008037624A1 (en) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbicide combination with dimethoxytriazinyl-substituted difluoromethanesulfonylanilides |
| KR20110132441A (en) * | 2009-03-11 | 2011-12-07 | 스미또모 가가꾸 가부시끼가이샤 | Herbicide composition and weed control method |
| AR097245A1 (en) * | 2013-08-09 | 2016-03-02 | Kyoyu Agri Co Ltd | DERIVED FROM SUBSTITUTED PIRAZOLILPIRAZOL AND ITS EMPLOYMENT AS A HERBICIDE |
| JP6128555B2 (en) * | 2013-08-13 | 2017-05-17 | 協友アグリ株式会社 | Substituted pyrazolylpyrazole derivatives and their use as herbicides |
| JP6097655B2 (en) * | 2013-08-13 | 2017-03-15 | 協友アグリ株式会社 | Substituted pyrazolylpyrazole derivatives and their use as herbicides |
| JP6128556B2 (en) * | 2013-08-13 | 2017-05-17 | 協友アグリ株式会社 | Substituted pyrazolylpyrazole derivatives and their use as herbicides |
| AR103467A1 (en) * | 2015-01-23 | 2017-05-10 | Kyoyu Agri Co Ltd | DERIVED FROM SUBSTITUTED PIRAZOLILPIRAZOL AND ITS EMPLOYMENT AS A HERBICIDE |
| AR103469A1 (en) * | 2015-01-23 | 2017-05-10 | Kyoyu Agri Co Ltd | DERIVED FROM SUBSTITUTED PIRAZOLILPIRAZOL AND ITS EMPLOYMENT AS A HERBICIDE |
| AR103472A1 (en) * | 2015-01-23 | 2017-05-10 | Kyoyu Agri Co Ltd | DERIVED FROM SUBSTITUTED PIRAZOLILPIRAZOL AND ITS EMPLOYMENT AS A HERBICIDE |
| AR103468A1 (en) * | 2015-01-23 | 2017-05-10 | Kyoyu Agri Co Ltd | DERIVED FROM SUBSTITUTED PIRAZOLILPIRAZOL AND ITS EMPLOYMENT AS A HERBICIDE |
| TW201630910A (en) * | 2015-01-23 | 2016-09-01 | 協友股份有限公司 | Substituted pyrazolylpyrazole derivative and use of same as herbicide |
| TW201630912A (en) * | 2015-01-23 | 2016-09-01 | 協友股份有限公司 | Substituted pyrazolylpyrazole derivative and use of same as herbicide |
| TW201630909A (en) * | 2015-01-23 | 2016-09-01 | 協友股份有限公司 | Substituted pyrazolylpyrazole derivative and use of same as herbicide |
| JP2016141628A (en) * | 2015-01-30 | 2016-08-08 | 協友アグリ株式会社 | Herbicide composition |
| JP6584079B2 (en) * | 2015-01-30 | 2019-10-02 | 協友アグリ株式会社 | Herbicidal composition |
| JP2016141629A (en) * | 2015-01-30 | 2016-08-08 | 協友アグリ株式会社 | Herbicide composition |
| JP2016141627A (en) * | 2015-01-30 | 2016-08-08 | 協友アグリ株式会社 | Herbicide composition |
| WO2017002201A1 (en) * | 2015-06-30 | 2017-01-05 | 株式会社エス・ディー・エス バイオテック | Cyclopropane carboxylic acid amide compound and herbicide containing same |
| CN105076162B (en) * | 2015-08-05 | 2018-03-09 | 安徽华星化工有限公司 | A kind of Herbicidal composition for rice field containing Oxyfluorfen and pyraclonil |
| CN107540669B (en) * | 2016-06-23 | 2021-01-15 | 湖北相和精密化学有限公司 | Preparation method of 1- (3-chloropyrazolo [1,5a ] -4,5,6, 7-tetrahydropyridine-2-yl) -5-aminopyrazole-4-carbonitrile |
| CN107540670B (en) * | 2016-06-23 | 2021-08-13 | 湖北相和精密化学有限公司 | Preparation method of 1- (3-chloropyrazolo [1,5a ] -4,5,6, 7-tetrahydropyridine-2-yl) -5-methylamine pyrazole-4-carbonitrile |
| JP6783575B2 (en) * | 2016-07-27 | 2020-11-11 | 協友アグリ株式会社 | Herbicide composition |
| CN108064866A (en) * | 2016-11-15 | 2018-05-25 | 江苏龙灯化学有限公司 | A kind of Herbicidal combinations |
