ZA942031B - 2,5-dichloro-3, 4, 6-tricyano-benzotrifluoride - Google Patents
2,5-dichloro-3, 4, 6-tricyano-benzotrifluorideInfo
- Publication number
- ZA942031B ZA942031B ZA942031A ZA942031A ZA942031B ZA 942031 B ZA942031 B ZA 942031B ZA 942031 A ZA942031 A ZA 942031A ZA 942031 A ZA942031 A ZA 942031A ZA 942031 B ZA942031 B ZA 942031B
- Authority
- ZA
- South Africa
- Prior art keywords
- tricyano
- benzotrifluoride
- dichloro
- Prior art date
Links
- KQVSRIDYMTVIEX-UHFFFAOYSA-N 3,6-dichloro-5-(trifluoromethyl)benzene-1,2,4-tricarbonitrile Chemical compound FC(F)(F)C1=C(Cl)C(C#N)=C(C#N)C(Cl)=C1C#N KQVSRIDYMTVIEX-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/50—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
- C07C255/51—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings containing at least two cyano groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4309566A DE4309566A1 (de) | 1993-03-24 | 1993-03-24 | 2,5-Dichlor-3,4,6-tricyano-benzotrifluorid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA942031B true ZA942031B (en) | 1994-10-24 |
Family
ID=6483728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA942031A ZA942031B (en) | 1993-03-24 | 1994-03-23 | 2,5-dichloro-3, 4, 6-tricyano-benzotrifluoride |
Country Status (5)
| Country | Link |
|---|---|
| AU (1) | AU6284094A (cs) |
| DE (1) | DE4309566A1 (cs) |
| TW (1) | TW247269B (cs) |
| WO (1) | WO1994021601A1 (cs) |
| ZA (1) | ZA942031B (cs) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1199756B (de) * | 1964-02-29 | 1965-09-02 | Hoechst Ag | Verfahren zur Herstellung von 1, 3, 5-Trifluor-2, 4, 6-tricyan-benzol |
| BR6912818D0 (pt) * | 1969-06-02 | 1973-01-04 | Diamond Shamrock Corp | Composicao pesticida a base de tricianobenzenos halogenados bem como processo para a preparacao das referidas tricianobenzenos halogenados |
-
1993
- 1993-03-24 DE DE4309566A patent/DE4309566A1/de not_active Withdrawn
-
1994
- 1994-02-23 TW TW083101539A patent/TW247269B/zh active
- 1994-03-11 AU AU62840/94A patent/AU6284094A/en not_active Abandoned
- 1994-03-11 WO PCT/EP1994/000756 patent/WO1994021601A1/de not_active Ceased
- 1994-03-23 ZA ZA942031A patent/ZA942031B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU6284094A (en) | 1994-10-11 |
| DE4309566A1 (de) | 1994-09-29 |
| TW247269B (cs) | 1995-05-11 |
| WO1994021601A1 (de) | 1994-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE59403259D1 (en) | Tetraaroxyperylen-3,4,9,10-tetracarbonsäurepolyimide | |
| EP0620222A3 (en) | Tetrahydro-beta-carbolines. | |
| EP0641704A3 (en) | One wheel sled. | |
| HU9202848D0 (en) | 1,2-dihydro-2-oxopyridine | |
| EP0620223A3 (en) | Tetrahydropyridoindole. | |
| GR3030863T3 (en) | 2',5'-oligoadenylate-2',3'-cyclophosphates | |
| ZA946728B (en) | Tocopherois. | |
| ZA95462B (en) | Substitute 1,2,3,4-tetrahydro -5-nitro-pyrimidines | |
| HU9400118D0 (en) | Substituted dialkyl-thioethers | |
| ZA946569B (en) | 1,5-Diphenyl-3-pyrazolylalkyl-N-hydroxydithiocarbamates | |
| ZA946699B (en) | Substituted 1-amino-3-phenyluracils | |
| EP0609763A3 (en) | Ph-glasselectrode. | |
| EP0657193A3 (de) | Skibremse. | |
| ZA945991B (en) | Substituted azadioxacycloalkenes | |
| EP0641898A3 (de) | Schachtabdeckung. | |
| HU9301783D0 (en) | Phenyl-1,2,5-oxadiazole-carbonamide-2-oxide | |
| EP0643916A3 (en) | Choux blends. | |
| ZA933848B (en) | Pyridyl-1,2,5-oxadiazolecarboxamide-2-oxides | |
| EP0645218A3 (de) | Werkzeugschaft. | |
| EP0639498A3 (de) | Wasserski. | |
| HU9403060D0 (en) | 1,2,-dihydro-2-oxo-pyridines | |
| IL110556A0 (en) | 7 alpha-amino-1, 1-dioxocephem l- valylamides | |
| ZA942031B (en) | 2,5-dichloro-3, 4, 6-tricyano-benzotrifluoride | |
| ZA947884B (en) | 1,2-dihydro-2-oxo-3-methylsulfonylaminomethylpyridines | |
| GR1001684B (el) | Συλλέκτης μελισσών. |