| CN108203431A (en) * | 2016-12-20 | 2018-06-26 | 海利尔药业集团股份有限公司 | A kind of Herbicidal combinations of compound of class containing double pyrazole and its application |
| CN107047582A (en) * | 2017-02-27 | 2017-08-18 | 南京华洲药业有限公司 | A kind of Herbicidal combinations and its application containing pyraclonil and esprocarb |
| CN106857621A (en) * | 2017-02-27 | 2017-06-20 | 南京华洲药业有限公司 | A kind of Herbicidal combinations and its application containing pyraclonil and molinate |
| CN106857578A (en) * | 2017-02-27 | 2017-06-20 | 南京华洲药业有限公司 | A kind of Herbicidal combinations and its application containing pyraclonil and Acetochlor |
| CN106889083B (en) * | 2017-02-27 | 2019-02-12 | 南京华洲药业有限公司 | A kind of herbicidal composition containing pyraclostrobin and clomazone and application thereof |
| CN109400601B (en) * | 2017-08-15 | 2021-09-14 | 海利尔药业集团股份有限公司 | Pyrazole-substituted pyrazole derivative and preparation and application thereof |
| CN108308187A (en) * | 2018-02-11 | 2018-07-24 | 河北中天邦正生物科技股份公司 | A kind of composition pesticide and its application |
| CN110343102B (en) * | 2018-04-08 | 2022-02-18 | 海利尔药业集团股份有限公司 | Substituted pyrazolyl pyrazole sulfonylurea compound or its salt as pesticide acceptable, composition and use thereof |
| WO2019233372A1 (en) * | 2018-06-04 | 2019-12-12 | 海利尔药业集团股份有限公司 | Substituted pyrazolyl pyrazole sulfonamide compound or pesticidally acceptable salt thereof, composition and use thereof |
| CN112341456B (en) * | 2019-08-07 | 2024-01-05 | 海利尔药业集团股份有限公司 | Substituted pyrazolyl pyrazole bisamide compound or salt, composition and application thereof acceptable as pesticide |
| CN114276251B (en) * | 2021-12-07 | 2022-12-16 | 武汉大学 | A method for synthesizing nitro (hetero) aromatics |
| CN114213420B (en) * | 2021-12-30 | 2024-04-16 | 海利尔药业集团股份有限公司 | Compound containing chlorinated pyridine structure or salt and composition acceptable by pesticides and application thereof |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2321330A1 (en) * | 1973-04-27 | 1974-11-07 | Bayer Ag | AZOLYL-AMIDINES, THE PROCESS FOR THEIR MANUFACTURING AND THEIR USE AS HERBICIDES |
| DE3402308A1 (en) * | 1984-01-24 | 1985-08-01 | Bayer Ag, 5090 Leverkusen | HERBICIDES BASED ON PYRAZOLE DERIVATIVES |
| DE3423101A1 (en) * | 1984-06-22 | 1986-01-02 | Bayer Ag, 5090 Leverkusen | 5-AMINO-4-HETEROCYCLYL-1-PHENYLPYRAZOLE |
| JPH0613477B2 (en) * | 1985-04-29 | 1994-02-23 | コニカ株式会社 | 5-hydrazino-1H-pyrazole compound |
| DE3707686A1 (en) * | 1987-03-11 | 1988-09-22 | Bayer Ag | 4-CYANO-1-ARYL-PYRAZOLE |
| IL103678A (en) * | 1991-11-13 | 1996-09-12 | Schering Ag | Pyrazolylpyrazole derivatives processes for the preparation thereof and herbicidal compositions containing the same |
-
1993
- 1993-10-11 DK DK93922559T patent/DK0663913T3/en active
- 1993-10-11 NZ NZ256693A patent/NZ256693A/en unknown
- 1993-10-11 FI FI951722A patent/FI951722L/en not_active Application Discontinuation
- 1993-10-11 RU RU95112481/04A patent/RU2137771C1/en active
- 1993-10-11 EP EP93922559A patent/EP0663913B1/en not_active Expired - Lifetime
- 1993-10-11 ES ES93922559T patent/ES2122043T3/en not_active Expired - Lifetime
- 1993-10-11 IL IL10723193A patent/IL107231A/en not_active IP Right Cessation
- 1993-10-11 BR BR9307226A patent/BR9307226A/en not_active IP Right Cessation
- 1993-10-11 RO RO95-00649A patent/RO113244B1/en unknown
- 1993-10-11 CZ CZ95920A patent/CZ282691B6/en not_active IP Right Cessation
- 1993-10-11 US US08/416,748 patent/US5756424A/en not_active Expired - Lifetime
- 1993-10-11 SK SK486-95A patent/SK281874B6/en not_active IP Right Cessation
- 1993-10-11 KR KR1019950701380A patent/KR100296062B1/en not_active Expired - Lifetime
- 1993-10-11 WO PCT/EP1993/002821 patent/WO1994008999A1/en not_active Ceased
- 1993-10-11 AT AT93922559T patent/ATE169017T1/en not_active IP Right Cessation
- 1993-10-11 HU HU9501042A patent/HU219150B/en unknown
- 1993-10-11 JP JP50962394A patent/JP3770403B2/en not_active Expired - Lifetime
- 1993-10-11 DE DE69320050T patent/DE69320050T2/en not_active Expired - Lifetime
- 1993-10-11 AU AU51513/93A patent/AU676213B2/en not_active Expired
- 1993-10-11 PL PL93308348A patent/PL174304B1/en unknown
- 1993-10-11 CA CA002146852A patent/CA2146852C/en not_active Expired - Lifetime
- 1993-10-12 AP APAP/P/1993/000579A patent/AP440A/en active
- 1993-10-12 DZ DZ930110A patent/DZ1720A1/en active
- 1993-10-12 CN CN93114437A patent/CN1036397C/en not_active Expired - Lifetime
- 1993-10-12 YU YU64793A patent/YU64793A/en unknown
-
1994
- 1994-03-07 TW TW083101950A patent/TW285634B/zh not_active IP Right Cessation
-
1995
- 1995-04-11 BG BG99560A patent/BG62772B1/en unknown
- 1995-06-02 US US08/458,706 patent/US5580986A/en not_active Expired - Lifetime
-
1996
- 1996-12-30 CN CN96116762A patent/CN1060478C/en not_active Expired - Lifetime
-
1998
- 1998-04-10 US US09/058,033 patent/US5869686A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| Journal of Heterocyclic Chemistry vol. 26, 1989, pages 893- 898, A. Fruchier et al. see compound 13 * |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AP440A (en) | New substituted pyrazole derivatives, processes for their preparation and their use as herbicides. | |
| AP391A (en) | New substituted pyrazolylprazoles, processes for their preparation, as well as intermediates, and their use as herbicides. | |
| HU200891B (en) | Herbicide composition containing pyrazol derivatives as active components and process for producing these compounds | |
| KR20000016396A (en) | Substituted pyrazolylpyrazole derivatives and their use as herbicides | |
| EP0583353A1 (en) | Substituted benzothiazole derivatives, their preparation and use as herbicides | |
| US5919732A (en) | Herbicidal 3-arylamino-6-trifluoromethyluracils | |
| DE4310091A1 (en) | Novel 1-(4-bromo-3-pyrazolyl)pyrazoles, their preparation, intermediates for their preparation, and their use as herbicides |